diff --git a/.gitignore b/.gitignore
new file mode 100644
index 00000000..d93bbb19
--- /dev/null
+++ b/.gitignore
@@ -0,0 +1,18 @@
+# mac
+.DS_Store
+
+# git folder
+.git
+
+# npm
+node_modules
+npm-debug.log
+
+# package
+package-lock.json
+
+# cache
+.cache
+
+# personal config
+config.js
\ No newline at end of file
diff --git a/.prettierrc.js b/.prettierrc.js
new file mode 100644
index 00000000..c8c6a549
--- /dev/null
+++ b/.prettierrc.js
@@ -0,0 +1,7 @@
+module.exports = {
+    semi: true,
+    trailingComma: 'all',
+    singleQuote: true,
+    printWidth: 120,
+    tabWidth: 4,
+};
diff --git a/LICENSE b/LICENSE
new file mode 100644
index 00000000..8410c200
--- /dev/null
+++ b/LICENSE
@@ -0,0 +1,661 @@
+GNU AFFERO GENERAL PUBLIC LICENSE
+                       Version 3, 19 November 2007
+
+ Copyright (C) 2007 Free Software Foundation, Inc. <https://fsf.org/>
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+                            Preamble
+
+  The GNU Affero General Public License is a free, copyleft license for
+software and other kinds of works, specifically designed to ensure
+cooperation with the community in the case of network server software.
+
+  The licenses for most software and other practical works are designed
+to take away your freedom to share and change the works.  By contrast,
+our General Public Licenses are intended to guarantee your freedom to
+share and change all versions of a program--to make sure it remains free
+software for all its users.
+
+  When we speak of free software, we are referring to freedom, not
+price.  Our General Public Licenses are designed to make sure that you
+have the freedom to distribute copies of free software (and charge for
+them if you wish), that you receive source code or can get it if you
+want it, that you can change the software or use pieces of it in new
+free programs, and that you know you can do these things.
+
+  Developers that use our General Public Licenses protect your rights
+with two steps: (1) assert copyright on the software, and (2) offer
+you this License which gives you legal permission to copy, distribute
+and/or modify the software.
+
+  A secondary benefit of defending all users' freedom is that
+improvements made in alternate versions of the program, if they
+receive widespread use, become available for other developers to
+incorporate.  Many developers of free software are heartened and
+encouraged by the resulting cooperation.  However, in the case of
+software used on network servers, this result may fail to come about.
+The GNU General Public License permits making a modified version and
+letting the public access it on a server without ever releasing its
+source code to the public.
+
+  The GNU Affero General Public License is designed specifically to
+ensure that, in such cases, the modified source code becomes available
+to the community.  It requires the operator of a network server to
+provide the source code of the modified version running there to the
+users of that server.  Therefore, public use of a modified version, on
+a publicly accessible server, gives the public access to the source
+code of the modified version.
+
+  An older license, called the Affero General Public License and
+published by Affero, was designed to accomplish similar goals.  This is
+a different license, not a version of the Affero GPL, but Affero has
+released a new version of the Affero GPL which permits relicensing under
+this license.
+
+  The precise terms and conditions for copying, distribution and
+modification follow.
+
+                       TERMS AND CONDITIONS
+
+  0. Definitions.
+
+  "This License" refers to version 3 of the GNU Affero General Public License.
+
+  "Copyright" also means copyright-like laws that apply to other kinds of
+works, such as semiconductor masks.
+
+  "The Program" refers to any copyrightable work licensed under this
+License.  Each licensee is addressed as "you".  "Licensees" and
+"recipients" may be individuals or organizations.
+
+  To "modify" a work means to copy from or adapt all or part of the work
+in a fashion requiring copyright permission, other than the making of an
+exact copy.  The resulting work is called a "modified version" of the
+earlier work or a work "based on" the earlier work.
+
+  A "covered work" means either the unmodified Program or a work based
+on the Program.
+
+  To "propagate" a work means to do anything with it that, without
+permission, would make you directly or secondarily liable for
+infringement under applicable copyright law, except executing it on a
+computer or modifying a private copy.  Propagation includes copying,
+distribution (with or without modification), making available to the
+public, and in some countries other activities as well.
+
+  To "convey" a work means any kind of propagation that enables other
+parties to make or receive copies.  Mere interaction with a user through
+a computer network, with no transfer of a copy, is not conveying.
+
+  An interactive user interface displays "Appropriate Legal Notices"
+to the extent that it includes a convenient and prominently visible
+feature that (1) displays an appropriate copyright notice, and (2)
+tells the user that there is no warranty for the work (except to the
+extent that warranties are provided), that licensees may convey the
+work under this License, and how to view a copy of this License.  If
+the interface presents a list of user commands or options, such as a
+menu, a prominent item in the list meets this criterion.
+
+  1. Source Code.
+
+  The "source code" for a work means the preferred form of the work
+for making modifications to it.  "Object code" means any non-source
+form of a work.
+
+  A "Standard Interface" means an interface that either is an official
+standard defined by a recognized standards body, or, in the case of
+interfaces specified for a particular programming language, one that
+is widely used among developers working in that language.
+
+  The "System Libraries" of an executable work include anything, other
+than the work as a whole, that (a) is included in the normal form of
+packaging a Major Component, but which is not part of that Major
+Component, and (b) serves only to enable use of the work with that
+Major Component, or to implement a Standard Interface for which an
+implementation is available to the public in source code form.  A
+"Major Component", in this context, means a major essential component
+(kernel, window system, and so on) of the specific operating system
+(if any) on which the executable work runs, or a compiler used to
+produce the work, or an object code interpreter used to run it.
+
+  The "Corresponding Source" for a work in object code form means all
+the source code needed to generate, install, and (for an executable
+work) run the object code and to modify the work, including scripts to
+control those activities.  However, it does not include the work's
+System Libraries, or general-purpose tools or generally available free
+programs which are used unmodified in performing those activities but
+which are not part of the work.  For example, Corresponding Source
+includes interface definition files associated with source files for
+the work, and the source code for shared libraries and dynamically
+linked subprograms that the work is specifically designed to require,
+such as by intimate data communication or control flow between those
+subprograms and other parts of the work.
+
+  The Corresponding Source need not include anything that users
+can regenerate automatically from other parts of the Corresponding
+Source.
+
+  The Corresponding Source for a work in source code form is that
+same work.
+
+  2. Basic Permissions.
+
+  All rights granted under this License are granted for the term of
+copyright on the Program, and are irrevocable provided the stated
+conditions are met.  This License explicitly affirms your unlimited
+permission to run the unmodified Program.  The output from running a
+covered work is covered by this License only if the output, given its
+content, constitutes a covered work.  This License acknowledges your
+rights of fair use or other equivalent, as provided by copyright law.
+
+  You may make, run and propagate covered works that you do not
+convey, without conditions so long as your license otherwise remains
+in force.  You may convey covered works to others for the sole purpose
+of having them make modifications exclusively for you, or provide you
+with facilities for running those works, provided that you comply with
+the terms of this License in conveying all material for which you do
+not control copyright.  Those thus making or running the covered works
+for you must do so exclusively on your behalf, under your direction
+and control, on terms that prohibit them from making any copies of
+your copyrighted material outside their relationship with you.
+
+  Conveying under any other circumstances is permitted solely under
+the conditions stated below.  Sublicensing is not allowed; section 10
+makes it unnecessary.
+
+  3. Protecting Users' Legal Rights From Anti-Circumvention Law.
+
+  No covered work shall be deemed part of an effective technological
+measure under any applicable law fulfilling obligations under article
+11 of the WIPO copyright treaty adopted on 20 December 1996, or
+similar laws prohibiting or restricting circumvention of such
+measures.
+
+  When you convey a covered work, you waive any legal power to forbid
+circumvention of technological measures to the extent such circumvention
+is effected by exercising rights under this License with respect to
+the covered work, and you disclaim any intention to limit operation or
+modification of the work as a means of enforcing, against the work's
+users, your or third parties' legal rights to forbid circumvention of
+technological measures.
+
+  4. Conveying Verbatim Copies.
+
+  You may convey verbatim copies of the Program's source code as you
+receive it, in any medium, provided that you conspicuously and
+appropriately publish on each copy an appropriate copyright notice;
+keep intact all notices stating that this License and any
+non-permissive terms added in accord with section 7 apply to the code;
+keep intact all notices of the absence of any warranty; and give all
+recipients a copy of this License along with the Program.
+
+  You may charge any price or no price for each copy that you convey,
+and you may offer support or warranty protection for a fee.
+
+  5. Conveying Modified Source Versions.
+
+  You may convey a work based on the Program, or the modifications to
+produce it from the Program, in the form of source code under the
+terms of section 4, provided that you also meet all of these conditions:
+
+    a) The work must carry prominent notices stating that you modified
+    it, and giving a relevant date.
+
+    b) The work must carry prominent notices stating that it is
+    released under this License and any conditions added under section
+    7.  This requirement modifies the requirement in section 4 to
+    "keep intact all notices".
+
+    c) You must license the entire work, as a whole, under this
+    License to anyone who comes into possession of a copy.  This
+    License will therefore apply, along with any applicable section 7
+    additional terms, to the whole of the work, and all its parts,
+    regardless of how they are packaged.  This License gives no
+    permission to license the work in any other way, but it does not
+    invalidate such permission if you have separately received it.
+
+    d) If the work has interactive user interfaces, each must display
+    Appropriate Legal Notices; however, if the Program has interactive
+    interfaces that do not display Appropriate Legal Notices, your
+    work need not make them do so.
+
+  A compilation of a covered work with other separate and independent
+works, which are not by their nature extensions of the covered work,
+and which are not combined with it such as to form a larger program,
+in or on a volume of a storage or distribution medium, is called an
+"aggregate" if the compilation and its resulting copyright are not
+used to limit the access or legal rights of the compilation's users
+beyond what the individual works permit.  Inclusion of a covered work
+in an aggregate does not cause this License to apply to the other
+parts of the aggregate.
+
+  6. Conveying Non-Source Forms.
+
+  You may convey a covered work in object code form under the terms
+of sections 4 and 5, provided that you also convey the
+machine-readable Corresponding Source under the terms of this License,
+in one of these ways:
+
+    a) Convey the object code in, or embodied in, a physical product
+    (including a physical distribution medium), accompanied by the
+    Corresponding Source fixed on a durable physical medium
+    customarily used for software interchange.
+
+    b) Convey the object code in, or embodied in, a physical product
+    (including a physical distribution medium), accompanied by a
+    written offer, valid for at least three years and valid for as
+    long as you offer spare parts or customer support for that product
+    model, to give anyone who possesses the object code either (1) a
+    copy of the Corresponding Source for all the software in the
+    product that is covered by this License, on a durable physical
+    medium customarily used for software interchange, for a price no
+    more than your reasonable cost of physically performing this
+    conveying of source, or (2) access to copy the
+    Corresponding Source from a network server at no charge.
+
+    c) Convey individual copies of the object code with a copy of the
+    written offer to provide the Corresponding Source.  This
+    alternative is allowed only occasionally and noncommercially, and
+    only if you received the object code with such an offer, in accord
+    with subsection 6b.
+
+    d) Convey the object code by offering access from a designated
+    place (gratis or for a charge), and offer equivalent access to the
+    Corresponding Source in the same way through the same place at no
+    further charge.  You need not require recipients to copy the
+    Corresponding Source along with the object code.  If the place to
+    copy the object code is a network server, the Corresponding Source
+    may be on a different server (operated by you or a third party)
+    that supports equivalent copying facilities, provided you maintain
+    clear directions next to the object code saying where to find the
+    Corresponding Source.  Regardless of what server hosts the
+    Corresponding Source, you remain obligated to ensure that it is
+    available for as long as needed to satisfy these requirements.
+
+    e) Convey the object code using peer-to-peer transmission, provided
+    you inform other peers where the object code and Corresponding
+    Source of the work are being offered to the general public at no
+    charge under subsection 6d.
+
+  A separable portion of the object code, whose source code is excluded
+from the Corresponding Source as a System Library, need not be
+included in conveying the object code work.
+
+  A "User Product" is either (1) a "consumer product", which means any
+tangible personal property which is normally used for personal, family,
+or household purposes, or (2) anything designed or sold for incorporation
+into a dwelling.  In determining whether a product is a consumer product,
+doubtful cases shall be resolved in favor of coverage.  For a particular
+product received by a particular user, "normally used" refers to a
+typical or common use of that class of product, regardless of the status
+of the particular user or of the way in which the particular user
+actually uses, or expects or is expected to use, the product.  A product
+is a consumer product regardless of whether the product has substantial
+commercial, industrial or non-consumer uses, unless such uses represent
+the only significant mode of use of the product.
+
+  "Installation Information" for a User Product means any methods,
+procedures, authorization keys, or other information required to install
+and execute modified versions of a covered work in that User Product from
+a modified version of its Corresponding Source.  The information must
+suffice to ensure that the continued functioning of the modified object
+code is in no case prevented or interfered with solely because
+modification has been made.
+
+  If you convey an object code work under this section in, or with, or
+specifically for use in, a User Product, and the conveying occurs as
+part of a transaction in which the right of possession and use of the
+User Product is transferred to the recipient in perpetuity or for a
+fixed term (regardless of how the transaction is characterized), the
+Corresponding Source conveyed under this section must be accompanied
+by the Installation Information.  But this requirement does not apply
+if neither you nor any third party retains the ability to install
+modified object code on the User Product (for example, the work has
+been installed in ROM).
+
+  The requirement to provide Installation Information does not include a
+requirement to continue to provide support service, warranty, or updates
+for a work that has been modified or installed by the recipient, or for
+the User Product in which it has been modified or installed.  Access to a
+network may be denied when the modification itself materially and
+adversely affects the operation of the network or violates the rules and
+protocols for communication across the network.
+
+  Corresponding Source conveyed, and Installation Information provided,
+in accord with this section must be in a format that is publicly
+documented (and with an implementation available to the public in
+source code form), and must require no special password or key for
+unpacking, reading or copying.
+
+  7. Additional Terms.
+
+  "Additional permissions" are terms that supplement the terms of this
+License by making exceptions from one or more of its conditions.
+Additional permissions that are applicable to the entire Program shall
+be treated as though they were included in this License, to the extent
+that they are valid under applicable law.  If additional permissions
+apply only to part of the Program, that part may be used separately
+under those permissions, but the entire Program remains governed by
+this License without regard to the additional permissions.
+
+  When you convey a copy of a covered work, you may at your option
+remove any additional permissions from that copy, or from any part of
+it.  (Additional permissions may be written to require their own
+removal in certain cases when you modify the work.)  You may place
+additional permissions on material, added by you to a covered work,
+for which you have or can give appropriate copyright permission.
+
+  Notwithstanding any other provision of this License, for material you
+add to a covered work, you may (if authorized by the copyright holders of
+that material) supplement the terms of this License with terms:
+
+    a) Disclaiming warranty or limiting liability differently from the
+    terms of sections 15 and 16 of this License; or
+
+    b) Requiring preservation of specified reasonable legal notices or
+    author attributions in that material or in the Appropriate Legal
+    Notices displayed by works containing it; or
+
+    c) Prohibiting misrepresentation of the origin of that material, or
+    requiring that modified versions of such material be marked in
+    reasonable ways as different from the original version; or
+
+    d) Limiting the use for publicity purposes of names of licensors or
+    authors of the material; or
+
+    e) Declining to grant rights under trademark law for use of some
+    trade names, trademarks, or service marks; or
+
+    f) Requiring indemnification of licensors and authors of that
+    material by anyone who conveys the material (or modified versions of
+    it) with contractual assumptions of liability to the recipient, for
+    any liability that these contractual assumptions directly impose on
+    those licensors and authors.
+
+  All other non-permissive additional terms are considered "further
+restrictions" within the meaning of section 10.  If the Program as you
+received it, or any part of it, contains a notice stating that it is
+governed by this License along with a term that is a further
+restriction, you may remove that term.  If a license document contains
+a further restriction but permits relicensing or conveying under this
+License, you may add to a covered work material governed by the terms
+of that license document, provided that the further restriction does
+not survive such relicensing or conveying.
+
+  If you add terms to a covered work in accord with this section, you
+must place, in the relevant source files, a statement of the
+additional terms that apply to those files, or a notice indicating
+where to find the applicable terms.
+
+  Additional terms, permissive or non-permissive, may be stated in the
+form of a separately written license, or stated as exceptions;
+the above requirements apply either way.
+
+  8. Termination.
+
+  You may not propagate or modify a covered work except as expressly
+provided under this License.  Any attempt otherwise to propagate or
+modify it is void, and will automatically terminate your rights under
+this License (including any patent licenses granted under the third
+paragraph of section 11).
+
+  However, if you cease all violation of this License, then your
+license from a particular copyright holder is reinstated (a)
+provisionally, unless and until the copyright holder explicitly and
+finally terminates your license, and (b) permanently, if the copyright
+holder fails to notify you of the violation by some reasonable means
+prior to 60 days after the cessation.
+
+  Moreover, your license from a particular copyright holder is
+reinstated permanently if the copyright holder notifies you of the
+violation by some reasonable means, this is the first time you have
+received notice of violation of this License (for any work) from that
+copyright holder, and you cure the violation prior to 30 days after
+your receipt of the notice.
+
+  Termination of your rights under this section does not terminate the
+licenses of parties who have received copies or rights from you under
+this License.  If your rights have been terminated and not permanently
+reinstated, you do not qualify to receive new licenses for the same
+material under section 10.
+
+  9. Acceptance Not Required for Having Copies.
+
+  You are not required to accept this License in order to receive or
+run a copy of the Program.  Ancillary propagation of a covered work
+occurring solely as a consequence of using peer-to-peer transmission
+to receive a copy likewise does not require acceptance.  However,
+nothing other than this License grants you permission to propagate or
+modify any covered work.  These actions infringe copyright if you do
+not accept this License.  Therefore, by modifying or propagating a
+covered work, you indicate your acceptance of this License to do so.
+
+  10. Automatic Licensing of Downstream Recipients.
+
+  Each time you convey a covered work, the recipient automatically
+receives a license from the original licensors, to run, modify and
+propagate that work, subject to this License.  You are not responsible
+for enforcing compliance by third parties with this License.
+
+  An "entity transaction" is a transaction transferring control of an
+organization, or substantially all assets of one, or subdividing an
+organization, or merging organizations.  If propagation of a covered
+work results from an entity transaction, each party to that
+transaction who receives a copy of the work also receives whatever
+licenses to the work the party's predecessor in interest had or could
+give under the previous paragraph, plus a right to possession of the
+Corresponding Source of the work from the predecessor in interest, if
+the predecessor has it or can get it with reasonable efforts.
+
+  You may not impose any further restrictions on the exercise of the
+rights granted or affirmed under this License.  For example, you may
+not impose a license fee, royalty, or other charge for exercise of
+rights granted under this License, and you may not initiate litigation
+(including a cross-claim or counterclaim in a lawsuit) alleging that
+any patent claim is infringed by making, using, selling, offering for
+sale, or importing the Program or any portion of it.
+
+  11. Patents.
+
+  A "contributor" is a copyright holder who authorizes use under this
+License of the Program or a work on which the Program is based.  The
+work thus licensed is called the contributor's "contributor version".
+
+  A contributor's "essential patent claims" are all patent claims
+owned or controlled by the contributor, whether already acquired or
+hereafter acquired, that would be infringed by some manner, permitted
+by this License, of making, using, or selling its contributor version,
+but do not include claims that would be infringed only as a
+consequence of further modification of the contributor version.  For
+purposes of this definition, "control" includes the right to grant
+patent sublicenses in a manner consistent with the requirements of
+this License.
+
+  Each contributor grants you a non-exclusive, worldwide, royalty-free
+patent license under the contributor's essential patent claims, to
+make, use, sell, offer for sale, import and otherwise run, modify and
+propagate the contents of its contributor version.
+
+  In the following three paragraphs, a "patent license" is any express
+agreement or commitment, however denominated, not to enforce a patent
+(such as an express permission to practice a patent or covenant not to
+sue for patent infringement).  To "grant" such a patent license to a
+party means to make such an agreement or commitment not to enforce a
+patent against the party.
+
+  If you convey a covered work, knowingly relying on a patent license,
+and the Corresponding Source of the work is not available for anyone
+to copy, free of charge and under the terms of this License, through a
+publicly available network server or other readily accessible means,
+then you must either (1) cause the Corresponding Source to be so
+available, or (2) arrange to deprive yourself of the benefit of the
+patent license for this particular work, or (3) arrange, in a manner
+consistent with the requirements of this License, to extend the patent
+license to downstream recipients.  "Knowingly relying" means you have
+actual knowledge that, but for the patent license, your conveying the
+covered work in a country, or your recipient's use of the covered work
+in a country, would infringe one or more identifiable patents in that
+country that you have reason to believe are valid.
+
+  If, pursuant to or in connection with a single transaction or
+arrangement, you convey, or propagate by procuring conveyance of, a
+covered work, and grant a patent license to some of the parties
+receiving the covered work authorizing them to use, propagate, modify
+or convey a specific copy of the covered work, then the patent license
+you grant is automatically extended to all recipients of the covered
+work and works based on it.
+
+  A patent license is "discriminatory" if it does not include within
+the scope of its coverage, prohibits the exercise of, or is
+conditioned on the non-exercise of one or more of the rights that are
+specifically granted under this License.  You may not convey a covered
+work if you are a party to an arrangement with a third party that is
+in the business of distributing software, under which you make payment
+to the third party based on the extent of your activity of conveying
+the work, and under which the third party grants, to any of the
+parties who would receive the covered work from you, a discriminatory
+patent license (a) in connection with copies of the covered work
+conveyed by you (or copies made from those copies), or (b) primarily
+for and in connection with specific products or compilations that
+contain the covered work, unless you entered into that arrangement,
+or that patent license was granted, prior to 28 March 2007.
+
+  Nothing in this License shall be construed as excluding or limiting
+any implied license or other defenses to infringement that may
+otherwise be available to you under applicable patent law.
+
+  12. No Surrender of Others' Freedom.
+
+  If conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License.  If you cannot convey a
+covered work so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you may
+not convey it at all.  For example, if you agree to terms that obligate you
+to collect a royalty for further conveying from those to whom you convey
+the Program, the only way you could satisfy both those terms and this
+License would be to refrain entirely from conveying the Program.
+
+  13. Remote Network Interaction; Use with the GNU General Public License.
+
+  Notwithstanding any other provision of this License, if you modify the
+Program, your modified version must prominently offer all users
+interacting with it remotely through a computer network (if your version
+supports such interaction) an opportunity to receive the Corresponding
+Source of your version by providing access to the Corresponding Source
+from a network server at no charge, through some standard or customary
+means of facilitating copying of software.  This Corresponding Source
+shall include the Corresponding Source for any work covered by version 3
+of the GNU General Public License that is incorporated pursuant to the
+following paragraph.
+
+  Notwithstanding any other provision of this License, you have
+permission to link or combine any covered work with a work licensed
+under version 3 of the GNU General Public License into a single
+combined work, and to convey the resulting work.  The terms of this
+License will continue to apply to the part which is the covered work,
+but the work with which it is combined will remain governed by version
+3 of the GNU General Public License.
+
+  14. Revised Versions of this License.
+
+  The Free Software Foundation may publish revised and/or new versions of
+the GNU Affero General Public License from time to time.  Such new versions
+will be similar in spirit to the present version, but may differ in detail to
+address new problems or concerns.
+
+  Each version is given a distinguishing version number.  If the
+Program specifies that a certain numbered version of the GNU Affero General
+Public License "or any later version" applies to it, you have the
+option of following the terms and conditions either of that numbered
+version or of any later version published by the Free Software
+Foundation.  If the Program does not specify a version number of the
+GNU Affero General Public License, you may choose any version ever published
+by the Free Software Foundation.
+
+  If the Program specifies that a proxy can decide which future
+versions of the GNU Affero General Public License can be used, that proxy's
+public statement of acceptance of a version permanently authorizes you
+to choose that version for the Program.
+
+  Later license versions may give you additional or different
+permissions.  However, no additional obligations are imposed on any
+author or copyright holder as a result of your choosing to follow a
+later version.
+
+  15. Disclaimer of Warranty.
+
+  THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY
+APPLICABLE LAW.  EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT
+HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY
+OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO,
+THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
+PURPOSE.  THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM
+IS WITH YOU.  SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF
+ALL NECESSARY SERVICING, REPAIR OR CORRECTION.
+
+  16. Limitation of Liability.
+
+  IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
+WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MODIFIES AND/OR CONVEYS
+THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY
+GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE
+USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF
+DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD
+PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS),
+EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF
+SUCH DAMAGES.
+
+  17. Interpretation of Sections 15 and 16.
+
+  If the disclaimer of warranty and limitation of liability provided
+above cannot be given local legal effect according to their terms,
+reviewing courts shall apply local law that most closely approximates
+an absolute waiver of all civil liability in connection with the
+Program, unless a warranty or assumption of liability accompanies a
+copy of the Program in return for a fee.
+
+                     END OF TERMS AND CONDITIONS
+
+            How to Apply These Terms to Your New Programs
+
+  If you develop a new program, and you want it to be of the greatest
+possible use to the public, the best way to achieve this is to make it
+free software which everyone can redistribute and change under these terms.
+
+  To do so, attach the following notices to the program.  It is safest
+to attach them to the start of each source file to most effectively
+state the exclusion of warranty; and each file should have at least
+the "copyright" line and a pointer to where the full notice is found.
+
+    <one line to give the program's name and a brief idea of what it does.>
+    Copyright (C) <year>  <name of author>
+
+    This program is free software: you can redistribute it and/or modify
+    it under the terms of the GNU Affero General Public License as published
+    by the Free Software Foundation, either version 3 of the License, or
+    (at your option) any later version.
+
+    This program is distributed in the hope that it will be useful,
+    but WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+    GNU Affero General Public License for more details.
+
+    You should have received a copy of the GNU Affero General Public License
+    along with this program.  If not, see <https://www.gnu.org/licenses/>.
+
+Also add information on how to contact you by electronic and paper mail.
+
+  If your software can interact with users remotely through a computer
+network, you should also make sure that it provides a way for users to
+get its source.  For example, if your program is a web application, its
+interface could display a "Source" link that leads users to an archive
+of the code.  There are many ways you could offer source, and different
+solutions will be better for different programs; see section 13 for the
+specific requirements.
+
+  You should also get your employer (if you work as a programmer) or school,
+if any, to sign a "copyright disclaimer" for the program, if necessary.
+For more information on this, and how to apply and follow the GNU AGPL, see
+<https://www.gnu.org/licenses/>.
\ No newline at end of file
diff --git a/README.md b/README.md
index 626eda61..c3ee8920 100644
--- a/README.md
+++ b/README.md
@@ -1 +1,86 @@
-# mirotalksfu
\ No newline at end of file
+# mirotalksfu
+
+`Open Source WebRTC video calls, messaging and screen sharing`
+
+![License: AGPLv3](https://img.shields.io/badge/License-AGPLv3-blue.svg)
+[![Donate](https://img.shields.io/badge/Donate-PayPal-brightgreen.svg)](https://paypal.me/MiroslavPejic?locale.x=it_IT)
+[![Repo Link](https://img.shields.io/badge/Repo-Link-black.svg)](https://github.com/miroslavpejic85/mirotalk)
+[![Code style: prettier](https://img.shields.io/badge/Code_style-Prettier-ff69b4.svg?)](https://github.com/prettier/prettier)
+
+Powered by `WebRTC` using [SFU](https://mediasoup.org) integrated server.
+
+![mirotalksfu](public/images/mirotalksfu.png)
+
+## Features
+
+-   Is `100% Free` - `Open Source` and `Self Hosted`
+-   `No download`, `plug-in` or `login` required, entirely browser based
+-   `Unlimited` number of `conference rooms` and `users`, `without` call `time limitation`
+-   Desktop and Mobile compatible
+-   Optimized Room URL Sharing (share it to your participants, wait them to join)
+-   Webcam Streaming up to 4K quality (Front - Rear for mobile)
+-   Echo cancellation and noise suppression that makes your audio crystal clear
+-   Screen Sharing to present documents, slides, and more ...
+-   Chat with Emoji Picker to show you feeling and possibility to Save the conversations
+-   Select Microphone - Speaker and Video source
+-   Recording your Screen, Audio or Video
+-   Full Screen Mode on mouse click on the Video element
+-   Supports [REST API](api/README.md) (Application Programming Interface)
+
+## Quick Start
+
+-   You will need to have `Node.js` installed, this project has been tested with Node version [12.X](https://nodejs.org/en/blog/release/v12.22.1/) and [14.X](https://nodejs.org/en/blog/release/v14.17.5/) `not` with `16.X`.
+
+```bash
+# clone this repo
+git clone https://github.com/miroslavpejic85/mirotalksfu.git
+
+# mirotalk dir
+cd mirotalksfu
+
+# copy src/config.template.js src/config.js
+cp src/config.template.js src/config.js
+
+# install dependencies
+npm install
+
+# start the server
+npm start
+```
+
+-   Open https://localhost:3010 in browser
+
+---
+
+## API
+
+The `response` will give you a `entrypoint / Room URL` for `your meeting`.
+
+```bash
+curl -X POST "http://localhost:3010/api/v1/meeting" -H "authorization: mirotalksfu_default_secret" -H "Content-Type: application/json"
+```
+
+---
+
+## Notes
+
+Run the project on a `Linux or Mac` system as the `mediasoup` installation could have issues on `Windows`. If you have a Windows system, consider to installing [WSL](https://docs.microsoft.com/en-us/windows/wsl/install-win10) to be able to run it.
+
+---
+
+## Credits
+
+-   [Davide Pacilio](https://cruip.com/demos/solid/) (html template)
+-   [Dirk Vanbeveren](https://github.com/Dirvann) (sfu logic)
+-   [Mediasoup](https://mediasoup.org) (sfu server)
+
+---
+
+## Contributing
+
+-   Contributions are welcome and greatly appreciated!
+-   Just run before `npm run lint`
+
+## License
+
+[![AGPLv3](public/images/AGPLv3.png)](LICENSE)
diff --git a/api/README.md b/api/README.md
new file mode 100644
index 00000000..d5b890fc
--- /dev/null
+++ b/api/README.md
@@ -0,0 +1,40 @@
+![restAPI](restAPI.png)
+
+## Create a meeting
+
+Create a meeting with a `HTTP request` containing the `API_KEY` sent to MiroTalk’s server. The response contains a `meeting` URL that can be `embedded` in your client within an `iframe`.
+
+```bash
+# js
+node meeting.js
+# php
+php meeting.php
+# python
+python meeting.py
+# bash
+./meeting.sh
+```
+
+## Embed a meeting
+
+Embedding a meeting into a `service` or `app` requires using an `iframe` with the `src` attribute specified as the `meeting` from `HTTP response`.
+
+```html
+<iframe
+    allow="camera; microphone; fullscreen; display-capture; autoplay"
+    src="https://localhost:3010/join/room_name"
+    style="height: 100%; width: 100%; border: 0px;"
+></iframe>
+```
+
+## Fast Integration
+
+Develop your `website` or `application`, and bring `video meetings` in with a simple `iframe`.
+
+```html
+<iframe
+    allow="camera; microphone; fullscreen; display-capture; autoplay"
+    src="https://localhost:3010/newroom"
+    style="height: 100%; width: 100%; border: 0px;"
+></iframe>
+```
diff --git a/api/meeting.js b/api/meeting.js
new file mode 100644
index 00000000..0699341e
--- /dev/null
+++ b/api/meeting.js
@@ -0,0 +1,22 @@
+'use strict';
+
+const fetch = require('node-fetch');
+
+const API_KEY = 'mirotalksfu_default_secret';
+const MIROTALK_URL = 'http://localhost:3010/api/v1/meeting';
+
+function getResponse() {
+    return fetch(MIROTALK_URL, {
+        method: 'POST',
+        headers: {
+            authorization: API_KEY,
+            'Content-Type': 'application/json',
+        },
+    });
+}
+
+getResponse().then(async (res) => {
+    console.log('Status code:', res.status);
+    const data = await res.json();
+    console.log('meeting:', data.meeting);
+});
diff --git a/api/meeting.php b/api/meeting.php
new file mode 100644
index 00000000..56fff7a8
--- /dev/null
+++ b/api/meeting.php
@@ -0,0 +1,24 @@
+<?php
+
+$API_KEY = "mirotalksfu_default_secret";
+$MIROTALK_URL = "http://localhost:3010/api/v1/meeting";
+
+$ch = curl_init();
+curl_setopt($ch, CURLOPT_URL, $MIROTALK_URL);
+curl_setopt($ch, CURLOPT_RETURNTRANSFER, 1);
+curl_setopt($ch, CURLOPT_POST, 1);
+
+$headers = [
+    'authorization:' . $API_KEY,
+    'Content-Type: application/json'
+];
+
+curl_setopt($ch, CURLOPT_HTTPHEADER, $headers);
+$response = curl_exec($ch);
+$httpcode = curl_getinfo($ch, CURLINFO_HTTP_CODE);
+
+curl_close($ch);
+
+echo "Status code: $httpcode \n";
+$data = json_decode($response);
+echo "meeting: ", $data->{'meeting'}, "\n";
diff --git a/api/meeting.py b/api/meeting.py
new file mode 100644
index 00000000..a926816f
--- /dev/null
+++ b/api/meeting.py
@@ -0,0 +1,19 @@
+import requests
+import json
+
+API_KEY = "mirotalksfu_default_secret"
+MIROTALK_URL = "http://localhost:3010/api/v1/meeting"
+
+headers = {
+    "authorization": API_KEY,
+    "Content-Type": "application/json",
+}
+
+response = requests.post(
+    MIROTALK_URL,
+    headers=headers
+)
+
+print("Status code:", response.status_code)
+data = json.loads(response.text)
+print("meeting:", data["meeting"])
diff --git a/api/meeting.sh b/api/meeting.sh
new file mode 100755
index 00000000..96ebe65c
--- /dev/null
+++ b/api/meeting.sh
@@ -0,0 +1,9 @@
+#!/bin/bash
+
+API_KEY="mirotalksfu_default_secret"
+MIROTALK_URL="http://localhost:3010/api/v1/meeting"
+
+curl $MIROTALK_URL \
+    --header "authorization: $API_KEY" \
+    --header "Content-Type: application/json" \
+    --request POST
\ No newline at end of file
diff --git a/api/restAPI.png b/api/restAPI.png
new file mode 100644
index 00000000..9c3f219f
Binary files /dev/null and b/api/restAPI.png differ
diff --git a/package.json b/package.json
new file mode 100644
index 00000000..9ae271b9
--- /dev/null
+++ b/package.json
@@ -0,0 +1,29 @@
+{
+    "name": "mirotalksfu",
+    "version": "1.0.0",
+    "description": "WebRTC SFU browser-based video calls",
+    "main": "Server.js",
+    "scripts": {
+        "test": "echo \"Error: no test specified\" && exit 1",
+        "start": "node src/Server.js",
+        "compile": "npx browserify public/modules/MediasoupClientCompile.js -o public/modules/MediasoupClient.js",
+        "lint": "npx prettier --write ."
+    },
+    "author": "Miroslav Pejic",
+    "license": "AGPLv3",
+    "dependencies": {
+        "compression": "^1.7.4",
+        "cors": "^2.8.5",
+        "express": "^4.17.1",
+        "httpolyglot": "^0.1.2",
+        "mediasoup": "^3.8.3",
+        "mediasoup-client": "^3.6.37",
+        "ngrok": "^4.0.1",
+        "socket.io": "^4.1.3",
+        "uuid": "8.3.2"
+    },
+    "devDependencies": {
+        "node-fetch": "^2.6.1",
+        "prettier": "2.3.2"
+    }
+}
diff --git a/public/Room.html b/public/Room.html
new file mode 100644
index 00000000..39033386
--- /dev/null
+++ b/public/Room.html
@@ -0,0 +1,228 @@
+<!DOCTYPE html>
+<html lang="en">
+    <head>
+        <!-- Title and Icon -->
+
+        <title>MiroTalk SFU - Room Video Calls, Messaging and Screen Sharing.</title>
+        <link rel="shortcut icon" href="images/logo.svg" />
+        <link rel="apple-touch-icon" href="images/logo.svg" />
+
+        <!-- Meta Information -->
+
+        <meta charset="utf-8" />
+        <meta name="viewport" content="width=device-width, initial-scale=1.0" />
+        <meta
+            name="description"
+            content="MiroTalk SFU powered by WebRTC and mediasoup, Real-time Simple Secure Fast video calls, messaging and screen sharing capabilities in the browser."
+        />
+        <meta
+            name="keywords"
+            content="webrtc, mediasoup, mediasoup-client, self hosted, voip, sip, real-time communications, chat, messaging, meet, webrtc stun, webrtc turn, video meeting, video chat, video conference, multi video chat, multi video conference, peer to peer, p2p, rtc, alternative to, zoom, microsoft teams, google meet, jitsi, meeting"
+        />
+
+        <!-- https://ogp.me -->
+
+        <meta property="og:type" content="app-webrtc" />
+        <meta property="og:site_name" content="MiroTalk SFU" />
+        <meta property="og:title" content="Click the link to make a call." />
+        <meta
+            property="og:description"
+            content="MiroTalk SFU calling provides real-time video calls, messaging and screen sharing."
+        />
+        <meta property="og:image" content="/images/mirotalksfu.png" />
+
+        <!-- StyleSheet -->
+
+        <link rel="stylesheet" href="/css/Room.css" />
+
+        <!-- https://animate.style 4 using for swal fadeIn-Out -->
+
+        <link rel="stylesheet" href="https://cdnjs.cloudflare.com/ajax/libs/animate.css/4.1.1/animate.min.css" />
+
+        <!-- Bootstrap 5 -->
+
+        <link rel="stylesheet" href="https://www.w3schools.com/w3css/4/w3.css" />
+
+        <link
+            href="https://cdn.jsdelivr.net/npm/bootstrap@5.0.2/dist/css/bootstrap.min.css"
+            rel="stylesheet"
+            integrity="sha384-EVSTQN3/azprG1Anm3QDgpJLIm9Nao0Yz1ztcQTwFspd3yD65VohhpuuCOmLASjC"
+            crossorigin="anonymous"
+        />
+        <script
+            src="https://cdn.jsdelivr.net/npm/bootstrap@5.0.2/dist/js/bootstrap.bundle.min.js"
+            integrity="sha384-MrcW6ZMFYlzcLA8Nl+NtUVF0sA7MsXsP1UyJoMp4YLEuNSfAP+JcXn/tWtIaxVXM"
+            crossorigin="anonymous"
+        ></script>
+
+        <!-- Js scripts -->
+
+        <script src="/socket.io/socket.io.js"></script>
+        <script src="/modules/MediasoupClient.js"></script>
+        <script src="/js/Room.js"></script>
+        <script src="/js/RoomClient.js"></script>
+        <script src="https://kit.fontawesome.com/d2f1016e6f.js" crossorigin="anonymous"></script>
+        <script src="https://cdn.rawgit.com/muaz-khan/DetectRTC/master/DetectRTC.js"></script>
+        <script src="https://cdnjs.cloudflare.com/ajax/libs/qrious/4.0.2/qrious.min.js"></script>
+        <script src="https://cdn.jsdelivr.net/npm/sweetalert2@11.1.2"></script>
+        <script src="https://unpkg.com/emoji-picker-element@1" type="module"></script>
+        <script src="https://unpkg.com/@popperjs/core@2"></script>
+        <script src="https://unpkg.com/tippy.js@6"></script>
+    </head>
+    <body onload="initClient()">
+        <noscript>You need to enable JavaScript to run this app.</noscript>
+        <div class="container-xxl">
+            <div id="control" class="fadein hidden">
+                <button id="exitButton" class="hidden">
+                    <i class="fas fa-arrow-left"></i>
+                </button>
+                <button id="shareButton" class="hidden">
+                    <i class="fas fa-users"></i>
+                </button>
+                <div class="dropdown">
+                    <button id="devicesButton" class="hidden">
+                        <i class="fas fa-cogs"></i>
+                    </button>
+                    <div id="myDevices" class="dropdown-content fadein">
+                        <div id="devicesList">
+                            <br />
+                            <i class="fas fa-video"></i> Video:
+                            <select id="videoSelect" class="form-select text-light bg-dark"></select>
+                            <br />
+                            <i class="fas fa-microphone"></i> Microphone:
+                            <select id="microphoneSelect" class="form-select text-light bg-dark"></select>
+                            <br />
+                            <i class="fas fa-volume-up"></i> Speaker:
+                            <select id="speakerSelect" class="form-select text-light bg-dark"></select>
+                        </div>
+                    </div>
+                </div>
+                <div class="dropdown">
+                    <button id="recButton" class="hidden">
+                        <i class="fas fa-record-vinyl"></i>
+                    </button>
+                    <div id="recording" class="dropdown-content fadein">
+                        <div id="recordingCommand" class="recording">
+                            <br />
+                            <button id="startRecButton" class="hidden">
+                                <i class="fas fa-record-vinyl"></i>
+                            </button>
+                            <button id="stopRecButton" class="hidden">
+                                <i class="fas fa-stop-circle"></i>
+                            </button>
+                            <button id="pauseRecButton" class="hidden">
+                                <i class="far fa-pause-circle"></i>
+                            </button>
+                            <button id="resumeRecButton" class="hidden">
+                                <i class="far fa-play-circle"></i>
+                            </button>
+                            <p id="recordingStatus">🔴 REC 0s</p>
+                        </div>
+                    </div>
+                </div>
+                <button id="chatButton" class="hidden">
+                    <i class="fas fa-comments"></i>
+                </button>
+                <button id="fullScreenButton" class="hidden">
+                    <i class="fas fa-expand-alt"></i>
+                </button>
+                <button id="swapCameraButton" class="hidden">
+                    <i class="fas fa-sync-alt"></i>
+                </button>
+                <button id="startAudioButton" class="hidden">
+                    <i class="fas fa-microphone-slash"></i>
+                </button>
+                <button id="stopAudioButton" class="hidden">
+                    <i class="fas fa-microphone"></i>
+                </button>
+                <button id="startVideoButton" class="hidden">
+                    <i class="fas fa-video-slash"></i>
+                </button>
+                <button id="stopVideoButton" class="hidden">
+                    <i class="fas fa-video"></i>
+                </button>
+                <button id="startScreenButton" class="hidden">
+                    <i class="fas fa-desktop"></i>
+                </button>
+                <button id="stopScreenButton" class="hidden">
+                    <i class="fas fa-stop-circle"></i>
+                </button>
+                <button id="aboutButton" class="hidden">
+                    <i class="fas fa-question"></i>
+                </button>
+                <p id="sessionTime"></p>
+            </div>
+        </div>
+        <div class="container-xxl">
+            <div id="videoMedia" class="hidden">
+                <div id="localMedia" class="containers">
+                    <!--<video id="localVideo" autoplay inline class="vid mirror"></video>-->
+                    <!--<video id="localScreen" autoplay inline class="vid"></video>-->
+                </div>
+                <div id="remoteVideos" class="containers"></div>
+                <div id="remoteAudios"></div>
+            </div>
+        </div>
+        <section id="chatRoom" class="chat-room center fadein">
+            <section id="msger" class="msger">
+                <header id="chatHeader" class="chat-header">
+                    <div class="chat-header-title"><i class="fas fa-comment-alt"></i> Chat</div>
+                    <div class="chat-header-options">
+                        <button id="chatCleanButton" class="fas fa-trash"></button>
+                        <button id="chatSaveButton" class="fas fa-save"></button>
+                        <button id="chatCloseButton" class="fas fa-times"></button>
+                    </div>
+                </header>
+                <main id="chatMsger" class="chat-msger">
+                    <div class="msg left-msg">
+                        <div
+                            class="msg-img"
+                            style="
+                                background-image: url('https://eu.ui-avatars.com/api?name=Participant&size=24&background=random&rounded=true');
+                            "
+                        ></div>
+                        <div class="msg-bubble">
+                            <div class="msg-info">
+                                <div class="msg-info-name">Participant</div>
+                                <div class="msg-info-time">00:00:00</div>
+                            </div>
+                            <div class="msg-text">Public message example</div>
+                        </div>
+                    </div>
+                    <div class="msg right-msg">
+                        <div
+                            class="msg-img"
+                            style="
+                                background-image: url('https://eu.ui-avatars.com/api?name=You&size=24&background=random&rounded=true');
+                            "
+                        ></div>
+                        <div class="msg-bubble">
+                            <div class="msg-info">
+                                <div class="msg-info-name">You</div>
+                                <div class="msg-info-time">00:00:00</div>
+                            </div>
+                            <div class="msg-text">Public message example</div>
+                        </div>
+                    </div>
+                </main>
+                <div class="chat-msger-inputarea">
+                    <input
+                        id="chatMessage"
+                        class="chat-msger-input"
+                        type="text"
+                        placeholder="💬 Enter your message..."
+                    />
+                    <button id="chatEmojiButton" class="hidden">
+                        <i class="fas fa-smile"></i>
+                    </button>
+                    <button id="chatSendButton" class="hidden">
+                        <i class="fas fa-paper-plane"></i>
+                    </button>
+                </div>
+                <div id="chatEmoji" class="hidden fadein">
+                    <emoji-picker class="dark"></emoji-picker>
+                </div>
+            </section>
+        </section>
+    </body>
+</html>
diff --git a/public/css/Room.css b/public/css/Room.css
new file mode 100644
index 00000000..d5ff3554
--- /dev/null
+++ b/public/css/Room.css
@@ -0,0 +1,575 @@
+/*--------------------------------------------------------------
+# Keyframes
+--------------------------------------------------------------*/
+
+@-webkit-keyframes fadeIn {
+    from {
+        opacity: 0;
+    }
+    to {
+        opacity: 1;
+    }
+}
+
+@-moz-keyframes fadeIn {
+    from {
+        opacity: 0;
+    }
+    to {
+        opacity: 1;
+    }
+}
+
+@keyframes fadeIn {
+    from {
+        opacity: 0;
+    }
+    to {
+        opacity: 1;
+    }
+}
+
+:root {
+    --msger-top: 50%;
+    --msger-left: 50%;
+    --msger-height: 680px;
+    --msger-width: 420px;
+    --msger-bg: #16171b;
+    --left-msg-bg: #222328;
+    --right-msg-bg: #0a0b0c;
+    --box-shadow: 0px 8px 16px 0px rgba(0, 0, 0, 0.2);
+}
+
+* {
+    outline: none;
+    font-family: 'Verdana';
+}
+
+body {
+    background-image: url('../images/background.jpg');
+    background-repeat: no-repeat;
+    background-attachment: fixed;
+    background-size: cover;
+}
+
+/*--------------------------------------------------------------
+# Control buttons
+--------------------------------------------------------------*/
+
+#control {
+    z-index: 1;
+    position: fixed;
+    padding: 10px;
+    top: 0;
+    width: 100%;
+    background: black;
+}
+
+#control button {
+    border-radius: 5px;
+}
+#control p {
+    font-size: small;
+    cursor: default;
+}
+
+/*--------------------------------------------------------------
+# Room QR
+--------------------------------------------------------------*/
+
+#qrRoomContainer {
+    display: flex;
+    justify-content: center;
+    align-items: center;
+}
+
+/*--------------------------------------------------------------
+# Video grid
+--------------------------------------------------------------*/
+
+.containers {
+    display: grid;
+    grid-template-columns: repeat(2, 1fr);
+    column-gap: 10px;
+    row-gap: 10px;
+    border-radius: 5px;
+}
+
+@media only screen and (max-width: 720px) {
+    .containers {
+        display: grid;
+        grid-template-columns: 1fr;
+        column-gap: 10px;
+        row-gap: 10px;
+        border-radius: 5px;
+    }
+}
+
+.vid {
+    flex: 0 1 auto;
+    height: 360px;
+    border-radius: 10px;
+    cursor: pointer;
+}
+
+video {
+    width: 100%;
+    height: 100%;
+    object-fit: cover;
+    box-shadow: var(--box-shadow);
+}
+
+video:hover {
+    opacity: 0.9;
+}
+
+video:fullscreen {
+    object-fit: contain; /* cover; */
+    opacity: 1;
+}
+
+.mirror {
+    -webkit-transform: rotateY(180deg);
+    -moz-transform: rotateY(180deg);
+    transform: rotateY(180deg);
+}
+
+#videoMedia {
+    margin-top: 50px;
+}
+
+#localMedia,
+#remoteVideos {
+    margin: 10px;
+    cursor: default;
+}
+
+.pn {
+    position: absolute;
+    display: flex;
+    align-items: center;
+    padding: 10px;
+    margin: 10px;
+    width: auto;
+    height: 30px;
+    border-radius: 5px;
+    margin-top: 325px;
+    color: white;
+    background: rgba(0, 0, 0, 0.7);
+}
+
+.d,
+.d video {
+    position: relative;
+}
+
+.d p {
+    position: absolute;
+    padding: 10px;
+    margin: 10px;
+    width: auto;
+    height: 30px;
+    border-radius: 5px;
+    top: 315px;
+    color: white;
+    background: rgba(0, 0, 0, 0.7);
+    display: flex;
+    align-items: center;
+}
+
+/*--------------------------------------------------------------
+# Dropdown menù
+--------------------------------------------------------------*/
+
+.dropdown {
+    position: relative;
+    display: inline-block;
+}
+
+.dropdown-content {
+    z-index: 2;
+    display: none;
+    position: absolute;
+    margin: auto;
+    padding: 10px;
+    min-width: 200px;
+    background-color: rgba(0, 0, 0, 0.7);
+    color: white;
+    overflow: auto;
+    border-radius: 5px;
+    box-shadow: var(--box-shadow);
+}
+
+.dropdown-content select {
+    width: auto;
+    font-size: small;
+}
+
+/*--------------------------------------------------------------
+# Recording
+--------------------------------------------------------------*/
+
+.recording {
+    display: flex;
+}
+
+.recording button,
+.recording p {
+    padding: 5px;
+    margin: 1px;
+    font-size: 0.8em;
+    border-radius: 5px;
+}
+
+/*--------------------------------------------------------------
+# Chat Room
+--------------------------------------------------------------*/
+
+.chat-room {
+    z-index: 3;
+    display: none;
+    position: fixed;
+    height: var(--msger-height);
+    width: var(--msger-width);
+    background: var(--msger-bg);
+    border-radius: 5px;
+    border-radius: 10px;
+    box-shadow: var(--box-shadow);
+    overflow: hidden;
+}
+
+.msger {
+    display: flex;
+    flex-flow: column wrap;
+    justify-content: space-between;
+    top: var(--msger-top);
+    left: var(--msger-left);
+    height: var(--msger-height);
+    width: var(--msger-width);
+    background: var(--msger-bg);
+}
+
+/*--------------------------------------------------------------
+# Chat room header
+--------------------------------------------------------------*/
+
+.chat-header {
+    display: flex;
+    justify-content: space-between;
+    padding: 10px;
+    background: rgb(0, 0, 0);
+    color: #666;
+    cursor: move;
+}
+
+.chat-header-options button {
+    border: none;
+    font-size: 1.2rem;
+    transition: all 0.3s ease-in-out;
+    background: rgb(0, 0, 0);
+    color: #fff;
+    border-radius: 5px;
+    transition: background 0.23s;
+}
+
+/*--------------------------------------------------------------
+# Chat room output area
+--------------------------------------------------------------*/
+
+.chat-msger {
+    flex: 1;
+    overflow-y: auto;
+    padding: 10px;
+    background: var(--msger-bg);
+}
+
+.chat-msger::-webkit-scrollbar {
+    width: 5px;
+}
+
+.chat-msger::-webkit-scrollbar-track {
+    background: transparent;
+}
+
+.chat-msger::-webkit-scrollbar-thumb {
+    background: black;
+    /*aqua;*/
+}
+
+.msg {
+    display: flex;
+    align-items: flex-end;
+    margin-bottom: 10px;
+}
+
+.msg:last-of-type {
+    margin: 0;
+}
+
+/*--------------------------------------------------------------
+# Chat room left side
+--------------------------------------------------------------*/
+
+.left-msg .msg-bubble {
+    background: var(--left-msg-bg);
+    border-bottom-left-radius: 0;
+    color: #fff;
+}
+
+.left-msg .private-msg-bubble {
+    background: var(--private-msg-bg);
+    border-bottom-left-radius: 0;
+    color: #fff;
+}
+
+/*--------------------------------------------------------------
+# Chat room right side
+--------------------------------------------------------------*/
+
+.right-msg {
+    flex-direction: row-reverse;
+}
+
+.right-msg .msg-bubble {
+    background: var(--right-msg-bg);
+    border-bottom-right-radius: 0;
+    color: #fff;
+}
+
+.right-msg .private-msg-bubble {
+    background: var(--private-msg-bg);
+    border-bottom-right-radius: 0;
+    color: #fff;
+}
+
+.right-msg .msg-img {
+    margin: 0 0 0 10px;
+}
+
+/*--------------------------------------------------------------
+# Chat room common
+--------------------------------------------------------------*/
+
+.msg-img {
+    width: 50px;
+    height: 50px;
+    margin-right: 10px;
+    background-repeat: no-repeat;
+    background-position: center;
+    background-size: cover;
+}
+
+.msg-bubble {
+    max-width: 200px;
+    padding: 15px;
+    border-radius: 15px;
+}
+
+.msg-info {
+    display: flex;
+    justify-content: space-between;
+    align-items: center;
+    margin-bottom: 10px;
+}
+
+.msg-info-name {
+    margin-right: 10px;
+    font-weight: bold;
+}
+
+.msg-info-time {
+    font-size: 0.85em;
+}
+
+.msg-text {
+    overflow-wrap: break-word;
+    word-wrap: break-word;
+    hyphens: auto;
+}
+
+#chat-msg-a {
+    color: white;
+}
+
+/*--------------------------------------------------------------
+# Chat room input area
+--------------------------------------------------------------*/
+
+.chat-msger-inputarea {
+    display: flex;
+    padding: 10px;
+    background: #222328;
+}
+
+.chat-msger-input {
+    flex: 1;
+    padding: 10px;
+    border: none;
+    border-top-left-radius: 10px;
+    background: rgb(0, 0, 0);
+    color: white;
+}
+
+.chat-msger-inputarea button {
+    width: 32px;
+}
+
+/*--------------------------------------------------------------
+# Chat room emoji picker
+--------------------------------------------------------------*/
+
+emoji-picker {
+    top: 0px;
+    position: absolute;
+    width: 100%;
+    height: 100%;
+    --background: #16171b;
+    --num-columns: 9;
+    --emoji-size: 1.5rem;
+    overflow: hidden;
+}
+
+/*--------------------------------------------------------------
+# swal2
+--------------------------------------------------------------*/
+
+.swal2-validation-message,
+.swal2-title,
+.swal2-content,
+.swal2-input {
+    text-align: center;
+    color: white !important;
+    background-color: transparent !important;
+}
+
+/*--------------------------------------------------------------
+# About
+--------------------------------------------------------------*/
+
+#about {
+    cursor: default;
+}
+
+#about b {
+    color: rgb(0, 180, 50);
+}
+
+#about img {
+    cursor: pointer;
+    border-radius: 10px;
+}
+
+#about a {
+    color: white;
+    text-decoration: none;
+}
+
+#about a:hover {
+    color: rgb(0, 180, 50);
+    transition: all 0.3s ease-in-out;
+}
+
+#about button {
+    border: none;
+    width: 170px;
+    height: 40px;
+    font-size: 1.2rem;
+    background: linear-gradient(100deg, #376df9 0, #4b4547 75%, #222222 100%);
+    box-shadow: 0 0 6px 0 rgb(251 255 0 / 82%);
+    color: #ffffff;
+    transition: background 0.23s;
+    cursor: pointer;
+}
+
+#about button:hover {
+    font-weight: bold;
+}
+
+/*--------------------------------------------------------------
+# Common
+--------------------------------------------------------------*/
+
+.hidden {
+    display: none;
+}
+
+.show {
+    display: block;
+}
+
+.center {
+    top: 50%;
+    left: 50%;
+    transform: translate(-50%, -50%);
+}
+
+.fadein {
+    -webkit-animation: fadeIn ease-in 1;
+    -moz-animation: fadeIn ease-in 1;
+    animation: fadeIn ease-in 1;
+    -webkit-animation-fill-mode: forwards;
+    -moz-animation-fill-mode: forwards;
+    animation-fill-mode: forwards;
+    -webkit-animation-duration: 1s;
+    -moz-animation-duration: 1s;
+    animation-duration: 1s;
+}
+
+p,
+button {
+    background: black;
+    color: white;
+    border: none;
+}
+
+button:hover {
+    color: rgb(0, 180, 50);
+}
+
+/*--------------------------------------------------------------
+# Pulse class effect
+--------------------------------------------------------------*/
+
+.pulsate {
+    animation: pulsate 3s ease-out;
+    animation-iteration-count: infinite;
+    -webkit-animation: pulsate 3s ease-out;
+    -webkit-animation-iteration-count: infinite;
+    opacity: 0.5;
+}
+
+@-webkit-keyframes pulsate {
+    0% {
+        opacity: 0.5;
+    }
+    50% {
+        opacity: 1;
+    }
+    100% {
+        opacity: 0.5;
+    }
+}
+
+@keyframes pulsate {
+    0% {
+        opacity: 0.5;
+    }
+    50% {
+        opacity: 1;
+    }
+    100% {
+        opacity: 0.5;
+    }
+}
+
+@-webkit-keyframes pulsate {
+    0% {
+        opacity: 0.5;
+    }
+    50% {
+        opacity: 1;
+    }
+    100% {
+        opacity: 0.5;
+    }
+}
diff --git a/public/css/landing.css b/public/css/landing.css
new file mode 100644
index 00000000..2b418c09
--- /dev/null
+++ b/public/css/landing.css
@@ -0,0 +1,1793 @@
+html {
+    line-height: 1.15;
+    -ms-text-size-adjust: 100%;
+    -webkit-text-size-adjust: 100%;
+}
+body {
+    margin: 0;
+}
+article,
+aside,
+footer,
+header,
+nav,
+section {
+    display: block;
+}
+h1 {
+    font-size: 2em;
+    margin: 0.67em 0;
+}
+figcaption,
+figure,
+main {
+    display: block;
+}
+figure {
+    margin: 1em 40px;
+}
+hr {
+    box-sizing: content-box;
+    height: 0;
+    overflow: visible;
+}
+pre {
+    font-family: monospace, monospace;
+    font-size: 1em;
+}
+a {
+    background-color: transparent;
+    -webkit-text-decoration-skip: objects;
+}
+abbr[title] {
+    border-bottom: none;
+    text-decoration: underline;
+    -webkit-text-decoration: underline dotted;
+    text-decoration: underline dotted;
+}
+b,
+strong {
+    font-weight: inherit;
+}
+b,
+strong {
+    font-weight: bolder;
+}
+code,
+kbd,
+samp {
+    font-family: monospace, monospace;
+    font-size: 1em;
+}
+dfn {
+    font-style: italic;
+}
+mark {
+    background-color: #ff0;
+    color: #000;
+}
+small {
+    font-size: 80%;
+}
+sub,
+sup {
+    font-size: 75%;
+    line-height: 0;
+    position: relative;
+    vertical-align: baseline;
+}
+sub {
+    bottom: -0.25em;
+}
+sup {
+    top: -0.5em;
+}
+audio,
+video {
+    display: inline-block;
+}
+audio:not([controls]) {
+    display: none;
+    height: 0;
+}
+img {
+    border-style: none;
+}
+svg:not(:root) {
+    overflow: hidden;
+}
+button,
+input,
+optgroup,
+select,
+textarea {
+    font-family: sans-serif;
+    font-size: 100%;
+    line-height: 1.15;
+    margin: 0;
+}
+button,
+input {
+    overflow: visible;
+}
+button,
+select {
+    text-transform: none;
+}
+button,
+html [type='button'],
+[type='reset'],
+[type='submit'] {
+    -webkit-appearance: button;
+}
+button::-moz-focus-inner,
+[type='button']::-moz-focus-inner,
+[type='reset']::-moz-focus-inner,
+[type='submit']::-moz-focus-inner {
+    border-style: none;
+    padding: 0;
+}
+button:-moz-focusring,
+[type='button']:-moz-focusring,
+[type='reset']:-moz-focusring,
+[type='submit']:-moz-focusring {
+    outline: 1px dotted ButtonText;
+}
+fieldset {
+    padding: 0.35em 0.75em 0.625em;
+}
+legend {
+    box-sizing: border-box;
+    color: inherit;
+    display: table;
+    max-width: 100%;
+    padding: 0;
+    white-space: normal;
+}
+progress {
+    display: inline-block;
+    vertical-align: baseline;
+}
+textarea {
+    overflow: auto;
+}
+[type='checkbox'],
+[type='radio'] {
+    box-sizing: border-box;
+    padding: 0;
+}
+[type='number']::-webkit-inner-spin-button,
+[type='number']::-webkit-outer-spin-button {
+    height: auto;
+}
+[type='search'] {
+    -webkit-appearance: textfield;
+    outline-offset: -2px;
+}
+[type='search']::-webkit-search-cancel-button,
+[type='search']::-webkit-search-decoration {
+    -webkit-appearance: none;
+}
+::-webkit-file-upload-button {
+    -webkit-appearance: button;
+    font: inherit;
+}
+details,
+menu {
+    display: block;
+}
+summary {
+    display: list-item;
+}
+canvas {
+    display: inline-block;
+}
+template {
+    display: none;
+}
+[hidden] {
+    display: none;
+}
+html {
+    box-sizing: border-box;
+}
+*,
+*:before,
+*:after {
+    box-sizing: inherit;
+}
+body {
+    background: #1d2026;
+    -moz-osx-font-smoothing: grayscale;
+    -webkit-font-smoothing: antialiased;
+}
+hr {
+    border: 0;
+    display: block;
+    height: 1px;
+    background: #242830;
+    margin-top: 24px;
+    margin-bottom: 24px;
+}
+ul,
+ol {
+    margin-top: 0;
+    margin-bottom: 24px;
+    padding-left: 24px;
+}
+ul {
+    list-style: disc;
+}
+ol {
+    list-style: decimal;
+}
+li > ul,
+li > ol {
+    margin-bottom: 0;
+}
+dl {
+    margin-top: 0;
+    margin-bottom: 24px;
+}
+dt {
+    font-weight: 600;
+}
+dd {
+    margin-left: 24px;
+    margin-bottom: 24px;
+}
+img {
+    height: auto;
+    max-width: 100%;
+    vertical-align: middle;
+}
+figure {
+    margin: 24px 0;
+}
+figcaption {
+    font-size: 16px;
+    line-height: 24px;
+    padding: 8px 0;
+}
+img,
+svg {
+    display: block;
+}
+table {
+    border-collapse: collapse;
+    margin-bottom: 24px;
+    width: 100%;
+}
+tr {
+    border-bottom: 1px solid #242830;
+}
+th {
+    text-align: left;
+}
+th,
+td {
+    padding: 10px 16px;
+}
+th:first-child,
+td:first-child {
+    padding-left: 0;
+}
+th:last-child,
+td:last-child {
+    padding-right: 0;
+}
+html {
+    font-size: 20px;
+    line-height: 30px;
+}
+body {
+    color: #8a94a7;
+    font-size: 1rem;
+}
+body,
+button,
+input,
+select,
+textarea {
+    font-family: 'IBM Plex Sans', sans-serif;
+}
+a {
+    color: #8a94a7;
+    text-decoration: underline;
+}
+a:hover,
+a:active {
+    outline: 0;
+    text-decoration: none;
+}
+h1,
+h2,
+h3,
+h4,
+h5,
+h6,
+.h1,
+.h2,
+.h3,
+.h4,
+.h5,
+.h6 {
+    clear: both;
+    color: #fff;
+    font-weight: 600;
+}
+h1,
+.h1 {
+    font-size: 38px;
+    line-height: 48px;
+    letter-spacing: 0px;
+}
+@media (min-width: 641px) {
+    h1,
+    .h1 {
+        font-size: 44px;
+        line-height: 54px;
+        letter-spacing: 0px;
+    }
+}
+h2,
+.h2 {
+    font-size: 32px;
+    line-height: 42px;
+    letter-spacing: 0px;
+}
+@media (min-width: 641px) {
+    h2,
+    .h2 {
+        font-size: 38px;
+        line-height: 48px;
+        letter-spacing: 0px;
+    }
+}
+h3,
+.h3,
+blockquote {
+    font-size: 24px;
+    line-height: 34px;
+    letter-spacing: 0px;
+}
+@media (min-width: 641px) {
+    h3,
+    .h3,
+    blockquote {
+        font-size: 32px;
+        line-height: 42px;
+        letter-spacing: 0px;
+    }
+}
+h4,
+h5,
+h6,
+.h4,
+.h5,
+.h6 {
+    font-size: 20px;
+    line-height: 30px;
+    letter-spacing: -0.1px;
+}
+@media (min-width: 641px) {
+    h4,
+    h5,
+    h6,
+    .h4,
+    .h5,
+    .h6 {
+        font-size: 24px;
+        line-height: 34px;
+        letter-spacing: 0px;
+    }
+}
+@media (max-width: 640px) {
+    .h1-mobile {
+        font-size: 38px;
+        line-height: 48px;
+        letter-spacing: 0px;
+    }
+    .h2-mobile {
+        font-size: 32px;
+        line-height: 42px;
+        letter-spacing: 0px;
+    }
+    .h3-mobile {
+        font-size: 24px;
+        line-height: 34px;
+        letter-spacing: 0px;
+    }
+    .h4-mobile,
+    .h5-mobile,
+    .h6-mobile {
+        font-size: 20px;
+        line-height: 30px;
+        letter-spacing: -0.1px;
+    }
+}
+.text-light h1,
+.text-light h2,
+.text-light h3,
+.text-light h4,
+.text-light h5,
+.text-light h6,
+.text-light .h1,
+.text-light .h2,
+.text-light .h3,
+.text-light .h4,
+.text-light .h5,
+.text-light .h6 {
+    color: !important;
+}
+.text-sm {
+    font-size: 18px;
+    line-height: 28px;
+    letter-spacing: -0.1px;
+}
+.text-xs {
+    font-size: 16px;
+    line-height: 24px;
+    letter-spacing: -0.1px;
+}
+h1,
+h2,
+.h1,
+.h2 {
+    margin-top: 48px;
+    margin-bottom: 16px;
+}
+h3,
+.h3 {
+    margin-top: 36px;
+    margin-bottom: 12px;
+}
+h4,
+h5,
+h6,
+.h4,
+.h5,
+.h6 {
+    margin-top: 24px;
+    margin-bottom: 4px;
+}
+p {
+    margin-top: 0;
+    margin-bottom: 24px;
+}
+dfn,
+cite,
+em,
+i {
+    font-style: italic;
+}
+blockquote {
+    color: #3b404c;
+    font-style: italic;
+    margin-top: 24px;
+    margin-bottom: 24px;
+    margin-left: 24px;
+}
+blockquote::before {
+    content: '\201C';
+}
+blockquote::after {
+    content: '\201D';
+}
+blockquote p {
+    display: inline;
+}
+address {
+    color: #8a94a7;
+    border-width: 1px 0;
+    border-style: solid;
+    border-color: #242830;
+    padding: 24px 0;
+    margin: 0 0 24px;
+}
+pre,
+pre h1,
+pre h2,
+pre h3,
+pre h4,
+pre h5,
+pre h6,
+pre .h1,
+pre .h2,
+pre .h3,
+pre .h4,
+pre .h5,
+pre .h6 {
+    font-family: 'Courier 10 Pitch', Courier, monospace;
+}
+pre,
+code,
+kbd,
+tt,
+var {
+    background: #1d2026;
+}
+pre {
+    font-size: 16px;
+    line-height: 24px;
+    margin-bottom: 1.6em;
+    max-width: 100%;
+    overflow: auto;
+    padding: 24px;
+    margin-top: 24px;
+    margin-bottom: 24px;
+}
+code,
+kbd,
+tt,
+var {
+    font-family: Monaco, Consolas, 'Andale Mono', 'DejaVu Sans Mono', monospace;
+    font-size: 16px;
+    padding: 2px 4px;
+}
+abbr,
+acronym {
+    cursor: help;
+}
+mark,
+ins {
+    text-decoration: none;
+}
+small {
+    font-size: 18px;
+    line-height: 28px;
+    letter-spacing: -0.1px;
+}
+b,
+strong {
+    font-weight: 600;
+}
+button,
+input,
+select,
+textarea,
+label {
+    font-size: 20px;
+    line-height: 30px;
+}
+.container,
+.container-sm {
+    width: 100%;
+    margin: 0 auto;
+    padding-left: 16px;
+    padding-right: 16px;
+}
+@media (min-width: 481px) {
+    .container,
+    .container-sm {
+        padding-left: 24px;
+        padding-right: 24px;
+    }
+}
+.container {
+    max-width: 1128px;
+}
+.container-sm {
+    max-width: 848px;
+}
+.container .container-sm {
+    max-width: 800px;
+    padding-left: 0;
+    padding-right: 0;
+}
+.screen-reader-text {
+    clip: rect(1px, 1px, 1px, 1px);
+    position: absolute !important;
+    height: 1px;
+    width: 1px;
+    overflow: hidden;
+    word-wrap: normal !important;
+}
+.screen-reader-text:focus {
+    border-radius: 2px;
+    box-shadow: 0 0 2px 2px rgba(0, 0, 0, 0.6);
+    clip: auto !important;
+    display: block;
+    font-size: 14px;
+    letter-spacing: 0px;
+    font-weight: 600;
+    line-height: 16px;
+    text-decoration: none;
+    text-transform: uppercase;
+    background-color: #1d2026;
+    color: #0270d7 !important;
+    border: none;
+    height: auto;
+    left: 8px;
+    padding: 16px 32px;
+    top: 8px;
+    width: auto;
+    z-index: 100000;
+}
+.list-reset {
+    list-style: none;
+    padding: 0;
+}
+.text-left {
+    text-align: left;
+}
+.text-center {
+    text-align: center;
+}
+.text-right {
+    text-align: right;
+}
+.text-primary {
+    color: #0270d7;
+}
+.has-top-divider {
+    position: relative;
+}
+.has-top-divider::before {
+    content: '';
+    position: absolute;
+    top: 0;
+    left: 0;
+    width: 100%;
+    display: block;
+    height: 1px;
+    background: #242830;
+}
+.has-bottom-divider {
+    position: relative;
+}
+.has-bottom-divider::after {
+    content: '';
+    position: absolute;
+    bottom: 0;
+    left: 0;
+    width: 100%;
+    display: block;
+    height: 1px;
+    background: #242830;
+}
+.m-0 {
+    margin: 0;
+}
+.mt-0 {
+    margin-top: 0;
+}
+.mr-0 {
+    margin-right: 0;
+}
+.mb-0 {
+    margin-bottom: 0;
+}
+.ml-0 {
+    margin-left: 0;
+}
+.m-8 {
+    margin: 8px;
+}
+.mt-8 {
+    margin-top: 8px;
+}
+.mr-8 {
+    margin-right: 8px;
+}
+.mb-8 {
+    margin-bottom: 8px;
+}
+.ml-8 {
+    margin-left: 8px;
+}
+.m-16 {
+    margin: 16px;
+}
+.mt-16 {
+    margin-top: 16px;
+}
+.mr-16 {
+    margin-right: 16px;
+}
+.mb-16 {
+    margin-bottom: 16px;
+}
+.ml-16 {
+    margin-left: 16px;
+}
+.m-24 {
+    margin: 24px;
+}
+.mt-24 {
+    margin-top: 24px;
+}
+.mr-24 {
+    margin-right: 24px;
+}
+.mb-24 {
+    margin-bottom: 24px;
+}
+.ml-24 {
+    margin-left: 24px;
+}
+.m-32 {
+    margin: 32px;
+}
+.mt-32 {
+    margin-top: 32px;
+}
+.mr-32 {
+    margin-right: 32px;
+}
+.mb-32 {
+    margin-bottom: 32px;
+}
+.ml-32 {
+    margin-left: 32px;
+}
+.m-40 {
+    margin: 40px;
+}
+.mt-40 {
+    margin-top: 40px;
+}
+.mr-40 {
+    margin-right: 40px;
+}
+.mb-40 {
+    margin-bottom: 40px;
+}
+.ml-40 {
+    margin-left: 40px;
+}
+.m-48 {
+    margin: 48px;
+}
+.mt-48 {
+    margin-top: 48px;
+}
+.mr-48 {
+    margin-right: 48px;
+}
+.mb-48 {
+    margin-bottom: 48px;
+}
+.ml-48 {
+    margin-left: 48px;
+}
+.m-56 {
+    margin: 56px;
+}
+.mt-56 {
+    margin-top: 56px;
+}
+.mr-56 {
+    margin-right: 56px;
+}
+.mb-56 {
+    margin-bottom: 56px;
+}
+.ml-56 {
+    margin-left: 56px;
+}
+.m-64 {
+    margin: 64px;
+}
+.mt-64 {
+    margin-top: 64px;
+}
+.mr-64 {
+    margin-right: 64px;
+}
+.mb-64 {
+    margin-bottom: 64px;
+}
+.ml-64 {
+    margin-left: 64px;
+}
+.p-0 {
+    padding: 0;
+}
+.pt-0 {
+    padding-top: 0;
+}
+.pr-0 {
+    padding-right: 0;
+}
+.pb-0 {
+    padding-bottom: 0;
+}
+.pl-0 {
+    padding-left: 0;
+}
+.p-8 {
+    padding: 8px;
+}
+.pt-8 {
+    padding-top: 8px;
+}
+.pr-8 {
+    padding-right: 8px;
+}
+.pb-8 {
+    padding-bottom: 8px;
+}
+.pl-8 {
+    padding-left: 8px;
+}
+.p-16 {
+    padding: 16px;
+}
+.pt-16 {
+    padding-top: 16px;
+}
+.pr-16 {
+    padding-right: 16px;
+}
+.pb-16 {
+    padding-bottom: 16px;
+}
+.pl-16 {
+    padding-left: 16px;
+}
+.p-24 {
+    padding: 24px;
+}
+.pt-24 {
+    padding-top: 24px;
+}
+.pr-24 {
+    padding-right: 24px;
+}
+.pb-24 {
+    padding-bottom: 24px;
+}
+.pl-24 {
+    padding-left: 24px;
+}
+.p-32 {
+    padding: 32px;
+}
+.pt-32 {
+    padding-top: 32px;
+}
+.pr-32 {
+    padding-right: 32px;
+}
+.pb-32 {
+    padding-bottom: 32px;
+}
+.pl-32 {
+    padding-left: 32px;
+}
+.p-40 {
+    padding: 40px;
+}
+.pt-40 {
+    padding-top: 40px;
+}
+.pr-40 {
+    padding-right: 40px;
+}
+.pb-40 {
+    padding-bottom: 40px;
+}
+.pl-40 {
+    padding-left: 40px;
+}
+.p-48 {
+    padding: 48px;
+}
+.pt-48 {
+    padding-top: 48px;
+}
+.pr-48 {
+    padding-right: 48px;
+}
+.pb-48 {
+    padding-bottom: 48px;
+}
+.pl-48 {
+    padding-left: 48px;
+}
+.p-56 {
+    padding: 56px;
+}
+.pt-56 {
+    padding-top: 56px;
+}
+.pr-56 {
+    padding-right: 56px;
+}
+.pb-56 {
+    padding-bottom: 56px;
+}
+.pl-56 {
+    padding-left: 56px;
+}
+.p-64 {
+    padding: 64px;
+}
+.pt-64 {
+    padding-top: 64px;
+}
+.pr-64 {
+    padding-right: 64px;
+}
+.pb-64 {
+    padding-bottom: 64px;
+}
+.pl-64 {
+    padding-left: 64px;
+}
+.sr .has-animations .is-revealing {
+    visibility: hidden;
+}
+.has-animations .anime-element {
+    visibility: hidden;
+}
+.anime-ready .has-animations .anime-element {
+    visibility: visible;
+}
+.input,
+.textarea {
+    background-color: #fff;
+    border-width: 1px;
+    border-style: solid;
+    border-color: #242830;
+    border-radius: 2px;
+    color: #8a94a7;
+    max-width: 100%;
+    width: 100%;
+}
+.input::-webkit-input-placeholder,
+.textarea::-webkit-input-placeholder {
+    color: #3b404c;
+}
+.input:-ms-input-placeholder,
+.textarea:-ms-input-placeholder {
+    color: #3b404c;
+}
+.input::-ms-input-placeholder,
+.textarea::-ms-input-placeholder {
+    color: #3b404c;
+}
+.input::placeholder,
+.textarea::placeholder {
+    color: #3b404c;
+}
+.input::-ms-input-placeholder,
+.textarea::-ms-input-placeholder {
+    color: #3b404c;
+}
+.input:-ms-input-placeholder,
+.textarea:-ms-input-placeholder {
+    color: #3b404c;
+}
+.input:hover,
+.textarea:hover {
+    border-color: #191c21;
+}
+.input:active,
+.input:focus,
+.textarea:active,
+.textarea:focus {
+    outline: none;
+    border-color: #242830;
+}
+.input[disabled],
+.textarea[disabled] {
+    cursor: not-allowed;
+    background-color: #1d2026;
+    border-color: #1d2026;
+}
+.input {
+    -moz-appearance: none;
+    -webkit-appearance: none;
+    font-size: 16px;
+    letter-spacing: -0.1px;
+    line-height: 20px;
+    padding: 13px 16px;
+    height: 48px;
+    box-shadow: none;
+}
+.input .inline-input {
+    display: inline;
+    width: auto;
+}
+.textarea {
+    display: block;
+    min-width: 100%;
+    resize: vertical;
+}
+.textarea .inline-textarea {
+    display: inline;
+    width: auto;
+}
+.field-grouped > .control:not(:last-child) {
+    margin-bottom: 8px;
+}
+@media (min-width: 641px) {
+    .field-grouped {
+        display: flex;
+    }
+    .field-grouped > .control {
+        flex-shrink: 0;
+    }
+    .field-grouped > .control.control-expanded {
+        flex-grow: 1;
+        flex-shrink: 1;
+    }
+    .field-grouped > .control:not(:last-child) {
+        margin-bottom: 0;
+        margin-right: 8px;
+    }
+}
+.button {
+    display: inline-flex;
+    font-size: 14px;
+    letter-spacing: 0px;
+    font-weight: 600;
+    line-height: 16px;
+    text-decoration: none !important;
+    text-transform: uppercase;
+    background-color: #242830;
+    color: #fff !important;
+    border: none;
+    border-radius: 2px;
+    cursor: pointer;
+    justify-content: center;
+    padding: 16px 32px;
+    height: 48px;
+    text-align: center;
+    white-space: nowrap;
+}
+.button:hover {
+    background: #262a33;
+}
+.button:active {
+    outline: 0;
+}
+.button::before {
+    border-radius: 2px;
+}
+.button-sm {
+    padding: 8px 24px;
+    height: 32px;
+}
+.button-primary {
+    background: #097dea;
+    background: linear-gradient(65deg, #0270d7 0, #0f8afd 100%);
+}
+.button-primary:hover {
+    background: #0982f4;
+    background: linear-gradient(65deg, #0275e1 0, #198ffd 100%);
+}
+.button-block {
+    display: flex;
+}
+.button-block {
+    display: flex;
+    width: 100%;
+}
+@media (max-width: 640px) {
+    .button-wide-mobile {
+        width: 100%;
+        max-width: 280px;
+    }
+}
+.site-header {
+    padding: 24px 0;
+}
+.site-header-inner {
+    position: relative;
+    display: flex;
+    justify-content: space-between;
+    align-items: center;
+}
+.header-links {
+    display: inline-flex;
+}
+.header-links li {
+    display: inline-flex;
+}
+.header-links a:not(.button) {
+    font-size: 16px;
+    line-height: 24px;
+    letter-spacing: -0.1px;
+    font-weight: 600;
+    color: #8a94a7;
+    text-transform: uppercase;
+    text-decoration: none;
+    line-height: 16px;
+    padding: 8px 24px;
+}
+@media (min-width: 641px) {
+    .site-header {
+        position: relative;
+    }
+    .site-header::before {
+        content: '';
+        position: absolute;
+        top: 0;
+        left: 0;
+        width: 100%;
+        height: 700px;
+        background: #242830;
+        background: linear-gradient(80deg, rgba(36, 40, 48, 0.5) 0%, rgba(36, 40, 48, 0) 100%);
+        -webkit-transform-origin: 0;
+        transform-origin: 0;
+        -webkit-transform: skewY(-12deg);
+        transform: skewY(-12deg);
+    }
+}
+.hero {
+    text-align: center;
+    padding-top: 48px;
+    padding-bottom: 88px;
+}
+.hero-copy {
+    position: relative;
+    z-index: 1;
+}
+.hero-cta {
+    margin-bottom: 40px;
+}
+.hero-figure {
+    position: relative;
+}
+.hero-figure svg {
+    width: 100%;
+    height: auto;
+}
+.hero-figure::before,
+.hero-figure::after {
+    content: '';
+    position: absolute;
+    background-repeat: no-repeat;
+    background-size: 100%;
+}
+.has-animations .hero-figure::before,
+.has-animations .hero-figure::after {
+    opacity: 0;
+    transition: opacity 2s ease;
+}
+.anime-ready .has-animations .hero-figure::before,
+.anime-ready .has-animations .hero-figure::after {
+    opacity: 1;
+}
+.hero-figure::before {
+    top: -57.8%;
+    left: -1.3%;
+    width: 152.84%;
+    height: 178.78%;
+    background-image: url('../images/hero-back-illustration.svg');
+}
+.hero-figure::after {
+    top: -35.6%;
+    left: 99.6%;
+    width: 57.2%;
+    height: 87.88%;
+    background-image: url('../images/hero-top-illustration.svg');
+}
+.hero-figure-box {
+    position: absolute;
+    top: 0;
+    will-change: transform;
+}
+.hero-figure-box-01,
+.hero-figure-box-02,
+.hero-figure-box-03,
+.hero-figure-box-04,
+.hero-figure-box-08,
+.hero-figure-box-09 {
+    overflow: hidden;
+}
+.hero-figure-box-01::before,
+.hero-figure-box-02::before,
+.hero-figure-box-03::before,
+.hero-figure-box-04::before,
+.hero-figure-box-08::before,
+.hero-figure-box-09::before {
+    content: '';
+    position: absolute;
+    top: 0;
+    bottom: 0;
+    left: 0;
+    right: 0;
+    -webkit-transform-origin: 100% 100%;
+    transform-origin: 100% 100%;
+}
+.hero-figure-box-01 {
+    left: 103.2%;
+    top: 41.9%;
+    width: 28.03%;
+    height: 37.37%;
+    background: linear-gradient(to left top, #00bffb, rgba(0, 191, 251, 0));
+    -webkit-transform: rotateZ(45deg);
+    transform: rotateZ(45deg);
+}
+.hero-figure-box-01::before {
+    background: linear-gradient(to left, #15181d 0%, rgba(21, 24, 29, 0) 60%);
+    -webkit-transform: rotateZ(45deg) scale(1.5);
+    transform: rotateZ(45deg) scale(1.5);
+}
+.hero-figure-box-02 {
+    left: 61.3%;
+    top: 64.1%;
+    width: 37.87%;
+    height: 50.5%;
+    background: linear-gradient(to left top, #0270d7, rgba(2, 112, 215, 0));
+    -webkit-transform: rotateZ(-45deg);
+    transform: rotateZ(-45deg);
+}
+.hero-figure-box-02::before {
+    background: linear-gradient(to top, #15181d 0%, rgba(21, 24, 29, 0) 60%);
+    -webkit-transform: rotateZ(-45deg) scale(1.5);
+    transform: rotateZ(-45deg) scale(1.5);
+}
+.hero-figure-box-03 {
+    left: 87.7%;
+    top: -56.8%;
+    width: 56.81%;
+    height: 75.75%;
+    background: linear-gradient(to left top, #00bffb, rgba(0, 191, 251, 0));
+}
+.hero-figure-box-03::before {
+    background: linear-gradient(to left, #15181d 0%, rgba(21, 24, 29, 0) 60%);
+    -webkit-transform: rotateZ(45deg) scale(1.5);
+    transform: rotateZ(45deg) scale(1.5);
+}
+.hero-figure-box-04 {
+    left: 54.9%;
+    top: -8%;
+    width: 45.45%;
+    height: 60.6%;
+    background: linear-gradient(to left top, #0270d7, rgba(2, 112, 215, 0));
+    -webkit-transform: rotateZ(-135deg);
+    transform: rotateZ(-135deg);
+}
+.hero-figure-box-04::before {
+    background: linear-gradient(to top, rgba(255, 255, 255, 0.24) 0%, rgba(255, 255, 255, 0) 60%);
+    -webkit-transform: rotateZ(-45deg) scale(1.5);
+    transform: rotateZ(-45deg) scale(1.5);
+}
+.hero-figure-box-05,
+.hero-figure-box-06,
+.hero-figure-box-07 {
+    background-color: #242830;
+    box-shadow: -20px 32px 64px rgba(0, 0, 0, 0.25);
+}
+.hero-figure-box-05 {
+    left: 17.4%;
+    top: 13.3%;
+    width: 64%;
+    height: 73.7%;
+    -webkit-transform: perspective(500px) rotateY(-15deg) rotateX(8deg) rotateZ(-1deg);
+    transform: perspective(500px) rotateY(-15deg) rotateX(8deg) rotateZ(-1deg);
+}
+.hero-figure-box-06 {
+    left: 65.5%;
+    top: 6.3%;
+    width: 30.3%;
+    height: 40.4%;
+    -webkit-transform: rotateZ(20deg);
+    transform: rotateZ(20deg);
+}
+.hero-figure-box-07 {
+    left: 1.9%;
+    top: 42.4%;
+    width: 12.12%;
+    height: 16.16%;
+    -webkit-transform: rotateZ(20deg);
+    transform: rotateZ(20deg);
+}
+.hero-figure-box-08 {
+    left: 27.1%;
+    top: 81.6%;
+    width: 19.51%;
+    height: 26.01%;
+    background: #0270d7;
+    -webkit-transform: rotateZ(-22deg);
+    transform: rotateZ(-22deg);
+}
+.hero-figure-box-08::before {
+    background: linear-gradient(to left, rgba(255, 255, 255, 0) 0%, rgba(255, 255, 255, 0.48) 100%);
+    -webkit-transform: rotateZ(45deg) scale(1.5);
+    transform: rotateZ(45deg) scale(1.5);
+}
+.hero-figure-box-09 {
+    left: 42.6%;
+    top: -17.9%;
+    width: 6.63%;
+    height: 8.83%;
+    background: #00bffb;
+    -webkit-transform: rotateZ(-52deg);
+    transform: rotateZ(-52deg);
+}
+.hero-figure-box-09::before {
+    background: linear-gradient(to left, rgba(255, 255, 255, 0) 0%, rgba(255, 255, 255, 0.64) 100%);
+    -webkit-transform: rotateZ(45deg) scale(1.5);
+    transform: rotateZ(45deg) scale(1.5);
+}
+.hero-figure-box-10 {
+    left: -3.8%;
+    top: 4.3%;
+    width: 3.03%;
+    height: 4.04%;
+    background: rgba(0, 191, 251, 0.32);
+    -webkit-transform: rotateZ(-50deg);
+    transform: rotateZ(-50deg);
+}
+@media (max-width: 640px) {
+    .hero-cta {
+        max-width: 280px;
+        margin-left: auto;
+        margin-right: auto;
+    }
+    .hero-cta .button {
+        display: flex;
+    }
+    .hero-cta .button + .button {
+        margin-top: 16px;
+    }
+    .hero-figure::after,
+    .hero-figure-box-03,
+    .hero-figure-box-04,
+    .hero-figure-box-09 {
+        display: none;
+    }
+}
+@media (min-width: 641px) {
+    .hero {
+        text-align: left;
+        padding-top: 64px;
+        padding-bottom: 88px;
+    }
+    .hero-inner {
+        display: flex;
+        justify-content: space-between;
+        align-items: center;
+    }
+    .hero-copy {
+        padding-right: 64px;
+        min-width: 552px;
+        width: 552px;
+    }
+    .hero-cta {
+        margin: 0;
+    }
+    .hero-cta .button {
+        min-width: 170px;
+    }
+    .hero-cta .button:first-child {
+        margin-right: 16px;
+    }
+    .hero-figure svg {
+        width: auto;
+    }
+}
+.features-wrap {
+    display: flex;
+    flex-wrap: wrap;
+    justify-content: space-evenly;
+    margin-right: -32px;
+    margin-left: -32px;
+}
+.features-wrap:first-of-type {
+    margin-top: -16px;
+}
+.features-wrap:last-of-type {
+    margin-bottom: -16px;
+}
+.feature {
+    padding: 16px 32px;
+    width: 380px;
+    max-width: 380px;
+    flex-grow: 1;
+}
+.feature-inner {
+    height: 100%;
+}
+.feature-icon {
+    display: flex;
+    justify-content: center;
+}
+@media (min-width: 641px) {
+    .features-wrap:first-of-type {
+        margin-top: -24px;
+    }
+    .features-wrap:last-of-type {
+        margin-bottom: -24px;
+    }
+    .feature {
+        padding: 32px 32px;
+    }
+}
+.pricing-header {
+    margin-bottom: 48px;
+}
+.pricing-tables-wrap {
+    display: flex;
+    flex-wrap: wrap;
+    justify-content: center;
+    margin-right: -12px;
+    margin-left: -12px;
+}
+.pricing-tables-wrap:first-child {
+    margin-top: -12px;
+}
+.pricing-tables-wrap:last-child {
+    margin-bottom: -12px;
+}
+.pricing-table {
+    position: relative;
+    padding: 12px;
+    width: 368px;
+    max-width: 368px;
+    flex-grow: 1;
+}
+.pricing-table::before {
+    content: '';
+    position: absolute;
+    left: 50%;
+    width: 200%;
+    max-width: 200%;
+    height: 435px;
+    background-repeat: no-repeat;
+    background-position: center;
+    background-size: 100%;
+    bottom: 18.8%;
+    -webkit-transform: translateX(-50%);
+    transform: translateX(-50%);
+    background-image: url('../images/pricing-illustration.svg');
+}
+.pricing-table-header,
+.pricing-table-features-title,
+.pricing-table-features li {
+    border-bottom: 1px solid rgba(138, 148, 167, 0.24);
+}
+.pricing-table-inner {
+    position: relative;
+    display: flex;
+    flex-wrap: wrap;
+    background: #2c3039;
+    padding: 24px;
+    height: 100%;
+}
+.pricing-table-inner > * {
+    position: relative;
+    width: 100%;
+}
+.pricing-table-inner::before {
+    content: '';
+    position: absolute;
+    top: 0;
+    right: 0;
+    bottom: 0;
+    left: 0;
+    box-shadow: 0 24px 48px rgba(21, 24, 29, 0.24);
+    mix-blend-mode: multiply;
+}
+.pricing-table-price-currency {
+    color: #8a94a7;
+}
+.pricing-table-features-title {
+    color: #fff;
+    font-weight: 700;
+}
+.pricing-table-features li {
+    display: flex;
+    align-items: center;
+    padding: 14px 0;
+}
+.pricing-table-features li::before {
+    content: '';
+    width: 16px;
+    height: 12px;
+    margin-right: 16px;
+    background-image: url(data:image/svg+xml;base64,PHN2ZyB3aWR0aD0iMTYiIGhlaWdodD0iMTIiIHhtbG5zPSJodHRwOi8vd3d3LnczLm9yZy8yMDAwL3N2ZyI+PHBhdGggZD0iTTUuNiA2LjRMMS42IDQgMCA1LjYgNS42IDEyIDE2IDEuNiAxNC40IDB6IiBmaWxsPSIjMDJDQkIxIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiLz48L3N2Zz4=);
+    background-repeat: no-repeat;
+}
+.pricing-table-cta {
+    align-self: flex-end;
+}
+@media (min-width: 641px) {
+    .pricing .section-paragraph {
+        padding-left: 90px;
+        padding-right: 90px;
+    }
+    .pricing-header {
+        margin-bottom: 52px;
+    }
+}
+.cta {
+    text-align: center;
+}
+.cta .section-inner {
+    padding: 48px 16px;
+}
+.cta .section-title {
+    margin-bottom: 40px;
+}
+.cta-inner {
+    position: relative;
+    background: #15181d;
+    overflow: hidden;
+}
+.cta-inner::before {
+    content: '';
+    position: absolute;
+    right: 98px;
+    top: -117px;
+    width: 160px;
+    height: 187px;
+    background-image: url('../images/cta-illustration.svg');
+    background-repeat: no-repeat;
+}
+.cta-inner > * {
+    position: relative;
+}
+@media (min-width: 641px) {
+    .cta {
+        text-align: left;
+    }
+    .cta .section-inner {
+        padding: 64px 32px;
+    }
+    .cta .section-title {
+        margin-bottom: 0;
+        padding-right: 24px;
+    }
+    .cta-inner {
+        display: flex;
+        align-items: center;
+        justify-content: space-between;
+    }
+}
+.is-boxed {
+    background: #242830;
+}
+.body-wrap {
+    background: #1d2026;
+    overflow: hidden;
+    display: flex;
+    flex-direction: column;
+    min-height: 100vh;
+}
+.boxed-container {
+    max-width: 1440px;
+    margin: 0 auto;
+    box-shadow: 0 24px 48px rgba(21, 24, 29, 0.24);
+    mix-blend-mode: multiply;
+    mix-blend-mode: normal;
+}
+main {
+    flex: 1 0 auto;
+}
+.section-inner {
+    position: relative;
+    padding-top: 48px;
+    padding-bottom: 48px;
+}
+@media (min-width: 641px) {
+    .section-inner {
+        padding-top: 88px;
+        padding-bottom: 88px;
+    }
+}
+.site-footer {
+    font-size: 14px;
+    line-height: 22px;
+    letter-spacing: 0px;
+}
+.site-footer a {
+    color: #8a94a7;
+    text-decoration: none;
+}
+.site-footer a:hover,
+.site-footer a:active {
+    text-decoration: underline;
+}
+.site-footer-inner {
+    position: relative;
+    display: flex;
+    flex-wrap: wrap;
+    padding-top: 48px;
+    padding-bottom: 48px;
+}
+.footer-brand,
+.footer-links,
+.footer-social-links,
+.footer-copyright {
+    flex: none;
+    width: 100%;
+    display: inline-flex;
+    justify-content: center;
+}
+.footer-brand,
+.footer-links,
+.footer-social-links {
+    margin-bottom: 24px;
+}
+.footer-social-links li {
+    display: inline-flex;
+}
+.footer-social-links li + li {
+    margin-left: 16px;
+}
+.footer-social-links li a {
+    padding: 8px;
+}
+.footer-links li + li {
+    margin-left: 24px;
+}
+@media (min-width: 641px) {
+    .site-footer {
+        margin-top: 20px;
+    }
+    .site-footer-inner {
+        justify-content: space-between;
+        padding-top: 64px;
+        padding-bottom: 64px;
+    }
+    .footer-brand,
+    .footer-links,
+    .footer-social-links,
+    .footer-copyright {
+        flex: 50%;
+    }
+    .footer-brand,
+    .footer-copyright {
+        justify-content: flex-start;
+    }
+    .footer-links,
+    .footer-social-links {
+        justify-content: flex-end;
+    }
+    .footer-links {
+        order: 1;
+        margin-bottom: 0;
+    }
+}
+
+/*Pulse Button*/
+.pulse {
+    box-shadow: 0 0 0 rgba(120, 120, 120, 0.4);
+    animation: pulse 4s infinite;
+}
+.pulse:hover {
+    animation: none;
+}
+
+@-webkit-keyframes pulse {
+    0% {
+        -webkit-box-shadow: 0 0 0 0 rgba(120, 120, 120, 0.4);
+    }
+    70% {
+        -webkit-box-shadow: 0 0 0 15px rgba(120, 120, 120, 0);
+    }
+    100% {
+        -webkit-box-shadow: 0 0 0 0 rgba(120, 120, 120, 0);
+    }
+}
+@keyframes pulse {
+    0% {
+        -moz-box-shadow: 0 0 0 0 rgba(120, 120, 120, 0.4);
+        box-shadow: 0 0 0 0 rgba(120, 120, 120, 0.4);
+    }
+    70% {
+        -moz-box-shadow: 0 0 0 10px rgba(120, 120, 120, 0);
+        box-shadow: 0 0 0 15px rgba(120, 120, 120, 0);
+    }
+    100% {
+        -moz-box-shadow: 0 0 0 0 rgba(120, 120, 120, 0);
+        box-shadow: 0 0 0 0 rgba(120, 120, 120, 0);
+    }
+}
+/*Pulse Button*/
+
+.tiles-wrap {
+    display: flex;
+    flex-wrap: wrap;
+    justify-content: center;
+    margin-right: -12px;
+    margin-left: -12px;
+    margin-top: -12px;
+}
+
+.tiles-wrap:last-of-type {
+    margin-bottom: -12px;
+}
+
+.tiles-wrap:not(:last-of-type) {
+    margin-bottom: 12px;
+}
+
+.tiles-wrap.push-left::after {
+    content: '';
+    flex-basis: 330px;
+    max-width: 330px;
+    box-sizing: content-box;
+    padding-left: 12px;
+    padding-right: 12px;
+    height: 0;
+}
+
+.tiles-item {
+    flex-basis: 330px;
+    max-width: 330px;
+    box-sizing: content-box;
+    padding: 12px;
+}
+
+.tiles-item * {
+    box-sizing: border-box;
+}
+
+.tiles-item-inner {
+    display: flex;
+    flex-wrap: wrap;
+    flex-direction: column;
+    height: 100%;
+    padding: 32px 24px;
+}
+
+@media (min-width: 641px) {
+    .has-animations [class*='reveal-'] {
+        opacity: 0;
+        will-change: opacity, transform;
+    }
+
+    .has-animations .reveal-from-top {
+        transform: translateY(-10px);
+    }
+
+    .has-animations .reveal-from-bottom {
+        transform: translateY(10px);
+    }
+
+    .has-animations .reveal-from-left {
+        transform: translateX(-10px);
+    }
+
+    .has-animations .reveal-from-right {
+        transform: translateX(10px);
+    }
+
+    .has-animations .reveal-scale-up {
+        transform: scale(0.95);
+    }
+
+    .has-animations .reveal-scale-down {
+        transform: scale(1.05);
+    }
+
+    .has-animations .reveal-rotate-from-left {
+        transform: perspective(1000px) rotateY(-45deg);
+    }
+
+    .has-animations .reveal-rotate-from-right {
+        transform: perspective(1000px) rotateY(45deg);
+    }
+
+    .has-animations.is-loaded [class*='reveal-'] {
+        transition: opacity 1s cubic-bezier(0.39, 0.575, 0.565, 1), transform 1s cubic-bezier(0.39, 0.575, 0.565, 1);
+    }
+
+    .has-animations.is-loaded [class*='reveal-'].is-revealed {
+        opacity: 1;
+        transform: translate(0);
+    }
+}
+
+.tiles-item-inner {
+    display: flex;
+    flex-wrap: wrap;
+    flex-direction: column;
+    height: 100%;
+    padding: 32px 24px;
+}
+
+.features-tiles .tiles-item-inner {
+    padding-top: 0;
+    padding-bottom: 0;
+    padding-left: 0;
+    padding-right: 0;
+}
diff --git a/public/images/AGPLv3.png b/public/images/AGPLv3.png
new file mode 100644
index 00000000..9bc4fc07
Binary files /dev/null and b/public/images/AGPLv3.png differ
diff --git a/public/images/architecture.svg b/public/images/architecture.svg
new file mode 100644
index 00000000..30a7023a
--- /dev/null
+++ b/public/images/architecture.svg
@@ -0,0 +1,590 @@
+<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd">
+<svg xmlns="http://www.w3.org/2000/svg"
+	xmlns:xlink="http://www.w3.org/1999/xlink" version="1.1" width="1516px" height="1313px" viewBox="-0.5 -0.5 1516 1313">
+	<defs>
+		<linearGradient x1="0%" y1="0%" x2="0%" y2="100%" id="mx-gradient-e3e3e3-1-9c9c9c-1-s-0">
+			<stop offset="0%" style="stop-color:#E3E3E3"/>
+			<stop offset="100%" style="stop-color:#9C9C9C"/>
+		</linearGradient>
+		<linearGradient x1="0%" y1="0%" x2="0%" y2="100%" id="mx-gradient-ffffff-1-e3e3e3-1-s-0">
+			<stop offset="0%" style="stop-color:#ffffff"/>
+			<stop offset="100%" style="stop-color:#E3E3E3"/>
+		</linearGradient>
+		<linearGradient x1="0%" y1="0%" x2="0%" y2="100%" id="mx-gradient-ea6b66-1-ff3333-1-s-0">
+			<stop offset="0%" style="stop-color:#EA6B66"/>
+			<stop offset="100%" style="stop-color:#FF3333"/>
+		</linearGradient>
+		<linearGradient x1="0%" y1="0%" x2="0%" y2="100%" id="mx-gradient-66cc00-1-4d9900-1-s-0">
+			<stop offset="0%" style="stop-color:#66CC00"/>
+			<stop offset="100%" style="stop-color:#4D9900"/>
+		</linearGradient>
+		<linearGradient x1="0%" y1="0%" x2="0%" y2="100%" id="mx-gradient-70a9ff-1-2e89ff-1-s-0">
+			<stop offset="0%" style="stop-color:#70A9FF"/>
+			<stop offset="100%" style="stop-color:#2E89FF"/>
+		</linearGradient>
+	</defs>
+	<g>
+		<rect x="275" y="21" width="980" height="1240" rx="19.6" ry="19.6" fill="url(#mx-gradient-e3e3e3-1-9c9c9c-1-s-0)" stroke="none" pointer-events="none"/>
+		<g transform="translate(743.5,1270.5)">
+			<switch>
+				<foreignObject style="overflow:visible;" pointer-events="all" width="42" height="22" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+					<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 20px; font-family: Helvetica; color: rgb(120, 120, 120); line-height: 1.2; vertical-align: top; width: 42px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+						<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Host</div>
+					</div>
+				</foreignObject>
+				<text x="21" y="21" fill="#787878" text-anchor="middle" font-size="20px" font-family="Helvetica">Host</text>
+			</switch>
+		</g>
+		<rect x="325" y="71" width="883" height="640" rx="19.2" ry="19.2" fill="url(#mx-gradient-ffffff-1-e3e3e3-1-s-0)" stroke="#616161" stroke-width="2" pointer-events="none"/>
+		<g transform="translate(725.5,721.5)">
+			<switch>
+				<foreignObject style="overflow:visible;" pointer-events="all" width="80" height="22" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+					<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 20px; font-family: Helvetica; color: rgb(97, 97, 97); line-height: 1.2; vertical-align: top; width: 82px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+						<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Worker 1</div>
+					</div>
+				</foreignObject>
+				<text x="40" y="21" fill="#616161" text-anchor="middle" font-size="20px" font-family="Helvetica">Worker 1</text>
+			</switch>
+		</g>
+		<rect x="357.5" y="121" width="150" height="150" rx="22.5" ry="22.5" fill="#ffffff" stroke="#666666" stroke-width="2" stroke-dasharray="2 4" pointer-events="none"/>
+		<g transform="translate(369.5,278.5)">
+			<switch>
+				<foreignObject style="overflow:visible;" pointer-events="all" width="125" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+					<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(102, 102, 102); line-height: 1.2; vertical-align: top; width: 125px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+						<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">WebRtcTransport</div>
+					</div>
+				</foreignObject>
+				<text x="63" y="17" fill="#666666" text-anchor="middle" font-size="16px" font-family="Helvetica">WebRtcTransport</text>
+			</switch>
+		</g>
+		<path d="M 508 196 L 709.76 196" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+		<path d="M 717.76 196 L 709.76 200 L 709.76 192 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+		<path d="M 382.5 136 L 472.5 136 L 472.5 136 L 482.5 151 L 472.5 166 L 472.5 166 L 382.5 166 L 392.5 151 Z" fill="url(#mx-gradient-ea6b66-1-ff3333-1-s-0)" stroke="none" pointer-events="none"/>
+		<g transform="translate(377.5,172.5)">
+			<switch>
+				<foreignObject style="overflow:visible;" pointer-events="all" width="110" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+					<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(255, 51, 51); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+						<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Audio Producer</div>
+					</div>
+				</foreignObject>
+				<text x="55" y="17" fill="#FF3333" text-anchor="middle" font-size="16px" font-family="Helvetica">Audio Producer</text>
+			</switch>
+		</g>
+		<path d="M 382.5 206 L 472.5 206 L 472.5 206 L 482.5 221 L 472.5 236 L 472.5 236 L 382.5 236 L 392.5 221 Z" fill="url(#mx-gradient-ea6b66-1-ff3333-1-s-0)" stroke="none" pointer-events="none"/>
+		<g transform="translate(377.5,242.5)">
+			<switch>
+				<foreignObject style="overflow:visible;" pointer-events="all" width="110" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+					<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(255, 51, 51); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+						<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Video Producer</div>
+					</div>
+				</foreignObject>
+				<text x="55" y="17" fill="#FF3333" text-anchor="middle" font-size="16px" font-family="Helvetica">Video Producer</text>
+			</switch>
+		</g>
+		<path d="M 820 196 L 1004.85 172.3" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+		<path d="M 1012.78 171.28 L 1005.36 176.27 L 1004.34 168.33 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+		<path d="M 820 196 L 1011.57 328.19" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+		<path d="M 1018.16 332.73 L 1009.3 331.48 L 1013.85 324.89 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+		<rect x="357.5" y="366" width="150" height="90" rx="13.5" ry="13.5" fill="#ffffff" stroke="#666666" stroke-width="2" stroke-dasharray="2 4" pointer-events="none"/>
+		<g transform="translate(367.5,463.5)">
+			<switch>
+				<foreignObject style="overflow:visible;" pointer-events="all" width="129" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+					<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(102, 102, 102); line-height: 1.2; vertical-align: top; width: 129px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+						<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">PlainRtpTransport</div>
+					</div>
+				</foreignObject>
+				<text x="65" y="17" fill="#666666" text-anchor="middle" font-size="16px" font-family="Helvetica">PlainRtpTransport</text>
+			</switch>
+		</g>
+		<path d="M 382.5 391 L 472.5 391 L 472.5 391 L 482.5 406 L 472.5 421 L 472.5 421 L 382.5 421 L 392.5 406 Z" fill="url(#mx-gradient-ea6b66-1-ff3333-1-s-0)" stroke="none" pointer-events="none"/>
+		<g transform="translate(377.5,427.5)">
+			<switch>
+				<foreignObject style="overflow:visible;" pointer-events="all" width="110" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+					<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(255, 51, 51); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+						<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Video Producer</div>
+					</div>
+				</foreignObject>
+				<text x="55" y="17" fill="#FF3333" text-anchor="middle" font-size="16px" font-family="Helvetica">Video Producer</text>
+			</switch>
+		</g>
+		<path d="M 483 406 L 709.76 406" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+		<path d="M 717.76 406 L 709.76 410 L 709.76 402 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+		<rect x="555" y="548.5" width="155" height="130" rx="19.5" ry="19.5" fill="#ffffff" stroke="#666666" stroke-width="2" stroke-dasharray="2 4" pointer-events="none"/>
+		<g transform="translate(668.5,613.5)rotate(-90,49.5,0)">
+			<switch>
+				<foreignObject style="overflow:visible;" pointer-events="all" width="99" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+					<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(102, 102, 102); line-height: 1.2; vertical-align: top; width: 101px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+						<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">PipeTransport</div>
+					</div>
+				</foreignObject>
+				<text x="50" y="17" fill="#666666" text-anchor="middle" font-size="16px" font-family="Helvetica">PipeTransport</text>
+			</switch>
+		</g>
+		<path d="M 582 598.5 L 672 598.5 L 672 598.5 L 682 613.5 L 672 628.5 L 672 628.5 L 582 628.5 L 592 613.5 Z" fill="url(#mx-gradient-66cc00-1-4d9900-1-s-0)" stroke="none" transform="rotate(90,632,613.5)" pointer-events="none"/>
+		<g transform="translate(602.5,604.5)rotate(-90,59.5,8.5)">
+			<switch>
+				<foreignObject style="overflow:visible;" pointer-events="all" width="119" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+					<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(77, 153, 0); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+						<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Video Consumer</div>
+					</div>
+				</foreignObject>
+				<text x="60" y="17" fill="#4D9900" text-anchor="middle" font-size="16px" font-family="Helvetica">Video Consumer</text>
+			</switch>
+		</g>
+		<path d="M 770 456 L 641.47 543.25" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+		<path d="M 634.85 547.74 L 639.22 539.94 L 643.72 546.56 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+		<path d="M 114 196 L 347.26 196" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+		<path d="M 355.26 196 L 347.26 200 L 347.26 192 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+		<g fill="#999999" font-family="Helvetica" text-anchor="middle" font-size="14px">
+			<rect fill="#ffffff" stroke="none" x="217" y="189" width="39" height="17" stroke-width="0"/>
+			<text x="235" y="200.5">SRTP</text>
+		</g>
+		<path d="M 1175 171 L 1414.76 169.08" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+		<path d="M 1422.76 169.02 L 1414.8 173.08 L 1414.73 165.08 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+		<g fill="#999999" font-family="Helvetica" text-anchor="middle" font-size="14px">
+			<rect fill="#ffffff" stroke="none" x="1280" y="163" width="39" height="17" stroke-width="0"/>
+			<text x="1299" y="174.5">SRTP</text>
+		</g>
+		<path d="M 89.53 210.86 C 90.09 210.86 90.48 210.64 90.37 210.48 L 89.26 208.86 C 89.12 208.61 88.92 208.57 88.59 208.57 L 81.41 208.57 C 81.06 208.57 80.88 208.62 80.71 208.87 L 79.68 210.47 C 79.48 210.72 80.08 210.86 80.51 210.86 Z M 106.32 205.61 L 106.32 181.96 L 63.65 181.96 L 63.65 205.61 Z M 59 213 C 57.87 212.99 56.85 212.62 56.42 212.03 C 56 211.46 56.17 210.89 56.53 210.5 L 60.66 206.35 L 60.66 181.83 C 60.66 180.6 61.78 179 63.63 179 L 106.33 179 C 107.77 179 109.31 180.14 109.31 181.99 L 109.31 206.35 L 113.48 210.54 C 113.83 210.93 114 211.45 113.58 212.01 C 113.03 212.72 111.99 212.95 111.02 213 Z" fill="#505050" stroke="none" pointer-events="none"/>
+		<g transform="translate(23.5,219.5)">
+			<switch>
+				<foreignObject style="overflow:visible;" pointer-events="all" width="122" height="36" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+					<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(120, 120, 120); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+						<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Participant<br />
+(mic/webcam on)<br />
+					</div>
+				</div>
+			</foreignObject>
+			<text x="61" y="26" fill="#787878" text-anchor="middle" font-size="16px" font-family="Helvetica">Participant&lt;br&gt;(mic/webcam on)&lt;br&gt;</text>
+		</switch>
+	</g>
+	<path d="M 1443.63 187.3 L 1484.45 187.3 L 1484.45 167.14 L 1443.63 167.14 Z M 1442.65 190.29 C 1441.41 190.29 1440.08 189.41 1440.08 188.09 L 1440.08 166.3 C 1440.08 165.24 1441.14 164.15 1442.69 164.15 L 1485.4 164.15 C 1486.96 164.15 1488 165.27 1488 166.29 L 1488 188 C 1488 189.32 1486.89 190.29 1485.27 190.29 L 1469.72 190.29 C 1469.41 191.2 1469.11 192.17 1469.05 192.99 C 1468.92 194.69 1470.19 195.17 1472.47 195.44 C 1473.99 195.6 1475.34 195.63 1476.78 195.66 C 1477.66 195.66 1478.5 196.2 1478.5 197.08 C 1478.5 197.92 1477.78 198.5 1476.8 198.5 L 1451.34 198.5 C 1450.44 198.5 1449.67 197.88 1449.67 197.08 C 1449.67 196.36 1450.34 195.66 1451.34 195.66 C 1453.02 195.61 1454.73 195.61 1456.49 195.32 C 1458.19 195.05 1459.23 194.52 1459.04 192.9 C 1458.97 192.17 1458.67 191.2 1458.36 190.29 Z M 1431.21 151.46 L 1450.73 151.46 L 1450.73 149.22 L 1431.21 149.22 Z M 1425 194.77 L 1425 145.43 C 1425 143.74 1426.81 142.5 1428.4 142.5 L 1453.5 142.5 C 1455.25 142.5 1456.94 143.82 1456.94 145.43 L 1456.94 161.91 L 1442.56 161.91 C 1439.86 161.91 1437.42 164.02 1437.42 166.25 L 1437.42 179.83 L 1431.21 179.83 L 1431.21 182.07 L 1437.42 182.07 L 1437.42 186.55 L 1431.21 186.55 L 1431.21 188.79 L 1437.49 188.79 C 1438 191.15 1440.47 192.53 1442.55 192.53 L 1456.23 192.53 C 1456.23 192.71 1456.33 192.9 1456.32 193.04 C 1455.42 193.29 1453.39 193.42 1451.68 193.42 C 1450.92 193.39 1450.27 193.47 1449.61 193.7 C 1448.96 193.92 1448.39 194.28 1447.9 194.77 Z" fill="#505050" stroke="none" pointer-events="none"/>
+	<g transform="translate(1418.5,205.5)">
+		<switch>
+			<foreignObject style="overflow:visible;" pointer-events="all" width="76" height="36" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+				<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(120, 120, 120); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+					<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Participant<br />
+(viewer)<br />
+				</div>
+			</div>
+		</foreignObject>
+		<text x="38" y="26" fill="#787878" text-anchor="middle" font-size="16px" font-family="Helvetica">[Not supported by viewer]</text>
+	</switch>
+</g>
+<path d="M 1175 334 L 1423.76 334.44" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 1431.76 334.46 L 1423.76 338.44 L 1423.77 330.44 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<g fill="#999999" font-family="Helvetica" text-anchor="middle" font-size="14px">
+	<rect fill="#ffffff" stroke="none" x="1290" y="327" width="30" height="17" stroke-width="0"/>
+	<text x="1304" y="338.73">RTP</text>
+</g>
+<path d="M 1461.13 335.37 C 1461.51 334.99 1461.76 334.05 1461.03 333.31 L 1447.88 320.84 C 1446.97 320.1 1445.62 319.95 1444.53 320.91 C 1443.45 322.03 1443.76 323.6 1444.56 324.37 L 1455.04 334.31 L 1444.68 343.47 C 1443.82 344.27 1443.46 345.56 1444.14 346.7 C 1445.05 348.16 1446.84 348.07 1447.82 347.23 Z M 1468.15 347.92 C 1468.97 347.92 1469.98 347.24 1469.98 346.03 C 1469.98 345.03 1469.22 344.15 1468.13 344.15 L 1457.66 344.15 C 1456.99 344.15 1455.86 344.74 1455.86 345.99 C 1455.86 347.13 1456.74 347.92 1457.69 347.92 Z M 1436.88 357 C 1435.4 357 1434 355.74 1434 354.13 L 1434 314.82 C 1434 313.19 1435.53 312 1436.79 312 L 1476.05 312 C 1477.64 312 1479 313.26 1479 314.91 L 1479 354.11 C 1479 355.9 1477.5 357 1476.21 357 Z" fill="#505050" stroke="none" pointer-events="none"/>
+<g transform="translate(1417.5,363.5)">
+	<switch>
+		<foreignObject style="overflow:visible;" pointer-events="all" width="77" height="36" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+			<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(120, 120, 120); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+				<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">FFmpeg<br />
+(recording)<br />
+			</div>
+		</div>
+	</foreignObject>
+	<text x="39" y="26" fill="#787878" text-anchor="middle" font-size="16px" font-family="Helvetica">[Not supported by viewer]</text>
+</switch>
+</g>
+<path d="M 89.42 411.87 C 89.8 411.49 90.05 410.55 89.32 409.81 L 76.18 397.34 C 75.27 396.6 73.91 396.45 72.82 397.41 C 71.74 398.53 72.05 400.1 72.85 400.87 L 83.33 410.81 L 72.97 419.97 C 72.11 420.77 71.75 422.06 72.43 423.2 C 73.34 424.66 75.14 424.57 76.12 423.73 Z M 96.44 424.42 C 97.27 424.42 98.28 423.74 98.28 422.53 C 98.28 421.53 97.52 420.65 96.42 420.65 L 85.96 420.65 C 85.28 420.65 84.15 421.24 84.15 422.49 C 84.15 423.63 85.03 424.42 85.99 424.42 Z M 65.17 433.5 C 63.7 433.5 62.29 432.24 62.29 430.63 L 62.29 391.32 C 62.29 389.69 63.83 388.5 65.09 388.5 L 104.35 388.5 C 105.93 388.5 107.29 389.76 107.29 391.41 L 107.29 430.61 C 107.29 432.4 105.79 433.5 104.5 433.5 Z" fill="#505050" stroke="none" pointer-events="none"/>
+<g transform="translate(18.5,440.5)">
+<switch>
+	<foreignObject style="overflow:visible;" pointer-events="all" width="131" height="36" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+		<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(120, 120, 120); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+			<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">GStreamer<br />
+(mp4 broadcaster)<br />
+		</div>
+	</div>
+</foreignObject>
+<text x="66" y="26" fill="#787878" text-anchor="middle" font-size="16px" font-family="Helvetica">GStreamer&lt;br&gt;(mp4 broadcaster)&lt;br&gt;</text>
+</switch>
+</g>
+<path d="M 107.29 411 L 347.76 411" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 355.76 411 L 347.76 415 L 347.76 407 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<g fill="#999999" font-family="Helvetica" text-anchor="middle" font-size="14px">
+<rect fill="#ffffff" stroke="none" x="217" y="404" width="30" height="17" stroke-width="0"/>
+<text x="231.29" y="415.5">RTP</text>
+</g>
+<path d="M 780 382 L 794 382 L 794 396 L 800 396 L 800 386 L 820 406 L 800 426 L 800 416 L 794 416 L 794 430 L 780 430 L 780 436 L 790 436 L 770 456 L 750 436 L 760 436 L 760 430 L 746 430 L 746 416 L 740 416 L 740 426 L 720 406 L 740 386 L 740 396 L 746 396 L 746 382 L 760 382 L 760 376 L 750 376 L 770 356 L 790 376 L 780 376 Z" fill="url(#mx-gradient-70a9ff-1-2e89ff-1-s-0)" stroke="none" pointer-events="none"/>
+<g transform="translate(831.5,394.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="77" height="22" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+	<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 20px; font-family: Helvetica; color: rgb(46, 137, 255); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+		<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Router 2</div>
+	</div>
+</foreignObject>
+<text x="39" y="21" fill="#2E89FF" text-anchor="middle" font-size="20px" font-family="Helvetica">Router 2</text>
+</switch>
+</g>
+<path d="M 780 172 L 794 172 L 794 186 L 800 186 L 800 176 L 820 196 L 800 216 L 800 206 L 794 206 L 794 220 L 780 220 L 780 226 L 790 226 L 770 246 L 750 226 L 760 226 L 760 220 L 746 220 L 746 206 L 740 206 L 740 216 L 720 196 L 740 176 L 740 186 L 746 186 L 746 172 L 760 172 L 760 166 L 750 166 L 770 146 L 790 166 L 780 166 Z" fill="url(#mx-gradient-70a9ff-1-2e89ff-1-s-0)" stroke="none" pointer-events="none"/>
+<g transform="translate(731.5,252.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="77" height="22" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+	<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 20px; font-family: Helvetica; color: rgb(46, 137, 255); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+		<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Router 1</div>
+	</div>
+</foreignObject>
+<text x="39" y="21" fill="#2E89FF" text-anchor="middle" font-size="20px" font-family="Helvetica">Router 1</text>
+</switch>
+</g>
+<rect x="325" y="761" width="425" height="450" rx="12.75" ry="12.75" fill="url(#mx-gradient-ffffff-1-e3e3e3-1-s-0)" stroke="#616161" stroke-width="2" pointer-events="none"/>
+<g transform="translate(496.5,1221.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="80" height="22" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+	<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 20px; font-family: Helvetica; color: rgb(97, 97, 97); line-height: 1.2; vertical-align: top; width: 82px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+		<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Worker 2</div>
+	</div>
+</foreignObject>
+<text x="40" y="21" fill="#616161" text-anchor="middle" font-size="20px" font-family="Helvetica">Worker 2</text>
+</switch>
+</g>
+<rect x="819.5" y="548.5" width="155" height="130" rx="19.5" ry="19.5" fill="#ffffff" stroke="#666666" stroke-width="2" stroke-dasharray="2 4" pointer-events="none"/>
+<g transform="translate(932.5,613.5)rotate(-90,49.5,0)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="99" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+	<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(102, 102, 102); line-height: 1.2; vertical-align: top; width: 101px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+		<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">PipeTransport</div>
+	</div>
+</foreignObject>
+<text x="50" y="17" fill="#666666" text-anchor="middle" font-size="16px" font-family="Helvetica">PipeTransport</text>
+</switch>
+</g>
+<path d="M 846.5 598.5 L 936.5 598.5 L 936.5 598.5 L 946.5 613.5 L 936.5 628.5 L 936.5 628.5 L 846.5 628.5 L 856.5 613.5 Z" fill="url(#mx-gradient-66cc00-1-4d9900-1-s-0)" stroke="none" transform="rotate(90,896.5,613.5)" pointer-events="none"/>
+<g transform="translate(866.5,604.5)rotate(-90,59.5,8.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="119" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+	<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(77, 153, 0); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+		<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Video Consumer</div>
+	</div>
+</foreignObject>
+<text x="60" y="17" fill="#4D9900" text-anchor="middle" font-size="16px" font-family="Helvetica">Video Consumer</text>
+</switch>
+</g>
+<path d="M 770 456 L 888.74 542.95" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 895.2 547.68 L 886.38 546.18 L 891.1 539.73 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 642 1022 L 656 1022 L 656 1036 L 662 1036 L 662 1026 L 682 1046 L 662 1066 L 662 1056 L 656 1056 L 656 1070 L 642 1070 L 642 1076 L 652 1076 L 632 1096 L 612 1076 L 622 1076 L 622 1070 L 608 1070 L 608 1056 L 602 1056 L 602 1066 L 582 1046 L 602 1026 L 602 1036 L 608 1036 L 608 1022 L 622 1022 L 622 1016 L 612 1016 L 632 996 L 652 1016 L 642 1016 Z" fill="url(#mx-gradient-70a9ff-1-2e89ff-1-s-0)" stroke="none" pointer-events="none"/>
+<g transform="translate(593.5,1102.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="77" height="22" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+	<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 20px; font-family: Helvetica; color: rgb(46, 137, 255); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+		<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Router 3</div>
+	</div>
+</foreignObject>
+<text x="39" y="21" fill="#2E89FF" text-anchor="middle" font-size="20px" font-family="Helvetica">Router 3</text>
+</switch>
+</g>
+<rect x="554.5" y="791" width="155" height="130" rx="19.5" ry="19.5" fill="#ffffff" stroke="#666666" stroke-width="2" stroke-dasharray="2 4" pointer-events="none"/>
+<g transform="translate(667.5,856.5)rotate(-90,49.5,0)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="99" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+	<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(102, 102, 102); line-height: 1.2; vertical-align: top; width: 101px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+		<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">PipeTransport</div>
+	</div>
+</foreignObject>
+<text x="50" y="17" fill="#666666" text-anchor="middle" font-size="16px" font-family="Helvetica">PipeTransport</text>
+</switch>
+</g>
+<path d="M 582 841 L 672 841 L 672 841 L 682 856 L 672 871 L 672 871 L 582 871 L 592 856 Z" fill="url(#mx-gradient-ea6b66-1-ff3333-1-s-0)" stroke="none" transform="rotate(90,632,856)" pointer-events="none"/>
+<g transform="translate(606.5,847.5)rotate(-90,55,8.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="110" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+	<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(255, 51, 51); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+		<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Video Producer</div>
+	</div>
+</foreignObject>
+<text x="55" y="17" fill="#FF3333" text-anchor="middle" font-size="16px" font-family="Helvetica">Video Producer</text>
+</switch>
+</g>
+<rect x="785" y="761" width="425" height="450" rx="12.75" ry="12.75" fill="url(#mx-gradient-ffffff-1-e3e3e3-1-s-0)" stroke="#616161" stroke-width="2" pointer-events="none"/>
+<g transform="translate(956.5,1221.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="80" height="22" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+	<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 20px; font-family: Helvetica; color: rgb(97, 97, 97); line-height: 1.2; vertical-align: top; width: 82px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+		<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Worker 3</div>
+	</div>
+</foreignObject>
+<text x="40" y="21" fill="#616161" text-anchor="middle" font-size="20px" font-family="Helvetica">Worker 3</text>
+</switch>
+</g>
+<rect x="824.5" y="791" width="150" height="130" rx="19.5" ry="19.5" fill="#ffffff" stroke="#666666" stroke-width="2" stroke-dasharray="2 4" pointer-events="none"/>
+<g transform="translate(932.5,856.5)rotate(-90,49.5,0)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="99" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+	<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(102, 102, 102); line-height: 1.2; vertical-align: top; width: 101px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+		<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">PipeTransport</div>
+	</div>
+</foreignObject>
+<text x="50" y="17" fill="#666666" text-anchor="middle" font-size="16px" font-family="Helvetica">PipeTransport</text>
+</switch>
+</g>
+<path d="M 847 841 L 937 841 L 937 841 L 947 856 L 937 871 L 937 871 L 847 871 L 857 856 Z" fill="url(#mx-gradient-ea6b66-1-ff3333-1-s-0)" stroke="none" transform="rotate(90,897,856)" pointer-events="none"/>
+<g transform="translate(871.5,847.5)rotate(-90,55,8.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="110" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+	<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(255, 51, 51); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+		<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Video Producer</div>
+	</div>
+</foreignObject>
+<text x="55" y="17" fill="#FF3333" text-anchor="middle" font-size="16px" font-family="Helvetica">Video Producer</text>
+</switch>
+</g>
+<path d="M 907.5 1022 L 921.5 1022 L 921.5 1036 L 927.5 1036 L 927.5 1026 L 947.5 1046 L 927.5 1066 L 927.5 1056 L 921.5 1056 L 921.5 1070 L 907.5 1070 L 907.5 1076 L 917.5 1076 L 897.5 1096 L 877.5 1076 L 887.5 1076 L 887.5 1070 L 873.5 1070 L 873.5 1056 L 867.5 1056 L 867.5 1066 L 847.5 1046 L 867.5 1026 L 867.5 1036 L 873.5 1036 L 873.5 1022 L 887.5 1022 L 887.5 1016 L 877.5 1016 L 897.5 996 L 917.5 1016 L 907.5 1016 Z" fill="url(#mx-gradient-70a9ff-1-2e89ff-1-s-0)" stroke="none" pointer-events="none"/>
+<g transform="translate(858.5,1102.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="77" height="22" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+	<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 20px; font-family: Helvetica; color: rgb(46, 137, 255); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+		<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Router 4</div>
+	</div>
+</foreignObject>
+<text x="39" y="21" fill="#2E89FF" text-anchor="middle" font-size="20px" font-family="Helvetica">Router 4</text>
+</switch>
+</g>
+<path d="M 633 679 L 632.09 780.76" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 632.02 788.76 L 628.09 780.73 L 636.09 780.8 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<g fill="#999999" font-family="Helvetica" text-anchor="middle" font-size="14px">
+<rect fill="#ffffff" stroke="none" x="618" y="727" width="30" height="17" stroke-width="0"/>
+<text x="631.5" y="739.5">RTP</text>
+</g>
+<path d="M 897 679 L 899.73 780.77" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 899.94 788.76 L 895.73 780.87 L 903.72 780.66 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<g fill="#999999" font-family="Helvetica" text-anchor="middle" font-size="14px">
+<rect fill="#ffffff" stroke="none" x="883" y="727" width="30" height="17" stroke-width="0"/>
+<text x="897.5" y="739.48">RTP</text>
+</g>
+<path d="M 632 921 L 632 985.76" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 632 993.76 L 628 985.76 L 636 985.76 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 900 921 L 898.27 985.77" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 898.06 993.76 L 894.27 985.66 L 902.27 985.87 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 1443.63 992.8 L 1484.45 992.8 L 1484.45 972.64 L 1443.63 972.64 Z M 1442.65 995.79 C 1441.41 995.79 1440.08 994.91 1440.08 993.59 L 1440.08 971.8 C 1440.08 970.74 1441.14 969.65 1442.69 969.65 L 1485.4 969.65 C 1486.96 969.65 1488 970.77 1488 971.79 L 1488 993.5 C 1488 994.82 1486.89 995.79 1485.27 995.79 L 1469.72 995.79 C 1469.41 996.7 1469.11 997.67 1469.05 998.49 C 1468.92 1000.19 1470.19 1000.67 1472.47 1000.94 C 1473.99 1001.1 1475.34 1001.13 1476.78 1001.16 C 1477.66 1001.16 1478.5 1001.7 1478.5 1002.58 C 1478.5 1003.42 1477.78 1004 1476.8 1004 L 1451.34 1004 C 1450.44 1004 1449.67 1003.38 1449.67 1002.58 C 1449.67 1001.86 1450.34 1001.16 1451.34 1001.16 C 1453.02 1001.11 1454.73 1001.11 1456.49 1000.82 C 1458.19 1000.55 1459.23 1000.02 1459.04 998.4 C 1458.97 997.67 1458.67 996.7 1458.36 995.79 Z M 1431.21 956.96 L 1450.73 956.96 L 1450.73 954.72 L 1431.21 954.72 Z M 1425 1000.27 L 1425 950.93 C 1425 949.24 1426.81 948 1428.4 948 L 1453.5 948 C 1455.25 948 1456.94 949.32 1456.94 950.93 L 1456.94 967.41 L 1442.56 967.41 C 1439.86 967.41 1437.42 969.52 1437.42 971.75 L 1437.42 985.33 L 1431.21 985.33 L 1431.21 987.57 L 1437.42 987.57 L 1437.42 992.05 L 1431.21 992.05 L 1431.21 994.29 L 1437.49 994.29 C 1438 996.65 1440.47 998.03 1442.55 998.03 L 1456.23 998.03 C 1456.23 998.21 1456.33 998.4 1456.32 998.54 C 1455.42 998.79 1453.39 998.92 1451.68 998.92 C 1450.92 998.89 1450.27 998.97 1449.61 999.2 C 1448.96 999.42 1448.39 999.78 1447.9 1000.27 Z" fill="#505050" stroke="none" pointer-events="none"/>
+<g transform="translate(1418.5,1010.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="76" height="36" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+	<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(120, 120, 120); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+		<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Participant<br />
+(viewer)<br />
+	</div>
+</div>
+</foreignObject>
+<text x="38" y="26" fill="#787878" text-anchor="middle" font-size="16px" font-family="Helvetica">[Not supported by viewer]</text>
+</switch>
+</g>
+<path d="M 1459.2 1098.25 C 1459.4 1098.25 1459.52 1098.06 1459.52 1097.85 C 1459.52 1097.67 1459.38 1097.5 1459.21 1097.5 L 1453.89 1097.5 C 1453.7 1097.5 1453.55 1097.63 1453.55 1097.85 C 1453.56 1098.11 1453.72 1098.25 1453.87 1098.25 Z M 1458.87 1134.63 C 1459.23 1134.63 1459.52 1134.37 1459.52 1134.18 L 1459.52 1133.57 C 1459.52 1133.26 1459.17 1133.08 1458.76 1133.08 L 1454.16 1133.08 C 1453.77 1133.08 1453.48 1133.34 1453.48 1133.54 L 1453.48 1134.14 C 1453.48 1134.36 1453.76 1134.63 1454.14 1134.63 Z M 1446.68 1130.92 L 1466.33 1130.92 L 1466.33 1100.47 L 1446.68 1100.47 Z M 1444.5 1100.49 C 1444.5 1098.29 1445.73 1096.39 1447.81 1095.52 C 1451.39 1094.36 1460.92 1094 1465.33 1095.64 C 1467.28 1096.49 1468.5 1098.19 1468.5 1100.54 L 1468.5 1131.73 C 1468.5 1133.34 1467.59 1135.58 1465.47 1136.5 C 1461.54 1137.97 1450.96 1138 1447.54 1136.41 C 1445.52 1135.46 1444.58 1133.7 1444.5 1131.85 Z" fill="#505050" stroke="none" pointer-events="none"/>
+<g transform="translate(1418.5,1144.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="76" height="36" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(120, 120, 120); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+	<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Participant<br style="font-size: 16px" />
+(viewer)<br style="font-size: 16px" />
+</div>
+</div>
+</foreignObject>
+<text x="38" y="26" fill="#787878" text-anchor="middle" font-size="16px" font-family="Helvetica">[Not supported by viewer]</text>
+</switch>
+</g>
+<path d="M 1175 976 L 1414.76 976" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 1422.76 976 L 1414.76 980 L 1414.76 972 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<g fill="#999999" font-family="Helvetica" text-anchor="middle" font-size="14px">
+<rect fill="#ffffff" stroke="none" x="1281" y="969" width="39" height="17" stroke-width="0"/>
+<text x="1299" y="980.5">SRTP</text>
+</g>
+<path d="M 1175 1116 L 1434.26 1116" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 1442.26 1116 L 1434.26 1120 L 1434.26 1112 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<g fill="#999999" font-family="Helvetica" text-anchor="middle" font-size="14px">
+<rect fill="#ffffff" stroke="none" x="1291" y="1109" width="39" height="17" stroke-width="0"/>
+<text x="1309" y="1120.5">SRTP</text>
+</g>
+<path d="M 948 1046 L 1012.66 983.14" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 1018.4 977.56 L 1015.45 986 L 1009.87 980.27 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 948 1046 L 1012.66 1108.86" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 1018.4 1114.44 L 1009.87 1111.73 L 1015.45 1106 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 582 1046 L 517.34 983.14" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 511.6 977.56 L 520.13 980.27 L 514.55 986 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 582 1046 L 517.34 1108.86" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 511.6 1114.44 L 514.55 1106 L 520.13 1111.73 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 355 976 L 124.24 976" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 116.24 976 L 124.24 972 L 124.24 980 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<g fill="#999999" font-family="Helvetica" text-anchor="middle" font-size="14px">
+<rect fill="#ffffff" stroke="none" x="215" y="969" width="39" height="17" stroke-width="0"/>
+<text x="233" y="980.5">SRTP</text>
+</g>
+<path d="M 89.53 992.17 C 90.09 992.17 90.48 991.94 90.37 991.75 L 89.26 990 C 89.12 989.73 88.92 989.67 88.59 989.67 L 81.41 989.67 C 81.06 989.67 80.88 989.74 80.71 990.01 L 79.68 991.74 C 79.48 992.02 80.08 992.17 80.51 992.17 Z M 106.32 986.46 L 106.32 960.72 L 63.65 960.72 L 63.65 986.46 Z M 59 994.5 C 57.87 994.49 56.85 994.08 56.42 993.45 C 56 992.83 56.17 992.2 56.53 991.78 L 60.66 987.26 L 60.66 960.58 C 60.66 959.24 61.78 957.5 63.63 957.5 L 106.33 957.5 C 107.77 957.5 109.31 958.74 109.31 960.75 L 109.31 987.26 L 113.48 991.82 C 113.83 992.25 114 992.82 113.58 993.43 C 113.03 994.2 111.99 994.45 111.02 994.5 Z" fill="#505050" stroke="none" pointer-events="none"/>
+<g transform="translate(46.5,1001.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="76" height="36" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(120, 120, 120); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Participant<br />
+(viewer)<br />
+</div>
+</div>
+</foreignObject>
+<text x="38" y="26" fill="#787878" text-anchor="middle" font-size="16px" font-family="Helvetica">[Not supported by viewer]</text>
+</switch>
+</g>
+<rect x="354.86" y="1071" width="155" height="90" rx="13.5" ry="13.5" fill="#ffffff" stroke="#666666" stroke-width="2" stroke-dasharray="2 4" pointer-events="none"/>
+<g transform="translate(369.5,1168.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="124" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(102, 102, 102); line-height: 1.2; vertical-align: top; width: 126px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">WebRtcTransport</div>
+</div>
+</foreignObject>
+<text x="62" y="17" fill="#666666" text-anchor="middle" font-size="16px" font-family="Helvetica">WebRtcTransport</text>
+</switch>
+</g>
+<path d="M 382.36 1096 L 472.36 1096 L 472.36 1096 L 482.36 1111 L 472.36 1126 L 472.36 1126 L 382.36 1126 L 392.36 1111 Z" fill="url(#mx-gradient-66cc00-1-4d9900-1-s-0)" stroke="none" transform="translate(432.36,0)scale(-1,1)translate(-432.36,0)" pointer-events="none"/>
+<g transform="translate(372.5,1132.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="119" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(77, 153, 0); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Video Consumer</div>
+</div>
+</foreignObject>
+<text x="60" y="17" fill="#4D9900" text-anchor="middle" font-size="16px" font-family="Helvetica">Video Consumer</text>
+</switch>
+</g>
+<rect x="354.86" y="931" width="155" height="90" rx="13.5" ry="13.5" fill="#ffffff" stroke="#666666" stroke-width="2" stroke-dasharray="2 4" pointer-events="none"/>
+<g transform="translate(369.5,1028.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="124" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(102, 102, 102); line-height: 1.2; vertical-align: top; width: 126px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">WebRtcTransport</div>
+</div>
+</foreignObject>
+<text x="62" y="17" fill="#666666" text-anchor="middle" font-size="16px" font-family="Helvetica">WebRtcTransport</text>
+</switch>
+</g>
+<path d="M 382.36 956 L 472.36 956 L 472.36 956 L 482.36 971 L 472.36 986 L 472.36 986 L 382.36 986 L 392.36 971 Z" fill="url(#mx-gradient-66cc00-1-4d9900-1-s-0)" stroke="none" transform="translate(432.36,0)scale(-1,1)translate(-432.36,0)" pointer-events="none"/>
+<g transform="translate(372.5,992.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="119" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(77, 153, 0); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Video Consumer</div>
+</div>
+</foreignObject>
+<text x="60" y="17" fill="#4D9900" text-anchor="middle" font-size="16px" font-family="Helvetica">Video Consumer</text>
+</switch>
+</g>
+<rect x="1019.86" y="931" width="155" height="90" rx="13.5" ry="13.5" fill="#ffffff" stroke="#666666" stroke-width="2" stroke-dasharray="2 4" pointer-events="none"/>
+<g transform="translate(1034.5,1028.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="124" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(102, 102, 102); line-height: 1.2; vertical-align: top; width: 126px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">WebRtcTransport</div>
+</div>
+</foreignObject>
+<text x="62" y="17" fill="#666666" text-anchor="middle" font-size="16px" font-family="Helvetica">WebRtcTransport</text>
+</switch>
+</g>
+<path d="M 1047.36 956 L 1137.36 956 L 1137.36 956 L 1147.36 971 L 1137.36 986 L 1137.36 986 L 1047.36 986 L 1057.36 971 Z" fill="url(#mx-gradient-66cc00-1-4d9900-1-s-0)" stroke="none" pointer-events="none"/>
+<g transform="translate(1037.5,992.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="119" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(77, 153, 0); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Video Consumer</div>
+</div>
+</foreignObject>
+<text x="60" y="17" fill="#4D9900" text-anchor="middle" font-size="16px" font-family="Helvetica">Video Consumer</text>
+</switch>
+</g>
+<rect x="1019.86" y="1071" width="155" height="90" rx="13.5" ry="13.5" fill="#ffffff" stroke="#666666" stroke-width="2" stroke-dasharray="2 4" pointer-events="none"/>
+<g transform="translate(1034.5,1168.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="124" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(102, 102, 102); line-height: 1.2; vertical-align: top; width: 126px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">WebRtcTransport</div>
+</div>
+</foreignObject>
+<text x="62" y="17" fill="#666666" text-anchor="middle" font-size="16px" font-family="Helvetica">WebRtcTransport</text>
+</switch>
+</g>
+<path d="M 1047.36 1096 L 1137.36 1096 L 1137.36 1096 L 1147.36 1111 L 1137.36 1126 L 1137.36 1126 L 1047.36 1126 L 1057.36 1111 Z" fill="url(#mx-gradient-66cc00-1-4d9900-1-s-0)" stroke="none" pointer-events="none"/>
+<g transform="translate(1037.5,1132.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="119" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(77, 153, 0); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Video Consumer</div>
+</div>
+</foreignObject>
+<text x="60" y="17" fill="#4D9900" text-anchor="middle" font-size="16px" font-family="Helvetica">Video Consumer</text>
+</switch>
+</g>
+<path d="M 89.53 1127.17 C 90.09 1127.17 90.48 1126.94 90.37 1126.75 L 89.26 1125 C 89.12 1124.73 88.92 1124.67 88.59 1124.67 L 81.41 1124.67 C 81.06 1124.67 80.88 1124.74 80.71 1125.01 L 79.68 1126.74 C 79.48 1127.02 80.08 1127.17 80.51 1127.17 Z M 106.32 1121.46 L 106.32 1095.72 L 63.65 1095.72 L 63.65 1121.46 Z M 59 1129.5 C 57.87 1129.49 56.85 1129.08 56.42 1128.45 C 56 1127.83 56.17 1127.2 56.53 1126.78 L 60.66 1122.26 L 60.66 1095.58 C 60.66 1094.24 61.78 1092.5 63.63 1092.5 L 106.33 1092.5 C 107.77 1092.5 109.31 1093.74 109.31 1095.75 L 109.31 1122.26 L 113.48 1126.82 C 113.83 1127.25 114 1127.82 113.58 1128.43 C 113.03 1129.2 111.99 1129.45 111.02 1129.5 Z" fill="#505050" stroke="none" pointer-events="none"/>
+<g transform="translate(46.5,1136.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="76" height="36" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(120, 120, 120); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Participant<br />
+(viewer)<br />
+</div>
+</div>
+</foreignObject>
+<text x="38" y="26" fill="#787878" text-anchor="middle" font-size="16px" font-family="Helvetica">[Not supported by viewer]</text>
+</switch>
+</g>
+<path d="M 355 1116 L 119.24 1114.08" fill="none" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<path d="M 111.24 1114.02 L 119.27 1110.08 L 119.2 1118.08 Z" fill="#999999" stroke="#999999" stroke-width="2" stroke-miterlimit="10" pointer-events="none"/>
+<g fill="#999999" font-family="Helvetica" text-anchor="middle" font-size="14px">
+<rect fill="#ffffff" stroke="none" x="213" y="1108" width="39" height="17" stroke-width="0"/>
+<text x="231" y="1119.5">SRTP</text>
+</g>
+<rect x="1015" y="95.5" width="160" height="150" rx="22.5" ry="22.5" fill="#ffffff" stroke="#666666" stroke-width="2" stroke-dasharray="2 4" pointer-events="none"/>
+<g transform="translate(1031.5,253.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="125" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(102, 102, 102); line-height: 1.2; vertical-align: top; width: 125px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">WebRtcTransport</div>
+</div>
+</foreignObject>
+<text x="63" y="17" fill="#666666" text-anchor="middle" font-size="16px" font-family="Helvetica">WebRtcTransport</text>
+</switch>
+</g>
+<path d="M 1045 109 L 1135 109 L 1135 109 L 1145 124 L 1135 139 L 1135 139 L 1045 139 L 1055 124 Z" fill="url(#mx-gradient-66cc00-1-4d9900-1-s-0)" stroke="none" pointer-events="none"/>
+<g transform="translate(1035.5,145.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="119" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(77, 153, 0); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Audio Consumer</div>
+</div>
+</foreignObject>
+<text x="60" y="17" fill="#4D9900" text-anchor="middle" font-size="16px" font-family="Helvetica">Audio Consumer</text>
+</switch>
+</g>
+<path d="M 1045 184 L 1135 184 L 1135 184 L 1145 199 L 1135 214 L 1135 214 L 1045 214 L 1055 199 Z" fill="url(#mx-gradient-66cc00-1-4d9900-1-s-0)" stroke="none" pointer-events="none"/>
+<g transform="translate(1035.5,220.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="119" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(77, 153, 0); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Video Consumer</div>
+</div>
+</foreignObject>
+<text x="60" y="17" fill="#4D9900" text-anchor="middle" font-size="16px" font-family="Helvetica">Video Consumer</text>
+</switch>
+</g>
+<rect x="1020" y="289" width="155" height="90" rx="13.5" ry="13.5" fill="#ffffff" stroke="#666666" stroke-width="2" stroke-dasharray="2 4" pointer-events="none"/>
+<g transform="translate(1032.5,386.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="128" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(102, 102, 102); line-height: 1.2; vertical-align: top; width: 130px; white-space: nowrap; overflow-wrap: normal; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">PlainRtpTransport</div>
+</div>
+</foreignObject>
+<text x="64" y="17" fill="#666666" text-anchor="middle" font-size="16px" font-family="Helvetica">PlainRtpTransport</text>
+</switch>
+</g>
+<path d="M 1047.5 314 L 1137.5 314 L 1137.5 314 L 1147.5 329 L 1137.5 344 L 1137.5 344 L 1047.5 344 L 1057.5 329 Z" fill="url(#mx-gradient-66cc00-1-4d9900-1-s-0)" stroke="none" pointer-events="none"/>
+<g transform="translate(1037.5,350.5)">
+<switch>
+<foreignObject style="overflow:visible;" pointer-events="all" width="119" height="17" requiredFeatures="http://www.w3.org/TR/SVG11/feature#Extensibility">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display: inline-block; font-size: 16px; font-family: Helvetica; color: rgb(77, 153, 0); line-height: 1.2; vertical-align: top; white-space: nowrap; text-align: center;">
+<div xmlns="http://www.w3.org/1999/xhtml" style="display:inline-block;text-align:inherit;text-decoration:inherit;">Audio Consumer</div>
+</div>
+</foreignObject>
+<text x="60" y="17" fill="#4D9900" text-anchor="middle" font-size="16px" font-family="Helvetica">Audio Consumer</text>
+</switch>
+</g>
+</g>
+</svg>
\ No newline at end of file
diff --git a/public/images/background.jpg b/public/images/background.jpg
new file mode 100644
index 00000000..e5a37200
Binary files /dev/null and b/public/images/background.jpg differ
diff --git a/public/images/cta-illustration.svg b/public/images/cta-illustration.svg
new file mode 100644
index 00000000..c46d2f37
--- /dev/null
+++ b/public/images/cta-illustration.svg
@@ -0,0 +1 @@
+<svg width="160" height="187" xmlns="http://www.w3.org/2000/svg"><g fill="#0270D7" fill-rule="evenodd"><path fill-opacity=".24" d="M110.211 0l49.45 89.211-89.21 49.45L21 49.452z"/><path fill-opacity=".16" d="M33.812 171.385l-18.385 15.427L0 168.427 18.385 153z"/></g></svg>
\ No newline at end of file
diff --git a/public/images/delete.png b/public/images/delete.png
new file mode 100644
index 00000000..4d46760e
Binary files /dev/null and b/public/images/delete.png differ
diff --git a/public/images/feature-icon-01.svg b/public/images/feature-icon-01.svg
new file mode 100644
index 00000000..60542994
--- /dev/null
+++ b/public/images/feature-icon-01.svg
@@ -0,0 +1 @@
+<svg width="112" height="100" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink"><defs><filter x="-90%" y="-90%" width="280%" height="280%" filterUnits="objectBoundingBox" id="a"><feGaussianBlur stdDeviation="12" in="SourceGraphic"/></filter><linearGradient x1="99.316%" y1="21.974%" x2="0%" y2="69.777%" id="b"><stop stop-color="#2C3039" offset="0%"/><stop stop-color="#8A94A7" offset="48.131%"/><stop stop-color="#2C3039" offset="100%"/></linearGradient><linearGradient x1="49.892%" y1=".428%" x2="24.856%" y2="100%" id="d"><stop stop-color="#3B404C" offset="0%"/><stop stop-color="#333843" offset="100%"/></linearGradient><path d="M32.833 63.264c-14.9 1.866-25.108-6.384-22.797-18.428 2.31-12.043 16.264-23.319 31.166-25.184C56.103 17.786 66.31 26.036 64 38.08c-2.311 12.043-16.264 23.319-31.167 25.184z" id="c"/></defs><g fill="none" fill-rule="evenodd"><path fill="#0270D7" d="M35.521 6.938L12.04 35.843l48.939 16.136L84.46 23.073z"/><path fill="#02CBB1" d="M20 65.494L35.822 74 36 26.506 20.176 18z"/><g transform="translate(28 31)"><path fill-opacity=".48" fill="#1D2026" filter="url(#a)" d="M1 0h40v40H1z"/><path d="M11.261 54.752l-9.71-18.785C.096 33.152-.389 29.783.327 26.051 2.637 14.01 16.59 2.732 31.492.867 41.776-.42 49.824 3.11 53.065 9.38l9.71 18.785c-3.242-6.27-11.29-9.8-21.573-8.514C26.3 21.518 12.347 32.793 10.036 44.837c-.716 3.732-.23 7.1 1.225 9.915" fill="url(#b)"/><use fill="url(#d)" xlink:href="#c"/></g><path fill="#00BFFB" d="M22.991 85.677l.826-6.614L7.855 84.8l-.825 6.616z"/><path fill-opacity=".32" fill="#00BFFB" d="M106.721 46.737l4.408-2.801-13.699-6.737L93.022 40z"/></g></svg>
\ No newline at end of file
diff --git a/public/images/feature-icon-02.svg b/public/images/feature-icon-02.svg
new file mode 100644
index 00000000..62b11938
--- /dev/null
+++ b/public/images/feature-icon-02.svg
@@ -0,0 +1 @@
+<svg width="108" height="100" xmlns="http://www.w3.org/2000/svg"><defs><filter x="-90%" y="-90%" width="280%" height="280%" filterUnits="objectBoundingBox" id="a"><feGaussianBlur stdDeviation="12" in="SourceGraphic"/></filter><linearGradient x1="17.713%" y1="0%" x2="77.754%" y2="68.424%" id="b"><stop stop-color="#2C3039" offset="0%"/><stop stop-color="#8A94A7" offset="100%"/></linearGradient><linearGradient x1="49.892%" y1=".428%" x2="24.856%" y2="100%" id="c"><stop stop-color="#3B404C" offset="0%"/><stop stop-color="#333843" offset="100%"/></linearGradient></defs><g fill="none" fill-rule="evenodd"><path fill-opacity=".32" fill="#00BFFB" d="M31.292 84.984l1.313-5.055-14.613 4.415-1.313 5.056z"/><path d="M41.203 74.416L.222 46.516l30.541-21.314 23.908 16.277-11.69 10.84-1.706 22-.072.097z" fill="#0270D7"/><path fill="#00BFFB" d="M103.305 14.443l4.556-4.866-16.287-4.74-4.556 4.867z"/><path fill="#02CBB1" d="M56.9 77.244L54.771 92.89 94.416 77.84l2.128-15.648z"/><path fill-opacity=".48" fill="#1D2026" filter="url(#a)" d="M31.778 38.241h40v40h-40z" transform="translate(.222 -2.241)"/><path d="M88.023 31.352a2.962 2.962 0 0 0-1.296-1.359l-29.464-15.06a2.888 2.888 0 0 0-2.634.001L25.147 30.03a2.972 2.972 0 0 0-1.298 1.361l32.078 16.398 32.096-16.436z" fill="url(#b)" fill-rule="nonzero" transform="rotate(31 66.542 55.443)"/><path d="M43.266 11.908a3.154 3.154 0 0 0-.96.977L23.763 43.707c-.586.974-.605 2.174-.048 3.1l16.423 27.335c.228.379.543.693.917.917l20.09-33.39-17.878-29.76z" fill="#2C3039" fill-rule="nonzero"/><path d="M38.935 50.59v38.956a3.04 3.04 0 0 0 1.35-.3L70.47 74.263a2.994 2.994 0 0 0 1.67-2.697V35.608a2.98 2.98 0 0 0-.342-1.33L38.935 50.59z" fill="url(#c)" transform="rotate(31 66.143 86.153)"/></g></svg>
\ No newline at end of file
diff --git a/public/images/feature-icon-03.svg b/public/images/feature-icon-03.svg
new file mode 100644
index 00000000..ab7bbaad
--- /dev/null
+++ b/public/images/feature-icon-03.svg
@@ -0,0 +1 @@
+<svg width="103" height="100" xmlns="http://www.w3.org/2000/svg"><defs><filter x="-90%" y="-90%" width="280%" height="280%" filterUnits="objectBoundingBox" id="a"><feGaussianBlur stdDeviation="12" in="SourceGraphic"/></filter><linearGradient x1="49.892%" y1=".428%" x2="24.856%" y2="100%" id="b"><stop stop-color="#3B404C" offset="0%"/><stop stop-color="#333843" offset="100%"/></linearGradient><linearGradient x1="17.713%" y1="0%" x2="77.754%" y2="68.424%" id="c"><stop stop-color="#2C3039" offset="0%"/><stop stop-color="#8A94A7" offset="100%"/></linearGradient></defs><g fill="none" fill-rule="evenodd"><path d="M48.028 64.452L.086 77.076l3.95-37.033 27.97-7.364c.1 3.076.27 8.387.512 15.934l15.485 15.72.025.119z" fill="#0270D7"/><path fill="#02CBB1" d="M91.767 72.042l2.455-13.396L58.895 70.67 56.44 84.067z"/><path fill="#00BFFB" d="M40.783 98.37l6.378-1.937-11.735-12.248-6.379 1.937z"/><path fill-opacity=".32" fill="#00BFFB" d="M23.783 14.37l6.378-1.937L18.426.185l-6.379 1.937z"/><path fill-opacity=".48" fill="#1D2026" filter="url(#a)" d="M50 43h40v40H50z" transform="translate(-16 -12)"/><path d="M51.759 16.34a.94.94 0 0 1 .922.399l23.35 40.193c.096.151.143.35.143.545-.001.629-.481 1.21-1.067 1.292l-46.872 6.553a.909.909 0 0 1-.527-.081c-.507-.237-.688-.912-.39-1.5L50.84 16.996c.076-.134.183-.262.307-.372.19-.16.403-.255.612-.283" fill="url(#b)" transform="rotate(27 42.978 77.641)"/><path d="M25.338.52c-.01-.006-.022-.01-.033-.017a.893.893 0 0 0-.174-.066c-.01-.002-.022.001-.034-.001a.925.925 0 0 0-.346-.018 1.064 1.064 0 0 0-.315.096l-.004.001c-.06.03-.12.064-.178.105a1.172 1.172 0 0 0-.107.083l-.008.008a1.495 1.495 0 0 0-.295.368L.616 48.344a1.469 1.469 0 0 0-.064.148c-.02.057-.02.113-.033.171-.012.058-.028.116-.033.174-.007.084.002.164.012.246.007.052.006.106.02.156a.99.99 0 0 0 .103.233c.02.037.031.08.056.113a.877.877 0 0 0 .28.25l26.938 14.927a.868.868 0 0 1-.28-.252c-.024-.034-.037-.076-.057-.113-.04-.075-.08-.15-.103-.232-.013-.051-.013-.104-.02-.156-.01-.082-.02-.163-.012-.248.005-.058.021-.115.033-.173.024-.107.046-.216.097-.32L50.78 16.006c.076-.136.18-.265.304-.376.091-.08.19-.142.289-.19a.96.96 0 0 1 .662-.078.95.95 0 0 1 .24.084L25.337.52z" transform="rotate(27 42.028 77.95)" fill="url(#c)" fill-rule="nonzero"/></g></svg>
\ No newline at end of file
diff --git a/public/images/feature-icon-04.svg b/public/images/feature-icon-04.svg
new file mode 100644
index 00000000..1ca34e73
--- /dev/null
+++ b/public/images/feature-icon-04.svg
@@ -0,0 +1 @@
+<svg width="98" height="100" xmlns="http://www.w3.org/2000/svg"><defs><filter x="-90%" y="-90%" width="280%" height="280%" filterUnits="objectBoundingBox" id="a"><feGaussianBlur stdDeviation="12" in="SourceGraphic"/></filter><linearGradient x1="49.892%" y1=".428%" x2="24.856%" y2="100%" id="b"><stop stop-color="#3B404C" offset="0%"/><stop stop-color="#333843" offset="100%"/></linearGradient><linearGradient x1="17.713%" y1="0%" x2="77.754%" y2="68.424%" id="c"><stop stop-color="#2C3039" offset="0%"/><stop stop-color="#8A94A7" offset="100%"/></linearGradient></defs><g fill="none" fill-rule="evenodd"><path d="M49.028 61.452L1.086 74.076l3.95-37.033 27.97-7.364c.1 3.076.27 8.387.512 15.934l15.485 15.72.025.119z" fill="#0270D7"/><path fill-opacity=".32" fill="#00BFFB" d="M23.725 84.328l-5.66 3.52 14.505 8.794 5.66-3.522z"/><path fill="#02CBB1" d="M89.345 72.466l-1.72-15.697L52.8 80.964l1.72 15.698z"/><path fill-opacity=".48" fill="#1D2026" filter="url(#a)" d="M44 41h40v40H44z" transform="translate(-15 -10)"/><path fill="url(#b)" d="M37.841 71.977L0 54.169 37.231 0z" transform="rotate(-36 55.277 18.264)"/><path fill="url(#c)" fill-rule="nonzero" transform="scale(-1 1) rotate(36 .538 -153.515)" d="M73.788 71.977L37.229 54 74.4 0z"/><path fill-opacity=".32" fill="#00BFFB" d="M58.57 10.221l-1.048 5.117 14.362-5.174 1.047-5.118z"/></g></svg>
\ No newline at end of file
diff --git a/public/images/feature-icon-05.svg b/public/images/feature-icon-05.svg
new file mode 100644
index 00000000..43b49046
--- /dev/null
+++ b/public/images/feature-icon-05.svg
@@ -0,0 +1 @@
+<svg width="98" height="100" xmlns="http://www.w3.org/2000/svg"><defs><filter x="-90%" y="-90%" width="280%" height="280%" filterUnits="objectBoundingBox" id="a"><feGaussianBlur stdDeviation="12" in="SourceGraphic"/></filter><linearGradient x1="7.786%" y1="0%" x2="90.938%" y2="49.407%" id="b"><stop stop-color="#2C3039" offset="0%"/><stop stop-color="#8A94A7" offset="100%"/></linearGradient></defs><g fill="none" fill-rule="evenodd"><path fill-opacity=".48" fill="#1D2026" filter="url(#a)" d="M38 48h40v40H38z" transform="translate(-9 -17)"/><path fill="#02CBB1" d="M86.755 88.926l3.46-15.26-39.363 10.387-3.459 15.261z"/><path fill="#0270D7" d="M90.735 53.81l7.137-28.53-77.08 20.354-7.137 28.533z"/><path fill-opacity=".32" fill="#00BFFB" d="M77.35 14.62l6.442-1.712-11.3-12.65-6.443 1.713z"/><path fill="#474C59" d="M46.63 33.718L28.384 61.923l43.659 19.72 18.244-28.206z"/><path fill="#00BFFB" d="M29.746 92.298l3.792-3.59-14.732-4-3.793 3.59z"/><path fill="#2C3039" fill-rule="nonzero" d="M17.685 36.372l10.7 25.55 18.339-28.026L35.015 8.122z"/><path fill="url(#b)" fill-rule="nonzero" d="M49.401 21.254L1.988 27.601l23.588 15.653 47.412-6.346z" transform="rotate(32 52.468 75.451)"/></g></svg>
\ No newline at end of file
diff --git a/public/images/feature-icon-06.svg b/public/images/feature-icon-06.svg
new file mode 100644
index 00000000..3a0c70d7
--- /dev/null
+++ b/public/images/feature-icon-06.svg
@@ -0,0 +1 @@
+<svg width="115" height="100" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink"><defs><filter x="-90%" y="-90%" width="280%" height="280%" filterUnits="objectBoundingBox" id="a"><feGaussianBlur stdDeviation="12" in="SourceGraphic"/></filter><path id="b" d="M0 .856h63.533v59.675H0z"/><linearGradient x1="56.146%" y1="10.87%" x2="25.695%" y2="72.649%" id="c"><stop stop-color="#2C3039" offset="0%"/><stop stop-color="#8A94A7" offset="48.131%"/><stop stop-color="#2C3039" offset="100%"/></linearGradient><path id="e" d="M.062.344h40.511v44.1H.062z"/><linearGradient x1="49.892%" y1=".428%" x2="24.856%" y2="100%" id="f"><stop stop-color="#3B404C" offset="0%"/><stop stop-color="#333843" offset="100%"/></linearGradient></defs><g fill="none" fill-rule="evenodd"><path fill="#0270D7" d="M23.302 63.083L.112 44.995l73.273-31.416 23.19 18.091z"/><path fill="#00BFFB" d="M35.902 83.663l1.17-6.562-16.24 4.895-1.17 6.563z"/><path fill-opacity=".32" fill="#00BFFB" d="M41.972 92.478l-2.962 3.376 11.56 2.714 2.961-3.376z"/><path fill-opacity=".48" fill="#1D2026" filter="url(#a)" d="M36.056 33.707h40v40h-40z" transform="rotate(16 55.276 48.942)"/><g transform="rotate(16 -28.89 116.929)"><mask id="d" fill="#fff"><use xlink:href="#b"/></mask><path d="M32.628 40.394c.06-.485.116-.972.204-1.45.055-.295.135-.583.2-.874.096-.427.181-.856.296-1.276.084-.303.192-.596.286-.894.128-.401.246-.808.393-1.202.05-.141.113-.275.169-.414.195-.5.4-.997.624-1.483.103-.22.214-.434.322-.65a28.007 28.007 0 0 1 2.005-3.412c.07-.1.15-.192.219-.29.448-.622.922-1.222 1.418-1.801.172-.198.347-.391.523-.584.464-.508.946-.993 1.444-1.46.175-.162.343-.334.522-.493.13-.113.263-.22.392-.332a25.56 25.56 0 0 1 1.147-.91c.146-.11.291-.22.44-.325.356-.254.723-.49 1.093-.723.212-.134.42-.276.637-.402.428-.252.868-.48 1.311-.702.157-.08.307-.169.465-.244a22.326 22.326 0 0 1 1.727-.721c.162-.06.326-.111.49-.168.45-.155.905-.293 1.366-.417.178-.047.354-.097.532-.14a20.012 20.012 0 0 1 1.862-.362 18.96 18.96 0 0 1 1.675-.155c.175-.01.347-.008.52-.013.382-.008.76-.008 1.134.005a17.935 17.935 0 0 1 1.654.144c.174.022.347.042.518.07.44.071.874.161 1.301.266.075.019.154.03.229.05.508.132 1.003.29 1.49.467.143.05.28.11.42.166.347.136.691.282 1.025.44.288.135.575.268.852.419L31.118 2.89a18.16 18.16 0 0 0-.619-.319c-.075-.038-.156-.065-.233-.1-.337-.16-.68-.305-1.028-.442-.14-.055-.276-.115-.417-.165-.49-.176-.985-.335-1.493-.466l-.03-.01c-.063-.016-.13-.024-.192-.04-.43-.105-.865-.195-1.307-.267-.17-.027-.344-.047-.518-.07a17.934 17.934 0 0 0-1.654-.144 17.699 17.699 0 0 0-1.133-.004c-.174.004-.346.003-.52.012-.554.03-1.112.076-1.678.155a20.56 20.56 0 0 0-1.86.364c-.178.04-.355.09-.532.139-.46.122-.917.262-1.368.417-.162.055-.326.106-.488.168-.566.209-1.126.436-1.674.694l-.054.027c-.155.074-.304.162-.458.24a22.56 22.56 0 0 0-1.318.705c-.215.127-.421.268-.633.401-.276.174-.558.338-.826.524-.093.064-.181.135-.272.2-.148.106-.293.217-.438.325-.39.291-.77.594-1.145.91-.132.112-.264.219-.394.333-.065.058-.136.11-.2.169-.113.102-.21.22-.32.324-.5.465-.982.952-1.445 1.46-.097.106-.208.197-.303.304-.079.09-.143.19-.22.281a26.06 26.06 0 0 0-1.42 1.8c-.057.08-.125.152-.182.233-.013.018-.023.038-.036.057a26.58 26.58 0 0 0-1.459 2.366c-.047.087-.108.167-.156.253-.138.26-.26.528-.391.792-.107.217-.218.43-.32.65-.225.485-.43.98-.625 1.481-.054.14-.118.276-.17.417l-.029.07c-.135.368-.242.749-.361 1.126-.094.3-.204.594-.287.899-.119.425-.204.859-.3 1.29-.065.287-.143.57-.197.86-.09.484-.145.974-.205 1.463-.03.247-.08.488-.102.734-.07.74-.107 1.485-.108 2.233-.014 7.778 3.736 14.079 9.395 17.158L41.813 60.53c-5.66-3.08-9.41-9.38-9.395-17.156.001-.75.037-1.495.107-2.235.024-.25.072-.496.103-.746" fill="url(#c)" mask="url(#d)"/></g><g transform="rotate(16 -109.581 222.973)"><mask id="g" fill="#fff"><use xlink:href="#e"/></mask><path d="M20.358.531C31.545-1.04 40.595 7.473 40.574 19.548c-.023 12.075-9.11 23.137-20.297 24.71C9.09 45.83.04 37.316.062 25.24.084 13.166 9.172 2.103 20.358.531" fill="url(#f)" mask="url(#g)"/></g><path fill="#02CBB1" d="M114.324 47.62l-10.196-8.59-7.761 33.025 10.197 8.59z"/></g></svg>
\ No newline at end of file
diff --git a/public/images/github.png b/public/images/github.png
new file mode 100644
index 00000000..a689f62e
Binary files /dev/null and b/public/images/github.png differ
diff --git a/public/images/hero-back-illustration.svg b/public/images/hero-back-illustration.svg
new file mode 100644
index 00000000..8f0d1515
--- /dev/null
+++ b/public/images/hero-back-illustration.svg
@@ -0,0 +1 @@
+<svg width="807" height="708" xmlns="http://www.w3.org/2000/svg"><defs><linearGradient x1="73.351%" y1="86.398%" x2="-8.617%" y2="-18.811%" id="a"><stop stop-color="#0270D7" stop-opacity="0" offset="0%"/><stop stop-color="#00BFFB" offset="51.568%"/><stop stop-color="#0270D7" offset="100%"/></linearGradient><linearGradient x1="50%" y1="0%" x2="50%" y2="100%" id="b"><stop stop-color="#FFF" stop-opacity=".32" offset="0%"/><stop stop-color="#0270D7" stop-opacity="0" offset="100%"/></linearGradient><linearGradient x1="0%" y1="0%" y2="88.353%" id="c"><stop stop-color="#00BFFB" offset="0%"/><stop stop-color="#FFF" stop-opacity="0" offset="100%"/></linearGradient></defs><g fill="none" fill-rule="evenodd"><path d="M548.329 331.135c-10.827-5.575-22.39-9.473-34.118-12.358-11.764-2.804-23.737-4.498-35.687-5.502-23.927-2.09-47.793-1.674-71.383-3.41l-8.853-.65-8.833-.895-4.417-.45c-1.47-.163-2.936-.372-4.404-.557l-8.81-1.14c-11.71-1.755-23.406-3.69-34.983-6.237-5.812-1.164-11.563-2.6-17.33-3.971-2.892-.652-5.738-1.49-8.61-2.227-2.86-.781-5.741-1.48-8.582-2.327-5.687-1.681-11.403-3.266-17.034-5.13-2.822-.912-5.66-1.777-8.47-2.728l-8.41-2.904c-2.812-.942-5.593-1.976-8.37-3.017l-8.34-3.107-8.27-3.29-4.135-1.644-4.098-1.735-8.196-3.474-8.122-3.643c-5.436-2.38-10.755-5.018-16.124-7.545-21.341-10.395-42.111-21.953-62.298-34.423-20.131-12.562-39.717-25.988-58.606-40.308-4.697-3.613-9.433-7.175-14.044-10.893l-6.948-5.538-6.862-5.64a343.29 343.29 0 0 1-6.81-5.7l-6.763-5.75-6.67-5.856c-2.225-1.948-4.447-3.901-6.624-5.902-9.988-9.067-11.182-7.79-1.261 1.388 2.167 2.029 4.378 4.01 6.594 5.986l6.638 5.943 6.732 5.837a339.623 339.623 0 0 0 6.778 5.789l6.83 5.729 6.916 5.628c4.59 3.78 9.306 7.402 13.98 11.079 18.81 14.569 38.32 28.26 58.397 41.096 20.135 12.742 40.87 24.585 62.217 35.266 5.37 2.6 10.69 5.309 16.133 7.762l8.132 3.75 8.21 3.582 4.106 1.789 4.145 1.698 8.29 3.397 8.367 3.213c2.788 1.076 5.577 2.146 8.4 3.123l8.446 3.009c2.82.987 5.673 1.885 8.508 2.832 5.659 1.932 11.406 3.587 17.126 5.333 2.857.884 5.759 1.613 8.636 2.426 2.89.77 5.754 1.642 8.666 2.326 5.808 1.43 11.602 2.934 17.46 4.158 11.67 2.67 23.474 4.714 35.3 6.578l8.9 1.214 4.453.598 4.465.482 8.932.964 8.957.712c23.907 1.898 47.776 1.584 71.289 3.7 11.759 1.016 23.409 2.684 34.785 5.4 11.344 2.794 22.466 6.546 32.785 11.845 1.254.623 2.465 1.236 3.602 1.887a7129.6 7129.6 0 0 0 3.335 1.829c2.085 1.273 4.095 2.352 5.838 3.518.89.557 1.745 1.09 2.562 1.6.799.539 1.562 1.05 2.289 1.54l2.097 1.374 1.839 1.287c1.153.812 2.223 1.464 3.102 2.07a29.24 29.24 0 0 0 2.282 1.45c1.283.717 2.084.936 2.366.659.283-.278.048-1.054-.741-2.328a29.382 29.382 0 0 0-1.603-2.284c-.677-.884-1.568-1.81-2.576-2.89-.511-.532-1.05-1.108-1.646-1.685-.617-.553-1.27-1.138-1.954-1.753-.695-.607-1.417-1.258-2.203-1.9-.806-.617-1.648-1.261-2.528-1.932-1.741-1.38-3.78-2.642-5.936-4.068-1.096-.682-2.263-1.334-3.46-2.03-1.188-.71-2.455-1.367-3.773-2.025" fill-opacity=".32" fill="url(#a)" transform="rotate(31 293.468 227.547)"/><path d="M325.998 406.651c9.565 7.539 20.17 13.571 31.134 18.641 11.012 4.997 22.442 8.945 33.981 12.21 23.089 6.618 46.596 10.763 69.421 16.969l8.566 2.326 8.5 2.565 4.25 1.283c1.412.442 2.811.927 4.217 1.388l8.43 2.8c11.16 3.958 22.272 8.089 33.15 12.798 5.484 2.252 10.855 4.759 16.255 7.205 2.714 1.192 5.348 2.556 8.026 3.828 2.658 1.313 5.354 2.548 7.98 3.922 5.263 2.736 10.571 5.382 15.743 8.286 2.596 1.434 5.217 2.825 7.793 4.294l7.701 4.456c2.582 1.461 5.115 3.007 7.642 4.558l7.594 4.642 7.49 4.806 3.745 2.404 3.692 2.485 7.383 4.974 7.277 5.126c4.882 3.373 9.6 6.978 14.388 10.483 18.966 14.276 37.149 29.585 54.586 45.678 17.364 16.172 34.028 33.088 49.838 50.75 3.921 4.442 7.89 8.843 11.707 13.372l5.764 6.762 5.66 6.845a343.29 343.29 0 0 1 5.596 6.894l5.543 6.935 5.429 7.022c1.813 2.337 3.621 4.678 5.377 7.058 8.074 10.806 9.49 9.78 1.502-1.122-1.74-2.405-3.532-4.772-5.33-7.134l-5.382-7.1-5.495-7.015a339.623 339.623 0 0 0-5.549-6.976l-5.611-6.927-5.715-6.844c-3.785-4.586-7.723-9.042-11.61-13.543-15.684-17.89-32.223-35.053-49.482-51.484-17.334-16.35-35.428-31.931-54.345-46.49-4.775-3.576-9.481-7.25-14.355-10.697l-7.267-5.233-7.376-5.082-3.69-2.54-3.744-2.458-7.49-4.916-7.6-4.75c-2.531-1.589-5.065-3.171-7.65-4.67l-7.716-4.564c-2.581-1.507-5.21-2.933-7.812-4.404-5.186-2.976-10.512-5.697-15.793-8.503-2.636-1.412-5.346-2.682-8.015-4.029-2.69-1.307-5.335-2.71-8.063-3.937-5.428-2.513-10.829-5.093-16.347-7.413-10.945-4.847-22.142-9.106-33.396-13.193l-8.505-2.89-4.256-1.436-4.29-1.325-8.585-2.65-8.656-2.409c-23.106-6.425-46.596-10.67-69.274-17.234-11.349-3.241-22.466-7.102-33.115-11.94-10.603-4.906-20.804-10.71-29.923-17.881-1.112-.851-2.184-1.684-3.175-2.54a7129.6 7129.6 0 0 0-2.925-2.432c-1.804-1.647-3.571-3.09-5.06-4.567-.768-.717-1.504-1.404-2.21-2.06-.68-.681-1.332-1.33-1.952-1.948l-1.797-1.749-1.56-1.614c-.976-1.017-1.902-1.861-2.65-2.625a29.24 29.24 0 0 0-1.963-1.858c-1.122-.948-1.867-1.316-2.197-1.098-.33.219-.248 1.025.284 2.426.265.7.644 1.55 1.137 2.548.496.997 1.194 2.075 1.978 3.329.4.62.818 1.288 1.294 1.968l1.583 2.094c.567.728 1.151 1.505 1.8 2.285l2.113 2.379c1.446 1.686 3.206 3.314 5.051 5.126.946.878 1.967 1.741 3.008 2.652 1.032.923 2.15 1.811 3.318 2.708" fill-opacity=".48" fill="#1D2026"/><path d="M279.236 342.842c21.126.122 42.298.388 63.513-.171 21.204-.56 42.464-1.952 63.528-5.152 2.638-.361 5.254-.865 7.877-1.318 2.62-.479 5.253-.885 7.86-1.425 5.207-1.118 10.444-2.105 15.603-3.435 10.382-2.399 20.595-5.457 30.757-8.64l7.567-2.556 3.78-1.288 3.748-1.38 7.493-2.765 7.421-2.952 3.71-1.478 3.673-1.567 7.343-3.135 7.268-3.305 3.633-1.655 3.598-1.73 7.187-3.472 7.115-3.618c4.764-2.372 9.41-4.965 14.108-7.46 9.302-5.16 18.54-10.437 27.578-16.038 18.143-11.088 35.716-23.055 52.924-35.474 34.397-24.886 67.16-51.775 99.673-78.699 9.273-7.68 8.706-8.346-.596-.723-32.704 26.796-65.626 53.476-100.11 78.095-17.25 12.287-34.848 24.107-52.99 35.043-9.036 5.524-18.265 10.724-27.554 15.806-4.69 2.455-9.328 5.01-14.08 7.343l-7.1 3.56-7.168 3.413-3.586 1.701-3.621 1.625-7.243 3.25-7.316 3.078-3.659 1.538-3.693 1.452-7.388 2.895-7.457 2.712-3.73 1.353c-1.245.443-2.506.841-3.759 1.264l-7.527 2.503c-10.102 3.12-20.252 6.11-30.56 8.455-5.124 1.299-10.321 2.264-15.491 3.353-2.586.534-5.2.92-7.8 1.39-2.604.436-5.197.936-7.816 1.284-20.901 3.115-42.04 4.454-63.183 4.986-21.15.53-42.329.255-63.51.15-40.935-.243-40.97 2.912-.02 3.187" fill-opacity=".64" fill="#FFF"/><path d="M317.207 613.49a115.075 115.075 0 0 1-16.962 38.129c-7.896 11.559-17.952 21.637-29.469 29.602a115.153 115.153 0 0 1-38.089 17.168c-13.599 3.384-27.833 4.119-41.737 2.419-13.904-1.707-27.517-5.942-39.873-12.578a116.18 116.18 0 0 1-32.738-26.035c-9.227-10.555-16.526-22.795-21.387-35.95-.219-.597-.428-1.197-.637-1.796.39.2.837.415 1.356.645a30.717 30.717 0 0 0 4.293 1.57c1.751.52 3.8 1.135 6.201 1.56 1.235.237 2.465.505 3.706.715l3.736.543 1.87.266 1.88.178 3.763.354c5.028.26 10.08.417 15.113.042 10.078-.54 20.057-2.56 29.664-5.657 19.17-6.347 36.766-17.59 50.325-32.588 13.672-14.897 23.201-33.44 27.693-53.055 4.476-19.631 3.815-40.355-1.912-59.525a41.554 41.554 0 0 0-.548-1.633c.511.178 1.02.354 1.54.543 13.076 4.82 25.255 12.062 35.776 21.22a116.054 116.054 0 0 1 26.005 32.52c13.275 24.59 17.05 54.148 10.431 81.344m-7.58-82.72a118.994 118.994 0 0 0-26.697-33.5c-10.819-9.436-23.36-16.898-36.837-21.856-6.523-2.376-12.442-3.803-17.542-4.785-5.123-.887-9.434-1.33-12.888-1.46-1.729-.052-3.239-.103-4.534-.092a79.164 79.164 0 0 0-3.236.185c-1.724.143-2.58.319-2.58.517-.002.198.853.419 2.551.648.848.114 1.908.23 3.177.349 1.266.162 2.741.35 4.426.567 3.366.42 7.548 1.1 12.511 2.135 4.283.978 9.161 2.226 14.518 4.049.143.609.34 1.345.607 2.232 5.48 19.112 5.838 39.63 1.168 58.91-4.688 19.27-14.296 37.329-27.837 51.74-13.434 14.52-30.706 25.302-49.42 31.372-9.384 2.954-19.106 4.882-28.924 5.378-4.904.355-9.823.188-14.722-.064l-3.666-.347-1.832-.173-1.823-.26-3.643-.525c-1.209-.203-2.409-.464-3.614-.692-2.337-.41-4.35-.91-6.102-1.25l-4.392-.846c-1.096-.19-1.946-.281-2.568-.291-4.006-12.132-5.96-24.926-5.83-37.7.084-14.028 2.881-28.008 8.013-41.043 5.137-13.04 12.681-25.121 22.118-35.482 9.43-10.372 20.785-18.968 33.276-25.293a115.85 115.85 0 0 1 40.06-11.824l5.22-.45c1.491-.143 2.74-.154 3.737-.241 1.994-.136 2.994-.275 2.992-.388 0-.113-1.003-.201-3.014-.238-1.004 0-2.263-.063-3.768.027-1.504.09-3.26.198-5.263.357a116.958 116.958 0 0 0-40.514 11.792c-12.649 6.344-24.157 14.996-33.74 25.447a117.426 117.426 0 0 0-22.519 35.834c-5.244 13.184-8.14 27.343-8.28 41.565-.2 14.213 2.137 28.48 6.995 41.873 4.878 13.383 12.246 25.854 21.582 36.628A118.335 118.335 0 0 0 150 690.22c12.555 6.815 26.416 11.197 40.594 13.005 14.175 1.804 28.702 1.115 42.618-2.276a117.727 117.727 0 0 0 39.032-17.377 117.543 117.543 0 0 0 30.302-30.18 117.9 117.9 0 0 0 17.556-39.03c6.882-27.88 3.143-58.261-10.474-83.59" fill="url(#b)" transform="rotate(-153 202.226 587.462)"/><path d="M225.208 378.092c-4.67-3.148-10.014-4.876-15.42-5.49-2.708-.347-5.455-.286-8.184-.023l-2.043.265-1.968.38c-.66.114-1.297.303-1.945.453-.648.154-1.292.319-1.922.516-10.215 2.978-18.986 8.399-27.77 12.792-17.4 8.892-37.08 13.095-56.65 12.62-19.566-.574-39.019-5.98-55.849-16.114l-1.59-.925-1.546-.997-3.089-2-2.996-2.136-1.497-1.07-1.449-1.134-2.893-2.277-2.788-2.402c-1.894-1.565-3.6-3.333-5.402-5-3.427-3.508-6.794-7.096-9.772-11-1.57-1.887-2.928-3.934-4.38-5.911-.7-1.007-1.343-2.052-2.017-3.076-.667-1.03-1.35-2.05-1.944-3.122-2.802-4.824-4.37-4.045-1.619.944.58 1.107 1.251 2.16 1.906 3.224.663 1.058 1.294 2.139 1.984 3.18 1.43 2.049 2.77 4.168 4.322 6.132 2.945 4.052 6.287 7.798 9.703 11.47 1.794 1.75 3.5 3.6 5.395 5.25l2.792 2.533 2.901 2.408 1.456 1.199 1.506 1.137 3.017 2.27 3.117 2.136 1.562 1.064 1.608.995c17.017 10.866 37.046 17.04 57.376 18.105 20.32.982 41.065-2.995 59.48-12.082 9.134-4.445 17.706-9.543 26.837-12.118 4.586-1.322 9.074-1.888 13.622-1.34 4.514.507 8.94 1.98 12.568 4.418 3.477 2.383 5.472 4.705 6.934 6.354.776.809 1.31 1.493 1.847 1.917.532.426 1.01.612 1.394.513.384-.1.674-.486.83-1.206.15-.718.223-1.795-.142-3.123a21.669 21.669 0 0 0-.28-1.072c-.11-.378-.298-.737-.47-1.135a36.352 36.352 0 0 0-.596-1.232c-.215-.432-.52-.82-.808-1.254-1.136-1.76-2.906-3.46-5.128-5.036" fill="url(#c)" transform="rotate(-29 117.147 385.807)"/></g></svg>
\ No newline at end of file
diff --git a/public/images/hero-top-illustration.svg b/public/images/hero-top-illustration.svg
new file mode 100644
index 00000000..3eec1021
--- /dev/null
+++ b/public/images/hero-top-illustration.svg
@@ -0,0 +1 @@
+<svg width="302" height="348" xmlns="http://www.w3.org/2000/svg"><defs><linearGradient x1="0%" y1="0%" y2="88.353%" id="a"><stop stop-color="#FFF" offset="0%"/><stop stop-color="#FFF" stop-opacity="0" offset="100%"/></linearGradient></defs><g fill="none" fill-rule="evenodd"><g fill="#FFF"><path d="M76.919 45.44c.294-1.08-.108-1.132-.405-.14a7.215 7.215 0 0 1-.25.611 7.85 7.85 0 0 0 .456-1.368v-.003c.175.033.389-.146.604-.588.11-.223.176-.52.25-.881.034-.362.079-.794.008-1.278-.217-2.003-1.179-3.896-2.65-5.221-1.468-1.335-3.434-2.046-5.399-2.012a8.017 8.017 0 0 0-5.373 2.226c-1.463 1.376-2.391 3.316-2.592 5.318a8.254 8.254 0 0 0 1.488 5.66 7.814 7.814 0 0 0 4.757 3.118c1.884.403 3.906.032 5.559-.97a8.214 8.214 0 0 0 3.547-4.471"/><path d="M48.497 61.03c-.266.979.15 1.034.422.143.067-.185.144-.365.227-.543a6.826 6.826 0 0 0-.412 1.225v.003c-.182-.036-.398.12-.61.517-.108.202-.174.47-.244.798-.033.328-.074.722-.004 1.163a7.612 7.612 0 0 0 2.54 4.775c1.397 1.227 3.257 1.89 5.11 1.874a7.523 7.523 0 0 0 7.448-6.804c.19-1.825-.356-3.702-1.452-5.159a7.55 7.55 0 0 0-4.507-2.867 7.428 7.428 0 0 0-5.223.842 7.323 7.323 0 0 0-3.295 4.032" fill-opacity=".64"/><path d="M34.452 73.065a6.814 6.814 0 0 0 3.06-3.758c.247-.912-.185-.97-.437-.15a5.814 5.814 0 0 1-.208.496c.157-.357.287-.731.378-1.125v-.003c.188.038.409-.101.621-.468.107-.187.176-.437.246-.743.035-.306.076-.674.01-1.086a7.11 7.11 0 0 0-2.372-4.463c-1.305-1.147-3.043-1.766-4.774-1.75a7.067 7.067 0 0 0-4.716 1.856 7.021 7.021 0 0 0-2.237 4.502c-.176 1.705.336 3.456 1.36 4.813a7.038 7.038 0 0 0 4.205 2.67 6.92 6.92 0 0 0 4.864-.791" fill-opacity=".48"/><path d="M15.556 53.978c.21-.78-.209-.836-.423-.144a5.167 5.167 0 0 1-.175.415c.132-.3.241-.616.318-.947v-.003c.182.037.39-.075.588-.387.1-.158.165-.372.23-.634.035-.262.073-.578.017-.932a6.098 6.098 0 0 0-2.035-3.831c-1.12-.985-2.612-1.516-4.097-1.502-1.49.01-2.963.59-4.046 1.595a6.025 6.025 0 0 0-1.914 3.864 5.915 5.915 0 0 0 1.169 4.124 6.017 6.017 0 0 0 3.603 2.28 5.91 5.91 0 0 0 4.158-.683 5.818 5.818 0 0 0 2.607-3.215" fill-opacity=".32"/><path d="M11.076 29.26c.175-.648-.263-.711-.445-.148a3.8 3.8 0 0 1-.148.334c.112-.244.203-.5.265-.77v-.001c.191.04.403-.043.596-.297.181-.257.325-.705.229-1.305-.186-1.232-.886-2.412-1.928-3.252-1.043-.847-2.416-1.32-3.773-1.334-1.362-.019-2.697.441-3.667 1.266A4.671 4.671 0 0 0 .531 26.96c-.107 1.222.324 2.487 1.148 3.474.816.994 2.032 1.705 3.327 1.967 1.297.273 2.669.078 3.769-.502 1.105-.575 1.938-1.535 2.301-2.639" fill-opacity=".24"/><path d="M23.609 8.986c.152-.581-.268-.638-.425-.145-.037.1-.08.196-.126.291.094-.214.172-.438.226-.674v-.001c.182.038.384-.032.567-.259.174-.227.315-.633.247-1.17a4.582 4.582 0 0 0-1.53-2.887 4.63 4.63 0 0 0-3.084-1.13 4.522 4.522 0 0 0-4.473 4.114 4.437 4.437 0 0 0 .887 3.09 4.49 4.49 0 0 0 2.699 1.692 4.394 4.394 0 0 0 3.092-.525 4.313 4.313 0 0 0 1.92-2.396" fill-opacity=".16"/><path d="M48.657 4.656c.115-.449-.277-.502-.398-.135-.012.032-.032.06-.046.093.047-.123.09-.249.12-.38v-.002c.17.037.355-.008.52-.18.157-.172.282-.488.23-.908A3.57 3.57 0 0 0 47.893.89a3.604 3.604 0 0 0-2.406-.88 3.526 3.526 0 0 0-3.48 3.213c-.082.855.18 1.729.695 2.4a3.478 3.478 0 0 0 2.096 1.305c.82.165 1.69.003 2.388-.417a3.326 3.326 0 0 0 1.47-1.855" fill-opacity=".08"/><path d="M63.347 17.009c-.095.381.327.438.428.146.017-.045.044-.085.065-.128a2.285 2.285 0 0 0-.122.362.617.617 0 0 0-.548.127c-.164.141-.291.413-.247.776a3.07 3.07 0 0 0 1.021 1.942c.567.5 1.32.768 2.07.757a3.03 3.03 0 0 0 2.983-2.77 2.954 2.954 0 0 0-.603-2.054 2.953 2.953 0 0 0-1.792-1.104 2.875 2.875 0 0 0-2.025.368 2.812 2.812 0 0 0-1.23 1.578" fill-opacity=".04"/></g><path d="M216.17 38.887c-4.67-3.148-10.015-4.876-15.422-5.49-2.707-.347-5.454-.286-8.183-.023l-2.043.265-1.968.381c-.66.113-1.297.302-1.945.452-.648.154-1.292.32-1.922.516-10.215 2.978-18.986 8.4-27.77 12.792-17.4 8.892-37.08 13.095-56.65 12.621-19.566-.575-39.019-5.98-55.849-16.115l-1.59-.925-1.546-.997-3.089-1.999-2.996-2.137-1.497-1.07-1.449-1.134-2.893-2.277-2.788-2.402c-1.894-1.565-3.6-3.333-5.402-5-3.427-3.508-6.794-7.096-9.772-10.999-1.57-1.888-2.928-3.935-4.38-5.912-.7-1.007-1.343-2.052-2.017-3.076-.667-1.03-1.35-2.049-1.944-3.122-2.802-4.824-4.37-4.045-1.619.944.58 1.107 1.251 2.16 1.906 3.224.663 1.058 1.294 2.14 1.984 3.18 1.43 2.05 2.77 4.168 4.322 6.132 2.945 4.052 6.287 7.798 9.703 11.47 1.794 1.75 3.5 3.6 5.395 5.251l2.792 2.532 2.901 2.408 1.456 1.2 1.506 1.136 3.017 2.271 3.117 2.135 1.562 1.064 1.608.995c17.017 10.866 37.046 17.04 57.376 18.105 20.32.982 41.065-2.995 59.48-12.082 9.134-4.445 17.706-9.543 26.837-12.118 4.586-1.322 9.074-1.888 13.622-1.34 4.514.507 8.94 1.981 12.568 4.418 3.477 2.383 5.472 4.705 6.934 6.354.776.81 1.31 1.493 1.847 1.917.532.426 1.01.612 1.394.513.384-.099.674-.486.83-1.206.15-.718.223-1.795-.142-3.123a21.669 21.669 0 0 0-.28-1.072c-.11-.378-.298-.737-.47-1.135a36.352 36.352 0 0 0-.596-1.232c-.215-.432-.52-.819-.808-1.254-1.136-1.76-2.906-3.459-5.128-5.036" transform="translate(78 282)" fill="url(#a)"/></g></svg>
\ No newline at end of file
diff --git a/public/images/loader.gif b/public/images/loader.gif
new file mode 100644
index 00000000..3f02eac1
Binary files /dev/null and b/public/images/loader.gif differ
diff --git a/public/images/logo.svg b/public/images/logo.svg
new file mode 100644
index 00000000..e2e655cb
--- /dev/null
+++ b/public/images/logo.svg
@@ -0,0 +1 @@
+<svg width="28" height="32" xmlns="http://www.w3.org/2000/svg"><defs><linearGradient x1="50%" y1="0%" x2="50%" y2="100%" id="a"><stop stop-color="#00BFFB" offset="0%"/><stop stop-color="#0270D7" offset="100%"/></linearGradient><linearGradient x1="50%" y1="0%" x2="50%" y2="100%" id="b"><stop stop-color="#1F232A" stop-opacity=".48" offset="0%"/><stop stop-color="#1F2329" stop-opacity="0" offset="100%"/></linearGradient><linearGradient x1="87.665%" y1="103.739%" x2="-3.169%" y2="38.807%" id="c"><stop stop-color="#FFF" stop-opacity="0" offset="0%"/><stop stop-color="#FFF" stop-opacity=".64" offset="100%"/></linearGradient><linearGradient x1="-14.104%" y1="111.262%" x2="109.871%" y2="26.355%" id="d"><stop stop-color="#0270D7" offset="0%"/><stop stop-color="#0270D7" stop-opacity="0" offset="100%"/></linearGradient></defs><g fill="none" fill-rule="evenodd"><path fill="url(#a)" transform="rotate(90 14 16)" d="M6 2l-8 13.999L6 30h16l8-14.001L22 2z"/><path fill="url(#b)" d="M14 0v32L0 24V8z"/><path fill="url(#c)" d="M28 24L0 8l14.001-8L28 8z"/><path fill-opacity=".48" fill="url(#d)" style="mix-blend-mode:multiply" d="M28 8L0 23.978V8l14.001-8L28 8z"/></g></svg>
\ No newline at end of file
diff --git a/public/images/miroslav-pejic.png b/public/images/miroslav-pejic.png
new file mode 100644
index 00000000..5adec6df
Binary files /dev/null and b/public/images/miroslav-pejic.png differ
diff --git a/public/images/mirotalksfu.png b/public/images/mirotalksfu.png
new file mode 100644
index 00000000..1e13d96f
Binary files /dev/null and b/public/images/mirotalksfu.png differ
diff --git a/public/images/pricing-illustration.svg b/public/images/pricing-illustration.svg
new file mode 100644
index 00000000..982f9830
--- /dev/null
+++ b/public/images/pricing-illustration.svg
@@ -0,0 +1 @@
+<svg width="736" height="435" xmlns="http://www.w3.org/2000/svg"><defs><linearGradient x1="0%" y1="0%" y2="88.353%" id="a"><stop stop-color="#00BFFB" offset="0%"/><stop stop-color="#FFF" stop-opacity="0" offset="100%"/></linearGradient><linearGradient x1="15.548%" y1="97.084%" x2="68.572%" y2="10.334%" id="b"><stop stop-color="#0270D7" offset="0%"/><stop stop-color="#FFF" stop-opacity="0" offset="100%"/></linearGradient><linearGradient x1="50%" y1="0%" x2="50%" y2="100%" id="c"><stop stop-color="#FFF" stop-opacity=".32" offset="0%"/><stop stop-color="#0270D7" stop-opacity="0" offset="100%"/></linearGradient><linearGradient x1="89.408%" y1="0%" x2="0%" y2="55.019%" id="d"><stop stop-color="#FFF" stop-opacity="0" offset="0%"/><stop stop-color="#FFF" stop-opacity=".64" offset="100%"/></linearGradient></defs><g fill="none" fill-rule="evenodd"><path d="M602.202 207.8c-4.67-3.148-10.014-4.876-15.421-5.49-2.707-.347-5.454-.286-8.183-.023l-2.043.265-1.968.381c-.661.113-1.297.302-1.945.452-.648.154-1.292.32-1.922.516-10.215 2.978-18.986 8.4-27.77 12.792-17.401 8.892-37.081 13.095-56.651 12.621-19.565-.575-39.018-5.98-55.848-16.115l-1.59-.925-1.546-.997-3.09-1.999-2.995-2.137-1.497-1.07-1.45-1.134-2.892-2.277-2.788-2.402c-1.894-1.565-3.601-3.333-5.402-5-3.427-3.508-6.794-7.096-9.772-10.999-1.571-1.888-2.928-3.935-4.381-5.912-.7-1.007-1.342-2.052-2.016-3.076-.667-1.03-1.351-2.049-1.944-3.122-2.802-4.824-4.37-4.045-1.62.944.58 1.107 1.252 2.16 1.907 3.224.663 1.058 1.294 2.14 1.984 3.18 1.43 2.05 2.769 4.168 4.322 6.132 2.945 4.052 6.287 7.798 9.703 11.47 1.794 1.75 3.5 3.6 5.395 5.251l2.792 2.532 2.9 2.408 1.457 1.2 1.506 1.136 3.017 2.271 3.117 2.135 1.562 1.064 1.608.995c17.017 10.866 37.046 17.04 57.376 18.105 20.32.982 41.065-2.995 59.48-12.082 9.134-4.445 17.706-9.543 26.837-12.118 4.586-1.322 9.074-1.888 13.622-1.34 4.514.507 8.94 1.981 12.568 4.418 3.477 2.383 5.472 4.705 6.934 6.354.776.81 1.31 1.493 1.847 1.917.532.426 1.01.612 1.394.513.384-.099.674-.486.83-1.206.149-.718.223-1.795-.142-3.123a21.669 21.669 0 0 0-.281-1.072c-.11-.378-.297-.737-.47-1.135a36.352 36.352 0 0 0-.595-1.232c-.215-.432-.52-.819-.808-1.254-1.136-1.76-2.906-3.459-5.128-5.036" fill="url(#a)" transform="scale(-1 1) rotate(16 1.413 -3339.98)"/><path d="M560.133 320.272a6.814 6.814 0 0 0-4.35-2.137c-.945-.035-.904.4-.047.46.178.022.354.054.53.092a6.259 6.259 0 0 0-1.182-.116h-.003c-.005-.191-.19-.375-.596-.499-.206-.062-.465-.072-.779-.072-.306.034-.674.077-1.06.233a7.11 7.11 0 0 0-3.815 3.316c-.824 1.53-1.036 3.363-.632 5.045a7.067 7.067 0 0 0 2.87 4.178 7.021 7.021 0 0 0 4.89 1.167c1.7-.212 3.29-1.105 4.384-2.407a7.038 7.038 0 0 0 1.655-4.699 6.92 6.92 0 0 0-1.865-4.561" fill-opacity=".32" fill="#FFF"/><path d="M577.917 276.164c-.464-.011-.428.383-.043.418.034.004.067.018.1.024a2.903 2.903 0 0 0-.397-.031c-.003-.174-.089-.344-.293-.466-.203-.114-.54-.165-.937-.02a3.57 3.57 0 0 0-1.928 1.667 3.604 3.604 0 0 0-.317 2.542 3.526 3.526 0 0 0 3.913 2.668 3.453 3.453 0 0 0 2.183-1.217c.544-.65.83-1.503.8-2.337a3.392 3.392 0 0 0-.943-2.233 3.326 3.326 0 0 0-2.138-1.015" fill-opacity=".08" fill="#FFF"/><path fill-opacity=".16" fill="#00BFFB" d="M109 333.481L136.43 317l16.48 27.43-27.429 16.48z"/><path fill="url(#b)" transform="rotate(61 304.384 203.793)" d="M154.263 54.263h300v300h-300z"/><path d="M629.901 344.354a115.075 115.075 0 0 1-16.962 38.128c-7.896 11.56-17.952 21.637-29.469 29.602a115.153 115.153 0 0 1-38.089 17.168c-13.599 3.384-27.833 4.12-41.737 2.42-13.904-1.708-27.517-5.943-39.873-12.579a116.18 116.18 0 0 1-32.738-26.035c-9.227-10.555-16.526-22.795-21.387-35.95-.219-.597-.428-1.197-.637-1.796.39.2.837.415 1.356.645a30.717 30.717 0 0 0 4.293 1.57c1.751.521 3.8 1.135 6.201 1.561 1.235.236 2.465.504 3.706.714l3.736.543 1.87.266 1.88.178 3.763.354c5.028.26 10.08.417 15.113.042 10.078-.539 20.057-2.559 29.664-5.657 19.17-6.347 36.766-17.589 50.325-32.588 13.672-14.897 23.201-33.44 27.693-53.055 4.476-19.63 3.815-40.355-1.912-59.525a41.554 41.554 0 0 0-.548-1.633c.511.178 1.02.354 1.54.543 13.076 4.821 25.255 12.062 35.776 21.22a116.054 116.054 0 0 1 26.005 32.521c13.275 24.59 17.05 54.147 10.431 81.343m-7.58-82.719a118.994 118.994 0 0 0-26.697-33.5c-10.819-9.437-23.36-16.899-36.837-21.857-6.523-2.376-12.442-3.803-17.542-4.785-5.123-.887-9.434-1.33-12.888-1.46-1.729-.052-3.239-.103-4.534-.092a79.164 79.164 0 0 0-3.236.185c-1.724.143-2.58.32-2.58.517-.002.198.853.42 2.551.648.848.114 1.908.231 3.177.35l4.426.566c3.366.42 7.548 1.101 12.511 2.135 4.283.978 9.161 2.226 14.518 4.05.143.608.34 1.344.607 2.231 5.48 19.112 5.838 39.631 1.168 58.91-4.688 19.271-14.296 37.33-27.837 51.741-13.434 14.52-30.706 25.301-49.42 31.371-9.384 2.954-19.106 4.882-28.924 5.378-4.904.355-9.823.188-14.722-.064l-3.666-.347-1.832-.173-1.823-.259-3.643-.526c-1.209-.203-2.409-.464-3.614-.692-2.337-.409-4.35-.909-6.102-1.25l-4.392-.846c-1.096-.189-1.946-.28-2.568-.29-4.006-12.133-5.96-24.927-5.83-37.7.084-14.029 2.881-28.009 8.013-41.044 5.137-13.04 12.681-25.12 22.118-35.482 9.43-10.372 20.785-18.968 33.276-25.293a115.85 115.85 0 0 1 40.06-11.824c1.988-.17 3.73-.32 5.22-.45 1.491-.143 2.74-.154 3.737-.24 1.994-.137 2.994-.276 2.992-.389 0-.113-1.003-.2-3.014-.238-1.004 0-2.263-.063-3.768.027-1.504.09-3.26.198-5.263.357a116.958 116.958 0 0 0-40.514 11.792c-12.649 6.344-24.157 14.996-33.74 25.447a117.426 117.426 0 0 0-22.519 35.834c-5.244 13.184-8.14 27.343-8.28 41.565-.2 14.213 2.137 28.48 6.995 41.873 4.878 13.383 12.246 25.854 21.582 36.628a118.335 118.335 0 0 0 33.206 26.644c12.555 6.815 26.416 11.197 40.594 13.005 14.175 1.804 28.702 1.115 42.618-2.276a117.727 117.727 0 0 0 39.032-17.377 117.543 117.543 0 0 0 30.302-30.18 117.9 117.9 0 0 0 17.556-39.03c6.882-27.88 3.143-58.26-10.474-83.59" fill="url(#c)" transform="rotate(-153 518.316 317.366)"/><path fill-opacity=".72" fill="#00BFFB" d="M579.572 284.286l-27.536-20.75L572.786 236l27.536 20.75z"/><path fill="url(#d)" transform="rotate(-143 340.003 49.99)" d="M7.599 6.893h34.479L7.598 41.37z"/></g></svg>
\ No newline at end of file
diff --git a/public/js/Room.js b/public/js/Room.js
new file mode 100644
index 00000000..eee54652
--- /dev/null
+++ b/public/js/Room.js
@@ -0,0 +1,734 @@
+'use strict';
+
+if (location.href.substr(0, 5) !== 'https') location.href = 'https' + location.href.substr(4, location.href.length - 4);
+
+const RoomURL = window.location.href;
+
+const swalBackground = 'rgba(0, 0, 0, 0.7)';
+const swalImageUrl = '../images/pricing-illustration.svg';
+
+const url = {
+    ipLookup: 'https://extreme-ip-lookup.com/json/',
+};
+
+let rc = null;
+let producer = null;
+
+let peer_name = 'peer_' + getRandomNumber(5);
+let peer_geo = null;
+let peer_info = null;
+
+let room_id = location.pathname.substring(6);
+let isEnumerateDevices = false;
+
+let isAudioAllowed = false;
+let isVideoAllowed = false;
+let isAudioOn = true;
+let isVideoOn = true;
+
+let recTimer = null;
+let recElapsedTime = null;
+
+const socket = io();
+
+function getRandomNumber(length) {
+    let result = '';
+    let characters = '0123456789';
+    let charactersLength = characters.length;
+    for (let i = 0; i < length; i++) {
+        result += characters.charAt(Math.floor(Math.random() * charactersLength));
+    }
+    return result;
+}
+
+function initClient() {
+    if (!DetectRTC.isMobileDevice) {
+        setTippy('sessionTime', 'Session time', 'bottom');
+        setTippy('exitButton', 'Exit room', 'bottom');
+        setTippy('shareButton', 'Share Room', 'bottom');
+        setTippy('devicesButton', 'Devices', 'bottom');
+        setTippy('chatButton', 'Chat', 'bottom');
+        setTippy('chatCleanButton', 'Clean', 'bottom');
+        setTippy('chatSaveButton', 'Save', 'bottom');
+        setTippy('chatCloseButton', 'Close', 'bottom');
+        setTippy('chatMessage', 'Press enter to send', 'top-start');
+        setTippy('chatSendButton', 'Send', 'top');
+        setTippy('chatEmojiButton', 'Emoji', 'top');
+        setTippy('fullScreenButton', 'Full Screen', 'bottom');
+        setTippy('recButton', 'Recording', 'bottom');
+        setTippy('startRecButton', 'Start Recording', 'bottom');
+        setTippy('stopRecButton', 'Stop Recording', 'bottom');
+        setTippy('pauseRecButton', 'Pause Recording', 'bottom');
+        setTippy('resumeRecButton', 'Resume Recording', 'bottom');
+        setTippy('stopAudioButton', 'Stop Audio', 'bottom');
+        setTippy('startAudioButton', 'Start Audio', 'bottom');
+        setTippy('swapCameraButton', 'Swap Camera', 'bottom');
+        setTippy('startVideoButton', 'Start Video', 'bottom');
+        setTippy('stopVideoButton', 'Stop Video', 'bottom');
+        setTippy('startScreenButton', 'Start Screen', 'bottom');
+        setTippy('stopScreenButton', 'Stop Screen', 'bottom');
+        setTippy('aboutButton', 'About', 'bottom');
+    }
+    initEnumerateDevices();
+}
+
+function setTippy(elem, content, placement) {
+    tippy(document.getElementById(elem), {
+        content: content,
+        placement: placement,
+    });
+}
+
+// ####################################################
+// ENUMERATE DEVICES
+// ####################################################
+
+async function initEnumerateDevices() {
+    if (isEnumerateDevices) return;
+    console.log('01 ----> init Enumerate Devices');
+
+    // allow the audio
+    await navigator.mediaDevices
+        .getUserMedia({ audio: true })
+        .then((stream) => {
+            enumerateAudioDevices(stream);
+            isAudioAllowed = true;
+        })
+        .catch(() => {
+            isAudioAllowed = false;
+        });
+
+    // allow the video
+    await navigator.mediaDevices
+        .getUserMedia({ video: true })
+        .then((stream) => {
+            enumerateVideoDevices(stream);
+            isVideoAllowed = true;
+        })
+        .catch(() => {
+            isVideoAllowed = false;
+        });
+
+    if (!isAudioAllowed && !isVideoAllowed) {
+        window.location.href = `/permission?room_id=${room_id}&message=Not allowed both Audio and Video`;
+    } else {
+        getPeerInfo();
+        getPeerGeoLocation();
+        whoAreYou();
+    }
+}
+
+function enumerateAudioDevices(stream) {
+    console.log('02 ----> Get Audio Devices');
+    navigator.mediaDevices
+        .enumerateDevices()
+        .then((devices) =>
+            devices.forEach((device) => {
+                let el = null;
+                if ('audioinput' === device.kind) {
+                    el = microphoneSelect;
+                } else if ('audiooutput' === device.kind) {
+                    el = speakerSelect;
+                }
+                if (!el) return;
+                appenChild(device, el);
+            }),
+        )
+        .then(() => {
+            stopTracks(stream);
+            isEnumerateDevices = true;
+            speakerSelect.disabled = !('sinkId' in HTMLMediaElement.prototype);
+        });
+}
+
+function enumerateVideoDevices(stream) {
+    console.log('03 ----> Get Video Devices');
+    navigator.mediaDevices
+        .enumerateDevices()
+        .then((devices) =>
+            devices.forEach((device) => {
+                let el = null;
+                if ('videoinput' === device.kind) {
+                    el = videoSelect;
+                }
+                if (!el) return;
+                appenChild(device, el);
+            }),
+        )
+        .then(() => {
+            stopTracks(stream);
+            isEnumerateDevices = true;
+        });
+}
+
+function stopTracks(stream) {
+    stream.getTracks().forEach((track) => {
+        track.stop();
+    });
+}
+
+function appenChild(device, el) {
+    let option = document.createElement('option');
+    option.value = device.deviceId;
+    option.innerText = device.label;
+    el.appendChild(option);
+}
+
+// ####################################################
+// SOME PEER INFO
+// ####################################################
+
+function getPeerInfo() {
+    peer_info = {
+        detectRTCversion: DetectRTC.version,
+        isWebRTCSupported: DetectRTC.isWebRTCSupported,
+        isMobileDevice: DetectRTC.isMobileDevice,
+        osName: DetectRTC.osName,
+        osVersion: DetectRTC.osVersion,
+        browserName: DetectRTC.browser.name,
+        browserVersion: DetectRTC.browser.version,
+    };
+}
+
+function getPeerGeoLocation() {
+    fetch(url.ipLookup)
+        .then((res) => res.json())
+        .then((outJson) => {
+            peer_geo = outJson;
+        })
+        .catch((ex) => console.warn('IP Lookup', ex));
+}
+
+// ####################################################
+// ENTER YOUR NAME | Enable/Disable AUDIO/VIDEO
+// ####################################################
+
+function whoAreYou() {
+    console.log('04 ----> Who are you');
+
+    Swal.fire({
+        allowOutsideClick: false,
+        allowEscapeKey: false,
+        background: swalBackground,
+        input: 'text',
+        inputPlaceholder: 'Enter your name',
+        html: `<br />
+        <button id="initAudioButton" class="fas fa-microphone" onclick="handleAudio(event)"></button>
+        <button id="initVideoButton" class="fas fa-video" onclick="handleVideo(event)"></button>`,
+        confirmButtonText: `Join meeting`,
+        showClass: {
+            popup: 'animate__animated animate__fadeInDown',
+        },
+        hideClass: {
+            popup: 'animate__animated animate__fadeOutUp',
+        },
+        inputValidator: (name) => {
+            if (!name) return 'Please enter your name';
+            peer_name = name;
+        },
+    }).then(() => {
+        shareRoom();
+        joinRoom(peer_name, room_id);
+    });
+
+    let initAudioButton = document.getElementById('initAudioButton');
+    let initVideoButton = document.getElementById('initVideoButton');
+    if (!isAudioAllowed) initAudioButton.className = 'hidden';
+    if (!isVideoAllowed) initVideoButton.className = 'hidden';
+    if (!DetectRTC.isMobileDevice) {
+        setTippy('initAudioButton', 'Enable / Disable audio', 'left');
+        setTippy('initVideoButton', 'Enable / Disable video', 'right');
+    }
+}
+
+function handleAudio(e) {
+    isAudioOn ? (isAudioOn = false) : (isAudioOn = true);
+    e.target.className = 'fas fa-microphone' + (isAudioOn ? '' : '-slash');
+}
+
+function handleVideo(e) {
+    isVideoOn ? (isVideoOn = false) : (isVideoOn = true);
+    e.target.className = 'fas fa-video' + (isVideoOn ? '' : '-slash');
+}
+
+// ####################################################
+// SHARE ROOM
+// ####################################################
+
+async function shareRoom(useNavigator = false) {
+    if (navigator.share && useNavigator) {
+        try {
+            await navigator.share({ url: RoomURL });
+            userLog('info', 'Room Shared successfully', 'top-end');
+        } catch (err) {
+            share();
+        }
+    } else {
+        share();
+    }
+    function share() {
+        sound('open');
+
+        Swal.fire({
+            background: swalBackground,
+            imageUrl: swalImageUrl,
+            position: 'center',
+            title: '<strong>Hello ' + peer_name + '</strong>',
+            html:
+                `
+            <br/>
+            <div id="qrRoomContainer">
+                <canvas id="qrRoom"></canvas>
+            </div>
+            <br/><br/>
+            <p style="color:white;">Share this meeting invite others to join.</p>
+            <p style="color:rgb(8, 189, 89);">` +
+                RoomURL +
+                `</p>`,
+            showDenyButton: true,
+            showCancelButton: true,
+            confirmButtonText: `Copy meeting URL`,
+            denyButtonText: `Email invite`,
+            cancelButtonText: `Close`,
+            showClass: {
+                popup: 'animate__animated animate__fadeInUp',
+            },
+            hideClass: {
+                popup: 'animate__animated animate__fadeOutUp',
+            },
+        }).then((result) => {
+            if (result.isConfirmed) {
+                copyRoomURL();
+            } else if (result.isDenied) {
+                let message = {
+                    email: '',
+                    subject: 'Please join our MiroTalkSfu Video Chat Meeting',
+                    body: 'Click to join: ' + RoomURL,
+                };
+                shareRoomByEmail(message);
+            }
+        });
+        makeRoomQR();
+    }
+}
+
+// ####################################################
+// ROOM UTILITY
+// ####################################################
+
+function makeRoomQR() {
+    let qr = new QRious({
+        element: document.getElementById('qrRoom'),
+        value: RoomURL,
+    });
+    qr.set({
+        size: 128,
+    });
+}
+
+function copyRoomURL() {
+    let tmpInput = document.createElement('input');
+    document.body.appendChild(tmpInput);
+    tmpInput.value = RoomURL;
+    tmpInput.select();
+    document.execCommand('copy');
+    document.body.removeChild(tmpInput);
+    userLog('info', 'Room URL copied to clipboard', 'top-end');
+}
+
+function shareRoomByEmail(message) {
+    let email = message.email;
+    let subject = message.subject;
+    let emailBody = message.body;
+    document.location = 'mailto:' + email + '?subject=' + subject + '&body=' + emailBody;
+}
+
+// ####################################################
+// JOIN TO ROOM
+// ####################################################
+
+function joinRoom(peer_name, room_id) {
+    if (rc && rc.isConnected()) {
+        console.log('Already connected to a room');
+    } else {
+        console.log('05 ----> join to Room ' + room_id);
+        rc = new RoomClient(
+            localMedia,
+            remoteVideos,
+            remoteAudios,
+            window.mediasoupClient,
+            socket,
+            room_id,
+            peer_name,
+            peer_geo,
+            peer_info,
+            isAudioAllowed,
+            isVideoAllowed,
+            isAudioOn,
+            isVideoOn,
+            roomIsReady,
+        );
+        handleRoomClientEvents();
+    }
+}
+
+function roomIsReady() {
+    control.className = '';
+    show(exitButton);
+    show(shareButton);
+    show(recButton);
+    show(startRecButton);
+    show(chatButton);
+    show(chatSendButton);
+    show(chatEmojiButton);
+    if (DetectRTC.isMobileDevice) {
+        show(swapCameraButton);
+        setChatSize();
+    } else {
+        rc.makeDraggable(chatRoom, chatHeader);
+        show(startScreenButton);
+    }
+    if (DetectRTC.browser.name != 'Safari') {
+        document.onfullscreenchange = () => {
+            if (!document.fullscreenElement) rc.isDocumentOnFullScreen = false;
+        };
+        show(fullScreenButton);
+    }
+    show(devicesButton);
+    if (isAudioAllowed) show(startAudioButton);
+    if (isVideoAllowed) show(startVideoButton);
+    show(videoMedia);
+    show(aboutButton);
+    handleButtons();
+    handleSelects();
+    handleInputs();
+    startSessionTimer();
+}
+
+function hide(elem) {
+    elem.className = 'hidden';
+}
+
+function show(elem) {
+    elem.className = '';
+}
+
+// ####################################################
+// SET CHAT MOBILE
+// ####################################################
+
+function setChatSize() {
+    document.documentElement.style.setProperty('--msger-width', '99%');
+    document.documentElement.style.setProperty('--msger-height', '99%');
+}
+
+// ####################################################
+// SESSION TIMER
+// ####################################################
+
+function startSessionTimer() {
+    sessionTime.style.display = 'inline';
+    let callStartTime = Date.now();
+    setInterval(function printTime() {
+        let callElapsedTime = Date.now() - callStartTime;
+        sessionTime.innerHTML = getTimeToString(callElapsedTime);
+    }, 1000);
+}
+
+function getTimeToString(time) {
+    let diffInHrs = time / 3600000;
+    let hh = Math.floor(diffInHrs);
+    let diffInMin = (diffInHrs - hh) * 60;
+    let mm = Math.floor(diffInMin);
+    let diffInSec = (diffInMin - mm) * 60;
+    let ss = Math.floor(diffInSec);
+    let formattedHH = hh.toString().padStart(2, '0');
+    let formattedMM = mm.toString().padStart(2, '0');
+    let formattedSS = ss.toString().padStart(2, '0');
+    return `${formattedHH}:${formattedMM}:${formattedSS}`;
+}
+
+// ####################################################
+// RECORDING TIMER
+// ####################################################
+
+function secondsToHms(d) {
+    d = Number(d);
+    let h = Math.floor(d / 3600);
+    let m = Math.floor((d % 3600) / 60);
+    let s = Math.floor((d % 3600) % 60);
+    let hDisplay = h > 0 ? h + 'h' : '';
+    let mDisplay = m > 0 ? m + 'm' : '';
+    let sDisplay = s > 0 ? s + 's' : '';
+    return hDisplay + ' ' + mDisplay + ' ' + sDisplay;
+}
+
+function startRecordingTimer() {
+    recElapsedTime = 0;
+    recTimer = setInterval(function printTime() {
+        if (rc.isRecording()) {
+            recElapsedTime++;
+            recordingStatus.innerHTML = '🔴 REC ' + secondsToHms(recElapsedTime);
+        }
+    }, 1000);
+}
+function stopRecordingTimer() {
+    clearInterval(recTimer);
+}
+
+// ####################################################
+// HTML BUTTONS
+// ####################################################
+
+function handleButtons() {
+    exitButton.onclick = () => {
+        rc.exit();
+    };
+    shareButton.onclick = () => {
+        shareRoom(true);
+    };
+    devicesButton.onclick = () => {
+        rc.toggleDevices();
+    };
+    chatButton.onclick = () => {
+        rc.toggleChat();
+    };
+    chatCleanButton.onclick = () => {
+        rc.chatClean();
+    };
+    chatSaveButton.onclick = () => {
+        rc.chatSave();
+    };
+    chatCloseButton.onclick = () => {
+        rc.toggleChat();
+    };
+    chatSendButton.onclick = () => {
+        rc.sendMessage();
+    };
+    chatEmojiButton.onclick = () => {
+        rc.toggleChatEmoji();
+    };
+    fullScreenButton.onclick = () => {
+        rc.toggleFullScreen();
+    };
+    recButton.onclick = () => {
+        rc.toggleRecording();
+    };
+    startRecButton.onclick = () => {
+        rc.startRecording();
+    };
+    stopRecButton.onclick = () => {
+        rc.stopRecording();
+    };
+    pauseRecButton.onclick = () => {
+        rc.pauseRecording();
+    };
+    resumeRecButton.onclick = () => {
+        rc.resumeRecording();
+    };
+    swapCameraButton.onclick = () => {
+        rc.closeThenProduce(RoomClient.mediaType.video, null, true);
+    };
+    startAudioButton.onclick = () => {
+        rc.produce(RoomClient.mediaType.audio, microphoneSelect.value);
+        // rc.resumeProducer(RoomClient.mediaType.audio);
+    };
+    stopAudioButton.onclick = () => {
+        rc.closeProducer(RoomClient.mediaType.audio);
+        // rc.pauseProducer(RoomClient.mediaType.audio);
+    };
+    startVideoButton.onclick = () => {
+        rc.produce(RoomClient.mediaType.video, videoSelect.value);
+        // rc.resumeProducer(RoomClient.mediaType.video);
+    };
+    stopVideoButton.onclick = () => {
+        rc.closeProducer(RoomClient.mediaType.video);
+        // rc.pauseProducer(RoomClient.mediaType.video);
+    };
+    startScreenButton.onclick = () => {
+        rc.produce(RoomClient.mediaType.screen);
+    };
+    stopScreenButton.onclick = () => {
+        rc.closeProducer(RoomClient.mediaType.screen);
+    };
+    aboutButton.onclick = () => {
+        showAbout();
+    };
+}
+
+// ####################################################
+// HTML SELECTS
+// ####################################################
+
+function handleSelects() {
+    microphoneSelect.onchange = () => {
+        rc.closeThenProduce(RoomClient.mediaType.audio, microphoneSelect.value);
+    };
+    speakerSelect.onchange = () => {
+        rc.attachSinkId(localMedia, speakerSelect.value);
+    };
+    videoSelect.onchange = () => {
+        rc.closeThenProduce(RoomClient.mediaType.video, videoSelect.value);
+    };
+}
+
+// ####################################################
+// HTML INPUTS
+// ####################################################
+
+function handleInputs() {
+    chatMessage.onkeyup = (e) => {
+        if (e.keyCode === 13) {
+            e.preventDefault();
+            chatSendButton.click();
+        }
+    };
+    rc.getId('chatEmoji').addEventListener('emoji-click', (e) => {
+        chatMessage.value += e.detail.emoji.unicode;
+        rc.toggleChatEmoji();
+    });
+}
+
+// ####################################################
+// ROOM CLIENT EVENT LISTNERS
+// ####################################################
+
+function handleRoomClientEvents() {
+    rc.on(RoomClient.EVENTS.startRec, () => {
+        hide(startRecButton);
+        show(stopRecButton);
+        show(pauseRecButton);
+        startRecordingTimer();
+    });
+    rc.on(RoomClient.EVENTS.pauseRec, () => {
+        hide(pauseRecButton);
+        show(resumeRecButton);
+    });
+    rc.on(RoomClient.EVENTS.resumeRec, () => {
+        hide(resumeRecButton);
+        show(pauseRecButton);
+    });
+    rc.on(RoomClient.EVENTS.stopRec, () => {
+        hide(stopRecButton);
+        hide(pauseRecButton);
+        hide(resumeRecButton);
+        show(startRecButton);
+        stopRecordingTimer();
+    });
+    rc.on(RoomClient.EVENTS.startAudio, () => {
+        hide(startAudioButton);
+        show(stopAudioButton);
+    });
+    rc.on(RoomClient.EVENTS.pauseAudio, () => {
+        console.log('Room Client pause audio');
+        hide(stopAudioButton);
+        show(startAudioButton);
+    });
+    rc.on(RoomClient.EVENTS.resumeAudio, () => {
+        console.log('Room Client resume audio');
+        hide(startAudioButton);
+        show(stopAudioButton);
+    });
+    rc.on(RoomClient.EVENTS.stopAudio, () => {
+        hide(stopAudioButton);
+        show(startAudioButton);
+    });
+    rc.on(RoomClient.EVENTS.startVideo, () => {
+        hide(startVideoButton);
+        show(stopVideoButton);
+    });
+    rc.on(RoomClient.EVENTS.pauseVideo, () => {
+        console.log('Room Client pause video');
+        hide(stopVideoButton);
+        show(startVideoButton);
+    });
+    rc.on(RoomClient.EVENTS.resumeVideo, () => {
+        console.log('Room Client resume video');
+        hide(startVideoButton);
+        show(stopVideoButton);
+    });
+    rc.on(RoomClient.EVENTS.stopVideo, () => {
+        hide(stopVideoButton);
+        show(startVideoButton);
+    });
+    rc.on(RoomClient.EVENTS.startScreen, () => {
+        hide(startScreenButton);
+        show(stopScreenButton);
+    });
+    rc.on(RoomClient.EVENTS.pauseScreen, () => {
+        console.log('Room Client pause screen');
+    });
+    rc.on(RoomClient.EVENTS.resumeScreen, () => {
+        console.log('Room Client resume screen');
+    });
+    rc.on(RoomClient.EVENTS.stopScreen, () => {
+        hide(stopScreenButton);
+        show(startScreenButton);
+    });
+    rc.on(RoomClient.EVENTS.exitRoom, () => {
+        window.location.href = '/newroom';
+    });
+}
+
+// ####################################################
+// SHOW LOG
+// ####################################################
+
+function userLog(icon, message, position) {
+    const Toast = Swal.mixin({
+        background: swalBackground,
+        toast: true,
+        position: position,
+        showConfirmButton: false,
+        timer: 3000,
+    });
+    Toast.fire({
+        icon: icon,
+        title: message,
+    });
+}
+
+// ####################################################
+// SOUND
+// ####################################################
+
+async function sound(name) {
+    let sound = '../sounds/' + name + '.wav';
+    let audioToPlay = new Audio(sound);
+    try {
+        await audioToPlay.play();
+    } catch (err) {
+        return false;
+    }
+}
+
+// ####################################################
+// ABOUT
+// ####################################################
+
+function showAbout() {
+    sound('open');
+
+    Swal.fire({
+        background: swalBackground,
+        imageUrl: swalImageUrl,
+        position: 'center',
+        html: `
+        <br/>
+        <div id="about">
+            <b>Open Source</b> project on
+            <a href="https://github.com/miroslavpejic85/mirotalksfu" target="_blank"><br/><br />
+            <img alt="mirotalksfu-github" src="../images/github.png"></a><br/><br />
+            <button class="far fa-heart pulsate" onclick="window.open('https://github.com/sponsors/miroslavpejic85?o=esb')"> Sponsor</button>
+            <br /><br />
+            Contact: <a href="https://www.linkedin.com/in/miroslav-pejic-976a07101/" target="_blank"> Miroslav Pejic</a>
+        </div>
+        `,
+        showClass: {
+            popup: 'animate__animated animate__fadeInUp',
+        },
+        hideClass: {
+            popup: 'animate__animated animate__fadeOutUp',
+        },
+    });
+}
diff --git a/public/js/RoomClient.js b/public/js/RoomClient.js
new file mode 100644
index 00000000..d0be6595
--- /dev/null
+++ b/public/js/RoomClient.js
@@ -0,0 +1,1369 @@
+'use strict';
+
+const cfg = {
+    msgAvatar: 'https://eu.ui-avatars.com/api',
+};
+
+const html = {
+    newline: '<br />',
+};
+
+const image = {
+    poster: '../images/loader.gif',
+    delete: '../images/delete.png',
+};
+
+const mediaType = {
+    audio: 'audioType',
+    video: 'videoType',
+    camera: 'cameraType',
+    screen: 'screenType',
+};
+
+const _EVENTS = {
+    openRoom: 'openRoom',
+    exitRoom: 'exitRoom',
+    startRec: 'startRec',
+    pauseRec: 'pauseRec',
+    resumeRec: 'resumeRec',
+    stopRec: 'stopRec',
+    startVideo: 'startVideo',
+    pauseVideo: 'pauseVideo',
+    resumeVideo: 'resumeVideo',
+    stopVideo: 'stopVideo',
+    startAudio: 'startAudio',
+    pauseAudio: 'pauseAudio',
+    resumeAudio: 'resumeAudio',
+    stopAudio: 'stopAudio',
+    startScreen: 'startScreen',
+    pauseScreen: 'pauseScreen',
+    resumeScreen: 'resumeScreen',
+    stopScreen: 'stopScreen',
+};
+
+let recordedBlobs;
+
+class RoomClient {
+    constructor(
+        localMediaEl,
+        remoteVideoEl,
+        remoteAudioEl,
+        mediasoupClient,
+        socket,
+        room_id,
+        peer_name,
+        peer_geo,
+        peer_info,
+        isAudioAllowed,
+        isVideoAllowed,
+        isAudioOn,
+        isVideoOn,
+        successCallback,
+    ) {
+        this.localMediaEl = localMediaEl;
+        this.remoteVideoEl = remoteVideoEl;
+        this.remoteAudioEl = remoteAudioEl;
+        this.mediasoupClient = mediasoupClient;
+
+        this.socket = socket;
+        this.room_id = room_id;
+        this.peer_name = peer_name;
+        this.peer_geo = peer_geo;
+        this.peer_info = peer_info;
+        this.peer_info.peerName = peer_name;
+
+        this.isAudioAllowed = isAudioAllowed;
+        this.isVideoAllowed = isVideoAllowed;
+        this.isAudioOn = isAudioOn;
+        this.isVideoOn = isVideoOn;
+        this.producerTransport = null;
+        this.consumerTransport = null;
+        this.device = null;
+
+        this.isMobileDevice = DetectRTC.isMobileDevice;
+
+        this._isConnected = false;
+        this.peerGeo = null;
+        this.peerInfo = null;
+        this.isVideoOnFullScreen = false;
+        this.isDocumentOnFullScreen = false;
+        this.isChatOpen = false;
+        this.camVideo = false;
+        this.camera = 'user';
+
+        this.chatMessages = [];
+        this.leftMsgAvatar = null;
+        this.rightMsgAvatar = null;
+
+        this.localVideoStream = null;
+        this.localScreenStream = null;
+        this.localAudioStream = null;
+        this.mediaRecorder = null;
+        this.recScreenStream = null;
+        this._isRecording = false;
+
+        this.connectedRoom = null;
+        this.debug = false;
+
+        this.consumers = new Map();
+        this.producers = new Map();
+        this.producerLabel = new Map();
+        this.eventListeners = new Map();
+
+        console.log('06 ----> Load Mediasoup Client v', mediasoupClient.version);
+
+        Object.keys(_EVENTS).forEach(
+            function (evt) {
+                this.eventListeners.set(evt, []);
+            }.bind(this),
+        );
+
+        this.socket.request = function request(type, data = {}) {
+            return new Promise((resolve, reject) => {
+                socket.emit(type, data, (data) => {
+                    if (data.error) {
+                        reject(data.error);
+                    } else {
+                        resolve(data);
+                    }
+                });
+            });
+        };
+
+        // ####################################################
+        // CREATE ROOM AND JOIN
+        // ####################################################
+
+        this.createRoom(this.room_id).then(
+            async function () {
+                let data = {
+                    room_id: this.room_id,
+                    peer_name: this.peer_name,
+                    peer_audio: this.isAudioOn,
+                    peer_video: this.isVideoOn,
+                    peer_info: this.peer_info,
+                    peer_geo: this.peer_geo,
+                };
+                await this.join(data);
+                this.initSockets();
+                this._isConnected = true;
+                successCallback();
+            }.bind(this),
+        );
+    }
+
+    // ####################################################
+    // GET STARTED
+    // ####################################################
+
+    async createRoom(room_id) {
+        await this.socket
+            .request('createRoom', {
+                room_id,
+            })
+            .catch((err) => {
+                console.log('Create room error:', err);
+            });
+    }
+
+    async join(data) {
+        socket
+            .request('join', data)
+            .then(
+                async function (room) {
+                    this.connectedRoom = room;
+                    console.log('07 ----> Joined to room', this.connectedRoom);
+                    const data = await this.socket.request('getRouterRtpCapabilities');
+                    this.device = await this.loadDevice(data);
+                    console.log('08 ----> Get Router Rtp Capabilities codecs: ', this.device.rtpCapabilities.codecs);
+                    await this.initTransports(this.device);
+                    this.startLocalMedia();
+                    this.socket.emit('getProducers');
+                }.bind(this),
+            )
+            .catch((err) => {
+                console.log('Join error:', err);
+            });
+    }
+
+    async loadDevice(routerRtpCapabilities) {
+        let device;
+        try {
+            device = new this.mediasoupClient.Device();
+        } catch (error) {
+            if (error.name === 'UnsupportedError') {
+                console.error('Browser not supported');
+                this.userLog('error', 'Browser not supported', 'center');
+            }
+            console.error('Browser not supported: ', error);
+            this.userLog('error', 'Browser not supported: ' + error, 'center');
+        }
+        await device.load({
+            routerRtpCapabilities,
+        });
+        return device;
+    }
+
+    // ####################################################
+    // PRODUCER TRANSPORT
+    // ####################################################
+
+    async initTransports(device) {
+        {
+            const data = await this.socket.request('createWebRtcTransport', {
+                forceTcp: false,
+                rtpCapabilities: device.rtpCapabilities,
+            });
+
+            if (data.error) {
+                console.error('Create WebRtc Transport for Producer err: ', data.error);
+                return;
+            }
+
+            this.producerTransport = device.createSendTransport(data);
+            this.producerTransport.on(
+                'connect',
+                async function ({ dtlsParameters }, callback, errback) {
+                    this.socket
+                        .request('connectTransport', {
+                            dtlsParameters,
+                            transport_id: data.id,
+                        })
+                        .then(callback)
+                        .catch(errback);
+                }.bind(this),
+            );
+
+            this.producerTransport.on(
+                'produce',
+                async function ({ kind, rtpParameters }, callback, errback) {
+                    try {
+                        const { producer_id } = await this.socket.request('produce', {
+                            producerTransportId: this.producerTransport.id,
+                            kind,
+                            rtpParameters,
+                        });
+                        callback({
+                            id: producer_id,
+                        });
+                    } catch (err) {
+                        errback(err);
+                    }
+                }.bind(this),
+            );
+
+            this.producerTransport.on(
+                'connectionstatechange',
+                function (state) {
+                    switch (state) {
+                        case 'connecting':
+                            break;
+
+                        case 'connected':
+                            console.log('Producer Transport connected');
+                            break;
+
+                        case 'failed':
+                            console.warn('Producer Transport failed');
+                            this.producerTransport.close();
+                            break;
+
+                        default:
+                            break;
+                    }
+                }.bind(this),
+            );
+        }
+
+        // ####################################################
+        // CONSUMER TRANSPORT
+        // ####################################################
+
+        {
+            const data = await this.socket.request('createWebRtcTransport', {
+                forceTcp: false,
+            });
+
+            if (data.error) {
+                console.error('Create WebRtc Transport for Consumer err: ', data.error);
+                return;
+            }
+
+            this.consumerTransport = device.createRecvTransport(data);
+            this.consumerTransport.on(
+                'connect',
+                function ({ dtlsParameters }, callback, errback) {
+                    this.socket
+                        .request('connectTransport', {
+                            transport_id: this.consumerTransport.id,
+                            dtlsParameters,
+                        })
+                        .then(callback)
+                        .catch(errback);
+                }.bind(this),
+            );
+
+            this.consumerTransport.on(
+                'connectionstatechange',
+                async function (state) {
+                    switch (state) {
+                        case 'connecting':
+                            break;
+
+                        case 'connected':
+                            console.log('Consumer Transport connected');
+                            break;
+
+                        case 'failed':
+                            console.warn('Consumer Transport failed');
+                            this.consumerTransport.close();
+                            break;
+
+                        default:
+                            break;
+                    }
+                }.bind(this),
+            );
+        }
+    }
+
+    // ####################################################
+    // TODO DATACHANNEL TRANSPORT
+    // ####################################################
+
+
+    // ####################################################
+    // SOCKET ON
+    // ####################################################
+
+    initSockets() {
+        this.socket.on(
+            'consumerClosed',
+            function ({ consumer_id }) {
+                console.log('Closing consumer:', consumer_id);
+                this.removeConsumer(consumer_id);
+            }.bind(this),
+        );
+
+        this.socket.on(
+            'newProducers',
+            async function (data) {
+                if (data.length > 0) {
+                    console.log('New producers', data);
+                    for (let { producer_id, peer_name, peer_info } of data) {
+                        await this.consume(producer_id, peer_name, peer_info);
+                    }
+                }
+            }.bind(this),
+        );
+
+        this.socket.on(
+            'message',
+            function (data) {
+                console.log('message', data);
+                this.showMessage(data);
+            }.bind(this),
+        );
+
+        this.socket.on(
+            'disconnect',
+            function () {
+                this.exit(true);
+            }.bind(this),
+        );
+    }
+
+    // ####################################################
+    // START LOCAL AUDIO VIDEO MEDIA
+    // ####################################################
+
+    startLocalMedia() {
+        if (this.isAudioAllowed && this.isAudioOn) {
+            console.log('09 ----> Start audio media');
+            this.produce(mediaType.audio, microphoneSelect.value);
+        }
+        if (this.isVideoAllowed && this.isVideoOn) {
+            console.log('10 ----> Start video media');
+            this.produce(mediaType.video, videoSelect.value);
+        }
+    }
+
+    // ####################################################
+    // PRODUCER
+    // ####################################################
+
+    async produce(type, deviceId = null, swapCamera = false) {
+        let mediaConstraints = {};
+        let audio = false;
+        let screen = false;
+        switch (type) {
+            case mediaType.audio:
+                mediaConstraints = this.getAudioConstraints(deviceId);
+                audio = true;
+                break;
+            case mediaType.video:
+                if (swapCamera) {
+                    mediaConstraints = this.getCameraConstraints();
+                } else {
+                    mediaConstraints = this.getVideoConstraints(deviceId);
+                }
+                break;
+            case mediaType.screen:
+                mediaConstraints = this.getScreenConstraints();
+                screen = true;
+                break;
+            default:
+                return;
+        }
+        if (!this.device.canProduce('video') && !audio) {
+            console.error('Cannot produce video');
+            return;
+        }
+        if (this.producerLabel.has(type)) {
+            console.log('Producer already exists for this type ' + type);
+            return;
+        }
+        console.log('Mediacontraints:', mediaConstraints);
+        let stream;
+        try {
+            stream = screen
+                ? await navigator.mediaDevices.getDisplayMedia()
+                : await navigator.mediaDevices.getUserMedia(mediaConstraints);
+            console.log('Supported Constraints', navigator.mediaDevices.getSupportedConstraints());
+
+            const track = audio ? stream.getAudioTracks()[0] : stream.getVideoTracks()[0];
+            const params = {
+                track,
+            };
+
+            if (!audio && !screen) {
+                params.encodings = this.getEncoding();
+                params.codecOptions = {
+                    videoGoogleStartBitrate: 1000,
+                };
+            }
+            producer = await this.producerTransport.produce(params);
+
+            console.log('Producer', producer);
+
+            this.producers.set(producer.id, producer);
+
+            let elem;
+            if (!audio) {
+                this.localVideoStream = stream;
+                elem = await this.handleProducer(producer.id, type, stream);
+            } else {
+                this.localAudioStream = stream;
+            }
+
+            producer.on('trackended', () => {
+                this.closeProducer(type);
+            });
+
+            producer.on('transportclose', () => {
+                console.log('Producer transport close');
+                if (!audio) {
+                    elem.srcObject.getTracks().forEach(function (track) {
+                        track.stop();
+                    });
+                    elem.parentNode.removeChild(elem);
+                }
+                this.producers.delete(producer.id);
+            });
+
+            producer.on('close', () => {
+                console.log('Closing producer');
+                if (!audio) {
+                    elem.srcObject.getTracks().forEach(function (track) {
+                        track.stop();
+                    });
+                    elem.parentNode.removeChild(elem);
+                }
+                this.producers.delete(producer.id);
+            });
+
+            this.producerLabel.set(type, producer.id);
+
+            switch (type) {
+                case mediaType.audio:
+                    this.event(_EVENTS.startAudio);
+                    break;
+                case mediaType.video:
+                    this.event(_EVENTS.startVideo);
+                    break;
+                case mediaType.screen:
+                    this.event(_EVENTS.startScreen);
+                    break;
+                default:
+                    return;
+            }
+        } catch (err) {
+            console.log('Produce error:', err);
+        }
+    }
+
+    getAudioConstraints(deviceId) {
+        return {
+            audio: {
+                echoCancellation: true,
+                noiseSuppression: true,
+                sampleRate: 44100,
+                deviceId: deviceId,
+            },
+            video: false,
+        };
+    }
+
+    getCameraConstraints() {
+        this.camera = this.camera == 'user' ? 'environment' : 'user';
+        if (this.camera != 'user') this.camVideo = { facingMode: { exact: this.camera } };
+        else this.camVideo = true;
+        return {
+            audio: false,
+            video: this.camVideo,
+        };
+    }
+
+    getVideoConstraints(deviceId) {
+        return {
+            audio: false,
+            video: {
+                width: {
+                    min: 640,
+                    ideal: 1920,
+                    max: 3840,
+                },
+                height: {
+                    min: 480,
+                    ideal: 1080,
+                    max: 2160,
+                },
+                deviceId: deviceId,
+                aspectRatio: 1.777, // 16:9
+                frameRate: 15, // 15fps
+            },
+        };
+    }
+
+    getScreenConstraints() {
+        return {
+            video: {
+                frameRate: {
+                    min: 5,
+                    ideal: 15,
+                    max: 30,
+                },
+            },
+        };
+    }
+
+    getEncoding() {
+        return [
+            {
+                rid: 'r0',
+                maxBitrate: 100000,
+                scalabilityMode: 'S1T3',
+            },
+            {
+                rid: 'r1',
+                maxBitrate: 300000,
+                scalabilityMode: 'S1T3',
+            },
+            {
+                rid: 'r2',
+                maxBitrate: 900000,
+                scalabilityMode: 'S1T3',
+            },
+        ];
+    }
+
+    closeThenProduce(type, deviceId, swapCamera = false) {
+        this.closeProducer(type);
+        this.produce(type, deviceId, swapCamera);
+    }
+
+    async handleProducer(id, type, stream) {
+        let elem, d, p;
+        d = document.createElement('div');
+        d.className = 'd';
+        d.id = id + '_d';
+        elem = document.createElement('video');
+        elem.id = id;
+        elem.playsinline = false;
+        elem.autoplay = true;
+        elem.poster = image.poster;
+        if (this.isMobileDevice || type === mediaType.screen) elem.className = 'vid';
+        else elem.className = 'vid mirror';
+        p = document.createElement('p');
+        p.id = id + '_name';
+        p.className = 'pn';
+        p.innerHTML = '👤 ' + this.peer_name;
+        d.appendChild(elem);
+        d.appendChild(p);
+        this.localMediaEl.appendChild(d);
+        this.attachMediaStream(elem, stream, type, 'Producer');
+        this.handleFS(elem.id);
+        this.setTippy(elem.id, 'Full Screen', 'top-end');
+        if (this.debug) {
+            this.setTippy(
+                p.id,
+                JSON.stringify(
+                    this.peer_info,
+                    ['peerName', 'isMobileDevice', 'osName', 'osVersion', 'browserName', 'browserVersion'],
+                    2,
+                ),
+                'top-start',
+            );
+        }
+        this.sound('joined');
+        return elem;
+    }
+
+    pauseProducer(type) {
+        if (!this.producerLabel.has(type)) {
+            console.log('There is no producer for this type ' + type);
+            return;
+        }
+
+        let producer_id = this.producerLabel.get(type);
+        this.producers.get(producer_id).pause();
+
+        switch (type) {
+            case mediaType.audio:
+                this.event(_EVENTS.pauseAudio);
+                break;
+            case mediaType.video:
+                this.event(_EVENTS.pauseVideo);
+                break;
+            case mediaType.screen:
+                this.event(_EVENTS.pauseScreen);
+                break;
+            default:
+                return;
+        }
+    }
+
+    resumeProducer(type) {
+        if (!this.producerLabel.has(type)) {
+            console.log('There is no producer for this type ' + type);
+            return;
+        }
+
+        let producer_id = this.producerLabel.get(type);
+        this.producers.get(producer_id).resume();
+
+        switch (type) {
+            case mediaType.audio:
+                this.event(_EVENTS.resumeAudio);
+                break;
+            case mediaType.video:
+                this.event(_EVENTS.resumeVideo);
+                break;
+            case mediaType.screen:
+                this.event(_EVENTS.resumeScreen);
+                break;
+            default:
+                return;
+        }
+    }
+
+    closeProducer(type) {
+        if (!this.producerLabel.has(type)) {
+            console.log('There is no producer for this type ' + type);
+            return;
+        }
+
+        let producer_id = this.producerLabel.get(type);
+        console.log('Close producer', producer_id);
+
+        this.socket.emit('producerClosed', {
+            producer_id,
+        });
+
+        this.producers.get(producer_id).close();
+        this.producers.delete(producer_id);
+        this.producerLabel.delete(type);
+
+        if (type !== mediaType.audio) {
+            let elem = this.getId(producer_id);
+            let d = this.getId(producer_id + '_d');
+            elem.srcObject.getTracks().forEach(function (track) {
+                track.stop();
+            });
+            d.parentNode.removeChild(d);
+        }
+
+        switch (type) {
+            case mediaType.audio:
+                this.event(_EVENTS.stopAudio);
+                break;
+            case mediaType.video:
+                this.event(_EVENTS.stopVideo);
+                break;
+            case mediaType.screen:
+                this.event(_EVENTS.stopScreen);
+                break;
+            default:
+                return;
+        }
+
+        this.sound('left');
+    }
+
+    // ####################################################
+    // CONSUMER
+    // ####################################################
+
+    async consume(producer_id, peer_name, peer_info) {
+        this.getConsumeStream(producer_id).then(
+            function ({ consumer, stream, kind }) {
+                this.consumers.set(consumer.id, consumer);
+
+                if (kind === 'video') {
+                    this.handleConsumer(consumer.id, mediaType.video, stream, peer_name, peer_info);
+                } else {
+                    this.handleConsumer(consumer.id, mediaType.audio, stream, peer_name, peer_info);
+                }
+
+                consumer.on(
+                    'trackended',
+                    function () {
+                        this.removeConsumer(consumer.id);
+                    }.bind(this),
+                );
+
+                consumer.on(
+                    'transportclose',
+                    function () {
+                        this.removeConsumer(consumer.id);
+                    }.bind(this),
+                );
+            }.bind(this),
+        );
+    }
+
+    async getConsumeStream(producerId) {
+        const { rtpCapabilities } = this.device;
+        const data = await this.socket.request('consume', {
+            rtpCapabilities,
+            consumerTransportId: this.consumerTransport.id,
+            producerId,
+        });
+        const { id, kind, rtpParameters } = data;
+        const codecOptions = {};
+        const consumer = await this.consumerTransport.consume({
+            id,
+            producerId,
+            kind,
+            rtpParameters,
+            codecOptions,
+        });
+        const stream = new MediaStream();
+        stream.addTrack(consumer.track);
+
+        return {
+            consumer,
+            stream,
+            kind,
+        };
+    }
+
+    handleConsumer(id, type, stream, peer_name, peer_info) {
+        let elem, d, p;
+        switch (type) {
+            case mediaType.video:
+                d = document.createElement('div');
+                d.className = 'd';
+                d.id = id + '_d';
+                elem = document.createElement('video');
+                elem.id = id;
+                elem.playsinline = false;
+                elem.autoplay = true;
+                elem.className = 'vid';
+                elem.poster = image.poster;
+                p = document.createElement('p');
+                p.id = id + '_name';
+                p.innerHTML = '👤 ' + peer_name;
+                d.appendChild(elem);
+                d.appendChild(p);
+                this.remoteVideoEl.appendChild(d);
+                this.attachMediaStream(elem, stream, mediaType.video, 'Consumer');
+                this.handleFS(elem.id);
+                this.setTippy(elem.id, 'Full Screen', 'top-end');
+                if (this.debug) {
+                    this.setTippy(
+                        p.id,
+                        JSON.stringify(
+                            peer_info,
+                            ['peerName', 'isMobileDevice', 'osName', 'osVersion', 'browserName', 'browserVersion'],
+                            2,
+                        ),
+                        'top-start',
+                    );
+                }
+                this.sound('joined');
+                break;
+            case mediaType.audio:
+                elem = document.createElement('audio');
+                elem.id = id;
+                elem.playsinline = false;
+                elem.autoplay = true;
+                this.remoteAudioEl.appendChild(elem);
+                this.attachMediaStream(elem, stream, mediaType.audio, 'Consumer');
+                break;
+        }
+        return elem;
+    }
+
+    removeConsumer(consumer_id) {
+        let elem = this.getId(consumer_id);
+        let d = this.getId(consumer_id + '_d');
+        elem.srcObject.getTracks().forEach(function (track) {
+            track.stop();
+        });
+        if (d) d.parentNode.removeChild(d);
+
+        this.consumers.delete(consumer_id);
+        this.sound('left');
+    }
+
+    // ####################################################
+    // EXIT ROOM
+    // ####################################################
+
+    exit(offline = false) {
+        let clean = function () {
+            this._isConnected = false;
+            this.consumerTransport.close();
+            this.producerTransport.close();
+            this.socket.off('disconnect');
+            this.socket.off('newProducers');
+            this.socket.off('consumerClosed');
+        }.bind(this);
+
+        if (!offline) {
+            this.socket
+                .request('exitRoom')
+                .then((e) => console.log('Exit Room', e))
+                .catch((e) => console.warn('Exit Room ', e))
+                .finally(
+                    function () {
+                        clean();
+                    }.bind(this),
+                );
+        } else {
+            clean();
+        }
+
+        this.event(_EVENTS.exitRoom);
+    }
+
+    // ####################################################
+    // HELPERS
+    // ####################################################
+
+    attachMediaStream(elem, stream, mediaType, type) {
+        console.log(type + ' Success attached media ' + mediaType);
+        elem.srcObject = stream;
+    }
+
+    attachSinkId(elem, sinkId) {
+        if (typeof elem.sinkId !== 'undefined') {
+            elem.setSinkId(sinkId)
+                .then(() => {
+                    console.log(`Success, audio output device attached: ${sinkId}`);
+                })
+                .catch((err) => {
+                    let errorMessage = err;
+                    if (err.name === 'SecurityError')
+                        errorMessage = `You need to use HTTPS for selecting audio output device: ${err}`;
+                    console.error('Attach SinkId error: ', errorMessage);
+                    this.userLog('error', errorMessage, 'top-end');
+                    this.getId('speakerSelect').selectedIndex = 0;
+                });
+        } else {
+            let error = `Browser seems doesn't support output device selection.`;
+            console.warn(error);
+            this.userLog('error', error, 'top-end');
+        }
+    }
+
+    event(evt) {
+        if (this.eventListeners.has(evt)) {
+            this.eventListeners.get(evt).forEach((callback) => callback());
+        }
+    }
+
+    on(evt, callback) {
+        this.eventListeners.get(evt).push(callback);
+    }
+
+    // ####################################################
+    // SET
+    // ####################################################
+
+    setTippy(elem, content, placement) {
+        if (DetectRTC.isMobileDevice) return;
+        tippy(this.getId(elem), {
+            content: content,
+            placement: placement,
+        });
+    }
+
+    // ####################################################
+    // GET
+    // ####################################################
+
+    isConnected() {
+        return this._isConnected;
+    }
+
+    isRecording() {
+        return this._isRecording;
+    }
+
+    static get mediaType() {
+        return mediaType;
+    }
+
+    static get EVENTS() {
+        return _EVENTS;
+    }
+
+    getTimeNow() {
+        return new Date().toTimeString().split(' ')[0];
+    }
+
+    getId(id) {
+        return document.getElementById(id);
+    }
+
+    async getMyRoomInfo() {
+        let roomInfo = await this.socket.request('getMyRoomInfo');
+        console.log('Room info', roomInfo);
+        return roomInfo;
+    }
+
+    // ####################################################
+    // UTILITY
+    // ####################################################
+
+    toggleDevices() {
+        this.getId('myDevices').classList.toggle('show');
+    }
+
+    async sound(name) {
+        let sound = '../sounds/' + name + '.wav';
+        let audioToPlay = new Audio(sound);
+        try {
+            await audioToPlay.play();
+        } catch (err) {
+            return false;
+        }
+    }
+
+    userLog(icon, message, position) {
+        const Toast = Swal.mixin({
+            background: swalBackground,
+            toast: true,
+            position: position,
+            showConfirmButton: false,
+            timer: 5000,
+        });
+        Toast.fire({
+            icon: icon,
+            title: message,
+        });
+    }
+
+    thereIsConsumers() {
+        if (this.consumers.size > 0) {
+            return true;
+        }
+        this.userLog('info', 'No participants in the room', 'top-end');
+        return false;
+    }
+
+    // ####################################################
+    // FULL SCREEN
+    // ####################################################
+
+    toggleFullScreen() {
+        if (!document.fullscreenElement) {
+            document.documentElement.requestFullscreen();
+            this.isDocumentOnFullScreen = true;
+        } else {
+            if (document.exitFullscreen) {
+                document.exitFullscreen();
+                this.isDocumentOnFullScreen = false;
+            }
+        }
+    }
+
+    handleFS(id) {
+        let videoPlayer = this.getId(id);
+        videoPlayer.addEventListener('fullscreenchange', (e) => {
+            if (videoPlayer.controls || this.isDocumentOnFullScreen) return;
+            let fullscreenElement = document.fullscreenElement;
+            if (!fullscreenElement) {
+                videoPlayer.style.pointerEvents = 'auto';
+                this.isVideoOnFullScreen = false;
+            }
+        });
+        videoPlayer.addEventListener('webkitfullscreenchange', (e) => {
+            if (videoPlayer.controls || this.isDocumentOnFullScreen) return;
+            let webkitIsFullScreen = document.webkitIsFullScreen;
+            if (!webkitIsFullScreen) {
+                videoPlayer.style.pointerEvents = 'auto';
+                this.isVideoOnFullScreen = false;
+            }
+        });
+        videoPlayer.addEventListener('click', () => {
+            if (videoPlayer.controls || this.isDocumentOnFullScreen) return;
+            if (!this.isVideoOnFullScreen) {
+                if (videoPlayer.requestFullscreen) {
+                    videoPlayer.requestFullscreen();
+                } else if (videoPlayer.webkitRequestFullscreen) {
+                    videoPlayer.webkitRequestFullscreen();
+                } else if (videoPlayer.msRequestFullscreen) {
+                    videoPlayer.msRequestFullscreen();
+                }
+                this.isVideoOnFullScreen = true;
+                videoPlayer.style.pointerEvents = 'none';
+            } else {
+                if (document.exitFullscreen) {
+                    document.exitFullscreen();
+                } else if (document.webkitCancelFullScreen) {
+                    document.webkitCancelFullScreen();
+                } else if (document.msExitFullscreen) {
+                    document.msExitFullscreen();
+                }
+                this.isVideoOnFullScreen = false;
+                videoPlayer.style.pointerEvents = 'auto';
+            }
+        });
+    }
+
+    // ####################################################
+    // DRAGGABLE
+    // ####################################################
+
+    makeDraggable(elmnt, dragObj) {
+        let pos1 = 0,
+            pos2 = 0,
+            pos3 = 0,
+            pos4 = 0;
+        if (dragObj) {
+            dragObj.onmousedown = dragMouseDown;
+        } else {
+            elmnt.onmousedown = dragMouseDown;
+        }
+        function dragMouseDown(e) {
+            e = e || window.event;
+            e.preventDefault();
+            pos3 = e.clientX;
+            pos4 = e.clientY;
+            document.onmouseup = closeDragElement;
+            document.onmousemove = elementDrag;
+        }
+        function elementDrag(e) {
+            e = e || window.event;
+            e.preventDefault();
+            pos1 = pos3 - e.clientX;
+            pos2 = pos4 - e.clientY;
+            pos3 = e.clientX;
+            pos4 = e.clientY;
+            elmnt.style.top = elmnt.offsetTop - pos2 + 'px';
+            elmnt.style.left = elmnt.offsetLeft - pos1 + 'px';
+        }
+        function closeDragElement() {
+            document.onmouseup = null;
+            document.onmousemove = null;
+        }
+    }
+
+    // ####################################################
+    // CHAT
+    // ####################################################
+
+    toggleChat() {
+        let chatRoom = this.getId('chatRoom');
+        if (this.isChatOpen == false) {
+            chatRoom.style.display = 'block';
+            chatRoom.style.top = '50%';
+            chatRoom.style.left = '50%';
+            this.sound('open');
+            this.isChatOpen = true;
+        } else {
+            chatRoom.style.display = 'none';
+            this.isChatOpen = false;
+        }
+    }
+
+    toggleChatEmoji() {
+        this.getId('chatEmoji').classList.toggle('show');
+    }
+
+    sendMessage() {
+        if (!this.thereIsConsumers()) {
+            chatMessage.value = '';
+            return;
+        }
+        let peer_msg = this.formatMsg(chatMessage.value);
+        if (!peer_msg) return;
+        let data = {
+            peer_name: this.peer_name,
+            peer_msg: peer_msg,
+        };
+        this.socket.emit('message', data);
+        this.setMsgAvatar('right', this.peer_name);
+        this.appendMessage('right', this.rightMsgAvatar, this.peer_name, peer_msg);
+        chatMessage.value = '';
+    }
+
+    showMessage(data) {
+        if (!this.isChatOpen) this.toggleChat();
+        this.setMsgAvatar('left', data.peer_name);
+        this.appendMessage('left', this.leftMsgAvatar, data.peer_name, data.peer_msg);
+        this.sound('message');
+    }
+
+    setMsgAvatar(avatar, peerName) {
+        let avatarImg = cfg.msgAvatar + '?name=' + peerName + '&size=32' + '&background=random&rounded=true';
+        avatar === 'left' ? (this.leftMsgAvatar = avatarImg) : (this.rightMsgAvatar = avatarImg);
+    }
+
+    appendMessage(side, img, from, msg) {
+        let time = this.getTimeNow();
+        let msgHTML = `
+        <div class="msg ${side}-msg">
+            <div class="msg-img" style="background-image: url('${img}')"></div>
+            <div class="msg-bubble">
+                <div class="msg-info">
+                    <div class="msg-info-name">${from}</div>
+                    <div class="msg-info-time">${time}</div>
+                </div>
+                <div class="msg-text">${msg}</div>
+            </div>
+        </div>
+        `;
+        this.collectMessages(time, from, msg);
+        chatMsger.insertAdjacentHTML('beforeend', msgHTML);
+        chatMsger.scrollTop += 500;
+    }
+
+    formatMsg(message) {
+        let urlRegex = /(https?:\/\/[^\s]+)/g;
+        return message.replace(urlRegex, (url) => {
+            if (message.match(/\.(jpeg|jpg|gif|png|tiff|bmp)$/))
+                return '<img src="' + url + '" alt="img" width="300" height="auto"/>';
+            return '<a href="' + url + '" target="_blank">' + url + '</a>';
+        });
+    }
+
+    collectMessages(time, from, msg) {
+        this.chatMessages.push({
+            time: time,
+            from: from,
+            msg: msg,
+        });
+    }
+
+    chatClean() {
+        Swal.fire({
+            background: swalBackground,
+            position: 'center',
+            title: 'Clean up chat Messages?',
+            imageUrl: image.delete,
+            showDenyButton: true,
+            confirmButtonText: `Yes`,
+            denyButtonText: `No`,
+            showClass: {
+                popup: 'animate__animated animate__fadeInDown',
+            },
+            hideClass: {
+                popup: 'animate__animated animate__fadeOutUp',
+            },
+        }).then((result) => {
+            if (result.isConfirmed) {
+                let msgs = chatMsger.firstChild;
+                while (msgs) {
+                    chatMsger.removeChild(msgs);
+                    msgs = chatMsger.firstChild;
+                }
+                this.chatMessages = [];
+            }
+        });
+    }
+
+    chatSave() {
+        if (this.chatMessages.length === 0) {
+            userLog('info', 'No chat messages to save', 'top-end');
+            return;
+        }
+
+        const newDate = new Date();
+        const date = newDate.toISOString().split('T')[0];
+        const time = newDate.toTimeString().split(' ')[0];
+
+        let a = document.createElement('a');
+        a.href = 'data:text/json;charset=utf-8,' + encodeURIComponent(JSON.stringify(this.chatMessages, null, 1));
+        a.download = `${date}-${time}` + '-CHAT.txt';
+        document.body.appendChild(a);
+        a.click();
+        setTimeout(() => {
+            document.body.removeChild(a);
+            window.URL.revokeObjectURL(url);
+        }, 100);
+    }
+
+    // ####################################################
+    // RECORDING
+    // ####################################################
+
+    toggleRecording() {
+        this.getId('recording').classList.toggle('show');
+    }
+
+    getSupportedMimeTypes() {
+        const possibleTypes = [
+            'video/webm;codecs=vp9,opus',
+            'video/webm;codecs=vp8,opus',
+            'video/webm;codecs=h264,opus',
+            'video/mp4;codecs=h264,aac',
+            'video/mp4',
+        ];
+        return possibleTypes.filter((mimeType) => {
+            return MediaRecorder.isTypeSupported(mimeType);
+        });
+    }
+
+    startRecording() {
+        recordedBlobs = [];
+        let options = this.getSupportedMimeTypes();
+        console.log('MediaRecorder supported options', options);
+        options = { mimeType: options[0] };
+        try {
+            if (this.isMobileDevice) {
+                // on mobile devices recording camera + audio
+                let newStream = this.getNewStream(this.localVideoStream, this.localAudioStream);
+                this.mediaRecorder = new MediaRecorder(newStream, options);
+                console.log('Created MediaRecorder', this.mediaRecorder, 'with options', options);
+                this.getId('swapCameraButton').className = 'hidden';
+                this._isRecording = true;
+                this.handleMediaRecorder();
+                this.event(_EVENTS.startRec);
+                this.sound('recStart');
+            } else {
+                // on desktop devices recording screen/window... + audio
+                const constraints = { video: true };
+                navigator.mediaDevices
+                    .getDisplayMedia(constraints)
+                    .then((screenStream) => {
+                        this.recScreenStream = this.getNewStream(screenStream, this.localAudioStream);
+                        this.mediaRecorder = new MediaRecorder(this.recScreenStream, options);
+                        console.log('Created MediaRecorder', this.mediaRecorder, 'with options', options);
+                        this._isRecording = true;
+                        this.handleMediaRecorder();
+                        this.event(_EVENTS.startRec);
+                        this.sound('recStart');
+                    })
+                    .catch((err) => {
+                        console.error('Error Unable to recording the screen + audio', err);
+                        this.userLog('error', 'Unable to recording the screen + audio reason: ' + err, 'top-end');
+                    });
+            }
+        } catch (err) {
+            console.error('Exception while creating MediaRecorder: ', err);
+            this.userLog('error', "Can't start stream recording reason: " + err, 'top-end');
+            return;
+        }
+    }
+
+    getNewStream(videoStream, audioStream) {
+        let newStream = null;
+        let videoStreamTrack = videoStream ? videoStream.getVideoTracks()[0] : undefined;
+        let audioStreamTrack = audioStream ? audioStream.getAudioTracks()[0] : undefined;
+        if (videoStreamTrack && audioStreamTrack) {
+            newStream = new MediaStream([videoStreamTrack, audioStreamTrack]);
+        } else if (videoStreamTrack) {
+            newStream = new MediaStream([videoStreamTrack]);
+        } else if (audioStreamTrack) {
+            newStream = new MediaStream([audioStreamTrack]);
+        }
+        return newStream;
+    }
+
+    handleMediaRecorder() {
+        this.mediaRecorder.start();
+        this.mediaRecorder.addEventListener('start', this.handleMediaRecorderStart);
+        this.mediaRecorder.addEventListener('dataavailable', this.handleMediaRecorderData);
+        this.mediaRecorder.addEventListener('stop', this.handleMediaRecorderStop);
+    }
+
+    handleMediaRecorderStart(evt) {
+        console.log('MediaRecorder started: ', evt);
+    }
+
+    handleMediaRecorderData(evt) {
+        console.log('MediaRecorder data: ', evt);
+        if (evt.data && evt.data.size > 0) recordedBlobs.push(evt.data);
+    }
+
+    handleMediaRecorderStop(evt) {
+        try {
+            console.log('MediaRecorder stopped: ', evt);
+            console.log('MediaRecorder Blobs: ', recordedBlobs);
+
+            const newDate = new Date();
+            const date = newDate.toISOString().split('T')[0];
+            const time = newDate.toTimeString().split(' ')[0];
+
+            const type = recordedBlobs[0].type.includes('mp4') ? 'mp4' : 'webm';
+            const blob = new Blob(recordedBlobs, { type: 'video/' + type });
+            const recFileName = `${date}-${time}` + '-REC.' + type;
+
+            console.log('MediaRecorder Download Blobs');
+            const url = window.URL.createObjectURL(blob);
+            const a = document.createElement('a');
+            a.style.display = 'none';
+            a.href = url;
+            a.download = recFileName;
+            document.body.appendChild(a);
+            a.click();
+            setTimeout(() => {
+                document.body.removeChild(a);
+                window.URL.revokeObjectURL(url);
+            }, 100);
+            console.log(`🔴 Recording FILE: ${recFileName} done 👍`);
+        } catch (ex) {
+            console.warn('Recording save failed', ex);
+        }
+    }
+
+    pauseRecording() {
+        this._isRecording = false;
+        this.mediaRecorder.pause();
+        this.event(_EVENTS.pauseRec);
+    }
+
+    resumeRecording() {
+        this._isRecording = true;
+        this.mediaRecorder.resume();
+        this.event(_EVENTS.resumeRec);
+    }
+
+    stopRecording() {
+        this._isRecording = false;
+        this.mediaRecorder.stop();
+        if (this.recScreenStream) {
+            this.recScreenStream.getTracks().forEach((track) => {
+                if (track.kind === 'video') track.stop();
+            });
+        }
+        if (this.isMobileDevice) this.getId('swapCameraButton').className = '';
+        this.getId('recordingStatus').innerHTML = '🔴 REC 0s';
+        this.event(_EVENTS.stopRec);
+        this.sound('recStop');
+    }
+}
diff --git a/public/js/landing.js b/public/js/landing.js
new file mode 100644
index 00000000..e90aaf7c
--- /dev/null
+++ b/public/js/landing.js
@@ -0,0 +1,58 @@
+!(function () {
+    window;
+    const e = document.documentElement;
+    if ((e.classList.remove('no-js'), e.classList.add('js'), document.body.classList.contains('has-animations'))) {
+        (window.sr = ScrollReveal()).reveal('.feature, .pricing-table-inner', {
+            duration: 600,
+            distance: '20px',
+            easing: 'cubic-bezier(0.5, -0.01, 0, 1.005)',
+            origin: 'bottom',
+            interval: 100,
+        }),
+            e.classList.add('anime-ready'),
+            anime
+                .timeline({ targets: '.hero-figure-box-05' })
+                .add({
+                    duration: 400,
+                    easing: 'easeInOutExpo',
+                    scaleX: [0.05, 0.05],
+                    scaleY: [0, 1],
+                    perspective: '500px',
+                    delay: anime.random(0, 400),
+                })
+                .add({ duration: 400, easing: 'easeInOutExpo', scaleX: 1 })
+                .add({
+                    duration: 800,
+                    rotateY: '-15deg',
+                    rotateX: '8deg',
+                    rotateZ: '-1deg',
+                }),
+            anime
+                .timeline({ targets: '.hero-figure-box-06, .hero-figure-box-07' })
+                .add({
+                    duration: 400,
+                    easing: 'easeInOutExpo',
+                    scaleX: [0.05, 0.05],
+                    scaleY: [0, 1],
+                    perspective: '500px',
+                    delay: anime.random(0, 400),
+                })
+                .add({ duration: 400, easing: 'easeInOutExpo', scaleX: 1 })
+                .add({ duration: 800, rotateZ: '20deg' }),
+            anime({
+                targets:
+                    '.hero-figure-box-01, .hero-figure-box-02, .hero-figure-box-03, .hero-figure-box-04, .hero-figure-box-08, .hero-figure-box-09, .hero-figure-box-10',
+                duration: anime.random(600, 800),
+                delay: anime.random(600, 800),
+                rotate: [
+                    anime.random(-360, 360),
+                    function (e) {
+                        return e.getAttribute('data-rotation');
+                    },
+                ],
+                scale: [0.7, 1],
+                opacity: [0, 1],
+                easing: 'easeInOutExpo',
+            });
+    }
+})();
diff --git a/public/js/newroom.js b/public/js/newroom.js
new file mode 100644
index 00000000..995c73ae
--- /dev/null
+++ b/public/js/newroom.js
@@ -0,0 +1,155 @@
+'use strict';
+
+let adjectives = [
+    'small',
+    'big',
+    'large',
+    'smelly',
+    'new',
+    'happy',
+    'shiny',
+    'old',
+    'clean',
+    'nice',
+    'bad',
+    'cool',
+    'hot',
+    'cold',
+    'warm',
+    'hungry',
+    'slow',
+    'fast',
+    'red',
+    'white',
+    'black',
+    'blue',
+    'green',
+    'basic',
+    'strong',
+    'cute',
+    'poor',
+    'nice',
+    'huge',
+    'rare',
+    'lucky',
+    'weak',
+    'tall',
+    'short',
+    'tiny',
+    'great',
+    'long',
+    'single',
+    'rich',
+    'young',
+    'dirty',
+    'fresh',
+    'brown',
+    'dark',
+    'crazy',
+    'sad',
+    'loud',
+    'brave',
+    'calm',
+    'silly',
+    'smart',
+];
+
+let nouns = [
+    'dog',
+    'bat',
+    'wrench',
+    'apple',
+    'pear',
+    'ghost',
+    'cat',
+    'wolf',
+    'squid',
+    'goat',
+    'snail',
+    'hat',
+    'sock',
+    'plum',
+    'bear',
+    'snake',
+    'turtle',
+    'horse',
+    'spoon',
+    'fork',
+    'spider',
+    'tree',
+    'chair',
+    'table',
+    'couch',
+    'towel',
+    'panda',
+    'bread',
+    'grape',
+    'cake',
+    'brick',
+    'rat',
+    'mouse',
+    'bird',
+    'oven',
+    'phone',
+    'photo',
+    'frog',
+    'bear',
+    'camel',
+    'sheep',
+    'shark',
+    'tiger',
+    'zebra',
+    'duck',
+    'eagle',
+    'fish',
+    'kitten',
+    'lobster',
+    'monkey',
+    'owl',
+    'puppy',
+    'pig',
+    'rabbit',
+    'fox',
+    'whale',
+    'beaver',
+    'gorilla',
+    'lizard',
+    'parrot',
+    'sloth',
+    'swan',
+];
+
+function getRandomNumber(length) {
+    let result = '';
+    let characters = '0123456789';
+    let charactersLength = characters.length;
+    for (let i = 0; i < length; i++) {
+        result += characters.charAt(Math.floor(Math.random() * charactersLength));
+    }
+    return result;
+}
+
+let adjective = adjectives[Math.floor(Math.random() * adjectives.length)];
+let noun = nouns[Math.floor(Math.random() * nouns.length)];
+let num = getRandomNumber(5);
+noun = noun.charAt(0).toUpperCase() + noun.substring(1);
+adjective = adjective.charAt(0).toUpperCase() + adjective.substring(1);
+document.getElementById('roomName').value = '';
+
+// ####################################################
+// TYPPING EFECT
+// ####################################################
+
+let i = 0;
+let txt = num + adjective + noun;
+let speed = 100;
+
+function typeWriter() {
+    if (i < txt.length) {
+        document.getElementById('roomName').value += txt.charAt(i);
+        i++;
+        setTimeout(typeWriter, speed);
+    }
+}
+
+typeWriter();
diff --git a/public/landing.html b/public/landing.html
new file mode 100644
index 00000000..4482cfd8
--- /dev/null
+++ b/public/landing.html
@@ -0,0 +1,246 @@
+<!DOCTYPE html>
+<html lang="en" class="no-js">
+    <head>
+        <!-- Title and Icon -->
+
+        <title>MiroTalk SFU a Free Video Calls and Screen Sharing.</title>
+        <link rel="shortcut icon" href="images/logo.svg" />
+        <link rel="apple-touch-icon" href="images/logo.svg" />
+
+        <!-- Meta Information -->
+
+        <meta charset="utf-8" />
+        <meta http-equiv="X-UA-Compatible" content="IE=edge" />
+        <meta name="viewport" content="width=device-width, initial-scale=1.0" />
+
+        <meta
+            name="description"
+            content="MiroTalk SFU powered by WebRTC and mediasoup, Real-time Simple Secure Fast video calls, messaging and screen sharing capabilities in the browser."
+        />
+        <meta
+            name="keywords"
+            content="webrtc, mediasoup, mediasoup-client, self hosted, voip, sip, real-time communications, chat, messaging, meet, webrtc stun, webrtc turn, video meeting, video chat, video conference, multi video chat, multi video conference, peer to peer, p2p, rtc, alternative to, zoom, microsoft teams, google meet, jitsi, meeting"
+        />
+
+        <!-- https://ogp.me -->
+
+        <meta property="og:type" content="app-webrtc" />
+        <meta property="og:site_name" content="MiroTalk SFU" />
+        <meta property="og:title" content="Click the link to make a call." />
+        <meta
+            property="og:description"
+            content="MiroTalk SFU calling provides real-time video calls, messaging and screen sharing."
+        />
+        <meta property="og:image" content="images/mirotalksfu.png" />
+
+        <!-- StyleSheet -->
+        <link rel="stylesheet" href="https://fonts.googleapis.com/css?family=IBM+Plex+Sans:400,600" />
+        <link rel="stylesheet" href="css/landing.css" />
+
+        <!-- Js scripts -->
+
+        <script src="https://unpkg.com/animejs@3.0.1/lib/anime.min.js"></script>
+        <script src="https://unpkg.com/scrollreveal@4.0.0/dist/scrollreveal.min.js"></script>
+    </head>
+    <body class="is-boxed has-animations">
+        <div class="body-wrap">
+            <header class="site-header">
+                <div class="container">
+                    <div class="site-header-inner">
+                        <div class="brand header-brand">
+                            <h1 class="m-0">
+                                <a href="/">
+                                    <img class="header-logo-image" src="images/logo.svg" alt="mirotalk-logo" />
+                                </a>
+                            </h1>
+                        </div>
+                    </div>
+                </div>
+            </header>
+
+            <main>
+                <section class="hero">
+                    <div class="container">
+                        <div class="hero-inner">
+                            <div class="hero-copy">
+                                <h1 class="hero-title mt-0">
+                                    MiroTalk SFU<br />Free browser based real-time video calls.<br />
+                                    Simple, Secure, Fast.
+                                </h1>
+                                <p class="hero-paragraph">
+                                    Start your next video call with a single click. No download, plug-in or login
+                                    required. Just get straight to talking, messaging and sharing your screen.
+                                </p>
+                                <div class="hero-cta">
+                                    <a class="button button-primary pulse" href="/newroom">TRY NOW</a>
+                                </div>
+                            </div>
+
+                            <div class="hero-figure anime-element">
+                                <svg class="placeholder" width="528" height="396" viewBox="0 0 528 396">
+                                    <rect width="528" height="396" style="fill: transparent" />
+                                </svg>
+                                <div class="hero-figure-box hero-figure-box-01" data-rotation="45deg"></div>
+                                <div class="hero-figure-box hero-figure-box-02" data-rotation="-45deg"></div>
+                                <div class="hero-figure-box hero-figure-box-03" data-rotation="0deg"></div>
+                                <div class="hero-figure-box hero-figure-box-04" data-rotation="-135deg"></div>
+                                <div class="hero-figure-box hero-figure-box-05"></div>
+                                <div class="hero-figure-box hero-figure-box-06"></div>
+                                <div class="hero-figure-box hero-figure-box-07"></div>
+                                <div class="hero-figure-box hero-figure-box-08" data-rotation="-22deg"></div>
+                                <div class="hero-figure-box hero-figure-box-09" data-rotation="-52deg"></div>
+                                <div class="hero-figure-box hero-figure-box-10" data-rotation="-50deg"></div>
+                            </div>
+                        </div>
+                    </div>
+                </section>
+
+                <section class="features section">
+                    <div class="container-sm">
+                        <div class="pricing-inner section-inner">
+                            <div class="pricing-header text-center">
+                                <h2 class="section-title mt-0">
+                                    Unlimited number of conference rooms and users without call time limitation!
+                                </h2>
+                                <p class="section-paragraph mb-0">
+                                    MiroTalk with SFU integrated Server. We engineered a platform with maximum video
+                                    quality lowest latency that makes your calls crystal clear.
+                                </p>
+                            </div>
+                        </div>
+                    </div>
+
+                    <div class="container">
+                        <div class="features-inner section-inner has-bottom-divider">
+                            <div class="features-wrap">
+                                <div class="feature text-center is-revealing">
+                                    <div class="feature-inner">
+                                        <div class="feature-icon">
+                                            <img src="images/feature-icon-01.svg" alt="mirotalksfu-screen" />
+                                        </div>
+                                        <h4 class="feature-title mt-24">Screen Sharing</h4>
+                                        <p class="text-sm mb-0">
+                                            Share your screen, application window, present your documents, slides and
+                                            more.
+                                        </p>
+                                    </div>
+                                </div>
+                                <div class="feature text-center is-revealing">
+                                    <div class="feature-inner">
+                                        <div class="feature-icon">
+                                            <img src="images/feature-icon-02.svg" alt="mirotalksfu-webcam" />
+                                        </div>
+                                        <h4 class="feature-title mt-24">WebCam Streaming</h4>
+                                        <p class="text-sm mb-0">
+                                            Having the webcam on, allows participants to make a deeper connection with
+                                            you. Up to 4k resolution.
+                                        </p>
+                                    </div>
+                                </div>
+                                <div class="feature text-center is-revealing">
+                                    <div class="feature-inner">
+                                        <div class="feature-icon">
+                                            <img src="images/feature-icon-03.svg" alt="mirotalksfu-audio" />
+                                        </div>
+                                        <h4 class="feature-title mt-24">Audio Streaming</h4>
+                                        <p class="text-sm mb-0">
+                                            Echo cancellation and noise suppression that makes your audio crystal clear.
+                                        </p>
+                                    </div>
+                                </div>
+                                <div class="feature text-center is-revealing">
+                                    <div class="feature-inner">
+                                        <div class="feature-icon">
+                                            <img src="images/feature-icon-04.svg" alt="mirotalksfu-chat" />
+                                        </div>
+                                        <h4 class="feature-title mt-24">Chat</h4>
+                                        <p class="text-sm mb-0">
+                                            Chat with others in meeting with integrated emoji picker to show you
+                                            feeling.
+                                        </p>
+                                    </div>
+                                </div>
+                                <div class="feature text-center is-revealing">
+                                    <div class="feature-inner">
+                                        <div class="feature-icon">
+                                            <img src="images/feature-icon-05.svg" alt="mirotalksfu-recording" />
+                                        </div>
+                                        <h4 class="feature-title mt-24">Recording meeting</h4>
+                                        <p class="text-sm mb-0">
+                                            Record your Screen, Video and Audio on Your browser Blobs. Save it for use
+                                            it in future or to share with others.
+                                        </p>
+                                    </div>
+                                </div>
+                                <div class="feature text-center is-revealing">
+                                    <div class="feature-inner">
+                                        <div class="feature-icon">
+                                            <img src="images/feature-icon-06.svg" alt="mirotalksfu-recording" />
+                                        </div>
+                                        <h4 class="feature-title mt-24">Total privacy</h4>
+                                        <p class="text-sm mb-0">
+                                            Data stays between you and your participants. MiroTalk SFU don't collect or
+                                            share personal information.
+                                        </p>
+                                    </div>
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                </section>
+
+                <section class="cta section">
+                    <div class="container">
+                        <h1 align="center">Meet the team</h1>
+                        <div align="center">
+                            <img src="images/miroslav-pejic.png" alt="Team member author" width="180" height="180" />
+                            <br />
+                            <a target="_blank" href="https://www.linkedin.com/in/miroslav-pejic-976a07101/">
+                                <h5 class="mt-0 mb-4">Miroslav Pejic</h5>
+                            </a>
+                            Full Stack Developer
+                            <br />
+                        </div>
+                    </div>
+                </section>
+            </main>
+
+            <footer class="site-footer">
+                <div class="container">
+                    <div class="site-footer-inner">
+                        <div class="brand footer-brand">
+                            <a href="/">
+                                <img class="header-logo-image" src="images/logo.svg" alt="Logo" />
+                            </a>
+                        </div>
+                        <ul class="footer-links list-reset">
+                            <li>
+                                Contact:
+                                <a target="_blank" href="https://www.linkedin.com/in/miroslav-pejic-976a07101/"
+                                    >Miroslav Pejic</a
+                                >
+                            </li>
+                        </ul>
+                        <ul class="footer-social-links list-reset">
+                            <li>
+                                <a target="_blank" href="https://github.com/miroslavpejic85/mirotalksfu">
+                                    <svg width="16" height="16" viewBox="0 0 16 16" xmlns="http://www.w3.org/2000/svg">
+                                        <title>GitHub</title>
+                                        <path
+                                            d="M7.95 0C3.578 0 0 3.578 0 7.95c0 3.479 2.286 6.46 5.466 7.553.397.1.497-.199.497-.397v-1.392c-2.187.497-2.683-.994-2.683-.994-.398-.894-.895-1.192-.895-1.192-.696-.497.1-.497.1-.497.795.1 1.192.795 1.192.795.696 1.292 1.888.894 2.286.696.1-.497.298-.895.497-1.093-1.79-.2-3.578-.895-3.578-3.976 0-.894.298-1.59.795-2.087-.1-.198-.397-.993.1-2.086 0 0 .695-.2 2.186.795a6.408 6.408 0 0 1 1.987-.299c.696 0 1.392.1 1.988.299 1.49-.994 2.186-.795 2.186-.795.398 1.093.199 1.888.1 2.086.496.597.795 1.292.795 2.087 0 3.081-1.889 3.677-3.677 3.876.298.398.596.895.596 1.59v2.187c0 .198.1.496.596.397C13.714 14.41 16 11.43 16 7.95 15.9 3.578 12.323 0 7.95 0z"
+                                            fill="#0270D7"
+                                        />
+                                    </svg>
+                                </a>
+                            </li>
+                        </ul>
+                        <div class="footer-copyright">&copy; 2021 MiroTalk SFU, all rights reserved</div>
+                    </div>
+                </div>
+            </footer>
+        </div>
+
+        <script src="js/landing.js"></script>
+        <script src="js/gtag.js"></script>
+    </body>
+</html>
diff --git a/public/modules/MediasoupClient.js b/public/modules/MediasoupClient.js
new file mode 100644
index 00000000..2af13586
--- /dev/null
+++ b/public/modules/MediasoupClient.js
@@ -0,0 +1,13394 @@
+(function () {
+    function r(e, n, t) {
+        function o(i, f) {
+            if (!n[i]) {
+                if (!e[i]) {
+                    var c = 'function' == typeof require && require;
+                    if (!f && c) return c(i, !0);
+                    if (u) return u(i, !0);
+                    var a = new Error("Cannot find module '" + i + "'");
+                    throw ((a.code = 'MODULE_NOT_FOUND'), a);
+                }
+                var p = (n[i] = { exports: {} });
+                e[i][0].call(
+                    p.exports,
+                    function (r) {
+                        var n = e[i][1][r];
+                        return o(n || r);
+                    },
+                    p,
+                    p.exports,
+                    r,
+                    e,
+                    n,
+                    t,
+                );
+            }
+            return n[i].exports;
+        }
+        for (var u = 'function' == typeof require && require, i = 0; i < t.length; i++) o(t[i]);
+        return o;
+    }
+    return r;
+})()(
+    {
+        1: [
+            function (require, module, exports) {
+                const client = require('mediasoup-client');
+                window.mediasoupClient = client;
+            },
+            { 'mediasoup-client': 35 },
+        ],
+        2: [
+            function (require, module, exports) {
+                'use strict';
+                var __awaiter =
+                    (this && this.__awaiter) ||
+                    function (thisArg, _arguments, P, generator) {
+                        function adopt(value) {
+                            return value instanceof P
+                                ? value
+                                : new P(function (resolve) {
+                                      resolve(value);
+                                  });
+                        }
+                        return new (P || (P = Promise))(function (resolve, reject) {
+                            function fulfilled(value) {
+                                try {
+                                    step(generator.next(value));
+                                } catch (e) {
+                                    reject(e);
+                                }
+                            }
+                            function rejected(value) {
+                                try {
+                                    step(generator['throw'](value));
+                                } catch (e) {
+                                    reject(e);
+                                }
+                            }
+                            function step(result) {
+                                result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected);
+                            }
+                            step((generator = generator.apply(thisArg, _arguments || [])).next());
+                        });
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                class AwaitQueue {
+                    constructor(
+                        { ClosedErrorClass = Error, StoppedErrorClass = Error } = {
+                            ClosedErrorClass: Error,
+                            StoppedErrorClass: Error,
+                        },
+                    ) {
+                        // Closed flag.
+                        this.closed = false;
+                        // Queue of pending tasks.
+                        this.pendingTasks = [];
+                        // Error class used when rejecting a task due to AwaitQueue being closed.
+                        this.ClosedErrorClass = Error;
+                        // Error class used when rejecting a task due to AwaitQueue being stopped.
+                        this.StoppedErrorClass = Error;
+                        this.ClosedErrorClass = ClosedErrorClass;
+                        this.StoppedErrorClass = StoppedErrorClass;
+                    }
+                    /**
+                     * The number of ongoing enqueued tasks.
+                     */
+                    get size() {
+                        return this.pendingTasks.length;
+                    }
+                    /**
+                     * Closes the AwaitQueue. Pending tasks will be rejected with ClosedErrorClass
+                     * error.
+                     */
+                    close() {
+                        if (this.closed) return;
+                        this.closed = true;
+                        for (const pendingTask of this.pendingTasks) {
+                            pendingTask.stopped = true;
+                            pendingTask.reject(new this.ClosedErrorClass('AwaitQueue closed'));
+                        }
+                        // Enpty the pending tasks array.
+                        this.pendingTasks.length = 0;
+                    }
+                    /**
+                     * Accepts a task as argument (and an optional task name) and enqueues it after
+                     * pending tasks. Once processed, the push() method resolves (or rejects) with
+                     * the result returned by the given task.
+                     *
+                     * The given task must return a Promise or directly a value.
+                     */
+                    push(task, name) {
+                        return __awaiter(this, void 0, void 0, function* () {
+                            if (this.closed) throw new this.ClosedErrorClass('AwaitQueue closed');
+                            if (typeof task !== 'function') throw new TypeError('given task is not a function');
+                            if (!task.name && name) {
+                                try {
+                                    Object.defineProperty(task, 'name', { value: name });
+                                } catch (error) {}
+                            }
+                            return new Promise((resolve, reject) => {
+                                const pendingTask = {
+                                    task,
+                                    name,
+                                    resolve,
+                                    reject,
+                                    stopped: false,
+                                    enqueuedAt: new Date(),
+                                    executedAt: undefined,
+                                };
+                                // Append task to the queue.
+                                this.pendingTasks.push(pendingTask);
+                                // And run it if this is the only task in the queue.
+                                if (this.pendingTasks.length === 1) this.next();
+                            });
+                        });
+                    }
+                    /**
+                     * Make ongoing pending tasks reject with the given StoppedErrorClass error.
+                     * The AwaitQueue instance is still usable for future tasks added via push()
+                     * method.
+                     */
+                    stop() {
+                        if (this.closed) return;
+                        for (const pendingTask of this.pendingTasks) {
+                            pendingTask.stopped = true;
+                            pendingTask.reject(new this.StoppedErrorClass('AwaitQueue stopped'));
+                        }
+                        // Enpty the pending tasks array.
+                        this.pendingTasks.length = 0;
+                    }
+                    dump() {
+                        const now = new Date();
+                        return this.pendingTasks.map((pendingTask) => {
+                            return {
+                                task: pendingTask.task,
+                                name: pendingTask.name,
+                                enqueuedTime: pendingTask.executedAt
+                                    ? pendingTask.executedAt.getTime() - pendingTask.enqueuedAt.getTime()
+                                    : now.getTime() - pendingTask.enqueuedAt.getTime(),
+                                executingTime: pendingTask.executedAt
+                                    ? now.getTime() - pendingTask.executedAt.getTime()
+                                    : 0,
+                            };
+                        });
+                    }
+                    next() {
+                        return __awaiter(this, void 0, void 0, function* () {
+                            // Take the first pending task.
+                            const pendingTask = this.pendingTasks[0];
+                            if (!pendingTask) return;
+                            // Execute it.
+                            yield this.executeTask(pendingTask);
+                            // Remove the first pending task (the completed one) from the queue.
+                            this.pendingTasks.shift();
+                            // And continue.
+                            this.next();
+                        });
+                    }
+                    executeTask(pendingTask) {
+                        return __awaiter(this, void 0, void 0, function* () {
+                            // If the task is stopped, ignore it.
+                            if (pendingTask.stopped) return;
+                            pendingTask.executedAt = new Date();
+                            try {
+                                const result = yield pendingTask.task();
+                                // If the task is stopped, ignore it.
+                                if (pendingTask.stopped) return;
+                                // Resolve the task with the returned result (if any).
+                                pendingTask.resolve(result);
+                            } catch (error) {
+                                // If the task is stopped, ignore it.
+                                if (pendingTask.stopped) return;
+                                // Reject the task with its own error.
+                                pendingTask.reject(error);
+                            }
+                        });
+                    }
+                }
+                exports.AwaitQueue = AwaitQueue;
+            },
+            {},
+        ],
+        3: [
+            function (require, module, exports) {
+                !(function (e, t) {
+                    'object' == typeof exports && 'object' == typeof module
+                        ? (module.exports = t())
+                        : 'function' == typeof define && define.amd
+                        ? define([], t)
+                        : 'object' == typeof exports
+                        ? (exports.bowser = t())
+                        : (e.bowser = t());
+                })(this, function () {
+                    return (function (e) {
+                        var t = {};
+                        function r(n) {
+                            if (t[n]) return t[n].exports;
+                            var i = (t[n] = { i: n, l: !1, exports: {} });
+                            return e[n].call(i.exports, i, i.exports, r), (i.l = !0), i.exports;
+                        }
+                        return (
+                            (r.m = e),
+                            (r.c = t),
+                            (r.d = function (e, t, n) {
+                                r.o(e, t) || Object.defineProperty(e, t, { enumerable: !0, get: n });
+                            }),
+                            (r.r = function (e) {
+                                'undefined' != typeof Symbol &&
+                                    Symbol.toStringTag &&
+                                    Object.defineProperty(e, Symbol.toStringTag, { value: 'Module' }),
+                                    Object.defineProperty(e, '__esModule', { value: !0 });
+                            }),
+                            (r.t = function (e, t) {
+                                if ((1 & t && (e = r(e)), 8 & t)) return e;
+                                if (4 & t && 'object' == typeof e && e && e.__esModule) return e;
+                                var n = Object.create(null);
+                                if (
+                                    (r.r(n),
+                                    Object.defineProperty(n, 'default', { enumerable: !0, value: e }),
+                                    2 & t && 'string' != typeof e)
+                                )
+                                    for (var i in e)
+                                        r.d(
+                                            n,
+                                            i,
+                                            function (t) {
+                                                return e[t];
+                                            }.bind(null, i),
+                                        );
+                                return n;
+                            }),
+                            (r.n = function (e) {
+                                var t =
+                                    e && e.__esModule
+                                        ? function () {
+                                              return e.default;
+                                          }
+                                        : function () {
+                                              return e;
+                                          };
+                                return r.d(t, 'a', t), t;
+                            }),
+                            (r.o = function (e, t) {
+                                return Object.prototype.hasOwnProperty.call(e, t);
+                            }),
+                            (r.p = ''),
+                            r((r.s = 90))
+                        );
+                    })({
+                        17: function (e, t, r) {
+                            'use strict';
+                            (t.__esModule = !0), (t.default = void 0);
+                            var n = r(18),
+                                i = (function () {
+                                    function e() {}
+                                    return (
+                                        (e.getFirstMatch = function (e, t) {
+                                            var r = t.match(e);
+                                            return (r && r.length > 0 && r[1]) || '';
+                                        }),
+                                        (e.getSecondMatch = function (e, t) {
+                                            var r = t.match(e);
+                                            return (r && r.length > 1 && r[2]) || '';
+                                        }),
+                                        (e.matchAndReturnConst = function (e, t, r) {
+                                            if (e.test(t)) return r;
+                                        }),
+                                        (e.getWindowsVersionName = function (e) {
+                                            switch (e) {
+                                                case 'NT':
+                                                    return 'NT';
+                                                case 'XP':
+                                                    return 'XP';
+                                                case 'NT 5.0':
+                                                    return '2000';
+                                                case 'NT 5.1':
+                                                    return 'XP';
+                                                case 'NT 5.2':
+                                                    return '2003';
+                                                case 'NT 6.0':
+                                                    return 'Vista';
+                                                case 'NT 6.1':
+                                                    return '7';
+                                                case 'NT 6.2':
+                                                    return '8';
+                                                case 'NT 6.3':
+                                                    return '8.1';
+                                                case 'NT 10.0':
+                                                    return '10';
+                                                default:
+                                                    return;
+                                            }
+                                        }),
+                                        (e.getMacOSVersionName = function (e) {
+                                            var t = e
+                                                .split('.')
+                                                .splice(0, 2)
+                                                .map(function (e) {
+                                                    return parseInt(e, 10) || 0;
+                                                });
+                                            if ((t.push(0), 10 === t[0]))
+                                                switch (t[1]) {
+                                                    case 5:
+                                                        return 'Leopard';
+                                                    case 6:
+                                                        return 'Snow Leopard';
+                                                    case 7:
+                                                        return 'Lion';
+                                                    case 8:
+                                                        return 'Mountain Lion';
+                                                    case 9:
+                                                        return 'Mavericks';
+                                                    case 10:
+                                                        return 'Yosemite';
+                                                    case 11:
+                                                        return 'El Capitan';
+                                                    case 12:
+                                                        return 'Sierra';
+                                                    case 13:
+                                                        return 'High Sierra';
+                                                    case 14:
+                                                        return 'Mojave';
+                                                    case 15:
+                                                        return 'Catalina';
+                                                    default:
+                                                        return;
+                                                }
+                                        }),
+                                        (e.getAndroidVersionName = function (e) {
+                                            var t = e
+                                                .split('.')
+                                                .splice(0, 2)
+                                                .map(function (e) {
+                                                    return parseInt(e, 10) || 0;
+                                                });
+                                            if ((t.push(0), !(1 === t[0] && t[1] < 5)))
+                                                return 1 === t[0] && t[1] < 6
+                                                    ? 'Cupcake'
+                                                    : 1 === t[0] && t[1] >= 6
+                                                    ? 'Donut'
+                                                    : 2 === t[0] && t[1] < 2
+                                                    ? 'Eclair'
+                                                    : 2 === t[0] && 2 === t[1]
+                                                    ? 'Froyo'
+                                                    : 2 === t[0] && t[1] > 2
+                                                    ? 'Gingerbread'
+                                                    : 3 === t[0]
+                                                    ? 'Honeycomb'
+                                                    : 4 === t[0] && t[1] < 1
+                                                    ? 'Ice Cream Sandwich'
+                                                    : 4 === t[0] && t[1] < 4
+                                                    ? 'Jelly Bean'
+                                                    : 4 === t[0] && t[1] >= 4
+                                                    ? 'KitKat'
+                                                    : 5 === t[0]
+                                                    ? 'Lollipop'
+                                                    : 6 === t[0]
+                                                    ? 'Marshmallow'
+                                                    : 7 === t[0]
+                                                    ? 'Nougat'
+                                                    : 8 === t[0]
+                                                    ? 'Oreo'
+                                                    : 9 === t[0]
+                                                    ? 'Pie'
+                                                    : void 0;
+                                        }),
+                                        (e.getVersionPrecision = function (e) {
+                                            return e.split('.').length;
+                                        }),
+                                        (e.compareVersions = function (t, r, n) {
+                                            void 0 === n && (n = !1);
+                                            var i = e.getVersionPrecision(t),
+                                                s = e.getVersionPrecision(r),
+                                                a = Math.max(i, s),
+                                                o = 0,
+                                                u = e.map([t, r], function (t) {
+                                                    var r = a - e.getVersionPrecision(t),
+                                                        n = t + new Array(r + 1).join('.0');
+                                                    return e
+                                                        .map(n.split('.'), function (e) {
+                                                            return new Array(20 - e.length).join('0') + e;
+                                                        })
+                                                        .reverse();
+                                                });
+                                            for (n && (o = a - Math.min(i, s)), a -= 1; a >= o; ) {
+                                                if (u[0][a] > u[1][a]) return 1;
+                                                if (u[0][a] === u[1][a]) {
+                                                    if (a === o) return 0;
+                                                    a -= 1;
+                                                } else if (u[0][a] < u[1][a]) return -1;
+                                            }
+                                        }),
+                                        (e.map = function (e, t) {
+                                            var r,
+                                                n = [];
+                                            if (Array.prototype.map) return Array.prototype.map.call(e, t);
+                                            for (r = 0; r < e.length; r += 1) n.push(t(e[r]));
+                                            return n;
+                                        }),
+                                        (e.find = function (e, t) {
+                                            var r, n;
+                                            if (Array.prototype.find) return Array.prototype.find.call(e, t);
+                                            for (r = 0, n = e.length; r < n; r += 1) {
+                                                var i = e[r];
+                                                if (t(i, r)) return i;
+                                            }
+                                        }),
+                                        (e.assign = function (e) {
+                                            for (
+                                                var t,
+                                                    r,
+                                                    n = e,
+                                                    i = arguments.length,
+                                                    s = new Array(i > 1 ? i - 1 : 0),
+                                                    a = 1;
+                                                a < i;
+                                                a++
+                                            )
+                                                s[a - 1] = arguments[a];
+                                            if (Object.assign) return Object.assign.apply(Object, [e].concat(s));
+                                            var o = function () {
+                                                var e = s[t];
+                                                'object' == typeof e &&
+                                                    null !== e &&
+                                                    Object.keys(e).forEach(function (t) {
+                                                        n[t] = e[t];
+                                                    });
+                                            };
+                                            for (t = 0, r = s.length; t < r; t += 1) o();
+                                            return e;
+                                        }),
+                                        (e.getBrowserAlias = function (e) {
+                                            return n.BROWSER_ALIASES_MAP[e];
+                                        }),
+                                        (e.getBrowserTypeByAlias = function (e) {
+                                            return n.BROWSER_MAP[e] || '';
+                                        }),
+                                        e
+                                    );
+                                })();
+                            (t.default = i), (e.exports = t.default);
+                        },
+                        18: function (e, t, r) {
+                            'use strict';
+                            (t.__esModule = !0),
+                                (t.ENGINE_MAP =
+                                    t.OS_MAP =
+                                    t.PLATFORMS_MAP =
+                                    t.BROWSER_MAP =
+                                    t.BROWSER_ALIASES_MAP =
+                                        void 0);
+                            t.BROWSER_ALIASES_MAP = {
+                                'Amazon Silk': 'amazon_silk',
+                                'Android Browser': 'android',
+                                Bada: 'bada',
+                                BlackBerry: 'blackberry',
+                                Chrome: 'chrome',
+                                Chromium: 'chromium',
+                                Electron: 'electron',
+                                Epiphany: 'epiphany',
+                                Firefox: 'firefox',
+                                Focus: 'focus',
+                                Generic: 'generic',
+                                'Google Search': 'google_search',
+                                Googlebot: 'googlebot',
+                                'Internet Explorer': 'ie',
+                                'K-Meleon': 'k_meleon',
+                                Maxthon: 'maxthon',
+                                'Microsoft Edge': 'edge',
+                                'MZ Browser': 'mz',
+                                'NAVER Whale Browser': 'naver',
+                                Opera: 'opera',
+                                'Opera Coast': 'opera_coast',
+                                PhantomJS: 'phantomjs',
+                                Puffin: 'puffin',
+                                QupZilla: 'qupzilla',
+                                QQ: 'qq',
+                                QQLite: 'qqlite',
+                                Safari: 'safari',
+                                Sailfish: 'sailfish',
+                                'Samsung Internet for Android': 'samsung_internet',
+                                SeaMonkey: 'seamonkey',
+                                Sleipnir: 'sleipnir',
+                                Swing: 'swing',
+                                Tizen: 'tizen',
+                                'UC Browser': 'uc',
+                                Vivaldi: 'vivaldi',
+                                'WebOS Browser': 'webos',
+                                WeChat: 'wechat',
+                                'Yandex Browser': 'yandex',
+                                Roku: 'roku',
+                            };
+                            t.BROWSER_MAP = {
+                                amazon_silk: 'Amazon Silk',
+                                android: 'Android Browser',
+                                bada: 'Bada',
+                                blackberry: 'BlackBerry',
+                                chrome: 'Chrome',
+                                chromium: 'Chromium',
+                                electron: 'Electron',
+                                epiphany: 'Epiphany',
+                                firefox: 'Firefox',
+                                focus: 'Focus',
+                                generic: 'Generic',
+                                googlebot: 'Googlebot',
+                                google_search: 'Google Search',
+                                ie: 'Internet Explorer',
+                                k_meleon: 'K-Meleon',
+                                maxthon: 'Maxthon',
+                                edge: 'Microsoft Edge',
+                                mz: 'MZ Browser',
+                                naver: 'NAVER Whale Browser',
+                                opera: 'Opera',
+                                opera_coast: 'Opera Coast',
+                                phantomjs: 'PhantomJS',
+                                puffin: 'Puffin',
+                                qupzilla: 'QupZilla',
+                                qq: 'QQ Browser',
+                                qqlite: 'QQ Browser Lite',
+                                safari: 'Safari',
+                                sailfish: 'Sailfish',
+                                samsung_internet: 'Samsung Internet for Android',
+                                seamonkey: 'SeaMonkey',
+                                sleipnir: 'Sleipnir',
+                                swing: 'Swing',
+                                tizen: 'Tizen',
+                                uc: 'UC Browser',
+                                vivaldi: 'Vivaldi',
+                                webos: 'WebOS Browser',
+                                wechat: 'WeChat',
+                                yandex: 'Yandex Browser',
+                            };
+                            t.PLATFORMS_MAP = { tablet: 'tablet', mobile: 'mobile', desktop: 'desktop', tv: 'tv' };
+                            t.OS_MAP = {
+                                WindowsPhone: 'Windows Phone',
+                                Windows: 'Windows',
+                                MacOS: 'macOS',
+                                iOS: 'iOS',
+                                Android: 'Android',
+                                WebOS: 'WebOS',
+                                BlackBerry: 'BlackBerry',
+                                Bada: 'Bada',
+                                Tizen: 'Tizen',
+                                Linux: 'Linux',
+                                ChromeOS: 'Chrome OS',
+                                PlayStation4: 'PlayStation 4',
+                                Roku: 'Roku',
+                            };
+                            t.ENGINE_MAP = {
+                                EdgeHTML: 'EdgeHTML',
+                                Blink: 'Blink',
+                                Trident: 'Trident',
+                                Presto: 'Presto',
+                                Gecko: 'Gecko',
+                                WebKit: 'WebKit',
+                            };
+                        },
+                        90: function (e, t, r) {
+                            'use strict';
+                            (t.__esModule = !0), (t.default = void 0);
+                            var n,
+                                i = (n = r(91)) && n.__esModule ? n : { default: n },
+                                s = r(18);
+                            function a(e, t) {
+                                for (var r = 0; r < t.length; r++) {
+                                    var n = t[r];
+                                    (n.enumerable = n.enumerable || !1),
+                                        (n.configurable = !0),
+                                        'value' in n && (n.writable = !0),
+                                        Object.defineProperty(e, n.key, n);
+                                }
+                            }
+                            var o = (function () {
+                                function e() {}
+                                var t, r, n;
+                                return (
+                                    (e.getParser = function (e, t) {
+                                        if ((void 0 === t && (t = !1), 'string' != typeof e))
+                                            throw new Error('UserAgent should be a string');
+                                        return new i.default(e, t);
+                                    }),
+                                    (e.parse = function (e) {
+                                        return new i.default(e).getResult();
+                                    }),
+                                    (t = e),
+                                    (n = [
+                                        {
+                                            key: 'BROWSER_MAP',
+                                            get: function () {
+                                                return s.BROWSER_MAP;
+                                            },
+                                        },
+                                        {
+                                            key: 'ENGINE_MAP',
+                                            get: function () {
+                                                return s.ENGINE_MAP;
+                                            },
+                                        },
+                                        {
+                                            key: 'OS_MAP',
+                                            get: function () {
+                                                return s.OS_MAP;
+                                            },
+                                        },
+                                        {
+                                            key: 'PLATFORMS_MAP',
+                                            get: function () {
+                                                return s.PLATFORMS_MAP;
+                                            },
+                                        },
+                                    ]),
+                                    (r = null) && a(t.prototype, r),
+                                    n && a(t, n),
+                                    e
+                                );
+                            })();
+                            (t.default = o), (e.exports = t.default);
+                        },
+                        91: function (e, t, r) {
+                            'use strict';
+                            (t.__esModule = !0), (t.default = void 0);
+                            var n = u(r(92)),
+                                i = u(r(93)),
+                                s = u(r(94)),
+                                a = u(r(95)),
+                                o = u(r(17));
+                            function u(e) {
+                                return e && e.__esModule ? e : { default: e };
+                            }
+                            var d = (function () {
+                                function e(e, t) {
+                                    if ((void 0 === t && (t = !1), null == e || '' === e))
+                                        throw new Error("UserAgent parameter can't be empty");
+                                    (this._ua = e), (this.parsedResult = {}), !0 !== t && this.parse();
+                                }
+                                var t = e.prototype;
+                                return (
+                                    (t.getUA = function () {
+                                        return this._ua;
+                                    }),
+                                    (t.test = function (e) {
+                                        return e.test(this._ua);
+                                    }),
+                                    (t.parseBrowser = function () {
+                                        var e = this;
+                                        this.parsedResult.browser = {};
+                                        var t = o.default.find(n.default, function (t) {
+                                            if ('function' == typeof t.test) return t.test(e);
+                                            if (t.test instanceof Array)
+                                                return t.test.some(function (t) {
+                                                    return e.test(t);
+                                                });
+                                            throw new Error("Browser's test function is not valid");
+                                        });
+                                        return (
+                                            t && (this.parsedResult.browser = t.describe(this.getUA())),
+                                            this.parsedResult.browser
+                                        );
+                                    }),
+                                    (t.getBrowser = function () {
+                                        return this.parsedResult.browser
+                                            ? this.parsedResult.browser
+                                            : this.parseBrowser();
+                                    }),
+                                    (t.getBrowserName = function (e) {
+                                        return e
+                                            ? String(this.getBrowser().name).toLowerCase() || ''
+                                            : this.getBrowser().name || '';
+                                    }),
+                                    (t.getBrowserVersion = function () {
+                                        return this.getBrowser().version;
+                                    }),
+                                    (t.getOS = function () {
+                                        return this.parsedResult.os ? this.parsedResult.os : this.parseOS();
+                                    }),
+                                    (t.parseOS = function () {
+                                        var e = this;
+                                        this.parsedResult.os = {};
+                                        var t = o.default.find(i.default, function (t) {
+                                            if ('function' == typeof t.test) return t.test(e);
+                                            if (t.test instanceof Array)
+                                                return t.test.some(function (t) {
+                                                    return e.test(t);
+                                                });
+                                            throw new Error("Browser's test function is not valid");
+                                        });
+                                        return (
+                                            t && (this.parsedResult.os = t.describe(this.getUA())), this.parsedResult.os
+                                        );
+                                    }),
+                                    (t.getOSName = function (e) {
+                                        var t = this.getOS().name;
+                                        return e ? String(t).toLowerCase() || '' : t || '';
+                                    }),
+                                    (t.getOSVersion = function () {
+                                        return this.getOS().version;
+                                    }),
+                                    (t.getPlatform = function () {
+                                        return this.parsedResult.platform
+                                            ? this.parsedResult.platform
+                                            : this.parsePlatform();
+                                    }),
+                                    (t.getPlatformType = function (e) {
+                                        void 0 === e && (e = !1);
+                                        var t = this.getPlatform().type;
+                                        return e ? String(t).toLowerCase() || '' : t || '';
+                                    }),
+                                    (t.parsePlatform = function () {
+                                        var e = this;
+                                        this.parsedResult.platform = {};
+                                        var t = o.default.find(s.default, function (t) {
+                                            if ('function' == typeof t.test) return t.test(e);
+                                            if (t.test instanceof Array)
+                                                return t.test.some(function (t) {
+                                                    return e.test(t);
+                                                });
+                                            throw new Error("Browser's test function is not valid");
+                                        });
+                                        return (
+                                            t && (this.parsedResult.platform = t.describe(this.getUA())),
+                                            this.parsedResult.platform
+                                        );
+                                    }),
+                                    (t.getEngine = function () {
+                                        return this.parsedResult.engine ? this.parsedResult.engine : this.parseEngine();
+                                    }),
+                                    (t.getEngineName = function (e) {
+                                        return e
+                                            ? String(this.getEngine().name).toLowerCase() || ''
+                                            : this.getEngine().name || '';
+                                    }),
+                                    (t.parseEngine = function () {
+                                        var e = this;
+                                        this.parsedResult.engine = {};
+                                        var t = o.default.find(a.default, function (t) {
+                                            if ('function' == typeof t.test) return t.test(e);
+                                            if (t.test instanceof Array)
+                                                return t.test.some(function (t) {
+                                                    return e.test(t);
+                                                });
+                                            throw new Error("Browser's test function is not valid");
+                                        });
+                                        return (
+                                            t && (this.parsedResult.engine = t.describe(this.getUA())),
+                                            this.parsedResult.engine
+                                        );
+                                    }),
+                                    (t.parse = function () {
+                                        return (
+                                            this.parseBrowser(),
+                                            this.parseOS(),
+                                            this.parsePlatform(),
+                                            this.parseEngine(),
+                                            this
+                                        );
+                                    }),
+                                    (t.getResult = function () {
+                                        return o.default.assign({}, this.parsedResult);
+                                    }),
+                                    (t.satisfies = function (e) {
+                                        var t = this,
+                                            r = {},
+                                            n = 0,
+                                            i = {},
+                                            s = 0;
+                                        if (
+                                            (Object.keys(e).forEach(function (t) {
+                                                var a = e[t];
+                                                'string' == typeof a
+                                                    ? ((i[t] = a), (s += 1))
+                                                    : 'object' == typeof a && ((r[t] = a), (n += 1));
+                                            }),
+                                            n > 0)
+                                        ) {
+                                            var a = Object.keys(r),
+                                                u = o.default.find(a, function (e) {
+                                                    return t.isOS(e);
+                                                });
+                                            if (u) {
+                                                var d = this.satisfies(r[u]);
+                                                if (void 0 !== d) return d;
+                                            }
+                                            var c = o.default.find(a, function (e) {
+                                                return t.isPlatform(e);
+                                            });
+                                            if (c) {
+                                                var f = this.satisfies(r[c]);
+                                                if (void 0 !== f) return f;
+                                            }
+                                        }
+                                        if (s > 0) {
+                                            var l = Object.keys(i),
+                                                h = o.default.find(l, function (e) {
+                                                    return t.isBrowser(e, !0);
+                                                });
+                                            if (void 0 !== h) return this.compareVersion(i[h]);
+                                        }
+                                    }),
+                                    (t.isBrowser = function (e, t) {
+                                        void 0 === t && (t = !1);
+                                        var r = this.getBrowserName().toLowerCase(),
+                                            n = e.toLowerCase(),
+                                            i = o.default.getBrowserTypeByAlias(n);
+                                        return t && i && (n = i.toLowerCase()), n === r;
+                                    }),
+                                    (t.compareVersion = function (e) {
+                                        var t = [0],
+                                            r = e,
+                                            n = !1,
+                                            i = this.getBrowserVersion();
+                                        if ('string' == typeof i)
+                                            return (
+                                                '>' === e[0] || '<' === e[0]
+                                                    ? ((r = e.substr(1)),
+                                                      '=' === e[1] ? ((n = !0), (r = e.substr(2))) : (t = []),
+                                                      '>' === e[0] ? t.push(1) : t.push(-1))
+                                                    : '=' === e[0]
+                                                    ? (r = e.substr(1))
+                                                    : '~' === e[0] && ((n = !0), (r = e.substr(1))),
+                                                t.indexOf(o.default.compareVersions(i, r, n)) > -1
+                                            );
+                                    }),
+                                    (t.isOS = function (e) {
+                                        return this.getOSName(!0) === String(e).toLowerCase();
+                                    }),
+                                    (t.isPlatform = function (e) {
+                                        return this.getPlatformType(!0) === String(e).toLowerCase();
+                                    }),
+                                    (t.isEngine = function (e) {
+                                        return this.getEngineName(!0) === String(e).toLowerCase();
+                                    }),
+                                    (t.is = function (e, t) {
+                                        return (
+                                            void 0 === t && (t = !1),
+                                            this.isBrowser(e, t) || this.isOS(e) || this.isPlatform(e)
+                                        );
+                                    }),
+                                    (t.some = function (e) {
+                                        var t = this;
+                                        return (
+                                            void 0 === e && (e = []),
+                                            e.some(function (e) {
+                                                return t.is(e);
+                                            })
+                                        );
+                                    }),
+                                    e
+                                );
+                            })();
+                            (t.default = d), (e.exports = t.default);
+                        },
+                        92: function (e, t, r) {
+                            'use strict';
+                            (t.__esModule = !0), (t.default = void 0);
+                            var n,
+                                i = (n = r(17)) && n.__esModule ? n : { default: n };
+                            var s = /version\/(\d+(\.?_?\d+)+)/i,
+                                a = [
+                                    {
+                                        test: [/googlebot/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Googlebot' },
+                                                r =
+                                                    i.default.getFirstMatch(/googlebot\/(\d+(\.\d+))/i, e) ||
+                                                    i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/opera/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Opera' },
+                                                r =
+                                                    i.default.getFirstMatch(s, e) ||
+                                                    i.default.getFirstMatch(/(?:opera)[\s/](\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/opr\/|opios/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Opera' },
+                                                r =
+                                                    i.default.getFirstMatch(/(?:opr|opios)[\s/](\S+)/i, e) ||
+                                                    i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/SamsungBrowser/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Samsung Internet for Android' },
+                                                r =
+                                                    i.default.getFirstMatch(s, e) ||
+                                                    i.default.getFirstMatch(
+                                                        /(?:SamsungBrowser)[\s/](\d+(\.?_?\d+)+)/i,
+                                                        e,
+                                                    );
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/Whale/i],
+                                        describe: function (e) {
+                                            var t = { name: 'NAVER Whale Browser' },
+                                                r =
+                                                    i.default.getFirstMatch(s, e) ||
+                                                    i.default.getFirstMatch(/(?:whale)[\s/](\d+(?:\.\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/MZBrowser/i],
+                                        describe: function (e) {
+                                            var t = { name: 'MZ Browser' },
+                                                r =
+                                                    i.default.getFirstMatch(/(?:MZBrowser)[\s/](\d+(?:\.\d+)+)/i, e) ||
+                                                    i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/focus/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Focus' },
+                                                r =
+                                                    i.default.getFirstMatch(/(?:focus)[\s/](\d+(?:\.\d+)+)/i, e) ||
+                                                    i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/swing/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Swing' },
+                                                r =
+                                                    i.default.getFirstMatch(/(?:swing)[\s/](\d+(?:\.\d+)+)/i, e) ||
+                                                    i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/coast/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Opera Coast' },
+                                                r =
+                                                    i.default.getFirstMatch(s, e) ||
+                                                    i.default.getFirstMatch(/(?:coast)[\s/](\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/opt\/\d+(?:.?_?\d+)+/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Opera Touch' },
+                                                r =
+                                                    i.default.getFirstMatch(/(?:opt)[\s/](\d+(\.?_?\d+)+)/i, e) ||
+                                                    i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/yabrowser/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Yandex Browser' },
+                                                r =
+                                                    i.default.getFirstMatch(/(?:yabrowser)[\s/](\d+(\.?_?\d+)+)/i, e) ||
+                                                    i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/ucbrowser/i],
+                                        describe: function (e) {
+                                            var t = { name: 'UC Browser' },
+                                                r =
+                                                    i.default.getFirstMatch(s, e) ||
+                                                    i.default.getFirstMatch(/(?:ucbrowser)[\s/](\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/Maxthon|mxios/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Maxthon' },
+                                                r =
+                                                    i.default.getFirstMatch(s, e) ||
+                                                    i.default.getFirstMatch(
+                                                        /(?:Maxthon|mxios)[\s/](\d+(\.?_?\d+)+)/i,
+                                                        e,
+                                                    );
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/epiphany/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Epiphany' },
+                                                r =
+                                                    i.default.getFirstMatch(s, e) ||
+                                                    i.default.getFirstMatch(/(?:epiphany)[\s/](\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/puffin/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Puffin' },
+                                                r =
+                                                    i.default.getFirstMatch(s, e) ||
+                                                    i.default.getFirstMatch(/(?:puffin)[\s/](\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/sleipnir/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Sleipnir' },
+                                                r =
+                                                    i.default.getFirstMatch(s, e) ||
+                                                    i.default.getFirstMatch(/(?:sleipnir)[\s/](\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/k-meleon/i],
+                                        describe: function (e) {
+                                            var t = { name: 'K-Meleon' },
+                                                r =
+                                                    i.default.getFirstMatch(s, e) ||
+                                                    i.default.getFirstMatch(/(?:k-meleon)[\s/](\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/micromessenger/i],
+                                        describe: function (e) {
+                                            var t = { name: 'WeChat' },
+                                                r =
+                                                    i.default.getFirstMatch(
+                                                        /(?:micromessenger)[\s/](\d+(\.?_?\d+)+)/i,
+                                                        e,
+                                                    ) || i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/qqbrowser/i],
+                                        describe: function (e) {
+                                            var t = {
+                                                    name: /qqbrowserlite/i.test(e) ? 'QQ Browser Lite' : 'QQ Browser',
+                                                },
+                                                r =
+                                                    i.default.getFirstMatch(
+                                                        /(?:qqbrowserlite|qqbrowser)[/](\d+(\.?_?\d+)+)/i,
+                                                        e,
+                                                    ) || i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/msie|trident/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Internet Explorer' },
+                                                r = i.default.getFirstMatch(/(?:msie |rv:)(\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/\sedg\//i],
+                                        describe: function (e) {
+                                            var t = { name: 'Microsoft Edge' },
+                                                r = i.default.getFirstMatch(/\sedg\/(\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/edg([ea]|ios)/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Microsoft Edge' },
+                                                r = i.default.getSecondMatch(/edg([ea]|ios)\/(\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/vivaldi/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Vivaldi' },
+                                                r = i.default.getFirstMatch(/vivaldi\/(\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/seamonkey/i],
+                                        describe: function (e) {
+                                            var t = { name: 'SeaMonkey' },
+                                                r = i.default.getFirstMatch(/seamonkey\/(\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/sailfish/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Sailfish' },
+                                                r = i.default.getFirstMatch(/sailfish\s?browser\/(\d+(\.\d+)?)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/silk/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Amazon Silk' },
+                                                r = i.default.getFirstMatch(/silk\/(\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/phantom/i],
+                                        describe: function (e) {
+                                            var t = { name: 'PhantomJS' },
+                                                r = i.default.getFirstMatch(/phantomjs\/(\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/slimerjs/i],
+                                        describe: function (e) {
+                                            var t = { name: 'SlimerJS' },
+                                                r = i.default.getFirstMatch(/slimerjs\/(\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/blackberry|\bbb\d+/i, /rim\stablet/i],
+                                        describe: function (e) {
+                                            var t = { name: 'BlackBerry' },
+                                                r =
+                                                    i.default.getFirstMatch(s, e) ||
+                                                    i.default.getFirstMatch(/blackberry[\d]+\/(\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/(web|hpw)[o0]s/i],
+                                        describe: function (e) {
+                                            var t = { name: 'WebOS Browser' },
+                                                r =
+                                                    i.default.getFirstMatch(s, e) ||
+                                                    i.default.getFirstMatch(
+                                                        /w(?:eb)?[o0]sbrowser\/(\d+(\.?_?\d+)+)/i,
+                                                        e,
+                                                    );
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/bada/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Bada' },
+                                                r = i.default.getFirstMatch(/dolfin\/(\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/tizen/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Tizen' },
+                                                r =
+                                                    i.default.getFirstMatch(
+                                                        /(?:tizen\s?)?browser\/(\d+(\.?_?\d+)+)/i,
+                                                        e,
+                                                    ) || i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/qupzilla/i],
+                                        describe: function (e) {
+                                            var t = { name: 'QupZilla' },
+                                                r =
+                                                    i.default.getFirstMatch(/(?:qupzilla)[\s/](\d+(\.?_?\d+)+)/i, e) ||
+                                                    i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/firefox|iceweasel|fxios/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Firefox' },
+                                                r = i.default.getFirstMatch(
+                                                    /(?:firefox|iceweasel|fxios)[\s/](\d+(\.?_?\d+)+)/i,
+                                                    e,
+                                                );
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/electron/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Electron' },
+                                                r = i.default.getFirstMatch(/(?:electron)\/(\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/MiuiBrowser/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Miui' },
+                                                r = i.default.getFirstMatch(/(?:MiuiBrowser)[\s/](\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/chromium/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Chromium' },
+                                                r =
+                                                    i.default.getFirstMatch(/(?:chromium)[\s/](\d+(\.?_?\d+)+)/i, e) ||
+                                                    i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/chrome|crios|crmo/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Chrome' },
+                                                r = i.default.getFirstMatch(
+                                                    /(?:chrome|crios|crmo)\/(\d+(\.?_?\d+)+)/i,
+                                                    e,
+                                                );
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/GSA/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Google Search' },
+                                                r = i.default.getFirstMatch(/(?:GSA)\/(\d+(\.?_?\d+)+)/i, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: function (e) {
+                                            var t = !e.test(/like android/i),
+                                                r = e.test(/android/i);
+                                            return t && r;
+                                        },
+                                        describe: function (e) {
+                                            var t = { name: 'Android Browser' },
+                                                r = i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/playstation 4/i],
+                                        describe: function (e) {
+                                            var t = { name: 'PlayStation 4' },
+                                                r = i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/safari|applewebkit/i],
+                                        describe: function (e) {
+                                            var t = { name: 'Safari' },
+                                                r = i.default.getFirstMatch(s, e);
+                                            return r && (t.version = r), t;
+                                        },
+                                    },
+                                    {
+                                        test: [/.*/i],
+                                        describe: function (e) {
+                                            var t = -1 !== e.search('\\(') ? /^(.*)\/(.*)[ \t]\((.*)/ : /^(.*)\/(.*) /;
+                                            return {
+                                                name: i.default.getFirstMatch(t, e),
+                                                version: i.default.getSecondMatch(t, e),
+                                            };
+                                        },
+                                    },
+                                ];
+                            (t.default = a), (e.exports = t.default);
+                        },
+                        93: function (e, t, r) {
+                            'use strict';
+                            (t.__esModule = !0), (t.default = void 0);
+                            var n,
+                                i = (n = r(17)) && n.__esModule ? n : { default: n },
+                                s = r(18);
+                            var a = [
+                                {
+                                    test: [/Roku\/DVP/],
+                                    describe: function (e) {
+                                        var t = i.default.getFirstMatch(/Roku\/DVP-(\d+\.\d+)/i, e);
+                                        return { name: s.OS_MAP.Roku, version: t };
+                                    },
+                                },
+                                {
+                                    test: [/windows phone/i],
+                                    describe: function (e) {
+                                        var t = i.default.getFirstMatch(/windows phone (?:os)?\s?(\d+(\.\d+)*)/i, e);
+                                        return { name: s.OS_MAP.WindowsPhone, version: t };
+                                    },
+                                },
+                                {
+                                    test: [/windows /i],
+                                    describe: function (e) {
+                                        var t = i.default.getFirstMatch(/Windows ((NT|XP)( \d\d?.\d)?)/i, e),
+                                            r = i.default.getWindowsVersionName(t);
+                                        return { name: s.OS_MAP.Windows, version: t, versionName: r };
+                                    },
+                                },
+                                {
+                                    test: [/Macintosh(.*?) FxiOS(.*?)\//],
+                                    describe: function (e) {
+                                        var t = { name: s.OS_MAP.iOS },
+                                            r = i.default.getSecondMatch(/(Version\/)(\d[\d.]+)/, e);
+                                        return r && (t.version = r), t;
+                                    },
+                                },
+                                {
+                                    test: [/macintosh/i],
+                                    describe: function (e) {
+                                        var t = i.default
+                                                .getFirstMatch(/mac os x (\d+(\.?_?\d+)+)/i, e)
+                                                .replace(/[_\s]/g, '.'),
+                                            r = i.default.getMacOSVersionName(t),
+                                            n = { name: s.OS_MAP.MacOS, version: t };
+                                        return r && (n.versionName = r), n;
+                                    },
+                                },
+                                {
+                                    test: [/(ipod|iphone|ipad)/i],
+                                    describe: function (e) {
+                                        var t = i.default
+                                            .getFirstMatch(/os (\d+([_\s]\d+)*) like mac os x/i, e)
+                                            .replace(/[_\s]/g, '.');
+                                        return { name: s.OS_MAP.iOS, version: t };
+                                    },
+                                },
+                                {
+                                    test: function (e) {
+                                        var t = !e.test(/like android/i),
+                                            r = e.test(/android/i);
+                                        return t && r;
+                                    },
+                                    describe: function (e) {
+                                        var t = i.default.getFirstMatch(/android[\s/-](\d+(\.\d+)*)/i, e),
+                                            r = i.default.getAndroidVersionName(t),
+                                            n = { name: s.OS_MAP.Android, version: t };
+                                        return r && (n.versionName = r), n;
+                                    },
+                                },
+                                {
+                                    test: [/(web|hpw)[o0]s/i],
+                                    describe: function (e) {
+                                        var t = i.default.getFirstMatch(/(?:web|hpw)[o0]s\/(\d+(\.\d+)*)/i, e),
+                                            r = { name: s.OS_MAP.WebOS };
+                                        return t && t.length && (r.version = t), r;
+                                    },
+                                },
+                                {
+                                    test: [/blackberry|\bbb\d+/i, /rim\stablet/i],
+                                    describe: function (e) {
+                                        var t =
+                                            i.default.getFirstMatch(/rim\stablet\sos\s(\d+(\.\d+)*)/i, e) ||
+                                            i.default.getFirstMatch(/blackberry\d+\/(\d+([_\s]\d+)*)/i, e) ||
+                                            i.default.getFirstMatch(/\bbb(\d+)/i, e);
+                                        return { name: s.OS_MAP.BlackBerry, version: t };
+                                    },
+                                },
+                                {
+                                    test: [/bada/i],
+                                    describe: function (e) {
+                                        var t = i.default.getFirstMatch(/bada\/(\d+(\.\d+)*)/i, e);
+                                        return { name: s.OS_MAP.Bada, version: t };
+                                    },
+                                },
+                                {
+                                    test: [/tizen/i],
+                                    describe: function (e) {
+                                        var t = i.default.getFirstMatch(/tizen[/\s](\d+(\.\d+)*)/i, e);
+                                        return { name: s.OS_MAP.Tizen, version: t };
+                                    },
+                                },
+                                {
+                                    test: [/linux/i],
+                                    describe: function () {
+                                        return { name: s.OS_MAP.Linux };
+                                    },
+                                },
+                                {
+                                    test: [/CrOS/],
+                                    describe: function () {
+                                        return { name: s.OS_MAP.ChromeOS };
+                                    },
+                                },
+                                {
+                                    test: [/PlayStation 4/],
+                                    describe: function (e) {
+                                        var t = i.default.getFirstMatch(/PlayStation 4[/\s](\d+(\.\d+)*)/i, e);
+                                        return { name: s.OS_MAP.PlayStation4, version: t };
+                                    },
+                                },
+                            ];
+                            (t.default = a), (e.exports = t.default);
+                        },
+                        94: function (e, t, r) {
+                            'use strict';
+                            (t.__esModule = !0), (t.default = void 0);
+                            var n,
+                                i = (n = r(17)) && n.__esModule ? n : { default: n },
+                                s = r(18);
+                            var a = [
+                                {
+                                    test: [/googlebot/i],
+                                    describe: function () {
+                                        return { type: 'bot', vendor: 'Google' };
+                                    },
+                                },
+                                {
+                                    test: [/huawei/i],
+                                    describe: function (e) {
+                                        var t = i.default.getFirstMatch(/(can-l01)/i, e) && 'Nova',
+                                            r = { type: s.PLATFORMS_MAP.mobile, vendor: 'Huawei' };
+                                        return t && (r.model = t), r;
+                                    },
+                                },
+                                {
+                                    test: [/nexus\s*(?:7|8|9|10).*/i],
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.tablet, vendor: 'Nexus' };
+                                    },
+                                },
+                                {
+                                    test: [/ipad/i],
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.tablet, vendor: 'Apple', model: 'iPad' };
+                                    },
+                                },
+                                {
+                                    test: [/Macintosh(.*?) FxiOS(.*?)\//],
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.tablet, vendor: 'Apple', model: 'iPad' };
+                                    },
+                                },
+                                {
+                                    test: [/kftt build/i],
+                                    describe: function () {
+                                        return {
+                                            type: s.PLATFORMS_MAP.tablet,
+                                            vendor: 'Amazon',
+                                            model: 'Kindle Fire HD 7',
+                                        };
+                                    },
+                                },
+                                {
+                                    test: [/silk/i],
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.tablet, vendor: 'Amazon' };
+                                    },
+                                },
+                                {
+                                    test: [/tablet(?! pc)/i],
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.tablet };
+                                    },
+                                },
+                                {
+                                    test: function (e) {
+                                        var t = e.test(/ipod|iphone/i),
+                                            r = e.test(/like (ipod|iphone)/i);
+                                        return t && !r;
+                                    },
+                                    describe: function (e) {
+                                        var t = i.default.getFirstMatch(/(ipod|iphone)/i, e);
+                                        return { type: s.PLATFORMS_MAP.mobile, vendor: 'Apple', model: t };
+                                    },
+                                },
+                                {
+                                    test: [/nexus\s*[0-6].*/i, /galaxy nexus/i],
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.mobile, vendor: 'Nexus' };
+                                    },
+                                },
+                                {
+                                    test: [/[^-]mobi/i],
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.mobile };
+                                    },
+                                },
+                                {
+                                    test: function (e) {
+                                        return 'blackberry' === e.getBrowserName(!0);
+                                    },
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.mobile, vendor: 'BlackBerry' };
+                                    },
+                                },
+                                {
+                                    test: function (e) {
+                                        return 'bada' === e.getBrowserName(!0);
+                                    },
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.mobile };
+                                    },
+                                },
+                                {
+                                    test: function (e) {
+                                        return 'windows phone' === e.getBrowserName();
+                                    },
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.mobile, vendor: 'Microsoft' };
+                                    },
+                                },
+                                {
+                                    test: function (e) {
+                                        var t = Number(String(e.getOSVersion()).split('.')[0]);
+                                        return 'android' === e.getOSName(!0) && t >= 3;
+                                    },
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.tablet };
+                                    },
+                                },
+                                {
+                                    test: function (e) {
+                                        return 'android' === e.getOSName(!0);
+                                    },
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.mobile };
+                                    },
+                                },
+                                {
+                                    test: function (e) {
+                                        return 'macos' === e.getOSName(!0);
+                                    },
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.desktop, vendor: 'Apple' };
+                                    },
+                                },
+                                {
+                                    test: function (e) {
+                                        return 'windows' === e.getOSName(!0);
+                                    },
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.desktop };
+                                    },
+                                },
+                                {
+                                    test: function (e) {
+                                        return 'linux' === e.getOSName(!0);
+                                    },
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.desktop };
+                                    },
+                                },
+                                {
+                                    test: function (e) {
+                                        return 'playstation 4' === e.getOSName(!0);
+                                    },
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.tv };
+                                    },
+                                },
+                                {
+                                    test: function (e) {
+                                        return 'roku' === e.getOSName(!0);
+                                    },
+                                    describe: function () {
+                                        return { type: s.PLATFORMS_MAP.tv };
+                                    },
+                                },
+                            ];
+                            (t.default = a), (e.exports = t.default);
+                        },
+                        95: function (e, t, r) {
+                            'use strict';
+                            (t.__esModule = !0), (t.default = void 0);
+                            var n,
+                                i = (n = r(17)) && n.__esModule ? n : { default: n },
+                                s = r(18);
+                            var a = [
+                                {
+                                    test: function (e) {
+                                        return 'microsoft edge' === e.getBrowserName(!0);
+                                    },
+                                    describe: function (e) {
+                                        if (/\sedg\//i.test(e)) return { name: s.ENGINE_MAP.Blink };
+                                        var t = i.default.getFirstMatch(/edge\/(\d+(\.?_?\d+)+)/i, e);
+                                        return { name: s.ENGINE_MAP.EdgeHTML, version: t };
+                                    },
+                                },
+                                {
+                                    test: [/trident/i],
+                                    describe: function (e) {
+                                        var t = { name: s.ENGINE_MAP.Trident },
+                                            r = i.default.getFirstMatch(/trident\/(\d+(\.?_?\d+)+)/i, e);
+                                        return r && (t.version = r), t;
+                                    },
+                                },
+                                {
+                                    test: function (e) {
+                                        return e.test(/presto/i);
+                                    },
+                                    describe: function (e) {
+                                        var t = { name: s.ENGINE_MAP.Presto },
+                                            r = i.default.getFirstMatch(/presto\/(\d+(\.?_?\d+)+)/i, e);
+                                        return r && (t.version = r), t;
+                                    },
+                                },
+                                {
+                                    test: function (e) {
+                                        var t = e.test(/gecko/i),
+                                            r = e.test(/like gecko/i);
+                                        return t && !r;
+                                    },
+                                    describe: function (e) {
+                                        var t = { name: s.ENGINE_MAP.Gecko },
+                                            r = i.default.getFirstMatch(/gecko\/(\d+(\.?_?\d+)+)/i, e);
+                                        return r && (t.version = r), t;
+                                    },
+                                },
+                                {
+                                    test: [/(apple)?webkit\/537\.36/i],
+                                    describe: function () {
+                                        return { name: s.ENGINE_MAP.Blink };
+                                    },
+                                },
+                                {
+                                    test: [/(apple)?webkit/i],
+                                    describe: function (e) {
+                                        var t = { name: s.ENGINE_MAP.WebKit },
+                                            r = i.default.getFirstMatch(/webkit\/(\d+(\.?_?\d+)+)/i, e);
+                                        return r && (t.version = r), t;
+                                    },
+                                },
+                            ];
+                            (t.default = a), (e.exports = t.default);
+                        },
+                    });
+                });
+            },
+            {},
+        ],
+        4: [
+            function (require, module, exports) {
+                const debug = require('debug')('h264-profile-level-id');
+
+                /* eslint-disable no-console */
+                debug.log = console.info.bind(console);
+                /* eslint-enable no-console */
+
+                const ProfileConstrainedBaseline = 1;
+                const ProfileBaseline = 2;
+                const ProfileMain = 3;
+                const ProfileConstrainedHigh = 4;
+                const ProfileHigh = 5;
+
+                exports.ProfileConstrainedBaseline = ProfileConstrainedBaseline;
+                exports.ProfileBaseline = ProfileBaseline;
+                exports.ProfileMain = ProfileMain;
+                exports.ProfileConstrainedHigh = ProfileConstrainedHigh;
+                exports.ProfileHigh = ProfileHigh;
+
+                // All values are equal to ten times the level number, except level 1b which is
+                // special.
+                const Level1_b = 0;
+                const Level1 = 10;
+                const Level1_1 = 11;
+                const Level1_2 = 12;
+                const Level1_3 = 13;
+                const Level2 = 20;
+                const Level2_1 = 21;
+                const Level2_2 = 22;
+                const Level3 = 30;
+                const Level3_1 = 31;
+                const Level3_2 = 32;
+                const Level4 = 40;
+                const Level4_1 = 41;
+                const Level4_2 = 42;
+                const Level5 = 50;
+                const Level5_1 = 51;
+                const Level5_2 = 52;
+
+                exports.Level1_b = Level1_b;
+                exports.Level1 = Level1;
+                exports.Level1_1 = Level1_1;
+                exports.Level1_2 = Level1_2;
+                exports.Level1_3 = Level1_3;
+                exports.Level2 = Level2;
+                exports.Level2_1 = Level2_1;
+                exports.Level2_2 = Level2_2;
+                exports.Level3 = Level3;
+                exports.Level3_1 = Level3_1;
+                exports.Level3_2 = Level3_2;
+                exports.Level4 = Level4;
+                exports.Level4_1 = Level4_1;
+                exports.Level4_2 = Level4_2;
+                exports.Level5 = Level5;
+                exports.Level5_1 = Level5_1;
+                exports.Level5_2 = Level5_2;
+
+                class ProfileLevelId {
+                    constructor(profile, level) {
+                        this.profile = profile;
+                        this.level = level;
+                    }
+                }
+
+                exports.ProfileLevelId = ProfileLevelId;
+
+                // Default ProfileLevelId.
+                //
+                // TODO: The default should really be profile Baseline and level 1 according to
+                // the spec: https://tools.ietf.org/html/rfc6184#section-8.1. In order to not
+                // break backwards compatibility with older versions of WebRTC where external
+                // codecs don't have any parameters, use profile ConstrainedBaseline level 3_1
+                // instead. This workaround will only be done in an interim period to allow
+                // external clients to update their code.
+                //
+                // http://crbug/webrtc/6337.
+                const DefaultProfileLevelId = new ProfileLevelId(ProfileConstrainedBaseline, Level3_1);
+
+                // For level_idc=11 and profile_idc=0x42, 0x4D, or 0x58, the constraint set3
+                // flag specifies if level 1b or level 1.1 is used.
+                const ConstraintSet3Flag = 0x10;
+
+                // Class for matching bit patterns such as "x1xx0000" where 'x' is allowed to be
+                // either 0 or 1.
+                class BitPattern {
+                    constructor(str) {
+                        this._mask = ~byteMaskString('x', str);
+                        this._maskedValue = byteMaskString('1', str);
+                    }
+
+                    isMatch(value) {
+                        return this._maskedValue === (value & this._mask);
+                    }
+                }
+
+                // Class for converting between profile_idc/profile_iop to Profile.
+                class ProfilePattern {
+                    constructor(profile_idc, profile_iop, profile) {
+                        this.profile_idc = profile_idc;
+                        this.profile_iop = profile_iop;
+                        this.profile = profile;
+                    }
+                }
+
+                // This is from https://tools.ietf.org/html/rfc6184#section-8.1.
+                const ProfilePatterns = [
+                    new ProfilePattern(0x42, new BitPattern('x1xx0000'), ProfileConstrainedBaseline),
+                    new ProfilePattern(0x4d, new BitPattern('1xxx0000'), ProfileConstrainedBaseline),
+                    new ProfilePattern(0x58, new BitPattern('11xx0000'), ProfileConstrainedBaseline),
+                    new ProfilePattern(0x42, new BitPattern('x0xx0000'), ProfileBaseline),
+                    new ProfilePattern(0x58, new BitPattern('10xx0000'), ProfileBaseline),
+                    new ProfilePattern(0x4d, new BitPattern('0x0x0000'), ProfileMain),
+                    new ProfilePattern(0x64, new BitPattern('00000000'), ProfileHigh),
+                    new ProfilePattern(0x64, new BitPattern('00001100'), ProfileConstrainedHigh),
+                ];
+
+                /**
+                 * Parse profile level id that is represented as a string of 3 hex bytes.
+                 * Nothing will be returned if the string is not a recognized H264 profile
+                 * level id.
+                 *
+                 * @param {String} str - profile-level-id value as a string of 3 hex bytes.
+                 *
+                 * @returns {ProfileLevelId}
+                 */
+                exports.parseProfileLevelId = function (str) {
+                    // The string should consist of 3 bytes in hexadecimal format.
+                    if (typeof str !== 'string' || str.length !== 6) return null;
+
+                    const profile_level_id_numeric = parseInt(str, 16);
+
+                    if (profile_level_id_numeric === 0) return null;
+
+                    // Separate into three bytes.
+                    const level_idc = profile_level_id_numeric & 0xff;
+                    const profile_iop = (profile_level_id_numeric >> 8) & 0xff;
+                    const profile_idc = (profile_level_id_numeric >> 16) & 0xff;
+
+                    // Parse level based on level_idc and constraint set 3 flag.
+                    let level;
+
+                    switch (level_idc) {
+                        case Level1_1: {
+                            level = (profile_iop & ConstraintSet3Flag) !== 0 ? Level1_b : Level1_1;
+                            break;
+                        }
+                        case Level1:
+                        case Level1_2:
+                        case Level1_3:
+                        case Level2:
+                        case Level2_1:
+                        case Level2_2:
+                        case Level3:
+                        case Level3_1:
+                        case Level3_2:
+                        case Level4:
+                        case Level4_1:
+                        case Level4_2:
+                        case Level5:
+                        case Level5_1:
+                        case Level5_2: {
+                            level = level_idc;
+                            break;
+                        }
+                        // Unrecognized level_idc.
+                        default: {
+                            debug('parseProfileLevelId() | unrecognized level_idc:%s', level_idc);
+
+                            return null;
+                        }
+                    }
+
+                    // Parse profile_idc/profile_iop into a Profile enum.
+                    for (const pattern of ProfilePatterns) {
+                        if (profile_idc === pattern.profile_idc && pattern.profile_iop.isMatch(profile_iop)) {
+                            return new ProfileLevelId(pattern.profile, level);
+                        }
+                    }
+
+                    debug('parseProfileLevelId() | unrecognized profile_idc/profile_iop combination');
+
+                    return null;
+                };
+
+                /**
+                 * Returns canonical string representation as three hex bytes of the profile
+                 * level id, or returns nothing for invalid profile level ids.
+                 *
+                 * @param {ProfileLevelId} profile_level_id
+                 *
+                 * @returns {String}
+                 */
+                exports.profileLevelIdToString = function (profile_level_id) {
+                    // Handle special case level == 1b.
+                    if (profile_level_id.level == Level1_b) {
+                        switch (profile_level_id.profile) {
+                            case ProfileConstrainedBaseline: {
+                                return '42f00b';
+                            }
+                            case ProfileBaseline: {
+                                return '42100b';
+                            }
+                            case ProfileMain: {
+                                return '4d100b';
+                            }
+                            // Level 1_b is not allowed for other profiles.
+                            default: {
+                                debug(
+                                    'profileLevelIdToString() | Level 1_b not is allowed for profile:%s',
+                                    profile_level_id.profile,
+                                );
+
+                                return null;
+                            }
+                        }
+                    }
+
+                    let profile_idc_iop_string;
+
+                    switch (profile_level_id.profile) {
+                        case ProfileConstrainedBaseline: {
+                            profile_idc_iop_string = '42e0';
+                            break;
+                        }
+                        case ProfileBaseline: {
+                            profile_idc_iop_string = '4200';
+                            break;
+                        }
+                        case ProfileMain: {
+                            profile_idc_iop_string = '4d00';
+                            break;
+                        }
+                        case ProfileConstrainedHigh: {
+                            profile_idc_iop_string = '640c';
+                            break;
+                        }
+                        case ProfileHigh: {
+                            profile_idc_iop_string = '6400';
+                            break;
+                        }
+                        default: {
+                            debug('profileLevelIdToString() | unrecognized profile:%s', profile_level_id.profile);
+
+                            return null;
+                        }
+                    }
+
+                    let levelStr = profile_level_id.level.toString(16);
+
+                    if (levelStr.length === 1) levelStr = `0${levelStr}`;
+
+                    return `${profile_idc_iop_string}${levelStr}`;
+                };
+
+                /**
+                 * Parse profile level id that is represented as a string of 3 hex bytes
+                 * contained in an SDP key-value map. A default profile level id will be
+                 * returned if the profile-level-id key is missing. Nothing will be returned if
+                 * the key is present but the string is invalid.
+                 *
+                 * @param {Object} [params={}] - Codec parameters object.
+                 *
+                 * @returns {ProfileLevelId}
+                 */
+                exports.parseSdpProfileLevelId = function (params = {}) {
+                    const profile_level_id = params['profile-level-id'];
+
+                    return !profile_level_id ? DefaultProfileLevelId : exports.parseProfileLevelId(profile_level_id);
+                };
+
+                /**
+                 * Returns true if the parameters have the same H264 profile, i.e. the same
+                 * H264 profile (Baseline, High, etc).
+                 *
+                 * @param {Object} [params1={}] - Codec parameters object.
+                 * @param {Object} [params2={}] - Codec parameters object.
+                 *
+                 * @returns {Boolean}
+                 */
+                exports.isSameProfile = function (params1 = {}, params2 = {}) {
+                    const profile_level_id_1 = exports.parseSdpProfileLevelId(params1);
+                    const profile_level_id_2 = exports.parseSdpProfileLevelId(params2);
+
+                    // Compare H264 profiles, but not levels.
+                    return Boolean(
+                        profile_level_id_1 &&
+                            profile_level_id_2 &&
+                            profile_level_id_1.profile === profile_level_id_2.profile,
+                    );
+                };
+
+                /**
+                 * Generate codec parameters that will be used as answer in an SDP negotiation
+                 * based on local supported parameters and remote offered parameters. Both
+                 * local_supported_params and remote_offered_params represent sendrecv media
+                 * descriptions, i.e they are a mix of both encode and decode capabilities. In
+                 * theory, when the profile in local_supported_params represent a strict superset
+                 * of the profile in remote_offered_params, we could limit the profile in the
+                 * answer to the profile in remote_offered_params.
+                 *
+                 * However, to simplify the code, each supported H264 profile should be listed
+                 * explicitly in the list of local supported codecs, even if they are redundant.
+                 * Then each local codec in the list should be tested one at a time against the
+                 * remote codec, and only when the profiles are equal should this function be
+                 * called. Therefore, this function does not need to handle profile intersection,
+                 * and the profile of local_supported_params and remote_offered_params must be
+                 * equal before calling this function. The parameters that are used when
+                 * negotiating are the level part of profile-level-id and level-asymmetry-allowed.
+                 *
+                 * @param {Object} [local_supported_params={}]
+                 * @param {Object} [remote_offered_params={}]
+                 *
+                 * @returns {String} Canonical string representation as three hex bytes of the
+                 *   profile level id, or null if no one of the params have profile-level-id.
+                 *
+                 * @throws {TypeError} If Profile mismatch or invalid params.
+                 */
+                exports.generateProfileLevelIdForAnswer = function (
+                    local_supported_params = {},
+                    remote_offered_params = {},
+                ) {
+                    // If both local and remote params do not contain profile-level-id, they are
+                    // both using the default profile. In this case, don't return anything.
+                    if (!local_supported_params['profile-level-id'] && !remote_offered_params['profile-level-id']) {
+                        debug('generateProfileLevelIdForAnswer() | no profile-level-id in local and remote params');
+
+                        return null;
+                    }
+
+                    // Parse profile-level-ids.
+                    const local_profile_level_id = exports.parseSdpProfileLevelId(local_supported_params);
+                    const remote_profile_level_id = exports.parseSdpProfileLevelId(remote_offered_params);
+
+                    // The local and remote codec must have valid and equal H264 Profiles.
+                    if (!local_profile_level_id) throw new TypeError('invalid local_profile_level_id');
+
+                    if (!remote_profile_level_id) throw new TypeError('invalid remote_profile_level_id');
+
+                    if (local_profile_level_id.profile !== remote_profile_level_id.profile)
+                        throw new TypeError('H264 Profile mismatch');
+
+                    // Parse level information.
+                    const level_asymmetry_allowed =
+                        isLevelAsymmetryAllowed(local_supported_params) &&
+                        isLevelAsymmetryAllowed(remote_offered_params);
+
+                    const local_level = local_profile_level_id.level;
+                    const remote_level = remote_profile_level_id.level;
+                    const min_level = minLevel(local_level, remote_level);
+
+                    // Determine answer level. When level asymmetry is not allowed, level upgrade
+                    // is not allowed, i.e., the level in the answer must be equal to or lower
+                    // than the level in the offer.
+                    const answer_level = level_asymmetry_allowed ? local_level : min_level;
+
+                    debug(
+                        'generateProfileLevelIdForAnswer() | result: [profile:%s, level:%s]',
+                        local_profile_level_id.profile,
+                        answer_level,
+                    );
+
+                    // Return the resulting profile-level-id for the answer parameters.
+                    return exports.profileLevelIdToString(
+                        new ProfileLevelId(local_profile_level_id.profile, answer_level),
+                    );
+                };
+
+                // Convert a string of 8 characters into a byte where the positions containing
+                // character c will have their bit set. For example, c = 'x', str = "x1xx0000"
+                // will return 0b10110000.
+                function byteMaskString(c, str) {
+                    return (
+                        ((str[0] === c) << 7) |
+                        ((str[1] === c) << 6) |
+                        ((str[2] === c) << 5) |
+                        ((str[3] === c) << 4) |
+                        ((str[4] === c) << 3) |
+                        ((str[5] === c) << 2) |
+                        ((str[6] === c) << 1) |
+                        ((str[7] === c) << 0)
+                    );
+                }
+
+                // Compare H264 levels and handle the level 1b case.
+                function isLessLevel(a, b) {
+                    if (a === Level1_b) return b !== Level1 && b !== Level1_b;
+
+                    if (b === Level1_b) return a !== Level1;
+
+                    return a < b;
+                }
+
+                function minLevel(a, b) {
+                    return isLessLevel(a, b) ? a : b;
+                }
+
+                function isLevelAsymmetryAllowed(params = {}) {
+                    const level_asymmetry_allowed = params['level-asymmetry-allowed'];
+
+                    return level_asymmetry_allowed === 1 || level_asymmetry_allowed === '1';
+                }
+            },
+            { debug: 5 },
+        ],
+        5: [
+            function (require, module, exports) {
+                (function (process) {
+                    (function () {
+                        /* eslint-env browser */
+
+                        /**
+                         * This is the web browser implementation of `debug()`.
+                         */
+
+                        exports.formatArgs = formatArgs;
+                        exports.save = save;
+                        exports.load = load;
+                        exports.useColors = useColors;
+                        exports.storage = localstorage();
+                        exports.destroy = (() => {
+                            let warned = false;
+
+                            return () => {
+                                if (!warned) {
+                                    warned = true;
+                                    console.warn(
+                                        'Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.',
+                                    );
+                                }
+                            };
+                        })();
+
+                        /**
+                         * Colors.
+                         */
+
+                        exports.colors = [
+                            '#0000CC',
+                            '#0000FF',
+                            '#0033CC',
+                            '#0033FF',
+                            '#0066CC',
+                            '#0066FF',
+                            '#0099CC',
+                            '#0099FF',
+                            '#00CC00',
+                            '#00CC33',
+                            '#00CC66',
+                            '#00CC99',
+                            '#00CCCC',
+                            '#00CCFF',
+                            '#3300CC',
+                            '#3300FF',
+                            '#3333CC',
+                            '#3333FF',
+                            '#3366CC',
+                            '#3366FF',
+                            '#3399CC',
+                            '#3399FF',
+                            '#33CC00',
+                            '#33CC33',
+                            '#33CC66',
+                            '#33CC99',
+                            '#33CCCC',
+                            '#33CCFF',
+                            '#6600CC',
+                            '#6600FF',
+                            '#6633CC',
+                            '#6633FF',
+                            '#66CC00',
+                            '#66CC33',
+                            '#9900CC',
+                            '#9900FF',
+                            '#9933CC',
+                            '#9933FF',
+                            '#99CC00',
+                            '#99CC33',
+                            '#CC0000',
+                            '#CC0033',
+                            '#CC0066',
+                            '#CC0099',
+                            '#CC00CC',
+                            '#CC00FF',
+                            '#CC3300',
+                            '#CC3333',
+                            '#CC3366',
+                            '#CC3399',
+                            '#CC33CC',
+                            '#CC33FF',
+                            '#CC6600',
+                            '#CC6633',
+                            '#CC9900',
+                            '#CC9933',
+                            '#CCCC00',
+                            '#CCCC33',
+                            '#FF0000',
+                            '#FF0033',
+                            '#FF0066',
+                            '#FF0099',
+                            '#FF00CC',
+                            '#FF00FF',
+                            '#FF3300',
+                            '#FF3333',
+                            '#FF3366',
+                            '#FF3399',
+                            '#FF33CC',
+                            '#FF33FF',
+                            '#FF6600',
+                            '#FF6633',
+                            '#FF9900',
+                            '#FF9933',
+                            '#FFCC00',
+                            '#FFCC33',
+                        ];
+
+                        /**
+                         * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+                         * and the Firebug extension (any Firefox version) are known
+                         * to support "%c" CSS customizations.
+                         *
+                         * TODO: add a `localStorage` variable to explicitly enable/disable colors
+                         */
+
+                        // eslint-disable-next-line complexity
+                        function useColors() {
+                            // NB: In an Electron preload script, document will be defined but not fully
+                            // initialized. Since we know we're in Chrome, we'll just detect this case
+                            // explicitly
+                            if (
+                                typeof window !== 'undefined' &&
+                                window.process &&
+                                (window.process.type === 'renderer' || window.process.__nwjs)
+                            ) {
+                                return true;
+                            }
+
+                            // Internet Explorer and Edge do not support colors.
+                            if (
+                                typeof navigator !== 'undefined' &&
+                                navigator.userAgent &&
+                                navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)
+                            ) {
+                                return false;
+                            }
+
+                            // Is webkit? http://stackoverflow.com/a/16459606/376773
+                            // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+                            return (
+                                (typeof document !== 'undefined' &&
+                                    document.documentElement &&
+                                    document.documentElement.style &&
+                                    document.documentElement.style.WebkitAppearance) ||
+                                // Is firebug? http://stackoverflow.com/a/398120/376773
+                                (typeof window !== 'undefined' &&
+                                    window.console &&
+                                    (window.console.firebug || (window.console.exception && window.console.table))) ||
+                                // Is firefox >= v31?
+                                // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+                                (typeof navigator !== 'undefined' &&
+                                    navigator.userAgent &&
+                                    navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) &&
+                                    parseInt(RegExp.$1, 10) >= 31) ||
+                                // Double check webkit in userAgent just in case we are in a worker
+                                (typeof navigator !== 'undefined' &&
+                                    navigator.userAgent &&
+                                    navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/))
+                            );
+                        }
+
+                        /**
+                         * Colorize log arguments if enabled.
+                         *
+                         * @api public
+                         */
+
+                        function formatArgs(args) {
+                            args[0] =
+                                (this.useColors ? '%c' : '') +
+                                this.namespace +
+                                (this.useColors ? ' %c' : ' ') +
+                                args[0] +
+                                (this.useColors ? '%c ' : ' ') +
+                                '+' +
+                                module.exports.humanize(this.diff);
+
+                            if (!this.useColors) {
+                                return;
+                            }
+
+                            const c = 'color: ' + this.color;
+                            args.splice(1, 0, c, 'color: inherit');
+
+                            // The final "%c" is somewhat tricky, because there could be other
+                            // arguments passed either before or after the %c, so we need to
+                            // figure out the correct index to insert the CSS into
+                            let index = 0;
+                            let lastC = 0;
+                            args[0].replace(/%[a-zA-Z%]/g, (match) => {
+                                if (match === '%%') {
+                                    return;
+                                }
+                                index++;
+                                if (match === '%c') {
+                                    // We only are interested in the *last* %c
+                                    // (the user may have provided their own)
+                                    lastC = index;
+                                }
+                            });
+
+                            args.splice(lastC, 0, c);
+                        }
+
+                        /**
+                         * Invokes `console.debug()` when available.
+                         * No-op when `console.debug` is not a "function".
+                         * If `console.debug` is not available, falls back
+                         * to `console.log`.
+                         *
+                         * @api public
+                         */
+                        exports.log = console.debug || console.log || (() => {});
+
+                        /**
+                         * Save `namespaces`.
+                         *
+                         * @param {String} namespaces
+                         * @api private
+                         */
+                        function save(namespaces) {
+                            try {
+                                if (namespaces) {
+                                    exports.storage.setItem('debug', namespaces);
+                                } else {
+                                    exports.storage.removeItem('debug');
+                                }
+                            } catch (error) {
+                                // Swallow
+                                // XXX (@Qix-) should we be logging these?
+                            }
+                        }
+
+                        /**
+                         * Load `namespaces`.
+                         *
+                         * @return {String} returns the previously persisted debug modes
+                         * @api private
+                         */
+                        function load() {
+                            let r;
+                            try {
+                                r = exports.storage.getItem('debug');
+                            } catch (error) {
+                                // Swallow
+                                // XXX (@Qix-) should we be logging these?
+                            }
+
+                            // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+                            if (!r && typeof process !== 'undefined' && 'env' in process) {
+                                r = process.env.DEBUG;
+                            }
+
+                            return r;
+                        }
+
+                        /**
+                         * Localstorage attempts to return the localstorage.
+                         *
+                         * This is necessary because safari throws
+                         * when a user disables cookies/localstorage
+                         * and you attempt to access it.
+                         *
+                         * @return {LocalStorage}
+                         * @api private
+                         */
+
+                        function localstorage() {
+                            try {
+                                // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context
+                                // The Browser also has localStorage in the global context.
+                                return localStorage;
+                            } catch (error) {
+                                // Swallow
+                                // XXX (@Qix-) should we be logging these?
+                            }
+                        }
+
+                        module.exports = require('./common')(exports);
+
+                        const { formatters } = module.exports;
+
+                        /**
+                         * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+                         */
+
+                        formatters.j = function (v) {
+                            try {
+                                return JSON.stringify(v);
+                            } catch (error) {
+                                return '[UnexpectedJSONParseError]: ' + error.message;
+                            }
+                        };
+                    }.call(this));
+                }.call(this, require('_process')));
+            },
+            { './common': 6, _process: 48 },
+        ],
+        6: [
+            function (require, module, exports) {
+                /**
+                 * This is the common logic for both the Node.js and web browser
+                 * implementations of `debug()`.
+                 */
+
+                function setup(env) {
+                    createDebug.debug = createDebug;
+                    createDebug.default = createDebug;
+                    createDebug.coerce = coerce;
+                    createDebug.disable = disable;
+                    createDebug.enable = enable;
+                    createDebug.enabled = enabled;
+                    createDebug.humanize = require('ms');
+                    createDebug.destroy = destroy;
+
+                    Object.keys(env).forEach((key) => {
+                        createDebug[key] = env[key];
+                    });
+
+                    /**
+                     * The currently active debug mode names, and names to skip.
+                     */
+
+                    createDebug.names = [];
+                    createDebug.skips = [];
+
+                    /**
+                     * Map of special "%n" handling functions, for the debug "format" argument.
+                     *
+                     * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+                     */
+                    createDebug.formatters = {};
+
+                    /**
+                     * Selects a color for a debug namespace
+                     * @param {String} namespace The namespace string for the for the debug instance to be colored
+                     * @return {Number|String} An ANSI color code for the given namespace
+                     * @api private
+                     */
+                    function selectColor(namespace) {
+                        let hash = 0;
+
+                        for (let i = 0; i < namespace.length; i++) {
+                            hash = (hash << 5) - hash + namespace.charCodeAt(i);
+                            hash |= 0; // Convert to 32bit integer
+                        }
+
+                        return createDebug.colors[Math.abs(hash) % createDebug.colors.length];
+                    }
+                    createDebug.selectColor = selectColor;
+
+                    /**
+                     * Create a debugger with the given `namespace`.
+                     *
+                     * @param {String} namespace
+                     * @return {Function}
+                     * @api public
+                     */
+                    function createDebug(namespace) {
+                        let prevTime;
+                        let enableOverride = null;
+                        let namespacesCache;
+                        let enabledCache;
+
+                        function debug(...args) {
+                            // Disabled?
+                            if (!debug.enabled) {
+                                return;
+                            }
+
+                            const self = debug;
+
+                            // Set `diff` timestamp
+                            const curr = Number(new Date());
+                            const ms = curr - (prevTime || curr);
+                            self.diff = ms;
+                            self.prev = prevTime;
+                            self.curr = curr;
+                            prevTime = curr;
+
+                            args[0] = createDebug.coerce(args[0]);
+
+                            if (typeof args[0] !== 'string') {
+                                // Anything else let's inspect with %O
+                                args.unshift('%O');
+                            }
+
+                            // Apply any `formatters` transformations
+                            let index = 0;
+                            args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => {
+                                // If we encounter an escaped % then don't increase the array index
+                                if (match === '%%') {
+                                    return '%';
+                                }
+                                index++;
+                                const formatter = createDebug.formatters[format];
+                                if (typeof formatter === 'function') {
+                                    const val = args[index];
+                                    match = formatter.call(self, val);
+
+                                    // Now we need to remove `args[index]` since it's inlined in the `format`
+                                    args.splice(index, 1);
+                                    index--;
+                                }
+                                return match;
+                            });
+
+                            // Apply env-specific formatting (colors, etc.)
+                            createDebug.formatArgs.call(self, args);
+
+                            const logFn = self.log || createDebug.log;
+                            logFn.apply(self, args);
+                        }
+
+                        debug.namespace = namespace;
+                        debug.useColors = createDebug.useColors();
+                        debug.color = createDebug.selectColor(namespace);
+                        debug.extend = extend;
+                        debug.destroy = createDebug.destroy; // XXX Temporary. Will be removed in the next major release.
+
+                        Object.defineProperty(debug, 'enabled', {
+                            enumerable: true,
+                            configurable: false,
+                            get: () => {
+                                if (enableOverride !== null) {
+                                    return enableOverride;
+                                }
+                                if (namespacesCache !== createDebug.namespaces) {
+                                    namespacesCache = createDebug.namespaces;
+                                    enabledCache = createDebug.enabled(namespace);
+                                }
+
+                                return enabledCache;
+                            },
+                            set: (v) => {
+                                enableOverride = v;
+                            },
+                        });
+
+                        // Env-specific initialization logic for debug instances
+                        if (typeof createDebug.init === 'function') {
+                            createDebug.init(debug);
+                        }
+
+                        return debug;
+                    }
+
+                    function extend(namespace, delimiter) {
+                        const newDebug = createDebug(
+                            this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace,
+                        );
+                        newDebug.log = this.log;
+                        return newDebug;
+                    }
+
+                    /**
+                     * Enables a debug mode by namespaces. This can include modes
+                     * separated by a colon and wildcards.
+                     *
+                     * @param {String} namespaces
+                     * @api public
+                     */
+                    function enable(namespaces) {
+                        createDebug.save(namespaces);
+                        createDebug.namespaces = namespaces;
+
+                        createDebug.names = [];
+                        createDebug.skips = [];
+
+                        let i;
+                        const split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+                        const len = split.length;
+
+                        for (i = 0; i < len; i++) {
+                            if (!split[i]) {
+                                // ignore empty strings
+                                continue;
+                            }
+
+                            namespaces = split[i].replace(/\*/g, '.*?');
+
+                            if (namespaces[0] === '-') {
+                                createDebug.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+                            } else {
+                                createDebug.names.push(new RegExp('^' + namespaces + '$'));
+                            }
+                        }
+                    }
+
+                    /**
+                     * Disable debug output.
+                     *
+                     * @return {String} namespaces
+                     * @api public
+                     */
+                    function disable() {
+                        const namespaces = [
+                            ...createDebug.names.map(toNamespace),
+                            ...createDebug.skips.map(toNamespace).map((namespace) => '-' + namespace),
+                        ].join(',');
+                        createDebug.enable('');
+                        return namespaces;
+                    }
+
+                    /**
+                     * Returns true if the given mode name is enabled, false otherwise.
+                     *
+                     * @param {String} name
+                     * @return {Boolean}
+                     * @api public
+                     */
+                    function enabled(name) {
+                        if (name[name.length - 1] === '*') {
+                            return true;
+                        }
+
+                        let i;
+                        let len;
+
+                        for (i = 0, len = createDebug.skips.length; i < len; i++) {
+                            if (createDebug.skips[i].test(name)) {
+                                return false;
+                            }
+                        }
+
+                        for (i = 0, len = createDebug.names.length; i < len; i++) {
+                            if (createDebug.names[i].test(name)) {
+                                return true;
+                            }
+                        }
+
+                        return false;
+                    }
+
+                    /**
+                     * Convert regexp to namespace
+                     *
+                     * @param {RegExp} regxep
+                     * @return {String} namespace
+                     * @api private
+                     */
+                    function toNamespace(regexp) {
+                        return regexp
+                            .toString()
+                            .substring(2, regexp.toString().length - 2)
+                            .replace(/\.\*\?$/, '*');
+                    }
+
+                    /**
+                     * Coerce `val`.
+                     *
+                     * @param {Mixed} val
+                     * @return {Mixed}
+                     * @api private
+                     */
+                    function coerce(val) {
+                        if (val instanceof Error) {
+                            return val.stack || val.message;
+                        }
+                        return val;
+                    }
+
+                    /**
+                     * XXX DO NOT USE. This is a temporary stub function.
+                     * XXX It WILL be removed in the next major release.
+                     */
+                    function destroy() {
+                        console.warn(
+                            'Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.',
+                        );
+                    }
+
+                    createDebug.enable(createDebug.load());
+
+                    return createDebug;
+                }
+
+                module.exports = setup;
+            },
+            { ms: 7 },
+        ],
+        7: [
+            function (require, module, exports) {
+                /**
+                 * Helpers.
+                 */
+
+                var s = 1000;
+                var m = s * 60;
+                var h = m * 60;
+                var d = h * 24;
+                var w = d * 7;
+                var y = d * 365.25;
+
+                /**
+                 * Parse or format the given `val`.
+                 *
+                 * Options:
+                 *
+                 *  - `long` verbose formatting [false]
+                 *
+                 * @param {String|Number} val
+                 * @param {Object} [options]
+                 * @throws {Error} throw an error if val is not a non-empty string or a number
+                 * @return {String|Number}
+                 * @api public
+                 */
+
+                module.exports = function (val, options) {
+                    options = options || {};
+                    var type = typeof val;
+                    if (type === 'string' && val.length > 0) {
+                        return parse(val);
+                    } else if (type === 'number' && isFinite(val)) {
+                        return options.long ? fmtLong(val) : fmtShort(val);
+                    }
+                    throw new Error('val is not a non-empty string or a valid number. val=' + JSON.stringify(val));
+                };
+
+                /**
+                 * Parse the given `str` and return milliseconds.
+                 *
+                 * @param {String} str
+                 * @return {Number}
+                 * @api private
+                 */
+
+                function parse(str) {
+                    str = String(str);
+                    if (str.length > 100) {
+                        return;
+                    }
+                    var match =
+                        /^(-?(?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec(
+                            str,
+                        );
+                    if (!match) {
+                        return;
+                    }
+                    var n = parseFloat(match[1]);
+                    var type = (match[2] || 'ms').toLowerCase();
+                    switch (type) {
+                        case 'years':
+                        case 'year':
+                        case 'yrs':
+                        case 'yr':
+                        case 'y':
+                            return n * y;
+                        case 'weeks':
+                        case 'week':
+                        case 'w':
+                            return n * w;
+                        case 'days':
+                        case 'day':
+                        case 'd':
+                            return n * d;
+                        case 'hours':
+                        case 'hour':
+                        case 'hrs':
+                        case 'hr':
+                        case 'h':
+                            return n * h;
+                        case 'minutes':
+                        case 'minute':
+                        case 'mins':
+                        case 'min':
+                        case 'm':
+                            return n * m;
+                        case 'seconds':
+                        case 'second':
+                        case 'secs':
+                        case 'sec':
+                        case 's':
+                            return n * s;
+                        case 'milliseconds':
+                        case 'millisecond':
+                        case 'msecs':
+                        case 'msec':
+                        case 'ms':
+                            return n;
+                        default:
+                            return undefined;
+                    }
+                }
+
+                /**
+                 * Short format for `ms`.
+                 *
+                 * @param {Number} ms
+                 * @return {String}
+                 * @api private
+                 */
+
+                function fmtShort(ms) {
+                    var msAbs = Math.abs(ms);
+                    if (msAbs >= d) {
+                        return Math.round(ms / d) + 'd';
+                    }
+                    if (msAbs >= h) {
+                        return Math.round(ms / h) + 'h';
+                    }
+                    if (msAbs >= m) {
+                        return Math.round(ms / m) + 'm';
+                    }
+                    if (msAbs >= s) {
+                        return Math.round(ms / s) + 's';
+                    }
+                    return ms + 'ms';
+                }
+
+                /**
+                 * Long format for `ms`.
+                 *
+                 * @param {Number} ms
+                 * @return {String}
+                 * @api private
+                 */
+
+                function fmtLong(ms) {
+                    var msAbs = Math.abs(ms);
+                    if (msAbs >= d) {
+                        return plural(ms, msAbs, d, 'day');
+                    }
+                    if (msAbs >= h) {
+                        return plural(ms, msAbs, h, 'hour');
+                    }
+                    if (msAbs >= m) {
+                        return plural(ms, msAbs, m, 'minute');
+                    }
+                    if (msAbs >= s) {
+                        return plural(ms, msAbs, s, 'second');
+                    }
+                    return ms + ' ms';
+                }
+
+                /**
+                 * Pluralization helper.
+                 */
+
+                function plural(ms, msAbs, n, name) {
+                    var isPlural = msAbs >= n * 1.5;
+                    return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : '');
+                }
+            },
+            {},
+        ],
+        8: [
+            function (require, module, exports) {
+                'use strict';
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.Consumer = void 0;
+                const Logger_1 = require('./Logger');
+                const EnhancedEventEmitter_1 = require('./EnhancedEventEmitter');
+                const errors_1 = require('./errors');
+                const logger = new Logger_1.Logger('Consumer');
+                class Consumer extends EnhancedEventEmitter_1.EnhancedEventEmitter {
+                    /**
+                     * @emits transportclose
+                     * @emits trackended
+                     * @emits @getstats
+                     * @emits @close
+                     */
+                    constructor({ id, localId, producerId, rtpReceiver, track, rtpParameters, appData }) {
+                        super();
+                        // Closed flag.
+                        this._closed = false;
+                        // Observer instance.
+                        this._observer = new EnhancedEventEmitter_1.EnhancedEventEmitter();
+                        logger.debug('constructor()');
+                        this._id = id;
+                        this._localId = localId;
+                        this._producerId = producerId;
+                        this._rtpReceiver = rtpReceiver;
+                        this._track = track;
+                        this._rtpParameters = rtpParameters;
+                        this._paused = !track.enabled;
+                        this._appData = appData;
+                        this._onTrackEnded = this._onTrackEnded.bind(this);
+                        this._handleTrack();
+                    }
+                    /**
+                     * Consumer id.
+                     */
+                    get id() {
+                        return this._id;
+                    }
+                    /**
+                     * Local id.
+                     */
+                    get localId() {
+                        return this._localId;
+                    }
+                    /**
+                     * Associated Producer id.
+                     */
+                    get producerId() {
+                        return this._producerId;
+                    }
+                    /**
+                     * Whether the Consumer is closed.
+                     */
+                    get closed() {
+                        return this._closed;
+                    }
+                    /**
+                     * Media kind.
+                     */
+                    get kind() {
+                        return this._track.kind;
+                    }
+                    /**
+                     * Associated RTCRtpReceiver.
+                     */
+                    get rtpReceiver() {
+                        return this._rtpReceiver;
+                    }
+                    /**
+                     * The associated track.
+                     */
+                    get track() {
+                        return this._track;
+                    }
+                    /**
+                     * RTP parameters.
+                     */
+                    get rtpParameters() {
+                        return this._rtpParameters;
+                    }
+                    /**
+                     * Whether the Consumer is paused.
+                     */
+                    get paused() {
+                        return this._paused;
+                    }
+                    /**
+                     * App custom data.
+                     */
+                    get appData() {
+                        return this._appData;
+                    }
+                    /**
+                     * Invalid setter.
+                     */
+                    set appData(appData) {
+                        throw new Error('cannot override appData object');
+                    }
+                    /**
+                     * Observer.
+                     *
+                     * @emits close
+                     * @emits pause
+                     * @emits resume
+                     * @emits trackended
+                     */
+                    get observer() {
+                        return this._observer;
+                    }
+                    /**
+                     * Closes the Consumer.
+                     */
+                    close() {
+                        if (this._closed) return;
+                        logger.debug('close()');
+                        this._closed = true;
+                        this._destroyTrack();
+                        this.emit('@close');
+                        // Emit observer event.
+                        this._observer.safeEmit('close');
+                    }
+                    /**
+                     * Transport was closed.
+                     */
+                    transportClosed() {
+                        if (this._closed) return;
+                        logger.debug('transportClosed()');
+                        this._closed = true;
+                        this._destroyTrack();
+                        this.safeEmit('transportclose');
+                        // Emit observer event.
+                        this._observer.safeEmit('close');
+                    }
+                    /**
+                     * Get associated RTCRtpReceiver stats.
+                     */
+                    async getStats() {
+                        if (this._closed) throw new errors_1.InvalidStateError('closed');
+                        return this.safeEmitAsPromise('@getstats');
+                    }
+                    /**
+                     * Pauses receiving media.
+                     */
+                    pause() {
+                        logger.debug('pause()');
+                        if (this._closed) {
+                            logger.error('pause() | Consumer closed');
+                            return;
+                        }
+                        this._paused = true;
+                        this._track.enabled = false;
+                        // Emit observer event.
+                        this._observer.safeEmit('pause');
+                    }
+                    /**
+                     * Resumes receiving media.
+                     */
+                    resume() {
+                        logger.debug('resume()');
+                        if (this._closed) {
+                            logger.error('resume() | Consumer closed');
+                            return;
+                        }
+                        this._paused = false;
+                        this._track.enabled = true;
+                        // Emit observer event.
+                        this._observer.safeEmit('resume');
+                    }
+                    _onTrackEnded() {
+                        logger.debug('track "ended" event');
+                        this.safeEmit('trackended');
+                        // Emit observer event.
+                        this._observer.safeEmit('trackended');
+                    }
+                    _handleTrack() {
+                        this._track.addEventListener('ended', this._onTrackEnded);
+                    }
+                    _destroyTrack() {
+                        try {
+                            this._track.removeEventListener('ended', this._onTrackEnded);
+                            this._track.stop();
+                        } catch (error) {}
+                    }
+                }
+                exports.Consumer = Consumer;
+            },
+            { './EnhancedEventEmitter': 12, './Logger': 13, './errors': 18 },
+        ],
+        9: [
+            function (require, module, exports) {
+                'use strict';
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.DataConsumer = void 0;
+                const Logger_1 = require('./Logger');
+                const EnhancedEventEmitter_1 = require('./EnhancedEventEmitter');
+                const logger = new Logger_1.Logger('DataConsumer');
+                class DataConsumer extends EnhancedEventEmitter_1.EnhancedEventEmitter {
+                    /**
+                     * @emits transportclose
+                     * @emits open
+                     * @emits error - (error: Error)
+                     * @emits close
+                     * @emits message - (message: any)
+                     * @emits @close
+                     */
+                    constructor({ id, dataProducerId, dataChannel, sctpStreamParameters, appData }) {
+                        super();
+                        // Closed flag.
+                        this._closed = false;
+                        // Observer instance.
+                        this._observer = new EnhancedEventEmitter_1.EnhancedEventEmitter();
+                        logger.debug('constructor()');
+                        this._id = id;
+                        this._dataProducerId = dataProducerId;
+                        this._dataChannel = dataChannel;
+                        this._sctpStreamParameters = sctpStreamParameters;
+                        this._appData = appData;
+                        this._handleDataChannel();
+                    }
+                    /**
+                     * DataConsumer id.
+                     */
+                    get id() {
+                        return this._id;
+                    }
+                    /**
+                     * Associated DataProducer id.
+                     */
+                    get dataProducerId() {
+                        return this._dataProducerId;
+                    }
+                    /**
+                     * Whether the DataConsumer is closed.
+                     */
+                    get closed() {
+                        return this._closed;
+                    }
+                    /**
+                     * SCTP stream parameters.
+                     */
+                    get sctpStreamParameters() {
+                        return this._sctpStreamParameters;
+                    }
+                    /**
+                     * DataChannel readyState.
+                     */
+                    get readyState() {
+                        return this._dataChannel.readyState;
+                    }
+                    /**
+                     * DataChannel label.
+                     */
+                    get label() {
+                        return this._dataChannel.label;
+                    }
+                    /**
+                     * DataChannel protocol.
+                     */
+                    get protocol() {
+                        return this._dataChannel.protocol;
+                    }
+                    /**
+                     * DataChannel binaryType.
+                     */
+                    get binaryType() {
+                        return this._dataChannel.binaryType;
+                    }
+                    /**
+                     * Set DataChannel binaryType.
+                     */
+                    set binaryType(binaryType) {
+                        this._dataChannel.binaryType = binaryType;
+                    }
+                    /**
+                     * App custom data.
+                     */
+                    get appData() {
+                        return this._appData;
+                    }
+                    /**
+                     * Invalid setter.
+                     */
+                    set appData(appData) {
+                        throw new Error('cannot override appData object');
+                    }
+                    /**
+                     * Observer.
+                     *
+                     * @emits close
+                     */
+                    get observer() {
+                        return this._observer;
+                    }
+                    /**
+                     * Closes the DataConsumer.
+                     */
+                    close() {
+                        if (this._closed) return;
+                        logger.debug('close()');
+                        this._closed = true;
+                        this._dataChannel.close();
+                        this.emit('@close');
+                        // Emit observer event.
+                        this._observer.safeEmit('close');
+                    }
+                    /**
+                     * Transport was closed.
+                     */
+                    transportClosed() {
+                        if (this._closed) return;
+                        logger.debug('transportClosed()');
+                        this._closed = true;
+                        this._dataChannel.close();
+                        this.safeEmit('transportclose');
+                        // Emit observer event.
+                        this._observer.safeEmit('close');
+                    }
+                    _handleDataChannel() {
+                        this._dataChannel.addEventListener('open', () => {
+                            if (this._closed) return;
+                            logger.debug('DataChannel "open" event');
+                            this.safeEmit('open');
+                        });
+                        this._dataChannel.addEventListener('error', (event) => {
+                            if (this._closed) return;
+                            let { error } = event;
+                            if (!error) error = new Error('unknown DataChannel error');
+                            if (error.errorDetail === 'sctp-failure') {
+                                logger.error(
+                                    'DataChannel SCTP error [sctpCauseCode:%s]: %s',
+                                    error.sctpCauseCode,
+                                    error.message,
+                                );
+                            } else {
+                                logger.error('DataChannel "error" event: %o', error);
+                            }
+                            this.safeEmit('error', error);
+                        });
+                        this._dataChannel.addEventListener('close', () => {
+                            if (this._closed) return;
+                            logger.warn('DataChannel "close" event');
+                            this._closed = true;
+                            this.emit('@close');
+                            this.safeEmit('close');
+                        });
+                        this._dataChannel.addEventListener('message', (event) => {
+                            if (this._closed) return;
+                            this.safeEmit('message', event.data);
+                        });
+                    }
+                }
+                exports.DataConsumer = DataConsumer;
+            },
+            { './EnhancedEventEmitter': 12, './Logger': 13 },
+        ],
+        10: [
+            function (require, module, exports) {
+                'use strict';
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.DataProducer = void 0;
+                const Logger_1 = require('./Logger');
+                const EnhancedEventEmitter_1 = require('./EnhancedEventEmitter');
+                const errors_1 = require('./errors');
+                const logger = new Logger_1.Logger('DataProducer');
+                class DataProducer extends EnhancedEventEmitter_1.EnhancedEventEmitter {
+                    /**
+                     * @emits transportclose
+                     * @emits open
+                     * @emits error - (error: Error)
+                     * @emits close
+                     * @emits bufferedamountlow
+                     * @emits @close
+                     */
+                    constructor({ id, dataChannel, sctpStreamParameters, appData }) {
+                        super();
+                        // Closed flag.
+                        this._closed = false;
+                        // Observer instance.
+                        this._observer = new EnhancedEventEmitter_1.EnhancedEventEmitter();
+                        logger.debug('constructor()');
+                        this._id = id;
+                        this._dataChannel = dataChannel;
+                        this._sctpStreamParameters = sctpStreamParameters;
+                        this._appData = appData;
+                        this._handleDataChannel();
+                    }
+                    /**
+                     * DataProducer id.
+                     */
+                    get id() {
+                        return this._id;
+                    }
+                    /**
+                     * Whether the DataProducer is closed.
+                     */
+                    get closed() {
+                        return this._closed;
+                    }
+                    /**
+                     * SCTP stream parameters.
+                     */
+                    get sctpStreamParameters() {
+                        return this._sctpStreamParameters;
+                    }
+                    /**
+                     * DataChannel readyState.
+                     */
+                    get readyState() {
+                        return this._dataChannel.readyState;
+                    }
+                    /**
+                     * DataChannel label.
+                     */
+                    get label() {
+                        return this._dataChannel.label;
+                    }
+                    /**
+                     * DataChannel protocol.
+                     */
+                    get protocol() {
+                        return this._dataChannel.protocol;
+                    }
+                    /**
+                     * DataChannel bufferedAmount.
+                     */
+                    get bufferedAmount() {
+                        return this._dataChannel.bufferedAmount;
+                    }
+                    /**
+                     * DataChannel bufferedAmountLowThreshold.
+                     */
+                    get bufferedAmountLowThreshold() {
+                        return this._dataChannel.bufferedAmountLowThreshold;
+                    }
+                    /**
+                     * Set DataChannel bufferedAmountLowThreshold.
+                     */
+                    set bufferedAmountLowThreshold(bufferedAmountLowThreshold) {
+                        this._dataChannel.bufferedAmountLowThreshold = bufferedAmountLowThreshold;
+                    }
+                    /**
+                     * App custom data.
+                     */
+                    get appData() {
+                        return this._appData;
+                    }
+                    /**
+                     * Invalid setter.
+                     */
+                    set appData(appData) {
+                        throw new Error('cannot override appData object');
+                    }
+                    /**
+                     * Observer.
+                     *
+                     * @emits close
+                     */
+                    get observer() {
+                        return this._observer;
+                    }
+                    /**
+                     * Closes the DataProducer.
+                     */
+                    close() {
+                        if (this._closed) return;
+                        logger.debug('close()');
+                        this._closed = true;
+                        this._dataChannel.close();
+                        this.emit('@close');
+                        // Emit observer event.
+                        this._observer.safeEmit('close');
+                    }
+                    /**
+                     * Transport was closed.
+                     */
+                    transportClosed() {
+                        if (this._closed) return;
+                        logger.debug('transportClosed()');
+                        this._closed = true;
+                        this._dataChannel.close();
+                        this.safeEmit('transportclose');
+                        // Emit observer event.
+                        this._observer.safeEmit('close');
+                    }
+                    /**
+                     * Send a message.
+                     *
+                     * @param {String|Blob|ArrayBuffer|ArrayBufferView} data.
+                     */
+                    send(data) {
+                        logger.debug('send()');
+                        if (this._closed) throw new errors_1.InvalidStateError('closed');
+                        this._dataChannel.send(data);
+                    }
+                    _handleDataChannel() {
+                        this._dataChannel.addEventListener('open', () => {
+                            if (this._closed) return;
+                            logger.debug('DataChannel "open" event');
+                            this.safeEmit('open');
+                        });
+                        this._dataChannel.addEventListener('error', (event) => {
+                            if (this._closed) return;
+                            let { error } = event;
+                            if (!error) error = new Error('unknown DataChannel error');
+                            if (error.errorDetail === 'sctp-failure') {
+                                logger.error(
+                                    'DataChannel SCTP error [sctpCauseCode:%s]: %s',
+                                    error.sctpCauseCode,
+                                    error.message,
+                                );
+                            } else {
+                                logger.error('DataChannel "error" event: %o', error);
+                            }
+                            this.safeEmit('error', error);
+                        });
+                        this._dataChannel.addEventListener('close', () => {
+                            if (this._closed) return;
+                            logger.warn('DataChannel "close" event');
+                            this._closed = true;
+                            this.emit('@close');
+                            this.safeEmit('close');
+                        });
+                        this._dataChannel.addEventListener('message', () => {
+                            if (this._closed) return;
+                            logger.warn('DataChannel "message" event in a DataProducer, message discarded');
+                        });
+                        this._dataChannel.addEventListener('bufferedamountlow', () => {
+                            if (this._closed) return;
+                            this.safeEmit('bufferedamountlow');
+                        });
+                    }
+                }
+                exports.DataProducer = DataProducer;
+            },
+            { './EnhancedEventEmitter': 12, './Logger': 13, './errors': 18 },
+        ],
+        11: [
+            function (require, module, exports) {
+                'use strict';
+                /* global RTCRtpTransceiver */
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                var __importDefault =
+                    (this && this.__importDefault) ||
+                    function (mod) {
+                        return mod && mod.__esModule ? mod : { default: mod };
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.Device = exports.detectDevice = void 0;
+                const bowser_1 = __importDefault(require('bowser'));
+                const Logger_1 = require('./Logger');
+                const EnhancedEventEmitter_1 = require('./EnhancedEventEmitter');
+                const errors_1 = require('./errors');
+                const utils = __importStar(require('./utils'));
+                const ortc = __importStar(require('./ortc'));
+                const Transport_1 = require('./Transport');
+                const Chrome74_1 = require('./handlers/Chrome74');
+                const Chrome70_1 = require('./handlers/Chrome70');
+                const Chrome67_1 = require('./handlers/Chrome67');
+                const Chrome55_1 = require('./handlers/Chrome55');
+                const Firefox60_1 = require('./handlers/Firefox60');
+                const Safari12_1 = require('./handlers/Safari12');
+                const Safari11_1 = require('./handlers/Safari11');
+                const Edge11_1 = require('./handlers/Edge11');
+                const ReactNative_1 = require('./handlers/ReactNative');
+                const logger = new Logger_1.Logger('Device');
+                function detectDevice() {
+                    // React-Native.
+                    // NOTE: react-native-webrtc >= 1.75.0 is required.
+                    if (typeof navigator === 'object' && navigator.product === 'ReactNative') {
+                        if (typeof RTCPeerConnection === 'undefined') {
+                            logger.warn('this._detectDevice() | unsupported ReactNative without RTCPeerConnection');
+                            return undefined;
+                        }
+                        logger.debug('this._detectDevice() | ReactNative handler chosen');
+                        return 'ReactNative';
+                    }
+                    // Browser.
+                    else if (typeof navigator === 'object' && typeof navigator.userAgent === 'string') {
+                        const ua = navigator.userAgent;
+                        const browser = bowser_1.default.getParser(ua);
+                        const engine = browser.getEngine();
+                        // Chrome and Chromium.
+                        if (browser.satisfies({ chrome: '>=74', chromium: '>=74' })) {
+                            return 'Chrome74';
+                        } else if (browser.satisfies({ chrome: '>=70', chromium: '>=70' })) {
+                            return 'Chrome70';
+                        } else if (browser.satisfies({ chrome: '>=67', chromium: '>=67' })) {
+                            return 'Chrome67';
+                        } else if (browser.satisfies({ chrome: '>=55', chromium: '>=55' })) {
+                            return 'Chrome55';
+                        }
+                        // Firefox.
+                        else if (browser.satisfies({ firefox: '>=60' })) {
+                            return 'Firefox60';
+                        }
+                        // Safari with Unified-Plan support enabled.
+                        else if (
+                            browser.satisfies({ safari: '>=12.0' }) &&
+                            typeof RTCRtpTransceiver !== 'undefined' &&
+                            RTCRtpTransceiver.prototype.hasOwnProperty('currentDirection')
+                        ) {
+                            return 'Safari12';
+                        }
+                        // Safari with Plab-B support.
+                        else if (browser.satisfies({ safari: '>=11' })) {
+                            return 'Safari11';
+                        }
+                        // Old Edge with ORTC support.
+                        else if (
+                            browser.satisfies({ 'microsoft edge': '>=11' }) &&
+                            browser.satisfies({ 'microsoft edge': '<=18' })
+                        ) {
+                            return 'Edge11';
+                        }
+                        // Best effort for Chromium based browsers.
+                        else if (engine.name && engine.name.toLowerCase() === 'blink') {
+                            const match = ua.match(/(?:(?:Chrome|Chromium))[ /](\w+)/i);
+                            if (match) {
+                                const version = Number(match[1]);
+                                if (version >= 74) {
+                                    return 'Chrome74';
+                                } else if (version >= 70) {
+                                    return 'Chrome70';
+                                } else if (version >= 67) {
+                                    return 'Chrome67';
+                                } else {
+                                    return 'Chrome55';
+                                }
+                            } else {
+                                return 'Chrome74';
+                            }
+                        }
+                        // Unsupported browser.
+                        else {
+                            logger.warn(
+                                'this._detectDevice() | browser not supported [name:%s, version:%s]',
+                                browser.getBrowserName(),
+                                browser.getBrowserVersion(),
+                            );
+                            return undefined;
+                        }
+                    }
+                    // Unknown device.
+                    else {
+                        logger.warn('this._detectDevice() | unknown device');
+                        return undefined;
+                    }
+                }
+                exports.detectDevice = detectDevice;
+                class Device {
+                    /**
+                     * Create a new Device to connect to mediasoup server.
+                     *
+                     * @throws {UnsupportedError} if device is not supported.
+                     */
+                    constructor({ handlerName, handlerFactory, Handler } = {}) {
+                        // Loaded flag.
+                        this._loaded = false;
+                        // Observer instance.
+                        this._observer = new EnhancedEventEmitter_1.EnhancedEventEmitter();
+                        logger.debug('constructor()');
+                        // Handle deprecated option.
+                        if (Handler) {
+                            logger.warn(
+                                'constructor() | Handler option is DEPRECATED, use handlerName or handlerFactory instead',
+                            );
+                            if (typeof Handler === 'string') handlerName = Handler;
+                            else
+                                throw new TypeError(
+                                    'non string Handler option no longer supported, use handlerFactory instead',
+                                );
+                        }
+                        if (handlerName && handlerFactory) {
+                            throw new TypeError('just one of handlerName or handlerInterface can be given');
+                        }
+                        if (handlerFactory) {
+                            this._handlerFactory = handlerFactory;
+                        } else {
+                            if (handlerName) {
+                                logger.debug('constructor() | handler given: %s', handlerName);
+                            } else {
+                                handlerName = detectDevice();
+                                if (handlerName) logger.debug('constructor() | detected handler: %s', handlerName);
+                                else throw new errors_1.UnsupportedError('device not supported');
+                            }
+                            switch (handlerName) {
+                                case 'Chrome74':
+                                    this._handlerFactory = Chrome74_1.Chrome74.createFactory();
+                                    break;
+                                case 'Chrome70':
+                                    this._handlerFactory = Chrome70_1.Chrome70.createFactory();
+                                    break;
+                                case 'Chrome67':
+                                    this._handlerFactory = Chrome67_1.Chrome67.createFactory();
+                                    break;
+                                case 'Chrome55':
+                                    this._handlerFactory = Chrome55_1.Chrome55.createFactory();
+                                    break;
+                                case 'Firefox60':
+                                    this._handlerFactory = Firefox60_1.Firefox60.createFactory();
+                                    break;
+                                case 'Safari12':
+                                    this._handlerFactory = Safari12_1.Safari12.createFactory();
+                                    break;
+                                case 'Safari11':
+                                    this._handlerFactory = Safari11_1.Safari11.createFactory();
+                                    break;
+                                case 'Edge11':
+                                    this._handlerFactory = Edge11_1.Edge11.createFactory();
+                                    break;
+                                case 'ReactNative':
+                                    this._handlerFactory = ReactNative_1.ReactNative.createFactory();
+                                    break;
+                                default:
+                                    throw new TypeError(`unknown handlerName "${handlerName}"`);
+                            }
+                        }
+                        // Create a temporal handler to get its name.
+                        const handler = this._handlerFactory();
+                        this._handlerName = handler.name;
+                        handler.close();
+                        this._extendedRtpCapabilities = undefined;
+                        this._recvRtpCapabilities = undefined;
+                        this._canProduceByKind = {
+                            audio: false,
+                            video: false,
+                        };
+                        this._sctpCapabilities = undefined;
+                    }
+                    /**
+                     * The RTC handler name.
+                     */
+                    get handlerName() {
+                        return this._handlerName;
+                    }
+                    /**
+                     * Whether the Device is loaded.
+                     */
+                    get loaded() {
+                        return this._loaded;
+                    }
+                    /**
+                     * RTP capabilities of the Device for receiving media.
+                     *
+                     * @throws {InvalidStateError} if not loaded.
+                     */
+                    get rtpCapabilities() {
+                        if (!this._loaded) throw new errors_1.InvalidStateError('not loaded');
+                        return this._recvRtpCapabilities;
+                    }
+                    /**
+                     * SCTP capabilities of the Device.
+                     *
+                     * @throws {InvalidStateError} if not loaded.
+                     */
+                    get sctpCapabilities() {
+                        if (!this._loaded) throw new errors_1.InvalidStateError('not loaded');
+                        return this._sctpCapabilities;
+                    }
+                    /**
+                     * Observer.
+                     *
+                     * @emits newtransport - (transport: Transport)
+                     */
+                    get observer() {
+                        return this._observer;
+                    }
+                    /**
+                     * Initialize the Device.
+                     */
+                    async load({ routerRtpCapabilities }) {
+                        logger.debug('load() [routerRtpCapabilities:%o]', routerRtpCapabilities);
+                        routerRtpCapabilities = utils.clone(routerRtpCapabilities, undefined);
+                        // Temporal handler to get its capabilities.
+                        let handler;
+                        try {
+                            if (this._loaded) throw new errors_1.InvalidStateError('already loaded');
+                            // This may throw.
+                            ortc.validateRtpCapabilities(routerRtpCapabilities);
+                            handler = this._handlerFactory();
+                            const nativeRtpCapabilities = await handler.getNativeRtpCapabilities();
+                            logger.debug('load() | got native RTP capabilities:%o', nativeRtpCapabilities);
+                            // This may throw.
+                            ortc.validateRtpCapabilities(nativeRtpCapabilities);
+                            // Get extended RTP capabilities.
+                            this._extendedRtpCapabilities = ortc.getExtendedRtpCapabilities(
+                                nativeRtpCapabilities,
+                                routerRtpCapabilities,
+                            );
+                            logger.debug('load() | got extended RTP capabilities:%o', this._extendedRtpCapabilities);
+                            // Check whether we can produce audio/video.
+                            this._canProduceByKind.audio = ortc.canSend('audio', this._extendedRtpCapabilities);
+                            this._canProduceByKind.video = ortc.canSend('video', this._extendedRtpCapabilities);
+                            // Generate our receiving RTP capabilities for receiving media.
+                            this._recvRtpCapabilities = ortc.getRecvRtpCapabilities(this._extendedRtpCapabilities);
+                            // This may throw.
+                            ortc.validateRtpCapabilities(this._recvRtpCapabilities);
+                            logger.debug('load() | got receiving RTP capabilities:%o', this._recvRtpCapabilities);
+                            // Generate our SCTP capabilities.
+                            this._sctpCapabilities = await handler.getNativeSctpCapabilities();
+                            logger.debug('load() | got native SCTP capabilities:%o', this._sctpCapabilities);
+                            // This may throw.
+                            ortc.validateSctpCapabilities(this._sctpCapabilities);
+                            logger.debug('load() succeeded');
+                            this._loaded = true;
+                            handler.close();
+                        } catch (error) {
+                            if (handler) handler.close();
+                            throw error;
+                        }
+                    }
+                    /**
+                     * Whether we can produce audio/video.
+                     *
+                     * @throws {InvalidStateError} if not loaded.
+                     * @throws {TypeError} if wrong arguments.
+                     */
+                    canProduce(kind) {
+                        if (!this._loaded) throw new errors_1.InvalidStateError('not loaded');
+                        else if (kind !== 'audio' && kind !== 'video') throw new TypeError(`invalid kind "${kind}"`);
+                        return this._canProduceByKind[kind];
+                    }
+                    /**
+                     * Creates a Transport for sending media.
+                     *
+                     * @throws {InvalidStateError} if not loaded.
+                     * @throws {TypeError} if wrong arguments.
+                     */
+                    createSendTransport({
+                        id,
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        iceServers,
+                        iceTransportPolicy,
+                        additionalSettings,
+                        proprietaryConstraints,
+                        appData = {},
+                    }) {
+                        logger.debug('createSendTransport()');
+                        return this._createTransport({
+                            direction: 'send',
+                            id: id,
+                            iceParameters: iceParameters,
+                            iceCandidates: iceCandidates,
+                            dtlsParameters: dtlsParameters,
+                            sctpParameters: sctpParameters,
+                            iceServers: iceServers,
+                            iceTransportPolicy: iceTransportPolicy,
+                            additionalSettings: additionalSettings,
+                            proprietaryConstraints: proprietaryConstraints,
+                            appData: appData,
+                        });
+                    }
+                    /**
+                     * Creates a Transport for receiving media.
+                     *
+                     * @throws {InvalidStateError} if not loaded.
+                     * @throws {TypeError} if wrong arguments.
+                     */
+                    createRecvTransport({
+                        id,
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        iceServers,
+                        iceTransportPolicy,
+                        additionalSettings,
+                        proprietaryConstraints,
+                        appData = {},
+                    }) {
+                        logger.debug('createRecvTransport()');
+                        return this._createTransport({
+                            direction: 'recv',
+                            id: id,
+                            iceParameters: iceParameters,
+                            iceCandidates: iceCandidates,
+                            dtlsParameters: dtlsParameters,
+                            sctpParameters: sctpParameters,
+                            iceServers: iceServers,
+                            iceTransportPolicy: iceTransportPolicy,
+                            additionalSettings: additionalSettings,
+                            proprietaryConstraints: proprietaryConstraints,
+                            appData: appData,
+                        });
+                    }
+                    _createTransport({
+                        direction,
+                        id,
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        iceServers,
+                        iceTransportPolicy,
+                        additionalSettings,
+                        proprietaryConstraints,
+                        appData = {},
+                    }) {
+                        if (!this._loaded) throw new errors_1.InvalidStateError('not loaded');
+                        else if (typeof id !== 'string') throw new TypeError('missing id');
+                        else if (typeof iceParameters !== 'object') throw new TypeError('missing iceParameters');
+                        else if (!Array.isArray(iceCandidates)) throw new TypeError('missing iceCandidates');
+                        else if (typeof dtlsParameters !== 'object') throw new TypeError('missing dtlsParameters');
+                        else if (sctpParameters && typeof sctpParameters !== 'object')
+                            throw new TypeError('wrong sctpParameters');
+                        else if (appData && typeof appData !== 'object')
+                            throw new TypeError('if given, appData must be an object');
+                        // Create a new Transport.
+                        const transport = new Transport_1.Transport({
+                            direction,
+                            id,
+                            iceParameters,
+                            iceCandidates,
+                            dtlsParameters,
+                            sctpParameters,
+                            iceServers,
+                            iceTransportPolicy,
+                            additionalSettings,
+                            proprietaryConstraints,
+                            appData,
+                            handlerFactory: this._handlerFactory,
+                            extendedRtpCapabilities: this._extendedRtpCapabilities,
+                            canProduceByKind: this._canProduceByKind,
+                        });
+                        // Emit observer event.
+                        this._observer.safeEmit('newtransport', transport);
+                        return transport;
+                    }
+                }
+                exports.Device = Device;
+            },
+            {
+                './EnhancedEventEmitter': 12,
+                './Logger': 13,
+                './Transport': 17,
+                './errors': 18,
+                './handlers/Chrome55': 19,
+                './handlers/Chrome67': 20,
+                './handlers/Chrome70': 21,
+                './handlers/Chrome74': 22,
+                './handlers/Edge11': 23,
+                './handlers/Firefox60': 24,
+                './handlers/ReactNative': 26,
+                './handlers/Safari11': 27,
+                './handlers/Safari12': 28,
+                './ortc': 36,
+                './utils': 39,
+                bowser: 3,
+            },
+        ],
+        12: [
+            function (require, module, exports) {
+                'use strict';
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.EnhancedEventEmitter = void 0;
+                const events_1 = require('events');
+                const Logger_1 = require('./Logger');
+                const logger = new Logger_1.Logger('EnhancedEventEmitter');
+                class EnhancedEventEmitter extends events_1.EventEmitter {
+                    constructor() {
+                        super();
+                        this.setMaxListeners(Infinity);
+                    }
+                    safeEmit(event, ...args) {
+                        const numListeners = this.listenerCount(event);
+                        try {
+                            return this.emit(event, ...args);
+                        } catch (error) {
+                            logger.error('safeEmit() | event listener threw an error [event:%s]:%o', event, error);
+                            return Boolean(numListeners);
+                        }
+                    }
+                    async safeEmitAsPromise(event, ...args) {
+                        return new Promise((resolve, reject) => {
+                            try {
+                                this.emit(event, ...args, resolve, reject);
+                            } catch (error) {
+                                logger.error(
+                                    'safeEmitAsPromise() | event listener threw an error [event:%s]:%o',
+                                    event,
+                                    error,
+                                );
+                                reject(error);
+                            }
+                        });
+                    }
+                }
+                exports.EnhancedEventEmitter = EnhancedEventEmitter;
+            },
+            { './Logger': 13, events: 47 },
+        ],
+        13: [
+            function (require, module, exports) {
+                'use strict';
+                var __importDefault =
+                    (this && this.__importDefault) ||
+                    function (mod) {
+                        return mod && mod.__esModule ? mod : { default: mod };
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.Logger = void 0;
+                const debug_1 = __importDefault(require('debug'));
+                const APP_NAME = 'mediasoup-client';
+                class Logger {
+                    constructor(prefix) {
+                        if (prefix) {
+                            this._debug = debug_1.default(`${APP_NAME}:${prefix}`);
+                            this._warn = debug_1.default(`${APP_NAME}:WARN:${prefix}`);
+                            this._error = debug_1.default(`${APP_NAME}:ERROR:${prefix}`);
+                        } else {
+                            this._debug = debug_1.default(APP_NAME);
+                            this._warn = debug_1.default(`${APP_NAME}:WARN`);
+                            this._error = debug_1.default(`${APP_NAME}:ERROR`);
+                        }
+                        /* eslint-disable no-console */
+                        this._debug.log = console.info.bind(console);
+                        this._warn.log = console.warn.bind(console);
+                        this._error.log = console.error.bind(console);
+                        /* eslint-enable no-console */
+                    }
+                    get debug() {
+                        return this._debug;
+                    }
+                    get warn() {
+                        return this._warn;
+                    }
+                    get error() {
+                        return this._error;
+                    }
+                }
+                exports.Logger = Logger;
+            },
+            { debug: 40 },
+        ],
+        14: [
+            function (require, module, exports) {
+                'use strict';
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.Producer = void 0;
+                const Logger_1 = require('./Logger');
+                const EnhancedEventEmitter_1 = require('./EnhancedEventEmitter');
+                const errors_1 = require('./errors');
+                const logger = new Logger_1.Logger('Producer');
+                class Producer extends EnhancedEventEmitter_1.EnhancedEventEmitter {
+                    /**
+                     * @emits transportclose
+                     * @emits trackended
+                     * @emits @replacetrack - (track: MediaStreamTrack | null)
+                     * @emits @setmaxspatiallayer - (spatialLayer: string)
+                     * @emits @setrtpencodingparameters - (params: any)
+                     * @emits @getstats
+                     * @emits @close
+                     */
+                    constructor({
+                        id,
+                        localId,
+                        rtpSender,
+                        track,
+                        rtpParameters,
+                        stopTracks,
+                        disableTrackOnPause,
+                        zeroRtpOnPause,
+                        appData,
+                    }) {
+                        super();
+                        // Closed flag.
+                        this._closed = false;
+                        // Observer instance.
+                        this._observer = new EnhancedEventEmitter_1.EnhancedEventEmitter();
+                        logger.debug('constructor()');
+                        this._id = id;
+                        this._localId = localId;
+                        this._rtpSender = rtpSender;
+                        this._track = track;
+                        this._kind = track.kind;
+                        this._rtpParameters = rtpParameters;
+                        this._paused = disableTrackOnPause ? !track.enabled : false;
+                        this._maxSpatialLayer = undefined;
+                        this._stopTracks = stopTracks;
+                        this._disableTrackOnPause = disableTrackOnPause;
+                        this._zeroRtpOnPause = zeroRtpOnPause;
+                        this._appData = appData;
+                        this._onTrackEnded = this._onTrackEnded.bind(this);
+                        // NOTE: Minor issue. If zeroRtpOnPause is true, we cannot emit the
+                        // '@replacetrack' event here, so RTCRtpSender.track won't be null.
+                        this._handleTrack();
+                    }
+                    /**
+                     * Producer id.
+                     */
+                    get id() {
+                        return this._id;
+                    }
+                    /**
+                     * Local id.
+                     */
+                    get localId() {
+                        return this._localId;
+                    }
+                    /**
+                     * Whether the Producer is closed.
+                     */
+                    get closed() {
+                        return this._closed;
+                    }
+                    /**
+                     * Media kind.
+                     */
+                    get kind() {
+                        return this._kind;
+                    }
+                    /**
+                     * Associated RTCRtpSender.
+                     */
+                    get rtpSender() {
+                        return this._rtpSender;
+                    }
+                    /**
+                     * The associated track.
+                     */
+                    get track() {
+                        return this._track;
+                    }
+                    /**
+                     * RTP parameters.
+                     */
+                    get rtpParameters() {
+                        return this._rtpParameters;
+                    }
+                    /**
+                     * Whether the Producer is paused.
+                     */
+                    get paused() {
+                        return this._paused;
+                    }
+                    /**
+                     * Max spatial layer.
+                     *
+                     * @type {Number | undefined}
+                     */
+                    get maxSpatialLayer() {
+                        return this._maxSpatialLayer;
+                    }
+                    /**
+                     * App custom data.
+                     */
+                    get appData() {
+                        return this._appData;
+                    }
+                    /**
+                     * Invalid setter.
+                     */
+                    set appData(appData) {
+                        throw new Error('cannot override appData object');
+                    }
+                    /**
+                     * Observer.
+                     *
+                     * @emits close
+                     * @emits pause
+                     * @emits resume
+                     * @emits trackended
+                     */
+                    get observer() {
+                        return this._observer;
+                    }
+                    /**
+                     * Closes the Producer.
+                     */
+                    close() {
+                        if (this._closed) return;
+                        logger.debug('close()');
+                        this._closed = true;
+                        this._destroyTrack();
+                        this.emit('@close');
+                        // Emit observer event.
+                        this._observer.safeEmit('close');
+                    }
+                    /**
+                     * Transport was closed.
+                     */
+                    transportClosed() {
+                        if (this._closed) return;
+                        logger.debug('transportClosed()');
+                        this._closed = true;
+                        this._destroyTrack();
+                        this.safeEmit('transportclose');
+                        // Emit observer event.
+                        this._observer.safeEmit('close');
+                    }
+                    /**
+                     * Get associated RTCRtpSender stats.
+                     */
+                    async getStats() {
+                        if (this._closed) throw new errors_1.InvalidStateError('closed');
+                        return this.safeEmitAsPromise('@getstats');
+                    }
+                    /**
+                     * Pauses sending media.
+                     */
+                    pause() {
+                        logger.debug('pause()');
+                        if (this._closed) {
+                            logger.error('pause() | Producer closed');
+                            return;
+                        }
+                        this._paused = true;
+                        if (this._track && this._disableTrackOnPause) {
+                            this._track.enabled = false;
+                        }
+                        if (this._zeroRtpOnPause) {
+                            this.safeEmitAsPromise('@replacetrack', null).catch(() => {});
+                        }
+                        // Emit observer event.
+                        this._observer.safeEmit('pause');
+                    }
+                    /**
+                     * Resumes sending media.
+                     */
+                    resume() {
+                        logger.debug('resume()');
+                        if (this._closed) {
+                            logger.error('resume() | Producer closed');
+                            return;
+                        }
+                        this._paused = false;
+                        if (this._track && this._disableTrackOnPause) {
+                            this._track.enabled = true;
+                        }
+                        if (this._zeroRtpOnPause) {
+                            this.safeEmitAsPromise('@replacetrack', this._track).catch(() => {});
+                        }
+                        // Emit observer event.
+                        this._observer.safeEmit('resume');
+                    }
+                    /**
+                     * Replaces the current track with a new one or null.
+                     */
+                    async replaceTrack({ track }) {
+                        logger.debug('replaceTrack() [track:%o]', track);
+                        if (this._closed) {
+                            // This must be done here. Otherwise there is no chance to stop the given
+                            // track.
+                            if (track && this._stopTracks) {
+                                try {
+                                    track.stop();
+                                } catch (error) {}
+                            }
+                            throw new errors_1.InvalidStateError('closed');
+                        } else if (track && track.readyState === 'ended') {
+                            throw new errors_1.InvalidStateError('track ended');
+                        }
+                        // Do nothing if this is the same track as the current handled one.
+                        if (track === this._track) {
+                            logger.debug('replaceTrack() | same track, ignored');
+                            return;
+                        }
+                        if (!this._zeroRtpOnPause || !this._paused) {
+                            await this.safeEmitAsPromise('@replacetrack', track);
+                        }
+                        // Destroy the previous track.
+                        this._destroyTrack();
+                        // Set the new track.
+                        this._track = track;
+                        // If this Producer was paused/resumed and the state of the new
+                        // track does not match, fix it.
+                        if (this._track && this._disableTrackOnPause) {
+                            if (!this._paused) this._track.enabled = true;
+                            else if (this._paused) this._track.enabled = false;
+                        }
+                        // Handle the effective track.
+                        this._handleTrack();
+                    }
+                    /**
+                     * Sets the video max spatial layer to be sent.
+                     */
+                    async setMaxSpatialLayer(spatialLayer) {
+                        if (this._closed) throw new errors_1.InvalidStateError('closed');
+                        else if (this._kind !== 'video') throw new errors_1.UnsupportedError('not a video Producer');
+                        else if (typeof spatialLayer !== 'number') throw new TypeError('invalid spatialLayer');
+                        if (spatialLayer === this._maxSpatialLayer) return;
+                        await this.safeEmitAsPromise('@setmaxspatiallayer', spatialLayer);
+                        this._maxSpatialLayer = spatialLayer;
+                    }
+                    /**
+                     * Sets the DSCP value.
+                     */
+                    async setRtpEncodingParameters(params) {
+                        if (this._closed) throw new errors_1.InvalidStateError('closed');
+                        else if (typeof params !== 'object') throw new TypeError('invalid params');
+                        await this.safeEmitAsPromise('@setrtpencodingparameters', params);
+                    }
+                    _onTrackEnded() {
+                        logger.debug('track "ended" event');
+                        this.safeEmit('trackended');
+                        // Emit observer event.
+                        this._observer.safeEmit('trackended');
+                    }
+                    _handleTrack() {
+                        if (!this._track) return;
+                        this._track.addEventListener('ended', this._onTrackEnded);
+                    }
+                    _destroyTrack() {
+                        if (!this._track) return;
+                        try {
+                            this._track.removeEventListener('ended', this._onTrackEnded);
+                            // Just stop the track unless the app set stopTracks: false.
+                            if (this._stopTracks) this._track.stop();
+                        } catch (error) {}
+                    }
+                }
+                exports.Producer = Producer;
+            },
+            { './EnhancedEventEmitter': 12, './Logger': 13, './errors': 18 },
+        ],
+        15: [
+            function (require, module, exports) {
+                'use strict';
+                /**
+                 * The RTP capabilities define what mediasoup or an endpoint can receive at
+                 * media level.
+                 */
+                Object.defineProperty(exports, '__esModule', { value: true });
+            },
+            {},
+        ],
+        16: [
+            function (require, module, exports) {
+                'use strict';
+                Object.defineProperty(exports, '__esModule', { value: true });
+            },
+            {},
+        ],
+        17: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.Transport = void 0;
+                const awaitqueue_1 = require('awaitqueue');
+                const Logger_1 = require('./Logger');
+                const EnhancedEventEmitter_1 = require('./EnhancedEventEmitter');
+                const errors_1 = require('./errors');
+                const utils = __importStar(require('./utils'));
+                const ortc = __importStar(require('./ortc'));
+                const Producer_1 = require('./Producer');
+                const Consumer_1 = require('./Consumer');
+                const DataProducer_1 = require('./DataProducer');
+                const DataConsumer_1 = require('./DataConsumer');
+                const logger = new Logger_1.Logger('Transport');
+                class Transport extends EnhancedEventEmitter_1.EnhancedEventEmitter {
+                    /**
+                     * @emits connect - (transportLocalParameters: any, callback: Function, errback: Function)
+                     * @emits connectionstatechange - (connectionState: ConnectionState)
+                     * @emits produce - (producerLocalParameters: any, callback: Function, errback: Function)
+                     * @emits producedata - (dataProducerLocalParameters: any, callback: Function, errback: Function)
+                     */
+                    constructor({
+                        direction,
+                        id,
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        iceServers,
+                        iceTransportPolicy,
+                        additionalSettings,
+                        proprietaryConstraints,
+                        appData,
+                        handlerFactory,
+                        extendedRtpCapabilities,
+                        canProduceByKind,
+                    }) {
+                        super();
+                        // Closed flag.
+                        this._closed = false;
+                        // Transport connection state.
+                        this._connectionState = 'new';
+                        // Map of Producers indexed by id.
+                        this._producers = new Map();
+                        // Map of Consumers indexed by id.
+                        this._consumers = new Map();
+                        // Map of DataProducers indexed by id.
+                        this._dataProducers = new Map();
+                        // Map of DataConsumers indexed by id.
+                        this._dataConsumers = new Map();
+                        // Whether the Consumer for RTP probation has been created.
+                        this._probatorConsumerCreated = false;
+                        // AwaitQueue instance to make async tasks happen sequentially.
+                        this._awaitQueue = new awaitqueue_1.AwaitQueue({
+                            ClosedErrorClass: errors_1.InvalidStateError,
+                        });
+                        // Observer instance.
+                        this._observer = new EnhancedEventEmitter_1.EnhancedEventEmitter();
+                        logger.debug('constructor() [id:%s, direction:%s]', id, direction);
+                        this._id = id;
+                        this._direction = direction;
+                        this._extendedRtpCapabilities = extendedRtpCapabilities;
+                        this._canProduceByKind = canProduceByKind;
+                        this._maxSctpMessageSize = sctpParameters ? sctpParameters.maxMessageSize : null;
+                        // Clone and sanitize additionalSettings.
+                        additionalSettings = utils.clone(additionalSettings, {});
+                        delete additionalSettings.iceServers;
+                        delete additionalSettings.iceTransportPolicy;
+                        delete additionalSettings.bundlePolicy;
+                        delete additionalSettings.rtcpMuxPolicy;
+                        delete additionalSettings.sdpSemantics;
+                        this._handler = handlerFactory();
+                        this._handler.run({
+                            direction,
+                            iceParameters,
+                            iceCandidates,
+                            dtlsParameters,
+                            sctpParameters,
+                            iceServers,
+                            iceTransportPolicy,
+                            additionalSettings,
+                            proprietaryConstraints,
+                            extendedRtpCapabilities,
+                        });
+                        this._appData = appData;
+                        this._handleHandler();
+                    }
+                    /**
+                     * Transport id.
+                     */
+                    get id() {
+                        return this._id;
+                    }
+                    /**
+                     * Whether the Transport is closed.
+                     */
+                    get closed() {
+                        return this._closed;
+                    }
+                    /**
+                     * Transport direction.
+                     */
+                    get direction() {
+                        return this._direction;
+                    }
+                    /**
+                     * RTC handler instance.
+                     */
+                    get handler() {
+                        return this._handler;
+                    }
+                    /**
+                     * Connection state.
+                     */
+                    get connectionState() {
+                        return this._connectionState;
+                    }
+                    /**
+                     * App custom data.
+                     */
+                    get appData() {
+                        return this._appData;
+                    }
+                    /**
+                     * Invalid setter.
+                     */
+                    set appData(appData) {
+                        throw new Error('cannot override appData object');
+                    }
+                    /**
+                     * Observer.
+                     *
+                     * @emits close
+                     * @emits newproducer - (producer: Producer)
+                     * @emits newconsumer - (producer: Producer)
+                     * @emits newdataproducer - (dataProducer: DataProducer)
+                     * @emits newdataconsumer - (dataProducer: DataProducer)
+                     */
+                    get observer() {
+                        return this._observer;
+                    }
+                    /**
+                     * Close the Transport.
+                     */
+                    close() {
+                        if (this._closed) return;
+                        logger.debug('close()');
+                        this._closed = true;
+                        // Close the AwaitQueue.
+                        this._awaitQueue.close();
+                        // Close the handler.
+                        this._handler.close();
+                        // Close all Producers.
+                        for (const producer of this._producers.values()) {
+                            producer.transportClosed();
+                        }
+                        this._producers.clear();
+                        // Close all Consumers.
+                        for (const consumer of this._consumers.values()) {
+                            consumer.transportClosed();
+                        }
+                        this._consumers.clear();
+                        // Close all DataProducers.
+                        for (const dataProducer of this._dataProducers.values()) {
+                            dataProducer.transportClosed();
+                        }
+                        this._dataProducers.clear();
+                        // Close all DataConsumers.
+                        for (const dataConsumer of this._dataConsumers.values()) {
+                            dataConsumer.transportClosed();
+                        }
+                        this._dataConsumers.clear();
+                        // Emit observer event.
+                        this._observer.safeEmit('close');
+                    }
+                    /**
+                     * Get associated Transport (RTCPeerConnection) stats.
+                     *
+                     * @returns {RTCStatsReport}
+                     */
+                    async getStats() {
+                        if (this._closed) throw new errors_1.InvalidStateError('closed');
+                        return this._handler.getTransportStats();
+                    }
+                    /**
+                     * Restart ICE connection.
+                     */
+                    async restartIce({ iceParameters }) {
+                        logger.debug('restartIce()');
+                        if (this._closed) throw new errors_1.InvalidStateError('closed');
+                        else if (!iceParameters) throw new TypeError('missing iceParameters');
+                        // Enqueue command.
+                        return this._awaitQueue.push(
+                            async () => this._handler.restartIce(iceParameters),
+                            'transport.restartIce()',
+                        );
+                    }
+                    /**
+                     * Update ICE servers.
+                     */
+                    async updateIceServers({ iceServers } = {}) {
+                        logger.debug('updateIceServers()');
+                        if (this._closed) throw new errors_1.InvalidStateError('closed');
+                        else if (!Array.isArray(iceServers)) throw new TypeError('missing iceServers');
+                        // Enqueue command.
+                        return this._awaitQueue.push(
+                            async () => this._handler.updateIceServers(iceServers),
+                            'transport.updateIceServers()',
+                        );
+                    }
+                    /**
+                     * Create a Producer.
+                     */
+                    async produce({
+                        track,
+                        encodings,
+                        codecOptions,
+                        codec,
+                        stopTracks = true,
+                        disableTrackOnPause = true,
+                        zeroRtpOnPause = false,
+                        appData = {},
+                    } = {}) {
+                        logger.debug('produce() [track:%o]', track);
+                        if (!track) throw new TypeError('missing track');
+                        else if (this._direction !== 'send')
+                            throw new errors_1.UnsupportedError('not a sending Transport');
+                        else if (!this._canProduceByKind[track.kind])
+                            throw new errors_1.UnsupportedError(`cannot produce ${track.kind}`);
+                        else if (track.readyState === 'ended') throw new errors_1.InvalidStateError('track ended');
+                        else if (this.listenerCount('connect') === 0 && this._connectionState === 'new')
+                            throw new TypeError('no "connect" listener set into this transport');
+                        else if (this.listenerCount('produce') === 0)
+                            throw new TypeError('no "produce" listener set into this transport');
+                        else if (appData && typeof appData !== 'object')
+                            throw new TypeError('if given, appData must be an object');
+                        // Enqueue command.
+                        return (
+                            this._awaitQueue
+                                .push(async () => {
+                                    let normalizedEncodings;
+                                    if (encodings && !Array.isArray(encodings)) {
+                                        throw TypeError('encodings must be an array');
+                                    } else if (encodings && encodings.length === 0) {
+                                        normalizedEncodings = undefined;
+                                    } else if (encodings) {
+                                        normalizedEncodings = encodings.map((encoding) => {
+                                            const normalizedEncoding = { active: true };
+                                            if (encoding.active === false) normalizedEncoding.active = false;
+                                            if (typeof encoding.dtx === 'boolean')
+                                                normalizedEncoding.dtx = encoding.dtx;
+                                            if (typeof encoding.scalabilityMode === 'string')
+                                                normalizedEncoding.scalabilityMode = encoding.scalabilityMode;
+                                            if (typeof encoding.scaleResolutionDownBy === 'number')
+                                                normalizedEncoding.scaleResolutionDownBy =
+                                                    encoding.scaleResolutionDownBy;
+                                            if (typeof encoding.maxBitrate === 'number')
+                                                normalizedEncoding.maxBitrate = encoding.maxBitrate;
+                                            if (typeof encoding.maxFramerate === 'number')
+                                                normalizedEncoding.maxFramerate = encoding.maxFramerate;
+                                            if (typeof encoding.adaptivePtime === 'boolean')
+                                                normalizedEncoding.adaptivePtime = encoding.adaptivePtime;
+                                            if (typeof encoding.priority === 'string')
+                                                normalizedEncoding.priority = encoding.priority;
+                                            if (typeof encoding.networkPriority === 'string')
+                                                normalizedEncoding.networkPriority = encoding.networkPriority;
+                                            return normalizedEncoding;
+                                        });
+                                    }
+                                    const { localId, rtpParameters, rtpSender } = await this._handler.send({
+                                        track,
+                                        encodings: normalizedEncodings,
+                                        codecOptions,
+                                        codec,
+                                    });
+                                    try {
+                                        // This will fill rtpParameters's missing fields with default values.
+                                        ortc.validateRtpParameters(rtpParameters);
+                                        const { id } = await this.safeEmitAsPromise('produce', {
+                                            kind: track.kind,
+                                            rtpParameters,
+                                            appData,
+                                        });
+                                        const producer = new Producer_1.Producer({
+                                            id,
+                                            localId,
+                                            rtpSender,
+                                            track,
+                                            rtpParameters,
+                                            stopTracks,
+                                            disableTrackOnPause,
+                                            zeroRtpOnPause,
+                                            appData,
+                                        });
+                                        this._producers.set(producer.id, producer);
+                                        this._handleProducer(producer);
+                                        // Emit observer event.
+                                        this._observer.safeEmit('newproducer', producer);
+                                        return producer;
+                                    } catch (error) {
+                                        this._handler.stopSending(localId).catch(() => {});
+                                        throw error;
+                                    }
+                                }, 'transport.produce()')
+                                // This catch is needed to stop the given track if the command above
+                                // failed due to closed Transport.
+                                .catch((error) => {
+                                    if (stopTracks) {
+                                        try {
+                                            track.stop();
+                                        } catch (error2) {}
+                                    }
+                                    throw error;
+                                })
+                        );
+                    }
+                    /**
+                     * Create a Consumer to consume a remote Producer.
+                     */
+                    async consume({ id, producerId, kind, rtpParameters, appData = {} }) {
+                        logger.debug('consume()');
+                        rtpParameters = utils.clone(rtpParameters, undefined);
+                        if (this._closed) throw new errors_1.InvalidStateError('closed');
+                        else if (this._direction !== 'recv')
+                            throw new errors_1.UnsupportedError('not a receiving Transport');
+                        else if (typeof id !== 'string') throw new TypeError('missing id');
+                        else if (typeof producerId !== 'string') throw new TypeError('missing producerId');
+                        else if (kind !== 'audio' && kind !== 'video') throw new TypeError(`invalid kind '${kind}'`);
+                        else if (this.listenerCount('connect') === 0 && this._connectionState === 'new')
+                            throw new TypeError('no "connect" listener set into this transport');
+                        else if (appData && typeof appData !== 'object')
+                            throw new TypeError('if given, appData must be an object');
+                        // Enqueue command.
+                        return this._awaitQueue.push(async () => {
+                            // Ensure the device can consume it.
+                            const canConsume = ortc.canReceive(rtpParameters, this._extendedRtpCapabilities);
+                            if (!canConsume) throw new errors_1.UnsupportedError('cannot consume this Producer');
+                            const { localId, rtpReceiver, track } = await this._handler.receive({
+                                trackId: id,
+                                kind,
+                                rtpParameters,
+                            });
+                            const consumer = new Consumer_1.Consumer({
+                                id,
+                                localId,
+                                producerId,
+                                rtpReceiver,
+                                track,
+                                rtpParameters,
+                                appData,
+                            });
+                            this._consumers.set(consumer.id, consumer);
+                            this._handleConsumer(consumer);
+                            // If this is the first video Consumer and the Consumer for RTP probation
+                            // has not yet been created, create it now.
+                            if (!this._probatorConsumerCreated && kind === 'video') {
+                                try {
+                                    const probatorRtpParameters = ortc.generateProbatorRtpParameters(
+                                        consumer.rtpParameters,
+                                    );
+                                    await this._handler.receive({
+                                        trackId: 'probator',
+                                        kind: 'video',
+                                        rtpParameters: probatorRtpParameters,
+                                    });
+                                    logger.debug('consume() | Consumer for RTP probation created');
+                                    this._probatorConsumerCreated = true;
+                                } catch (error) {
+                                    logger.error('consume() | failed to create Consumer for RTP probation:%o', error);
+                                }
+                            }
+                            // Emit observer event.
+                            this._observer.safeEmit('newconsumer', consumer);
+                            return consumer;
+                        }, 'transport.consume()');
+                    }
+                    /**
+                     * Create a DataProducer
+                     */
+                    async produceData({
+                        ordered = true,
+                        maxPacketLifeTime,
+                        maxRetransmits,
+                        label = '',
+                        protocol = '',
+                        appData = {},
+                    } = {}) {
+                        logger.debug('produceData()');
+                        if (this._direction !== 'send') throw new errors_1.UnsupportedError('not a sending Transport');
+                        else if (!this._maxSctpMessageSize)
+                            throw new errors_1.UnsupportedError('SCTP not enabled by remote Transport');
+                        else if (this.listenerCount('connect') === 0 && this._connectionState === 'new')
+                            throw new TypeError('no "connect" listener set into this transport');
+                        else if (this.listenerCount('producedata') === 0)
+                            throw new TypeError('no "producedata" listener set into this transport');
+                        else if (appData && typeof appData !== 'object')
+                            throw new TypeError('if given, appData must be an object');
+                        if (maxPacketLifeTime || maxRetransmits) ordered = false;
+                        // Enqueue command.
+                        return this._awaitQueue.push(async () => {
+                            const { dataChannel, sctpStreamParameters } = await this._handler.sendDataChannel({
+                                ordered,
+                                maxPacketLifeTime,
+                                maxRetransmits,
+                                label,
+                                protocol,
+                            });
+                            // This will fill sctpStreamParameters's missing fields with default values.
+                            ortc.validateSctpStreamParameters(sctpStreamParameters);
+                            const { id } = await this.safeEmitAsPromise('producedata', {
+                                sctpStreamParameters,
+                                label,
+                                protocol,
+                                appData,
+                            });
+                            const dataProducer = new DataProducer_1.DataProducer({
+                                id,
+                                dataChannel,
+                                sctpStreamParameters,
+                                appData,
+                            });
+                            this._dataProducers.set(dataProducer.id, dataProducer);
+                            this._handleDataProducer(dataProducer);
+                            // Emit observer event.
+                            this._observer.safeEmit('newdataproducer', dataProducer);
+                            return dataProducer;
+                        }, 'transport.produceData()');
+                    }
+                    /**
+                     * Create a DataConsumer
+                     */
+                    async consumeData({
+                        id,
+                        dataProducerId,
+                        sctpStreamParameters,
+                        label = '',
+                        protocol = '',
+                        appData = {},
+                    }) {
+                        logger.debug('consumeData()');
+                        sctpStreamParameters = utils.clone(sctpStreamParameters, undefined);
+                        if (this._closed) throw new errors_1.InvalidStateError('closed');
+                        else if (this._direction !== 'recv')
+                            throw new errors_1.UnsupportedError('not a receiving Transport');
+                        else if (!this._maxSctpMessageSize)
+                            throw new errors_1.UnsupportedError('SCTP not enabled by remote Transport');
+                        else if (typeof id !== 'string') throw new TypeError('missing id');
+                        else if (typeof dataProducerId !== 'string') throw new TypeError('missing dataProducerId');
+                        else if (this.listenerCount('connect') === 0 && this._connectionState === 'new')
+                            throw new TypeError('no "connect" listener set into this transport');
+                        else if (appData && typeof appData !== 'object')
+                            throw new TypeError('if given, appData must be an object');
+                        // This may throw.
+                        ortc.validateSctpStreamParameters(sctpStreamParameters);
+                        // Enqueue command.
+                        return this._awaitQueue.push(async () => {
+                            const { dataChannel } = await this._handler.receiveDataChannel({
+                                sctpStreamParameters,
+                                label,
+                                protocol,
+                            });
+                            const dataConsumer = new DataConsumer_1.DataConsumer({
+                                id,
+                                dataProducerId,
+                                dataChannel,
+                                sctpStreamParameters,
+                                appData,
+                            });
+                            this._dataConsumers.set(dataConsumer.id, dataConsumer);
+                            this._handleDataConsumer(dataConsumer);
+                            // Emit observer event.
+                            this._observer.safeEmit('newdataconsumer', dataConsumer);
+                            return dataConsumer;
+                        }, 'transport.consumeData()');
+                    }
+                    _handleHandler() {
+                        const handler = this._handler;
+                        handler.on('@connect', ({ dtlsParameters }, callback, errback) => {
+                            if (this._closed) {
+                                errback(new errors_1.InvalidStateError('closed'));
+                                return;
+                            }
+                            this.safeEmit('connect', { dtlsParameters }, callback, errback);
+                        });
+                        handler.on('@connectionstatechange', (connectionState) => {
+                            if (connectionState === this._connectionState) return;
+                            logger.debug('connection state changed to %s', connectionState);
+                            this._connectionState = connectionState;
+                            if (!this._closed) this.safeEmit('connectionstatechange', connectionState);
+                        });
+                    }
+                    _handleProducer(producer) {
+                        producer.on('@close', () => {
+                            this._producers.delete(producer.id);
+                            if (this._closed) return;
+                            this._awaitQueue
+                                .push(async () => this._handler.stopSending(producer.localId), 'producer @close event')
+                                .catch((error) => logger.warn('producer.close() failed:%o', error));
+                        });
+                        producer.on('@replacetrack', (track, callback, errback) => {
+                            this._awaitQueue
+                                .push(
+                                    async () => this._handler.replaceTrack(producer.localId, track),
+                                    'producer @replacetrack event',
+                                )
+                                .then(callback)
+                                .catch(errback);
+                        });
+                        producer.on('@setmaxspatiallayer', (spatialLayer, callback, errback) => {
+                            this._awaitQueue
+                                .push(
+                                    async () => this._handler.setMaxSpatialLayer(producer.localId, spatialLayer),
+                                    'producer @setmaxspatiallayer event',
+                                )
+                                .then(callback)
+                                .catch(errback);
+                        });
+                        producer.on('@setrtpencodingparameters', (params, callback, errback) => {
+                            this._awaitQueue
+                                .push(
+                                    async () => this._handler.setRtpEncodingParameters(producer.localId, params),
+                                    'producer @setrtpencodingparameters event',
+                                )
+                                .then(callback)
+                                .catch(errback);
+                        });
+                        producer.on('@getstats', (callback, errback) => {
+                            if (this._closed) return errback(new errors_1.InvalidStateError('closed'));
+                            this._handler.getSenderStats(producer.localId).then(callback).catch(errback);
+                        });
+                    }
+                    _handleConsumer(consumer) {
+                        consumer.on('@close', () => {
+                            this._consumers.delete(consumer.id);
+                            if (this._closed) return;
+                            this._awaitQueue
+                                .push(
+                                    async () => this._handler.stopReceiving(consumer.localId),
+                                    'consumer @close event',
+                                )
+                                .catch(() => {});
+                        });
+                        consumer.on('@getstats', (callback, errback) => {
+                            if (this._closed) return errback(new errors_1.InvalidStateError('closed'));
+                            this._handler.getReceiverStats(consumer.localId).then(callback).catch(errback);
+                        });
+                    }
+                    _handleDataProducer(dataProducer) {
+                        dataProducer.on('@close', () => {
+                            this._dataProducers.delete(dataProducer.id);
+                        });
+                    }
+                    _handleDataConsumer(dataConsumer) {
+                        dataConsumer.on('@close', () => {
+                            this._dataConsumers.delete(dataConsumer.id);
+                        });
+                    }
+                }
+                exports.Transport = Transport;
+            },
+            {
+                './Consumer': 8,
+                './DataConsumer': 9,
+                './DataProducer': 10,
+                './EnhancedEventEmitter': 12,
+                './Logger': 13,
+                './Producer': 14,
+                './errors': 18,
+                './ortc': 36,
+                './utils': 39,
+                awaitqueue: 2,
+            },
+        ],
+        18: [
+            function (require, module, exports) {
+                'use strict';
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.InvalidStateError = exports.UnsupportedError = void 0;
+                /**
+                 * Error indicating not support for something.
+                 */
+                class UnsupportedError extends Error {
+                    constructor(message) {
+                        super(message);
+                        this.name = 'UnsupportedError';
+                        if (Error.hasOwnProperty('captureStackTrace')) {
+                            // Just in V8.
+                            // @ts-ignore
+                            Error.captureStackTrace(this, UnsupportedError);
+                        } else {
+                            this.stack = new Error(message).stack;
+                        }
+                    }
+                }
+                exports.UnsupportedError = UnsupportedError;
+                /**
+                 * Error produced when calling a method in an invalid state.
+                 */
+                class InvalidStateError extends Error {
+                    constructor(message) {
+                        super(message);
+                        this.name = 'InvalidStateError';
+                        if (Error.hasOwnProperty('captureStackTrace')) {
+                            // Just in V8.
+                            // @ts-ignore
+                            Error.captureStackTrace(this, InvalidStateError);
+                        } else {
+                            this.stack = new Error(message).stack;
+                        }
+                    }
+                }
+                exports.InvalidStateError = InvalidStateError;
+            },
+            {},
+        ],
+        19: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.Chrome55 = void 0;
+                const sdpTransform = __importStar(require('sdp-transform'));
+                const Logger_1 = require('../Logger');
+                const errors_1 = require('../errors');
+                const utils = __importStar(require('../utils'));
+                const ortc = __importStar(require('../ortc'));
+                const sdpCommonUtils = __importStar(require('./sdp/commonUtils'));
+                const sdpPlanBUtils = __importStar(require('./sdp/planBUtils'));
+                const HandlerInterface_1 = require('./HandlerInterface');
+                const RemoteSdp_1 = require('./sdp/RemoteSdp');
+                const logger = new Logger_1.Logger('Chrome55');
+                const SCTP_NUM_STREAMS = { OS: 1024, MIS: 1024 };
+                class Chrome55 extends HandlerInterface_1.HandlerInterface {
+                    constructor() {
+                        super();
+                        // Local stream for sending.
+                        this._sendStream = new MediaStream();
+                        // Map of sending MediaStreamTracks indexed by localId.
+                        this._mapSendLocalIdTrack = new Map();
+                        // Next sending localId.
+                        this._nextSendLocalId = 0;
+                        // Map of MID, RTP parameters and RTCRtpReceiver indexed by local id.
+                        // Value is an Object with mid, rtpParameters and rtpReceiver.
+                        this._mapRecvLocalIdInfo = new Map();
+                        // Whether a DataChannel m=application section has been created.
+                        this._hasDataChannelMediaSection = false;
+                        // Sending DataChannel id value counter. Incremented for each new DataChannel.
+                        this._nextSendSctpStreamId = 0;
+                        // Got transport local and remote parameters.
+                        this._transportReady = false;
+                    }
+                    /**
+                     * Creates a factory function.
+                     */
+                    static createFactory() {
+                        return () => new Chrome55();
+                    }
+                    get name() {
+                        return 'Chrome55';
+                    }
+                    close() {
+                        logger.debug('close()');
+                        // Close RTCPeerConnection.
+                        if (this._pc) {
+                            try {
+                                this._pc.close();
+                            } catch (error) {}
+                        }
+                    }
+                    async getNativeRtpCapabilities() {
+                        logger.debug('getNativeRtpCapabilities()');
+                        const pc = new RTCPeerConnection({
+                            iceServers: [],
+                            iceTransportPolicy: 'all',
+                            bundlePolicy: 'max-bundle',
+                            rtcpMuxPolicy: 'require',
+                            sdpSemantics: 'plan-b',
+                        });
+                        try {
+                            const offer = await pc.createOffer({
+                                offerToReceiveAudio: true,
+                                offerToReceiveVideo: true,
+                            });
+                            try {
+                                pc.close();
+                            } catch (error) {}
+                            const sdpObject = sdpTransform.parse(offer.sdp);
+                            const nativeRtpCapabilities = sdpCommonUtils.extractRtpCapabilities({ sdpObject });
+                            return nativeRtpCapabilities;
+                        } catch (error) {
+                            try {
+                                pc.close();
+                            } catch (error2) {}
+                            throw error;
+                        }
+                    }
+                    async getNativeSctpCapabilities() {
+                        logger.debug('getNativeSctpCapabilities()');
+                        return {
+                            numStreams: SCTP_NUM_STREAMS,
+                        };
+                    }
+                    run({
+                        direction,
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        iceServers,
+                        iceTransportPolicy,
+                        additionalSettings,
+                        proprietaryConstraints,
+                        extendedRtpCapabilities,
+                    }) {
+                        logger.debug('run()');
+                        this._direction = direction;
+                        this._remoteSdp = new RemoteSdp_1.RemoteSdp({
+                            iceParameters,
+                            iceCandidates,
+                            dtlsParameters,
+                            sctpParameters,
+                            planB: true,
+                        });
+                        this._sendingRtpParametersByKind = {
+                            audio: ortc.getSendingRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._sendingRemoteRtpParametersByKind = {
+                            audio: ortc.getSendingRemoteRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRemoteRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._pc = new RTCPeerConnection(
+                            Object.assign(
+                                {
+                                    iceServers: iceServers || [],
+                                    iceTransportPolicy: iceTransportPolicy || 'all',
+                                    bundlePolicy: 'max-bundle',
+                                    rtcpMuxPolicy: 'require',
+                                    sdpSemantics: 'plan-b',
+                                },
+                                additionalSettings,
+                            ),
+                            proprietaryConstraints,
+                        );
+                        // Handle RTCPeerConnection connection status.
+                        this._pc.addEventListener('iceconnectionstatechange', () => {
+                            switch (this._pc.iceConnectionState) {
+                                case 'checking':
+                                    this.emit('@connectionstatechange', 'connecting');
+                                    break;
+                                case 'connected':
+                                case 'completed':
+                                    this.emit('@connectionstatechange', 'connected');
+                                    break;
+                                case 'failed':
+                                    this.emit('@connectionstatechange', 'failed');
+                                    break;
+                                case 'disconnected':
+                                    this.emit('@connectionstatechange', 'disconnected');
+                                    break;
+                                case 'closed':
+                                    this.emit('@connectionstatechange', 'closed');
+                                    break;
+                            }
+                        });
+                    }
+                    async updateIceServers(iceServers) {
+                        logger.debug('updateIceServers()');
+                        const configuration = this._pc.getConfiguration();
+                        configuration.iceServers = iceServers;
+                        this._pc.setConfiguration(configuration);
+                    }
+                    async restartIce(iceParameters) {
+                        logger.debug('restartIce()');
+                        // Provide the remote SDP handler with new remote ICE parameters.
+                        this._remoteSdp.updateIceParameters(iceParameters);
+                        if (!this._transportReady) return;
+                        if (this._direction === 'send') {
+                            const offer = await this._pc.createOffer({ iceRestart: true });
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                        } else {
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [answer:%o]', answer);
+                            await this._pc.setLocalDescription(answer);
+                        }
+                    }
+                    async getTransportStats() {
+                        return this._pc.getStats();
+                    }
+                    async send({ track, encodings, codecOptions, codec }) {
+                        this._assertSendDirection();
+                        logger.debug('send() [kind:%s, track.id:%s]', track.kind, track.id);
+                        if (codec) {
+                            logger.warn('send() | codec selection is not available in %s handler', this.name);
+                        }
+                        this._sendStream.addTrack(track);
+                        this._pc.addStream(this._sendStream);
+                        let offer = await this._pc.createOffer();
+                        let localSdpObject = sdpTransform.parse(offer.sdp);
+                        let offerMediaObject;
+                        const sendingRtpParameters = utils.clone(this._sendingRtpParametersByKind[track.kind], {});
+                        sendingRtpParameters.codecs = ortc.reduceCodecs(sendingRtpParameters.codecs);
+                        const sendingRemoteRtpParameters = utils.clone(
+                            this._sendingRemoteRtpParametersByKind[track.kind],
+                            {},
+                        );
+                        sendingRemoteRtpParameters.codecs = ortc.reduceCodecs(sendingRemoteRtpParameters.codecs);
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                        if (track.kind === 'video' && encodings && encodings.length > 1) {
+                            logger.debug('send() | enabling simulcast');
+                            localSdpObject = sdpTransform.parse(offer.sdp);
+                            offerMediaObject = localSdpObject.media.find((m) => m.type === 'video');
+                            sdpPlanBUtils.addLegacySimulcast({
+                                offerMediaObject,
+                                track,
+                                numStreams: encodings.length,
+                            });
+                            offer = { type: 'offer', sdp: sdpTransform.write(localSdpObject) };
+                        }
+                        logger.debug('send() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        await this._pc.setLocalDescription(offer);
+                        localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        offerMediaObject = localSdpObject.media.find((m) => m.type === track.kind);
+                        // Set RTCP CNAME.
+                        sendingRtpParameters.rtcp.cname = sdpCommonUtils.getCname({ offerMediaObject });
+                        // Set RTP encodings.
+                        sendingRtpParameters.encodings = sdpPlanBUtils.getRtpEncodings({ offerMediaObject, track });
+                        // Complete encodings with given values.
+                        if (encodings) {
+                            for (let idx = 0; idx < sendingRtpParameters.encodings.length; ++idx) {
+                                if (encodings[idx]) Object.assign(sendingRtpParameters.encodings[idx], encodings[idx]);
+                            }
+                        }
+                        // If VP8 and there is effective simulcast, add scalabilityMode to each
+                        // encoding.
+                        if (
+                            sendingRtpParameters.encodings.length > 1 &&
+                            sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/vp8'
+                        ) {
+                            for (const encoding of sendingRtpParameters.encodings) {
+                                encoding.scalabilityMode = 'S1T3';
+                            }
+                        }
+                        this._remoteSdp.send({
+                            offerMediaObject,
+                            offerRtpParameters: sendingRtpParameters,
+                            answerRtpParameters: sendingRemoteRtpParameters,
+                            codecOptions,
+                        });
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('send() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                        const localId = String(this._nextSendLocalId);
+                        this._nextSendLocalId++;
+                        // Insert into the map.
+                        this._mapSendLocalIdTrack.set(localId, track);
+                        return {
+                            localId: localId,
+                            rtpParameters: sendingRtpParameters,
+                        };
+                    }
+                    async stopSending(localId) {
+                        this._assertSendDirection();
+                        logger.debug('stopSending() [localId:%s]', localId);
+                        const track = this._mapSendLocalIdTrack.get(localId);
+                        if (!track) throw new Error('track not found');
+                        this._mapSendLocalIdTrack.delete(localId);
+                        this._sendStream.removeTrack(track);
+                        this._pc.addStream(this._sendStream);
+                        const offer = await this._pc.createOffer();
+                        logger.debug('stopSending() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        try {
+                            await this._pc.setLocalDescription(offer);
+                        } catch (error) {
+                            // NOTE: If there are no sending tracks, setLocalDescription() will fail with
+                            // "Failed to create channels". If so, ignore it.
+                            if (this._sendStream.getTracks().length === 0) {
+                                logger.warn(
+                                    'stopSending() | ignoring expected error due no sending tracks: %s',
+                                    error.toString(),
+                                );
+                                return;
+                            }
+                            throw error;
+                        }
+                        if (this._pc.signalingState === 'stable') return;
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopSending() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                    }
+                    async replaceTrack(
+                        // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                        localId,
+                        track,
+                    ) {
+                        throw new errors_1.UnsupportedError('not implemented');
+                    }
+                    // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                    async setMaxSpatialLayer(localId, spatialLayer) {
+                        throw new errors_1.UnsupportedError(' not implemented');
+                    }
+                    // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                    async setRtpEncodingParameters(localId, params) {
+                        throw new errors_1.UnsupportedError('not supported');
+                    }
+                    // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                    async getSenderStats(localId) {
+                        throw new errors_1.UnsupportedError('not implemented');
+                    }
+                    async sendDataChannel({ ordered, maxPacketLifeTime, maxRetransmits, label, protocol }) {
+                        this._assertSendDirection();
+                        const options = {
+                            negotiated: true,
+                            id: this._nextSendSctpStreamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmitTime: maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('sendDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // Increase next id.
+                        this._nextSendSctpStreamId = ++this._nextSendSctpStreamId % SCTP_NUM_STREAMS.MIS;
+                        // If this is the first DataChannel we need to create the SDP answer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            const offer = await this._pc.createOffer();
+                            const localSdpObject = sdpTransform.parse(offer.sdp);
+                            const offerMediaObject = localSdpObject.media.find((m) => m.type === 'application');
+                            if (!this._transportReady)
+                                await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                            logger.debug('sendDataChannel() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            this._remoteSdp.sendSctpAssociation({ offerMediaObject });
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('sendDataChannel() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        const sctpStreamParameters = {
+                            streamId: options.id,
+                            ordered: options.ordered,
+                            maxPacketLifeTime: options.maxPacketLifeTime,
+                            maxRetransmits: options.maxRetransmits,
+                        };
+                        return { dataChannel, sctpStreamParameters };
+                    }
+                    async receive({ trackId, kind, rtpParameters }) {
+                        this._assertRecvDirection();
+                        logger.debug('receive() [trackId:%s, kind:%s]', trackId, kind);
+                        const localId = trackId;
+                        const mid = kind;
+                        const streamId = rtpParameters.rtcp.cname;
+                        this._remoteSdp.receive({
+                            mid,
+                            kind,
+                            offerRtpParameters: rtpParameters,
+                            streamId,
+                            trackId,
+                        });
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('receive() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        let answer = await this._pc.createAnswer();
+                        const localSdpObject = sdpTransform.parse(answer.sdp);
+                        const answerMediaObject = localSdpObject.media.find((m) => String(m.mid) === mid);
+                        // May need to modify codec parameters in the answer based on codec
+                        // parameters in the offer.
+                        sdpCommonUtils.applyCodecParameters({
+                            offerRtpParameters: rtpParameters,
+                            answerMediaObject,
+                        });
+                        answer = { type: 'answer', sdp: sdpTransform.write(localSdpObject) };
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                        logger.debug('receive() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                        const stream = this._pc.getRemoteStreams().find((s) => s.id === streamId);
+                        const track = stream.getTrackById(localId);
+                        if (!track) throw new Error('remote track not found');
+                        // Insert into the map.
+                        this._mapRecvLocalIdInfo.set(localId, { mid, rtpParameters });
+                        return { localId, track };
+                    }
+                    async stopReceiving(localId) {
+                        this._assertRecvDirection();
+                        logger.debug('stopReceiving() [localId:%s]', localId);
+                        const { mid, rtpParameters } = this._mapRecvLocalIdInfo.get(localId) || {};
+                        // Remove from the map.
+                        this._mapRecvLocalIdInfo.delete(localId);
+                        this._remoteSdp.planBStopReceiving({ mid: mid, offerRtpParameters: rtpParameters });
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopReceiving() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        const answer = await this._pc.createAnswer();
+                        logger.debug('stopReceiving() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                    }
+                    // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                    async getReceiverStats(localId) {
+                        throw new errors_1.UnsupportedError('not implemented');
+                    }
+                    async receiveDataChannel({ sctpStreamParameters, label, protocol }) {
+                        this._assertRecvDirection();
+                        const { streamId, ordered, maxPacketLifeTime, maxRetransmits } = sctpStreamParameters;
+                        const options = {
+                            negotiated: true,
+                            id: streamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmitTime: maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('receiveDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // If this is the first DataChannel we need to create the SDP offer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            this._remoteSdp.receiveSctpAssociation({ oldDataChannelSpec: true });
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('receiveDataChannel() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            if (!this._transportReady) {
+                                const localSdpObject = sdpTransform.parse(answer.sdp);
+                                await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                            }
+                            logger.debug(
+                                'receiveDataChannel() | calling pc.setRemoteDescription() [answer:%o]',
+                                answer,
+                            );
+                            await this._pc.setLocalDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        return { dataChannel };
+                    }
+                    async _setupTransport({ localDtlsRole, localSdpObject }) {
+                        if (!localSdpObject) localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        // Get our local DTLS parameters.
+                        const dtlsParameters = sdpCommonUtils.extractDtlsParameters({ sdpObject: localSdpObject });
+                        // Set our DTLS role.
+                        dtlsParameters.role = localDtlsRole;
+                        // Update the remote DTLS role in the SDP.
+                        this._remoteSdp.updateDtlsRole(localDtlsRole === 'client' ? 'server' : 'client');
+                        // Need to tell the remote transport about our parameters.
+                        await this.safeEmitAsPromise('@connect', { dtlsParameters });
+                        this._transportReady = true;
+                    }
+                    _assertSendDirection() {
+                        if (this._direction !== 'send') {
+                            throw new Error('method can just be called for handlers with "send" direction');
+                        }
+                    }
+                    _assertRecvDirection() {
+                        if (this._direction !== 'recv') {
+                            throw new Error('method can just be called for handlers with "recv" direction');
+                        }
+                    }
+                }
+                exports.Chrome55 = Chrome55;
+            },
+            {
+                '../Logger': 13,
+                '../errors': 18,
+                '../ortc': 36,
+                '../utils': 39,
+                './HandlerInterface': 25,
+                './sdp/RemoteSdp': 31,
+                './sdp/commonUtils': 32,
+                './sdp/planBUtils': 33,
+                'sdp-transform': 44,
+            },
+        ],
+        20: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.Chrome67 = void 0;
+                const sdpTransform = __importStar(require('sdp-transform'));
+                const Logger_1 = require('../Logger');
+                const utils = __importStar(require('../utils'));
+                const ortc = __importStar(require('../ortc'));
+                const sdpCommonUtils = __importStar(require('./sdp/commonUtils'));
+                const sdpPlanBUtils = __importStar(require('./sdp/planBUtils'));
+                const HandlerInterface_1 = require('./HandlerInterface');
+                const RemoteSdp_1 = require('./sdp/RemoteSdp');
+                const logger = new Logger_1.Logger('Chrome67');
+                const SCTP_NUM_STREAMS = { OS: 1024, MIS: 1024 };
+                class Chrome67 extends HandlerInterface_1.HandlerInterface {
+                    constructor() {
+                        super();
+                        // Local stream for sending.
+                        this._sendStream = new MediaStream();
+                        // Map of RTCRtpSender indexed by localId.
+                        this._mapSendLocalIdRtpSender = new Map();
+                        // Next sending localId.
+                        this._nextSendLocalId = 0;
+                        // Map of MID, RTP parameters and RTCRtpReceiver indexed by local id.
+                        // Value is an Object with mid, rtpParameters and rtpReceiver.
+                        this._mapRecvLocalIdInfo = new Map();
+                        // Whether a DataChannel m=application section has been created.
+                        this._hasDataChannelMediaSection = false;
+                        // Sending DataChannel id value counter. Incremented for each new DataChannel.
+                        this._nextSendSctpStreamId = 0;
+                        // Got transport local and remote parameters.
+                        this._transportReady = false;
+                    }
+                    /**
+                     * Creates a factory function.
+                     */
+                    static createFactory() {
+                        return () => new Chrome67();
+                    }
+                    get name() {
+                        return 'Chrome67';
+                    }
+                    close() {
+                        logger.debug('close()');
+                        // Close RTCPeerConnection.
+                        if (this._pc) {
+                            try {
+                                this._pc.close();
+                            } catch (error) {}
+                        }
+                    }
+                    async getNativeRtpCapabilities() {
+                        logger.debug('getNativeRtpCapabilities()');
+                        const pc = new RTCPeerConnection({
+                            iceServers: [],
+                            iceTransportPolicy: 'all',
+                            bundlePolicy: 'max-bundle',
+                            rtcpMuxPolicy: 'require',
+                            sdpSemantics: 'plan-b',
+                        });
+                        try {
+                            const offer = await pc.createOffer({
+                                offerToReceiveAudio: true,
+                                offerToReceiveVideo: true,
+                            });
+                            try {
+                                pc.close();
+                            } catch (error) {}
+                            const sdpObject = sdpTransform.parse(offer.sdp);
+                            const nativeRtpCapabilities = sdpCommonUtils.extractRtpCapabilities({ sdpObject });
+                            return nativeRtpCapabilities;
+                        } catch (error) {
+                            try {
+                                pc.close();
+                            } catch (error2) {}
+                            throw error;
+                        }
+                    }
+                    async getNativeSctpCapabilities() {
+                        logger.debug('getNativeSctpCapabilities()');
+                        return {
+                            numStreams: SCTP_NUM_STREAMS,
+                        };
+                    }
+                    run({
+                        direction,
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        iceServers,
+                        iceTransportPolicy,
+                        additionalSettings,
+                        proprietaryConstraints,
+                        extendedRtpCapabilities,
+                    }) {
+                        logger.debug('run()');
+                        this._direction = direction;
+                        this._remoteSdp = new RemoteSdp_1.RemoteSdp({
+                            iceParameters,
+                            iceCandidates,
+                            dtlsParameters,
+                            sctpParameters,
+                            planB: true,
+                        });
+                        this._sendingRtpParametersByKind = {
+                            audio: ortc.getSendingRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._sendingRemoteRtpParametersByKind = {
+                            audio: ortc.getSendingRemoteRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRemoteRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._pc = new RTCPeerConnection(
+                            Object.assign(
+                                {
+                                    iceServers: iceServers || [],
+                                    iceTransportPolicy: iceTransportPolicy || 'all',
+                                    bundlePolicy: 'max-bundle',
+                                    rtcpMuxPolicy: 'require',
+                                    sdpSemantics: 'plan-b',
+                                },
+                                additionalSettings,
+                            ),
+                            proprietaryConstraints,
+                        );
+                        // Handle RTCPeerConnection connection status.
+                        this._pc.addEventListener('iceconnectionstatechange', () => {
+                            switch (this._pc.iceConnectionState) {
+                                case 'checking':
+                                    this.emit('@connectionstatechange', 'connecting');
+                                    break;
+                                case 'connected':
+                                case 'completed':
+                                    this.emit('@connectionstatechange', 'connected');
+                                    break;
+                                case 'failed':
+                                    this.emit('@connectionstatechange', 'failed');
+                                    break;
+                                case 'disconnected':
+                                    this.emit('@connectionstatechange', 'disconnected');
+                                    break;
+                                case 'closed':
+                                    this.emit('@connectionstatechange', 'closed');
+                                    break;
+                            }
+                        });
+                    }
+                    async updateIceServers(iceServers) {
+                        logger.debug('updateIceServers()');
+                        const configuration = this._pc.getConfiguration();
+                        configuration.iceServers = iceServers;
+                        this._pc.setConfiguration(configuration);
+                    }
+                    async restartIce(iceParameters) {
+                        logger.debug('restartIce()');
+                        // Provide the remote SDP handler with new remote ICE parameters.
+                        this._remoteSdp.updateIceParameters(iceParameters);
+                        if (!this._transportReady) return;
+                        if (this._direction === 'send') {
+                            const offer = await this._pc.createOffer({ iceRestart: true });
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                        } else {
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [answer:%o]', answer);
+                            await this._pc.setLocalDescription(answer);
+                        }
+                    }
+                    async getTransportStats() {
+                        return this._pc.getStats();
+                    }
+                    async send({ track, encodings, codecOptions, codec }) {
+                        this._assertSendDirection();
+                        logger.debug('send() [kind:%s, track.id:%s]', track.kind, track.id);
+                        if (codec) {
+                            logger.warn('send() | codec selection is not available in %s handler', this.name);
+                        }
+                        this._sendStream.addTrack(track);
+                        this._pc.addTrack(track, this._sendStream);
+                        let offer = await this._pc.createOffer();
+                        let localSdpObject = sdpTransform.parse(offer.sdp);
+                        let offerMediaObject;
+                        const sendingRtpParameters = utils.clone(this._sendingRtpParametersByKind[track.kind], {});
+                        sendingRtpParameters.codecs = ortc.reduceCodecs(sendingRtpParameters.codecs);
+                        const sendingRemoteRtpParameters = utils.clone(
+                            this._sendingRemoteRtpParametersByKind[track.kind],
+                            {},
+                        );
+                        sendingRemoteRtpParameters.codecs = ortc.reduceCodecs(sendingRemoteRtpParameters.codecs);
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                        if (track.kind === 'video' && encodings && encodings.length > 1) {
+                            logger.debug('send() | enabling simulcast');
+                            localSdpObject = sdpTransform.parse(offer.sdp);
+                            offerMediaObject = localSdpObject.media.find((m) => m.type === 'video');
+                            sdpPlanBUtils.addLegacySimulcast({
+                                offerMediaObject,
+                                track,
+                                numStreams: encodings.length,
+                            });
+                            offer = { type: 'offer', sdp: sdpTransform.write(localSdpObject) };
+                        }
+                        logger.debug('send() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        await this._pc.setLocalDescription(offer);
+                        localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        offerMediaObject = localSdpObject.media.find((m) => m.type === track.kind);
+                        // Set RTCP CNAME.
+                        sendingRtpParameters.rtcp.cname = sdpCommonUtils.getCname({ offerMediaObject });
+                        // Set RTP encodings.
+                        sendingRtpParameters.encodings = sdpPlanBUtils.getRtpEncodings({ offerMediaObject, track });
+                        // Complete encodings with given values.
+                        if (encodings) {
+                            for (let idx = 0; idx < sendingRtpParameters.encodings.length; ++idx) {
+                                if (encodings[idx]) Object.assign(sendingRtpParameters.encodings[idx], encodings[idx]);
+                            }
+                        }
+                        // If VP8 and there is effective simulcast, add scalabilityMode to each
+                        // encoding.
+                        if (
+                            sendingRtpParameters.encodings.length > 1 &&
+                            sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/vp8'
+                        ) {
+                            for (const encoding of sendingRtpParameters.encodings) {
+                                encoding.scalabilityMode = 'S1T3';
+                            }
+                        }
+                        this._remoteSdp.send({
+                            offerMediaObject,
+                            offerRtpParameters: sendingRtpParameters,
+                            answerRtpParameters: sendingRemoteRtpParameters,
+                            codecOptions,
+                        });
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('send() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                        const localId = String(this._nextSendLocalId);
+                        this._nextSendLocalId++;
+                        const rtpSender = this._pc.getSenders().find((s) => s.track === track);
+                        // Insert into the map.
+                        this._mapSendLocalIdRtpSender.set(localId, rtpSender);
+                        return {
+                            localId: localId,
+                            rtpParameters: sendingRtpParameters,
+                            rtpSender,
+                        };
+                    }
+                    async stopSending(localId) {
+                        this._assertSendDirection();
+                        logger.debug('stopSending() [localId:%s]', localId);
+                        const rtpSender = this._mapSendLocalIdRtpSender.get(localId);
+                        if (!rtpSender) throw new Error('associated RTCRtpSender not found');
+                        this._pc.removeTrack(rtpSender);
+                        if (rtpSender.track) this._sendStream.removeTrack(rtpSender.track);
+                        this._mapSendLocalIdRtpSender.delete(localId);
+                        const offer = await this._pc.createOffer();
+                        logger.debug('stopSending() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        try {
+                            await this._pc.setLocalDescription(offer);
+                        } catch (error) {
+                            // NOTE: If there are no sending tracks, setLocalDescription() will fail with
+                            // "Failed to create channels". If so, ignore it.
+                            if (this._sendStream.getTracks().length === 0) {
+                                logger.warn(
+                                    'stopSending() | ignoring expected error due no sending tracks: %s',
+                                    error.toString(),
+                                );
+                                return;
+                            }
+                            throw error;
+                        }
+                        if (this._pc.signalingState === 'stable') return;
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopSending() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                    }
+                    async replaceTrack(localId, track) {
+                        this._assertSendDirection();
+                        if (track) {
+                            logger.debug('replaceTrack() [localId:%s, track.id:%s]', localId, track.id);
+                        } else {
+                            logger.debug('replaceTrack() [localId:%s, no track]', localId);
+                        }
+                        const rtpSender = this._mapSendLocalIdRtpSender.get(localId);
+                        if (!rtpSender) throw new Error('associated RTCRtpSender not found');
+                        const oldTrack = rtpSender.track;
+                        await rtpSender.replaceTrack(track);
+                        // Remove the old track from the local stream.
+                        if (oldTrack) this._sendStream.removeTrack(oldTrack);
+                        // Add the new track to the local stream.
+                        if (track) this._sendStream.addTrack(track);
+                    }
+                    async setMaxSpatialLayer(localId, spatialLayer) {
+                        this._assertSendDirection();
+                        logger.debug('setMaxSpatialLayer() [localId:%s, spatialLayer:%s]', localId, spatialLayer);
+                        const rtpSender = this._mapSendLocalIdRtpSender.get(localId);
+                        if (!rtpSender) throw new Error('associated RTCRtpSender not found');
+                        const parameters = rtpSender.getParameters();
+                        parameters.encodings.forEach((encoding, idx) => {
+                            if (idx <= spatialLayer) encoding.active = true;
+                            else encoding.active = false;
+                        });
+                        await rtpSender.setParameters(parameters);
+                    }
+                    async setRtpEncodingParameters(localId, params) {
+                        this._assertSendDirection();
+                        logger.debug('setRtpEncodingParameters() [localId:%s, params:%o]', localId, params);
+                        const rtpSender = this._mapSendLocalIdRtpSender.get(localId);
+                        if (!rtpSender) throw new Error('associated RTCRtpSender not found');
+                        const parameters = rtpSender.getParameters();
+                        parameters.encodings.forEach((encoding, idx) => {
+                            parameters.encodings[idx] = Object.assign(Object.assign({}, encoding), params);
+                        });
+                        await rtpSender.setParameters(parameters);
+                    }
+                    async getSenderStats(localId) {
+                        this._assertSendDirection();
+                        const rtpSender = this._mapSendLocalIdRtpSender.get(localId);
+                        if (!rtpSender) throw new Error('associated RTCRtpSender not found');
+                        return rtpSender.getStats();
+                    }
+                    async sendDataChannel({ ordered, maxPacketLifeTime, maxRetransmits, label, protocol }) {
+                        this._assertSendDirection();
+                        const options = {
+                            negotiated: true,
+                            id: this._nextSendSctpStreamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmitTime: maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('sendDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // Increase next id.
+                        this._nextSendSctpStreamId = ++this._nextSendSctpStreamId % SCTP_NUM_STREAMS.MIS;
+                        // If this is the first DataChannel we need to create the SDP answer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            const offer = await this._pc.createOffer();
+                            const localSdpObject = sdpTransform.parse(offer.sdp);
+                            const offerMediaObject = localSdpObject.media.find((m) => m.type === 'application');
+                            if (!this._transportReady)
+                                await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                            logger.debug('sendDataChannel() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            this._remoteSdp.sendSctpAssociation({ offerMediaObject });
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('sendDataChannel() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        const sctpStreamParameters = {
+                            streamId: options.id,
+                            ordered: options.ordered,
+                            maxPacketLifeTime: options.maxPacketLifeTime,
+                            maxRetransmits: options.maxRetransmits,
+                        };
+                        return { dataChannel, sctpStreamParameters };
+                    }
+                    async receive({ trackId, kind, rtpParameters }) {
+                        this._assertRecvDirection();
+                        logger.debug('receive() [trackId:%s, kind:%s]', trackId, kind);
+                        const localId = trackId;
+                        const mid = kind;
+                        this._remoteSdp.receive({
+                            mid,
+                            kind,
+                            offerRtpParameters: rtpParameters,
+                            streamId: rtpParameters.rtcp.cname,
+                            trackId,
+                        });
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('receive() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        let answer = await this._pc.createAnswer();
+                        const localSdpObject = sdpTransform.parse(answer.sdp);
+                        const answerMediaObject = localSdpObject.media.find((m) => String(m.mid) === mid);
+                        // May need to modify codec parameters in the answer based on codec
+                        // parameters in the offer.
+                        sdpCommonUtils.applyCodecParameters({
+                            offerRtpParameters: rtpParameters,
+                            answerMediaObject,
+                        });
+                        answer = { type: 'answer', sdp: sdpTransform.write(localSdpObject) };
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                        logger.debug('receive() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                        const rtpReceiver = this._pc.getReceivers().find((r) => r.track && r.track.id === localId);
+                        if (!rtpReceiver) throw new Error('new RTCRtpReceiver not');
+                        // Insert into the map.
+                        this._mapRecvLocalIdInfo.set(localId, { mid, rtpParameters, rtpReceiver });
+                        return {
+                            localId,
+                            track: rtpReceiver.track,
+                            rtpReceiver,
+                        };
+                    }
+                    async stopReceiving(localId) {
+                        this._assertRecvDirection();
+                        logger.debug('stopReceiving() [localId:%s]', localId);
+                        const { mid, rtpParameters } = this._mapRecvLocalIdInfo.get(localId) || {};
+                        // Remove from the map.
+                        this._mapRecvLocalIdInfo.delete(localId);
+                        this._remoteSdp.planBStopReceiving({ mid: mid, offerRtpParameters: rtpParameters });
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopReceiving() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        const answer = await this._pc.createAnswer();
+                        logger.debug('stopReceiving() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                    }
+                    async getReceiverStats(localId) {
+                        this._assertRecvDirection();
+                        const { rtpReceiver } = this._mapRecvLocalIdInfo.get(localId) || {};
+                        if (!rtpReceiver) throw new Error('associated RTCRtpReceiver not found');
+                        return rtpReceiver.getStats();
+                    }
+                    async receiveDataChannel({ sctpStreamParameters, label, protocol }) {
+                        this._assertRecvDirection();
+                        const { streamId, ordered, maxPacketLifeTime, maxRetransmits } = sctpStreamParameters;
+                        const options = {
+                            negotiated: true,
+                            id: streamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmitTime: maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('receiveDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // If this is the first DataChannel we need to create the SDP offer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            this._remoteSdp.receiveSctpAssociation({ oldDataChannelSpec: true });
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('receiveDataChannel() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            if (!this._transportReady) {
+                                const localSdpObject = sdpTransform.parse(answer.sdp);
+                                await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                            }
+                            logger.debug(
+                                'receiveDataChannel() | calling pc.setRemoteDescription() [answer:%o]',
+                                answer,
+                            );
+                            await this._pc.setLocalDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        return { dataChannel };
+                    }
+                    async _setupTransport({ localDtlsRole, localSdpObject }) {
+                        if (!localSdpObject) localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        // Get our local DTLS parameters.
+                        const dtlsParameters = sdpCommonUtils.extractDtlsParameters({ sdpObject: localSdpObject });
+                        // Set our DTLS role.
+                        dtlsParameters.role = localDtlsRole;
+                        // Update the remote DTLS role in the SDP.
+                        this._remoteSdp.updateDtlsRole(localDtlsRole === 'client' ? 'server' : 'client');
+                        // Need to tell the remote transport about our parameters.
+                        await this.safeEmitAsPromise('@connect', { dtlsParameters });
+                        this._transportReady = true;
+                    }
+                    _assertSendDirection() {
+                        if (this._direction !== 'send') {
+                            throw new Error('method can just be called for handlers with "send" direction');
+                        }
+                    }
+                    _assertRecvDirection() {
+                        if (this._direction !== 'recv') {
+                            throw new Error('method can just be called for handlers with "recv" direction');
+                        }
+                    }
+                }
+                exports.Chrome67 = Chrome67;
+            },
+            {
+                '../Logger': 13,
+                '../ortc': 36,
+                '../utils': 39,
+                './HandlerInterface': 25,
+                './sdp/RemoteSdp': 31,
+                './sdp/commonUtils': 32,
+                './sdp/planBUtils': 33,
+                'sdp-transform': 44,
+            },
+        ],
+        21: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.Chrome70 = void 0;
+                const sdpTransform = __importStar(require('sdp-transform'));
+                const Logger_1 = require('../Logger');
+                const utils = __importStar(require('../utils'));
+                const ortc = __importStar(require('../ortc'));
+                const sdpCommonUtils = __importStar(require('./sdp/commonUtils'));
+                const sdpUnifiedPlanUtils = __importStar(require('./sdp/unifiedPlanUtils'));
+                const HandlerInterface_1 = require('./HandlerInterface');
+                const RemoteSdp_1 = require('./sdp/RemoteSdp');
+                const scalabilityModes_1 = require('../scalabilityModes');
+                const logger = new Logger_1.Logger('Chrome70');
+                const SCTP_NUM_STREAMS = { OS: 1024, MIS: 1024 };
+                class Chrome70 extends HandlerInterface_1.HandlerInterface {
+                    constructor() {
+                        super();
+                        // Map of RTCTransceivers indexed by MID.
+                        this._mapMidTransceiver = new Map();
+                        // Local stream for sending.
+                        this._sendStream = new MediaStream();
+                        // Whether a DataChannel m=application section has been created.
+                        this._hasDataChannelMediaSection = false;
+                        // Sending DataChannel id value counter. Incremented for each new DataChannel.
+                        this._nextSendSctpStreamId = 0;
+                        // Got transport local and remote parameters.
+                        this._transportReady = false;
+                    }
+                    /**
+                     * Creates a factory function.
+                     */
+                    static createFactory() {
+                        return () => new Chrome70();
+                    }
+                    get name() {
+                        return 'Chrome70';
+                    }
+                    close() {
+                        logger.debug('close()');
+                        // Close RTCPeerConnection.
+                        if (this._pc) {
+                            try {
+                                this._pc.close();
+                            } catch (error) {}
+                        }
+                    }
+                    async getNativeRtpCapabilities() {
+                        logger.debug('getNativeRtpCapabilities()');
+                        const pc = new RTCPeerConnection({
+                            iceServers: [],
+                            iceTransportPolicy: 'all',
+                            bundlePolicy: 'max-bundle',
+                            rtcpMuxPolicy: 'require',
+                            sdpSemantics: 'unified-plan',
+                        });
+                        try {
+                            pc.addTransceiver('audio');
+                            pc.addTransceiver('video');
+                            const offer = await pc.createOffer();
+                            try {
+                                pc.close();
+                            } catch (error) {}
+                            const sdpObject = sdpTransform.parse(offer.sdp);
+                            const nativeRtpCapabilities = sdpCommonUtils.extractRtpCapabilities({ sdpObject });
+                            return nativeRtpCapabilities;
+                        } catch (error) {
+                            try {
+                                pc.close();
+                            } catch (error2) {}
+                            throw error;
+                        }
+                    }
+                    async getNativeSctpCapabilities() {
+                        logger.debug('getNativeSctpCapabilities()');
+                        return {
+                            numStreams: SCTP_NUM_STREAMS,
+                        };
+                    }
+                    run({
+                        direction,
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        iceServers,
+                        iceTransportPolicy,
+                        additionalSettings,
+                        proprietaryConstraints,
+                        extendedRtpCapabilities,
+                    }) {
+                        logger.debug('run()');
+                        this._direction = direction;
+                        this._remoteSdp = new RemoteSdp_1.RemoteSdp({
+                            iceParameters,
+                            iceCandidates,
+                            dtlsParameters,
+                            sctpParameters,
+                        });
+                        this._sendingRtpParametersByKind = {
+                            audio: ortc.getSendingRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._sendingRemoteRtpParametersByKind = {
+                            audio: ortc.getSendingRemoteRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRemoteRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._pc = new RTCPeerConnection(
+                            Object.assign(
+                                {
+                                    iceServers: iceServers || [],
+                                    iceTransportPolicy: iceTransportPolicy || 'all',
+                                    bundlePolicy: 'max-bundle',
+                                    rtcpMuxPolicy: 'require',
+                                    sdpSemantics: 'unified-plan',
+                                },
+                                additionalSettings,
+                            ),
+                            proprietaryConstraints,
+                        );
+                        // Handle RTCPeerConnection connection status.
+                        this._pc.addEventListener('iceconnectionstatechange', () => {
+                            switch (this._pc.iceConnectionState) {
+                                case 'checking':
+                                    this.emit('@connectionstatechange', 'connecting');
+                                    break;
+                                case 'connected':
+                                case 'completed':
+                                    this.emit('@connectionstatechange', 'connected');
+                                    break;
+                                case 'failed':
+                                    this.emit('@connectionstatechange', 'failed');
+                                    break;
+                                case 'disconnected':
+                                    this.emit('@connectionstatechange', 'disconnected');
+                                    break;
+                                case 'closed':
+                                    this.emit('@connectionstatechange', 'closed');
+                                    break;
+                            }
+                        });
+                    }
+                    async updateIceServers(iceServers) {
+                        logger.debug('updateIceServers()');
+                        const configuration = this._pc.getConfiguration();
+                        configuration.iceServers = iceServers;
+                        this._pc.setConfiguration(configuration);
+                    }
+                    async restartIce(iceParameters) {
+                        logger.debug('restartIce()');
+                        // Provide the remote SDP handler with new remote ICE parameters.
+                        this._remoteSdp.updateIceParameters(iceParameters);
+                        if (!this._transportReady) return;
+                        if (this._direction === 'send') {
+                            const offer = await this._pc.createOffer({ iceRestart: true });
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                        } else {
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [answer:%o]', answer);
+                            await this._pc.setLocalDescription(answer);
+                        }
+                    }
+                    async getTransportStats() {
+                        return this._pc.getStats();
+                    }
+                    async send({ track, encodings, codecOptions, codec }) {
+                        this._assertSendDirection();
+                        logger.debug('send() [kind:%s, track.id:%s]', track.kind, track.id);
+                        const sendingRtpParameters = utils.clone(this._sendingRtpParametersByKind[track.kind], {});
+                        // This may throw.
+                        sendingRtpParameters.codecs = ortc.reduceCodecs(sendingRtpParameters.codecs, codec);
+                        const sendingRemoteRtpParameters = utils.clone(
+                            this._sendingRemoteRtpParametersByKind[track.kind],
+                            {},
+                        );
+                        // This may throw.
+                        sendingRemoteRtpParameters.codecs = ortc.reduceCodecs(sendingRemoteRtpParameters.codecs, codec);
+                        const mediaSectionIdx = this._remoteSdp.getNextMediaSectionIdx();
+                        const transceiver = this._pc.addTransceiver(track, {
+                            direction: 'sendonly',
+                            streams: [this._sendStream],
+                        });
+                        let offer = await this._pc.createOffer();
+                        let localSdpObject = sdpTransform.parse(offer.sdp);
+                        let offerMediaObject;
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                        if (encodings && encodings.length > 1) {
+                            logger.debug('send() | enabling legacy simulcast');
+                            localSdpObject = sdpTransform.parse(offer.sdp);
+                            offerMediaObject = localSdpObject.media[mediaSectionIdx.idx];
+                            sdpUnifiedPlanUtils.addLegacySimulcast({
+                                offerMediaObject,
+                                numStreams: encodings.length,
+                            });
+                            offer = { type: 'offer', sdp: sdpTransform.write(localSdpObject) };
+                        }
+                        // Special case for VP9 with SVC.
+                        let hackVp9Svc = false;
+                        const layers = scalabilityModes_1.parse((encodings || [{}])[0].scalabilityMode);
+                        if (
+                            encodings &&
+                            encodings.length === 1 &&
+                            layers.spatialLayers > 1 &&
+                            sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/vp9'
+                        ) {
+                            logger.debug('send() | enabling legacy simulcast for VP9 SVC');
+                            hackVp9Svc = true;
+                            localSdpObject = sdpTransform.parse(offer.sdp);
+                            offerMediaObject = localSdpObject.media[mediaSectionIdx.idx];
+                            sdpUnifiedPlanUtils.addLegacySimulcast({
+                                offerMediaObject,
+                                numStreams: layers.spatialLayers,
+                            });
+                            offer = { type: 'offer', sdp: sdpTransform.write(localSdpObject) };
+                        }
+                        logger.debug('send() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        await this._pc.setLocalDescription(offer);
+                        // If encodings are given, apply them now.
+                        if (encodings) {
+                            logger.debug('send() | applying given encodings');
+                            const parameters = transceiver.sender.getParameters();
+                            for (let idx = 0; idx < (parameters.encodings || []).length; ++idx) {
+                                const encoding = parameters.encodings[idx];
+                                const desiredEncoding = encodings[idx];
+                                // Should not happen but just in case.
+                                if (!desiredEncoding) break;
+                                parameters.encodings[idx] = Object.assign(encoding, desiredEncoding);
+                            }
+                            await transceiver.sender.setParameters(parameters);
+                        }
+                        // We can now get the transceiver.mid.
+                        const localId = transceiver.mid;
+                        // Set MID.
+                        sendingRtpParameters.mid = localId;
+                        localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        offerMediaObject = localSdpObject.media[mediaSectionIdx.idx];
+                        // Set RTCP CNAME.
+                        sendingRtpParameters.rtcp.cname = sdpCommonUtils.getCname({ offerMediaObject });
+                        // Set RTP encodings.
+                        sendingRtpParameters.encodings = sdpUnifiedPlanUtils.getRtpEncodings({ offerMediaObject });
+                        // Complete encodings with given values.
+                        if (encodings) {
+                            for (let idx = 0; idx < sendingRtpParameters.encodings.length; ++idx) {
+                                if (encodings[idx]) Object.assign(sendingRtpParameters.encodings[idx], encodings[idx]);
+                            }
+                        }
+                        // Hack for VP9 SVC.
+                        if (hackVp9Svc) {
+                            sendingRtpParameters.encodings = [sendingRtpParameters.encodings[0]];
+                        }
+                        // If VP8 or H264 and there is effective simulcast, add scalabilityMode to
+                        // each encoding.
+                        if (
+                            sendingRtpParameters.encodings.length > 1 &&
+                            (sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/vp8' ||
+                                sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/h264')
+                        ) {
+                            for (const encoding of sendingRtpParameters.encodings) {
+                                encoding.scalabilityMode = 'S1T3';
+                            }
+                        }
+                        this._remoteSdp.send({
+                            offerMediaObject,
+                            reuseMid: mediaSectionIdx.reuseMid,
+                            offerRtpParameters: sendingRtpParameters,
+                            answerRtpParameters: sendingRemoteRtpParameters,
+                            codecOptions,
+                        });
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('send() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                        // Store in the map.
+                        this._mapMidTransceiver.set(localId, transceiver);
+                        return {
+                            localId,
+                            rtpParameters: sendingRtpParameters,
+                            rtpSender: transceiver.sender,
+                        };
+                    }
+                    async stopSending(localId) {
+                        this._assertSendDirection();
+                        logger.debug('stopSending() [localId:%s]', localId);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        transceiver.sender.replaceTrack(null);
+                        this._pc.removeTrack(transceiver.sender);
+                        this._remoteSdp.closeMediaSection(transceiver.mid);
+                        const offer = await this._pc.createOffer();
+                        logger.debug('stopSending() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        await this._pc.setLocalDescription(offer);
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopSending() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                    }
+                    async replaceTrack(localId, track) {
+                        this._assertSendDirection();
+                        if (track) {
+                            logger.debug('replaceTrack() [localId:%s, track.id:%s]', localId, track.id);
+                        } else {
+                            logger.debug('replaceTrack() [localId:%s, no track]', localId);
+                        }
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        await transceiver.sender.replaceTrack(track);
+                    }
+                    async setMaxSpatialLayer(localId, spatialLayer) {
+                        this._assertSendDirection();
+                        logger.debug('setMaxSpatialLayer() [localId:%s, spatialLayer:%s]', localId, spatialLayer);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        const parameters = transceiver.sender.getParameters();
+                        parameters.encodings.forEach((encoding, idx) => {
+                            if (idx <= spatialLayer) encoding.active = true;
+                            else encoding.active = false;
+                        });
+                        await transceiver.sender.setParameters(parameters);
+                    }
+                    async setRtpEncodingParameters(localId, params) {
+                        this._assertSendDirection();
+                        logger.debug('setRtpEncodingParameters() [localId:%s, params:%o]', localId, params);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        const parameters = transceiver.sender.getParameters();
+                        parameters.encodings.forEach((encoding, idx) => {
+                            parameters.encodings[idx] = Object.assign(Object.assign({}, encoding), params);
+                        });
+                        await transceiver.sender.setParameters(parameters);
+                    }
+                    async getSenderStats(localId) {
+                        this._assertSendDirection();
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        return transceiver.sender.getStats();
+                    }
+                    async sendDataChannel({ ordered, maxPacketLifeTime, maxRetransmits, label, protocol }) {
+                        this._assertSendDirection();
+                        const options = {
+                            negotiated: true,
+                            id: this._nextSendSctpStreamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmitTime: maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('sendDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // Increase next id.
+                        this._nextSendSctpStreamId = ++this._nextSendSctpStreamId % SCTP_NUM_STREAMS.MIS;
+                        // If this is the first DataChannel we need to create the SDP answer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            const offer = await this._pc.createOffer();
+                            const localSdpObject = sdpTransform.parse(offer.sdp);
+                            const offerMediaObject = localSdpObject.media.find((m) => m.type === 'application');
+                            if (!this._transportReady)
+                                await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                            logger.debug('sendDataChannel() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            this._remoteSdp.sendSctpAssociation({ offerMediaObject });
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('sendDataChannel() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        const sctpStreamParameters = {
+                            streamId: options.id,
+                            ordered: options.ordered,
+                            maxPacketLifeTime: options.maxPacketLifeTime,
+                            maxRetransmits: options.maxRetransmits,
+                        };
+                        return { dataChannel, sctpStreamParameters };
+                    }
+                    async receive({ trackId, kind, rtpParameters }) {
+                        this._assertRecvDirection();
+                        logger.debug('receive() [trackId:%s, kind:%s]', trackId, kind);
+                        const localId = rtpParameters.mid || String(this._mapMidTransceiver.size);
+                        this._remoteSdp.receive({
+                            mid: localId,
+                            kind,
+                            offerRtpParameters: rtpParameters,
+                            streamId: rtpParameters.rtcp.cname,
+                            trackId,
+                        });
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('receive() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        let answer = await this._pc.createAnswer();
+                        const localSdpObject = sdpTransform.parse(answer.sdp);
+                        const answerMediaObject = localSdpObject.media.find((m) => String(m.mid) === localId);
+                        // May need to modify codec parameters in the answer based on codec
+                        // parameters in the offer.
+                        sdpCommonUtils.applyCodecParameters({
+                            offerRtpParameters: rtpParameters,
+                            answerMediaObject,
+                        });
+                        answer = { type: 'answer', sdp: sdpTransform.write(localSdpObject) };
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                        logger.debug('receive() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                        const transceiver = this._pc.getTransceivers().find((t) => t.mid === localId);
+                        if (!transceiver) throw new Error('new RTCRtpTransceiver not found');
+                        // Store in the map.
+                        this._mapMidTransceiver.set(localId, transceiver);
+                        return {
+                            localId,
+                            track: transceiver.receiver.track,
+                            rtpReceiver: transceiver.receiver,
+                        };
+                    }
+                    async stopReceiving(localId) {
+                        this._assertRecvDirection();
+                        logger.debug('stopReceiving() [localId:%s]', localId);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        this._remoteSdp.closeMediaSection(transceiver.mid);
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopReceiving() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        const answer = await this._pc.createAnswer();
+                        logger.debug('stopReceiving() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                    }
+                    async getReceiverStats(localId) {
+                        this._assertRecvDirection();
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        return transceiver.receiver.getStats();
+                    }
+                    async receiveDataChannel({ sctpStreamParameters, label, protocol }) {
+                        this._assertRecvDirection();
+                        const { streamId, ordered, maxPacketLifeTime, maxRetransmits } = sctpStreamParameters;
+                        const options = {
+                            negotiated: true,
+                            id: streamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmitTime: maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('receiveDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // If this is the first DataChannel we need to create the SDP offer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            this._remoteSdp.receiveSctpAssociation();
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('receiveDataChannel() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            if (!this._transportReady) {
+                                const localSdpObject = sdpTransform.parse(answer.sdp);
+                                await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                            }
+                            logger.debug(
+                                'receiveDataChannel() | calling pc.setRemoteDescription() [answer:%o]',
+                                answer,
+                            );
+                            await this._pc.setLocalDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        return { dataChannel };
+                    }
+                    async _setupTransport({ localDtlsRole, localSdpObject }) {
+                        if (!localSdpObject) localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        // Get our local DTLS parameters.
+                        const dtlsParameters = sdpCommonUtils.extractDtlsParameters({ sdpObject: localSdpObject });
+                        // Set our DTLS role.
+                        dtlsParameters.role = localDtlsRole;
+                        // Update the remote DTLS role in the SDP.
+                        this._remoteSdp.updateDtlsRole(localDtlsRole === 'client' ? 'server' : 'client');
+                        // Need to tell the remote transport about our parameters.
+                        await this.safeEmitAsPromise('@connect', { dtlsParameters });
+                        this._transportReady = true;
+                    }
+                    _assertSendDirection() {
+                        if (this._direction !== 'send') {
+                            throw new Error('method can just be called for handlers with "send" direction');
+                        }
+                    }
+                    _assertRecvDirection() {
+                        if (this._direction !== 'recv') {
+                            throw new Error('method can just be called for handlers with "recv" direction');
+                        }
+                    }
+                }
+                exports.Chrome70 = Chrome70;
+            },
+            {
+                '../Logger': 13,
+                '../ortc': 36,
+                '../scalabilityModes': 37,
+                '../utils': 39,
+                './HandlerInterface': 25,
+                './sdp/RemoteSdp': 31,
+                './sdp/commonUtils': 32,
+                './sdp/unifiedPlanUtils': 34,
+                'sdp-transform': 44,
+            },
+        ],
+        22: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.Chrome74 = void 0;
+                const sdpTransform = __importStar(require('sdp-transform'));
+                const Logger_1 = require('../Logger');
+                const utils = __importStar(require('../utils'));
+                const ortc = __importStar(require('../ortc'));
+                const sdpCommonUtils = __importStar(require('./sdp/commonUtils'));
+                const sdpUnifiedPlanUtils = __importStar(require('./sdp/unifiedPlanUtils'));
+                const HandlerInterface_1 = require('./HandlerInterface');
+                const RemoteSdp_1 = require('./sdp/RemoteSdp');
+                const scalabilityModes_1 = require('../scalabilityModes');
+                const logger = new Logger_1.Logger('Chrome74');
+                const SCTP_NUM_STREAMS = { OS: 1024, MIS: 1024 };
+                class Chrome74 extends HandlerInterface_1.HandlerInterface {
+                    constructor() {
+                        super();
+                        // Map of RTCTransceivers indexed by MID.
+                        this._mapMidTransceiver = new Map();
+                        // Local stream for sending.
+                        this._sendStream = new MediaStream();
+                        // Whether a DataChannel m=application section has been created.
+                        this._hasDataChannelMediaSection = false;
+                        // Sending DataChannel id value counter. Incremented for each new DataChannel.
+                        this._nextSendSctpStreamId = 0;
+                        // Got transport local and remote parameters.
+                        this._transportReady = false;
+                    }
+                    /**
+                     * Creates a factory function.
+                     */
+                    static createFactory() {
+                        return () => new Chrome74();
+                    }
+                    get name() {
+                        return 'Chrome74';
+                    }
+                    close() {
+                        logger.debug('close()');
+                        // Close RTCPeerConnection.
+                        if (this._pc) {
+                            try {
+                                this._pc.close();
+                            } catch (error) {}
+                        }
+                    }
+                    async getNativeRtpCapabilities() {
+                        logger.debug('getNativeRtpCapabilities()');
+                        const pc = new RTCPeerConnection({
+                            iceServers: [],
+                            iceTransportPolicy: 'all',
+                            bundlePolicy: 'max-bundle',
+                            rtcpMuxPolicy: 'require',
+                            sdpSemantics: 'unified-plan',
+                        });
+                        try {
+                            pc.addTransceiver('audio');
+                            pc.addTransceiver('video');
+                            const offer = await pc.createOffer();
+                            try {
+                                pc.close();
+                            } catch (error) {}
+                            const sdpObject = sdpTransform.parse(offer.sdp);
+                            const nativeRtpCapabilities = sdpCommonUtils.extractRtpCapabilities({ sdpObject });
+                            return nativeRtpCapabilities;
+                        } catch (error) {
+                            try {
+                                pc.close();
+                            } catch (error2) {}
+                            throw error;
+                        }
+                    }
+                    async getNativeSctpCapabilities() {
+                        logger.debug('getNativeSctpCapabilities()');
+                        return {
+                            numStreams: SCTP_NUM_STREAMS,
+                        };
+                    }
+                    run({
+                        direction,
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        iceServers,
+                        iceTransportPolicy,
+                        additionalSettings,
+                        proprietaryConstraints,
+                        extendedRtpCapabilities,
+                    }) {
+                        logger.debug('run()');
+                        this._direction = direction;
+                        this._remoteSdp = new RemoteSdp_1.RemoteSdp({
+                            iceParameters,
+                            iceCandidates,
+                            dtlsParameters,
+                            sctpParameters,
+                        });
+                        this._sendingRtpParametersByKind = {
+                            audio: ortc.getSendingRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._sendingRemoteRtpParametersByKind = {
+                            audio: ortc.getSendingRemoteRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRemoteRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._pc = new RTCPeerConnection(
+                            Object.assign(
+                                {
+                                    iceServers: iceServers || [],
+                                    iceTransportPolicy: iceTransportPolicy || 'all',
+                                    bundlePolicy: 'max-bundle',
+                                    rtcpMuxPolicy: 'require',
+                                    sdpSemantics: 'unified-plan',
+                                },
+                                additionalSettings,
+                            ),
+                            proprietaryConstraints,
+                        );
+                        // Handle RTCPeerConnection connection status.
+                        this._pc.addEventListener('iceconnectionstatechange', () => {
+                            switch (this._pc.iceConnectionState) {
+                                case 'checking':
+                                    this.emit('@connectionstatechange', 'connecting');
+                                    break;
+                                case 'connected':
+                                case 'completed':
+                                    this.emit('@connectionstatechange', 'connected');
+                                    break;
+                                case 'failed':
+                                    this.emit('@connectionstatechange', 'failed');
+                                    break;
+                                case 'disconnected':
+                                    this.emit('@connectionstatechange', 'disconnected');
+                                    break;
+                                case 'closed':
+                                    this.emit('@connectionstatechange', 'closed');
+                                    break;
+                            }
+                        });
+                    }
+                    async updateIceServers(iceServers) {
+                        logger.debug('updateIceServers()');
+                        const configuration = this._pc.getConfiguration();
+                        configuration.iceServers = iceServers;
+                        this._pc.setConfiguration(configuration);
+                    }
+                    async restartIce(iceParameters) {
+                        logger.debug('restartIce()');
+                        // Provide the remote SDP handler with new remote ICE parameters.
+                        this._remoteSdp.updateIceParameters(iceParameters);
+                        if (!this._transportReady) return;
+                        if (this._direction === 'send') {
+                            const offer = await this._pc.createOffer({ iceRestart: true });
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                        } else {
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [answer:%o]', answer);
+                            await this._pc.setLocalDescription(answer);
+                        }
+                    }
+                    async getTransportStats() {
+                        return this._pc.getStats();
+                    }
+                    async send({ track, encodings, codecOptions, codec }) {
+                        this._assertSendDirection();
+                        logger.debug('send() [kind:%s, track.id:%s]', track.kind, track.id);
+                        if (encodings && encodings.length > 1) {
+                            encodings.forEach((encoding, idx) => {
+                                encoding.rid = `r${idx}`;
+                            });
+                        }
+                        const sendingRtpParameters = utils.clone(this._sendingRtpParametersByKind[track.kind], {});
+                        // This may throw.
+                        sendingRtpParameters.codecs = ortc.reduceCodecs(sendingRtpParameters.codecs, codec);
+                        const sendingRemoteRtpParameters = utils.clone(
+                            this._sendingRemoteRtpParametersByKind[track.kind],
+                            {},
+                        );
+                        // This may throw.
+                        sendingRemoteRtpParameters.codecs = ortc.reduceCodecs(sendingRemoteRtpParameters.codecs, codec);
+                        const mediaSectionIdx = this._remoteSdp.getNextMediaSectionIdx();
+                        const transceiver = this._pc.addTransceiver(track, {
+                            direction: 'sendonly',
+                            streams: [this._sendStream],
+                            sendEncodings: encodings,
+                        });
+                        let offer = await this._pc.createOffer();
+                        let localSdpObject = sdpTransform.parse(offer.sdp);
+                        let offerMediaObject;
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                        // Special case for VP9 with SVC.
+                        let hackVp9Svc = false;
+                        const layers = scalabilityModes_1.parse((encodings || [{}])[0].scalabilityMode);
+                        if (
+                            encodings &&
+                            encodings.length === 1 &&
+                            layers.spatialLayers > 1 &&
+                            sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/vp9'
+                        ) {
+                            logger.debug('send() | enabling legacy simulcast for VP9 SVC');
+                            hackVp9Svc = true;
+                            localSdpObject = sdpTransform.parse(offer.sdp);
+                            offerMediaObject = localSdpObject.media[mediaSectionIdx.idx];
+                            sdpUnifiedPlanUtils.addLegacySimulcast({
+                                offerMediaObject,
+                                numStreams: layers.spatialLayers,
+                            });
+                            offer = { type: 'offer', sdp: sdpTransform.write(localSdpObject) };
+                        }
+                        logger.debug('send() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        await this._pc.setLocalDescription(offer);
+                        // We can now get the transceiver.mid.
+                        const localId = transceiver.mid;
+                        // Set MID.
+                        sendingRtpParameters.mid = localId;
+                        localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        offerMediaObject = localSdpObject.media[mediaSectionIdx.idx];
+                        // Set RTCP CNAME.
+                        sendingRtpParameters.rtcp.cname = sdpCommonUtils.getCname({ offerMediaObject });
+                        // Set RTP encodings by parsing the SDP offer if no encodings are given.
+                        if (!encodings) {
+                            sendingRtpParameters.encodings = sdpUnifiedPlanUtils.getRtpEncodings({ offerMediaObject });
+                        }
+                        // Set RTP encodings by parsing the SDP offer and complete them with given
+                        // one if just a single encoding has been given.
+                        else if (encodings.length === 1) {
+                            let newEncodings = sdpUnifiedPlanUtils.getRtpEncodings({ offerMediaObject });
+                            Object.assign(newEncodings[0], encodings[0]);
+                            // Hack for VP9 SVC.
+                            if (hackVp9Svc) newEncodings = [newEncodings[0]];
+                            sendingRtpParameters.encodings = newEncodings;
+                        }
+                        // Otherwise if more than 1 encoding are given use them verbatim.
+                        else {
+                            sendingRtpParameters.encodings = encodings;
+                        }
+                        // If VP8 or H264 and there is effective simulcast, add scalabilityMode to
+                        // each encoding.
+                        if (
+                            sendingRtpParameters.encodings.length > 1 &&
+                            (sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/vp8' ||
+                                sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/h264')
+                        ) {
+                            for (const encoding of sendingRtpParameters.encodings) {
+                                encoding.scalabilityMode = 'S1T3';
+                            }
+                        }
+                        this._remoteSdp.send({
+                            offerMediaObject,
+                            reuseMid: mediaSectionIdx.reuseMid,
+                            offerRtpParameters: sendingRtpParameters,
+                            answerRtpParameters: sendingRemoteRtpParameters,
+                            codecOptions,
+                            extmapAllowMixed: true,
+                        });
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('send() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                        // Store in the map.
+                        this._mapMidTransceiver.set(localId, transceiver);
+                        return {
+                            localId,
+                            rtpParameters: sendingRtpParameters,
+                            rtpSender: transceiver.sender,
+                        };
+                    }
+                    async stopSending(localId) {
+                        this._assertSendDirection();
+                        logger.debug('stopSending() [localId:%s]', localId);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        transceiver.sender.replaceTrack(null);
+                        this._pc.removeTrack(transceiver.sender);
+                        this._remoteSdp.closeMediaSection(transceiver.mid);
+                        const offer = await this._pc.createOffer();
+                        logger.debug('stopSending() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        await this._pc.setLocalDescription(offer);
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopSending() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                    }
+                    async replaceTrack(localId, track) {
+                        this._assertSendDirection();
+                        if (track) {
+                            logger.debug('replaceTrack() [localId:%s, track.id:%s]', localId, track.id);
+                        } else {
+                            logger.debug('replaceTrack() [localId:%s, no track]', localId);
+                        }
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        await transceiver.sender.replaceTrack(track);
+                    }
+                    async setMaxSpatialLayer(localId, spatialLayer) {
+                        this._assertSendDirection();
+                        logger.debug('setMaxSpatialLayer() [localId:%s, spatialLayer:%s]', localId, spatialLayer);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        const parameters = transceiver.sender.getParameters();
+                        parameters.encodings.forEach((encoding, idx) => {
+                            if (idx <= spatialLayer) encoding.active = true;
+                            else encoding.active = false;
+                        });
+                        await transceiver.sender.setParameters(parameters);
+                    }
+                    async setRtpEncodingParameters(localId, params) {
+                        this._assertSendDirection();
+                        logger.debug('setRtpEncodingParameters() [localId:%s, params:%o]', localId, params);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        const parameters = transceiver.sender.getParameters();
+                        parameters.encodings.forEach((encoding, idx) => {
+                            parameters.encodings[idx] = Object.assign(Object.assign({}, encoding), params);
+                        });
+                        await transceiver.sender.setParameters(parameters);
+                    }
+                    async getSenderStats(localId) {
+                        this._assertSendDirection();
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        return transceiver.sender.getStats();
+                    }
+                    async sendDataChannel({ ordered, maxPacketLifeTime, maxRetransmits, label, protocol }) {
+                        this._assertSendDirection();
+                        const options = {
+                            negotiated: true,
+                            id: this._nextSendSctpStreamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('sendDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // Increase next id.
+                        this._nextSendSctpStreamId = ++this._nextSendSctpStreamId % SCTP_NUM_STREAMS.MIS;
+                        // If this is the first DataChannel we need to create the SDP answer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            const offer = await this._pc.createOffer();
+                            const localSdpObject = sdpTransform.parse(offer.sdp);
+                            const offerMediaObject = localSdpObject.media.find((m) => m.type === 'application');
+                            if (!this._transportReady)
+                                await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                            logger.debug('sendDataChannel() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            this._remoteSdp.sendSctpAssociation({ offerMediaObject });
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('sendDataChannel() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        const sctpStreamParameters = {
+                            streamId: options.id,
+                            ordered: options.ordered,
+                            maxPacketLifeTime: options.maxPacketLifeTime,
+                            maxRetransmits: options.maxRetransmits,
+                        };
+                        return { dataChannel, sctpStreamParameters };
+                    }
+                    async receive({ trackId, kind, rtpParameters }) {
+                        this._assertRecvDirection();
+                        logger.debug('receive() [trackId:%s, kind:%s]', trackId, kind);
+                        const localId = rtpParameters.mid || String(this._mapMidTransceiver.size);
+                        this._remoteSdp.receive({
+                            mid: localId,
+                            kind,
+                            offerRtpParameters: rtpParameters,
+                            streamId: rtpParameters.rtcp.cname,
+                            trackId,
+                        });
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('receive() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        let answer = await this._pc.createAnswer();
+                        const localSdpObject = sdpTransform.parse(answer.sdp);
+                        const answerMediaObject = localSdpObject.media.find((m) => String(m.mid) === localId);
+                        // May need to modify codec parameters in the answer based on codec
+                        // parameters in the offer.
+                        sdpCommonUtils.applyCodecParameters({
+                            offerRtpParameters: rtpParameters,
+                            answerMediaObject,
+                        });
+                        answer = { type: 'answer', sdp: sdpTransform.write(localSdpObject) };
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                        logger.debug('receive() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                        const transceiver = this._pc.getTransceivers().find((t) => t.mid === localId);
+                        if (!transceiver) throw new Error('new RTCRtpTransceiver not found');
+                        // Store in the map.
+                        this._mapMidTransceiver.set(localId, transceiver);
+                        return {
+                            localId,
+                            track: transceiver.receiver.track,
+                            rtpReceiver: transceiver.receiver,
+                        };
+                    }
+                    async stopReceiving(localId) {
+                        this._assertRecvDirection();
+                        logger.debug('stopReceiving() [localId:%s]', localId);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        this._remoteSdp.closeMediaSection(transceiver.mid);
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopReceiving() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        const answer = await this._pc.createAnswer();
+                        logger.debug('stopReceiving() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                    }
+                    async getReceiverStats(localId) {
+                        this._assertRecvDirection();
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        return transceiver.receiver.getStats();
+                    }
+                    async receiveDataChannel({ sctpStreamParameters, label, protocol }) {
+                        this._assertRecvDirection();
+                        const { streamId, ordered, maxPacketLifeTime, maxRetransmits } = sctpStreamParameters;
+                        const options = {
+                            negotiated: true,
+                            id: streamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('receiveDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // If this is the first DataChannel we need to create the SDP offer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            this._remoteSdp.receiveSctpAssociation();
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('receiveDataChannel() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            if (!this._transportReady) {
+                                const localSdpObject = sdpTransform.parse(answer.sdp);
+                                await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                            }
+                            logger.debug(
+                                'receiveDataChannel() | calling pc.setRemoteDescription() [answer:%o]',
+                                answer,
+                            );
+                            await this._pc.setLocalDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        return { dataChannel };
+                    }
+                    async _setupTransport({ localDtlsRole, localSdpObject }) {
+                        if (!localSdpObject) localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        // Get our local DTLS parameters.
+                        const dtlsParameters = sdpCommonUtils.extractDtlsParameters({ sdpObject: localSdpObject });
+                        // Set our DTLS role.
+                        dtlsParameters.role = localDtlsRole;
+                        // Update the remote DTLS role in the SDP.
+                        this._remoteSdp.updateDtlsRole(localDtlsRole === 'client' ? 'server' : 'client');
+                        // Need to tell the remote transport about our parameters.
+                        await this.safeEmitAsPromise('@connect', { dtlsParameters });
+                        this._transportReady = true;
+                    }
+                    _assertSendDirection() {
+                        if (this._direction !== 'send') {
+                            throw new Error('method can just be called for handlers with "send" direction');
+                        }
+                    }
+                    _assertRecvDirection() {
+                        if (this._direction !== 'recv') {
+                            throw new Error('method can just be called for handlers with "recv" direction');
+                        }
+                    }
+                }
+                exports.Chrome74 = Chrome74;
+            },
+            {
+                '../Logger': 13,
+                '../ortc': 36,
+                '../scalabilityModes': 37,
+                '../utils': 39,
+                './HandlerInterface': 25,
+                './sdp/RemoteSdp': 31,
+                './sdp/commonUtils': 32,
+                './sdp/unifiedPlanUtils': 34,
+                'sdp-transform': 44,
+            },
+        ],
+        23: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.Edge11 = void 0;
+                const Logger_1 = require('../Logger');
+                const errors_1 = require('../errors');
+                const utils = __importStar(require('../utils'));
+                const ortc = __importStar(require('../ortc'));
+                const edgeUtils = __importStar(require('./ortc/edgeUtils'));
+                const HandlerInterface_1 = require('./HandlerInterface');
+                const logger = new Logger_1.Logger('Edge11');
+                class Edge11 extends HandlerInterface_1.HandlerInterface {
+                    constructor() {
+                        super();
+                        // Map of RTCRtpSenders indexed by id.
+                        this._rtpSenders = new Map();
+                        // Map of RTCRtpReceivers indexed by id.
+                        this._rtpReceivers = new Map();
+                        // Next localId for sending tracks.
+                        this._nextSendLocalId = 0;
+                        // Got transport local and remote parameters.
+                        this._transportReady = false;
+                    }
+                    /**
+                     * Creates a factory function.
+                     */
+                    static createFactory() {
+                        return () => new Edge11();
+                    }
+                    get name() {
+                        return 'Edge11';
+                    }
+                    close() {
+                        logger.debug('close()');
+                        // Close the ICE gatherer.
+                        // NOTE: Not yet implemented by Edge.
+                        try {
+                            this._iceGatherer.close();
+                        } catch (error) {}
+                        // Close the ICE transport.
+                        try {
+                            this._iceTransport.stop();
+                        } catch (error) {}
+                        // Close the DTLS transport.
+                        try {
+                            this._dtlsTransport.stop();
+                        } catch (error) {}
+                        // Close RTCRtpSenders.
+                        for (const rtpSender of this._rtpSenders.values()) {
+                            try {
+                                rtpSender.stop();
+                            } catch (error) {}
+                        }
+                        // Close RTCRtpReceivers.
+                        for (const rtpReceiver of this._rtpReceivers.values()) {
+                            try {
+                                rtpReceiver.stop();
+                            } catch (error) {}
+                        }
+                    }
+                    async getNativeRtpCapabilities() {
+                        logger.debug('getNativeRtpCapabilities()');
+                        return edgeUtils.getCapabilities();
+                    }
+                    async getNativeSctpCapabilities() {
+                        logger.debug('getNativeSctpCapabilities()');
+                        return {
+                            numStreams: { OS: 0, MIS: 0 },
+                        };
+                    }
+                    run({
+                        direction, // eslint-disable-line @typescript-eslint/no-unused-vars
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters, // eslint-disable-line @typescript-eslint/no-unused-vars
+                        iceServers,
+                        iceTransportPolicy,
+                        additionalSettings, // eslint-disable-line @typescript-eslint/no-unused-vars
+                        proprietaryConstraints, // eslint-disable-line @typescript-eslint/no-unused-vars
+                        extendedRtpCapabilities,
+                    }) {
+                        logger.debug('run()');
+                        this._sendingRtpParametersByKind = {
+                            audio: ortc.getSendingRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._remoteIceParameters = iceParameters;
+                        this._remoteIceCandidates = iceCandidates;
+                        this._remoteDtlsParameters = dtlsParameters;
+                        this._cname = `CNAME-${utils.generateRandomNumber()}`;
+                        this._setIceGatherer({ iceServers, iceTransportPolicy });
+                        this._setIceTransport();
+                        this._setDtlsTransport();
+                    }
+                    // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                    async updateIceServers(iceServers) {
+                        // NOTE: Edge 11 does not implement iceGatherer.gater().
+                        throw new errors_1.UnsupportedError('not supported');
+                    }
+                    async restartIce(iceParameters) {
+                        logger.debug('restartIce()');
+                        this._remoteIceParameters = iceParameters;
+                        if (!this._transportReady) return;
+                        logger.debug('restartIce() | calling iceTransport.start()');
+                        this._iceTransport.start(this._iceGatherer, iceParameters, 'controlling');
+                        for (const candidate of this._remoteIceCandidates) {
+                            this._iceTransport.addRemoteCandidate(candidate);
+                        }
+                        this._iceTransport.addRemoteCandidate({});
+                    }
+                    async getTransportStats() {
+                        return this._iceTransport.getStats();
+                    }
+                    async send(
+                        // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                        { track, encodings, codecOptions, codec },
+                    ) {
+                        logger.debug('send() [kind:%s, track.id:%s]', track.kind, track.id);
+                        if (!this._transportReady) await this._setupTransport({ localDtlsRole: 'server' });
+                        logger.debug('send() | calling new RTCRtpSender()');
+                        const rtpSender = new RTCRtpSender(track, this._dtlsTransport);
+                        const rtpParameters = utils.clone(this._sendingRtpParametersByKind[track.kind], {});
+                        rtpParameters.codecs = ortc.reduceCodecs(rtpParameters.codecs, codec);
+                        const useRtx = rtpParameters.codecs.some((_codec) => /.+\/rtx$/i.test(_codec.mimeType));
+                        if (!encodings) encodings = [{}];
+                        for (const encoding of encodings) {
+                            encoding.ssrc = utils.generateRandomNumber();
+                            if (useRtx) encoding.rtx = { ssrc: utils.generateRandomNumber() };
+                        }
+                        rtpParameters.encodings = encodings;
+                        // Fill RTCRtpParameters.rtcp.
+                        rtpParameters.rtcp = {
+                            cname: this._cname,
+                            reducedSize: true,
+                            mux: true,
+                        };
+                        // NOTE: Convert our standard RTCRtpParameters into those that Edge
+                        // expects.
+                        const edgeRtpParameters = edgeUtils.mangleRtpParameters(rtpParameters);
+                        logger.debug('send() | calling rtpSender.send() [params:%o]', edgeRtpParameters);
+                        await rtpSender.send(edgeRtpParameters);
+                        const localId = String(this._nextSendLocalId);
+                        this._nextSendLocalId++;
+                        // Store it.
+                        this._rtpSenders.set(localId, rtpSender);
+                        return { localId, rtpParameters, rtpSender };
+                    }
+                    async stopSending(localId) {
+                        logger.debug('stopSending() [localId:%s]', localId);
+                        const rtpSender = this._rtpSenders.get(localId);
+                        if (!rtpSender) throw new Error('RTCRtpSender not found');
+                        this._rtpSenders.delete(localId);
+                        try {
+                            logger.debug('stopSending() | calling rtpSender.stop()');
+                            rtpSender.stop();
+                        } catch (error) {
+                            logger.warn('stopSending() | rtpSender.stop() failed:%o', error);
+                            throw error;
+                        }
+                    }
+                    async replaceTrack(localId, track) {
+                        if (track) {
+                            logger.debug('replaceTrack() [localId:%s, track.id:%s]', localId, track.id);
+                        } else {
+                            logger.debug('replaceTrack() [localId:%s, no track]', localId);
+                        }
+                        const rtpSender = this._rtpSenders.get(localId);
+                        if (!rtpSender) throw new Error('RTCRtpSender not found');
+                        rtpSender.setTrack(track);
+                    }
+                    async setMaxSpatialLayer(localId, spatialLayer) {
+                        logger.debug('setMaxSpatialLayer() [localId:%s, spatialLayer:%s]', localId, spatialLayer);
+                        const rtpSender = this._rtpSenders.get(localId);
+                        if (!rtpSender) throw new Error('RTCRtpSender not found');
+                        const parameters = rtpSender.getParameters();
+                        parameters.encodings.forEach((encoding, idx) => {
+                            if (idx <= spatialLayer) encoding.active = true;
+                            else encoding.active = false;
+                        });
+                        await rtpSender.setParameters(parameters);
+                    }
+                    async setRtpEncodingParameters(localId, params) {
+                        logger.debug('setRtpEncodingParameters() [localId:%s, params:%o]', localId, params);
+                        const rtpSender = this._rtpSenders.get(localId);
+                        if (!rtpSender) throw new Error('RTCRtpSender not found');
+                        const parameters = rtpSender.getParameters();
+                        parameters.encodings.forEach((encoding, idx) => {
+                            parameters.encodings[idx] = Object.assign(Object.assign({}, encoding), params);
+                        });
+                        await rtpSender.setParameters(parameters);
+                    }
+                    async getSenderStats(localId) {
+                        const rtpSender = this._rtpSenders.get(localId);
+                        if (!rtpSender) throw new Error('RTCRtpSender not found');
+                        return rtpSender.getStats();
+                    }
+                    async sendDataChannel(
+                        // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                        options,
+                    ) {
+                        throw new errors_1.UnsupportedError('not implemented');
+                    }
+                    async receive({ trackId, kind, rtpParameters }) {
+                        logger.debug('receive() [trackId:%s, kind:%s]', trackId, kind);
+                        if (!this._transportReady) await this._setupTransport({ localDtlsRole: 'server' });
+                        logger.debug('receive() | calling new RTCRtpReceiver()');
+                        const rtpReceiver = new RTCRtpReceiver(this._dtlsTransport, kind);
+                        rtpReceiver.addEventListener('error', (event) => {
+                            logger.error('rtpReceiver "error" event [event:%o]', event);
+                        });
+                        // NOTE: Convert our standard RTCRtpParameters into those that Edge
+                        // expects.
+                        const edgeRtpParameters = edgeUtils.mangleRtpParameters(rtpParameters);
+                        logger.debug('receive() | calling rtpReceiver.receive() [params:%o]', edgeRtpParameters);
+                        await rtpReceiver.receive(edgeRtpParameters);
+                        const localId = trackId;
+                        // Store it.
+                        this._rtpReceivers.set(localId, rtpReceiver);
+                        return {
+                            localId,
+                            track: rtpReceiver.track,
+                            rtpReceiver,
+                        };
+                    }
+                    async stopReceiving(localId) {
+                        logger.debug('stopReceiving() [localId:%s]', localId);
+                        const rtpReceiver = this._rtpReceivers.get(localId);
+                        if (!rtpReceiver) throw new Error('RTCRtpReceiver not found');
+                        this._rtpReceivers.delete(localId);
+                        try {
+                            logger.debug('stopReceiving() | calling rtpReceiver.stop()');
+                            rtpReceiver.stop();
+                        } catch (error) {
+                            logger.warn('stopReceiving() | rtpReceiver.stop() failed:%o', error);
+                        }
+                    }
+                    async getReceiverStats(localId) {
+                        const rtpReceiver = this._rtpReceivers.get(localId);
+                        if (!rtpReceiver) throw new Error('RTCRtpReceiver not found');
+                        return rtpReceiver.getStats();
+                    }
+                    async receiveDataChannel(
+                        // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                        options,
+                    ) {
+                        throw new errors_1.UnsupportedError('not implemented');
+                    }
+                    _setIceGatherer({ iceServers, iceTransportPolicy }) {
+                        const iceGatherer = new RTCIceGatherer({
+                            iceServers: iceServers || [],
+                            gatherPolicy: iceTransportPolicy || 'all',
+                        });
+                        iceGatherer.addEventListener('error', (event) => {
+                            logger.error('iceGatherer "error" event [event:%o]', event);
+                        });
+                        // NOTE: Not yet implemented by Edge, which starts gathering automatically.
+                        try {
+                            iceGatherer.gather();
+                        } catch (error) {
+                            logger.debug('_setIceGatherer() | iceGatherer.gather() failed: %s', error.toString());
+                        }
+                        this._iceGatherer = iceGatherer;
+                    }
+                    _setIceTransport() {
+                        const iceTransport = new RTCIceTransport(this._iceGatherer);
+                        // NOTE: Not yet implemented by Edge.
+                        iceTransport.addEventListener('statechange', () => {
+                            switch (iceTransport.state) {
+                                case 'checking':
+                                    this.emit('@connectionstatechange', 'connecting');
+                                    break;
+                                case 'connected':
+                                case 'completed':
+                                    this.emit('@connectionstatechange', 'connected');
+                                    break;
+                                case 'failed':
+                                    this.emit('@connectionstatechange', 'failed');
+                                    break;
+                                case 'disconnected':
+                                    this.emit('@connectionstatechange', 'disconnected');
+                                    break;
+                                case 'closed':
+                                    this.emit('@connectionstatechange', 'closed');
+                                    break;
+                            }
+                        });
+                        // NOTE: Not standard, but implemented by Edge.
+                        iceTransport.addEventListener('icestatechange', () => {
+                            switch (iceTransport.state) {
+                                case 'checking':
+                                    this.emit('@connectionstatechange', 'connecting');
+                                    break;
+                                case 'connected':
+                                case 'completed':
+                                    this.emit('@connectionstatechange', 'connected');
+                                    break;
+                                case 'failed':
+                                    this.emit('@connectionstatechange', 'failed');
+                                    break;
+                                case 'disconnected':
+                                    this.emit('@connectionstatechange', 'disconnected');
+                                    break;
+                                case 'closed':
+                                    this.emit('@connectionstatechange', 'closed');
+                                    break;
+                            }
+                        });
+                        iceTransport.addEventListener('candidatepairchange', (event) => {
+                            logger.debug('iceTransport "candidatepairchange" event [pair:%o]', event.pair);
+                        });
+                        this._iceTransport = iceTransport;
+                    }
+                    _setDtlsTransport() {
+                        const dtlsTransport = new RTCDtlsTransport(this._iceTransport);
+                        // NOTE: Not yet implemented by Edge.
+                        dtlsTransport.addEventListener('statechange', () => {
+                            logger.debug('dtlsTransport "statechange" event [state:%s]', dtlsTransport.state);
+                        });
+                        // NOTE: Not standard, but implemented by Edge.
+                        dtlsTransport.addEventListener('dtlsstatechange', () => {
+                            logger.debug('dtlsTransport "dtlsstatechange" event [state:%s]', dtlsTransport.state);
+                            if (dtlsTransport.state === 'closed') this.emit('@connectionstatechange', 'closed');
+                        });
+                        dtlsTransport.addEventListener('error', (event) => {
+                            logger.error('dtlsTransport "error" event [event:%o]', event);
+                        });
+                        this._dtlsTransport = dtlsTransport;
+                    }
+                    async _setupTransport({ localDtlsRole }) {
+                        logger.debug('_setupTransport()');
+                        // Get our local DTLS parameters.
+                        const dtlsParameters = this._dtlsTransport.getLocalParameters();
+                        dtlsParameters.role = localDtlsRole;
+                        // Need to tell the remote transport about our parameters.
+                        await this.safeEmitAsPromise('@connect', { dtlsParameters });
+                        // Start the RTCIceTransport.
+                        this._iceTransport.start(this._iceGatherer, this._remoteIceParameters, 'controlling');
+                        // Add remote ICE candidates.
+                        for (const candidate of this._remoteIceCandidates) {
+                            this._iceTransport.addRemoteCandidate(candidate);
+                        }
+                        // Also signal a 'complete' candidate as per spec.
+                        // NOTE: It should be {complete: true} but Edge prefers {}.
+                        // NOTE: If we don't signal end of candidates, the Edge RTCIceTransport
+                        // won't enter the 'completed' state.
+                        this._iceTransport.addRemoteCandidate({});
+                        // NOTE: Edge does not like SHA less than 256.
+                        this._remoteDtlsParameters.fingerprints = this._remoteDtlsParameters.fingerprints.filter(
+                            (fingerprint) => {
+                                return (
+                                    fingerprint.algorithm === 'sha-256' ||
+                                    fingerprint.algorithm === 'sha-384' ||
+                                    fingerprint.algorithm === 'sha-512'
+                                );
+                            },
+                        );
+                        // Start the RTCDtlsTransport.
+                        this._dtlsTransport.start(this._remoteDtlsParameters);
+                        this._transportReady = true;
+                    }
+                }
+                exports.Edge11 = Edge11;
+            },
+            {
+                '../Logger': 13,
+                '../errors': 18,
+                '../ortc': 36,
+                '../utils': 39,
+                './HandlerInterface': 25,
+                './ortc/edgeUtils': 29,
+            },
+        ],
+        24: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.Firefox60 = void 0;
+                const sdpTransform = __importStar(require('sdp-transform'));
+                const Logger_1 = require('../Logger');
+                const errors_1 = require('../errors');
+                const utils = __importStar(require('../utils'));
+                const ortc = __importStar(require('../ortc'));
+                const sdpCommonUtils = __importStar(require('./sdp/commonUtils'));
+                const sdpUnifiedPlanUtils = __importStar(require('./sdp/unifiedPlanUtils'));
+                const HandlerInterface_1 = require('./HandlerInterface');
+                const RemoteSdp_1 = require('./sdp/RemoteSdp');
+                const logger = new Logger_1.Logger('Firefox60');
+                const SCTP_NUM_STREAMS = { OS: 16, MIS: 2048 };
+                class Firefox60 extends HandlerInterface_1.HandlerInterface {
+                    constructor() {
+                        super();
+                        // Map of RTCTransceivers indexed by MID.
+                        this._mapMidTransceiver = new Map();
+                        // Local stream for sending.
+                        this._sendStream = new MediaStream();
+                        // Whether a DataChannel m=application section has been created.
+                        this._hasDataChannelMediaSection = false;
+                        // Sending DataChannel id value counter. Incremented for each new DataChannel.
+                        this._nextSendSctpStreamId = 0;
+                        // Got transport local and remote parameters.
+                        this._transportReady = false;
+                    }
+                    /**
+                     * Creates a factory function.
+                     */
+                    static createFactory() {
+                        return () => new Firefox60();
+                    }
+                    get name() {
+                        return 'Firefox60';
+                    }
+                    close() {
+                        logger.debug('close()');
+                        // Close RTCPeerConnection.
+                        if (this._pc) {
+                            try {
+                                this._pc.close();
+                            } catch (error) {}
+                        }
+                    }
+                    async getNativeRtpCapabilities() {
+                        logger.debug('getNativeRtpCapabilities()');
+                        const pc = new RTCPeerConnection({
+                            iceServers: [],
+                            iceTransportPolicy: 'all',
+                            bundlePolicy: 'max-bundle',
+                            rtcpMuxPolicy: 'require',
+                        });
+                        // NOTE: We need to add a real video track to get the RID extension mapping.
+                        const canvas = document.createElement('canvas');
+                        // NOTE: Otherwise Firefox fails in next line.
+                        canvas.getContext('2d');
+                        const fakeStream = canvas.captureStream();
+                        const fakeVideoTrack = fakeStream.getVideoTracks()[0];
+                        try {
+                            pc.addTransceiver('audio', { direction: 'sendrecv' });
+                            const videoTransceiver = pc.addTransceiver(fakeVideoTrack, { direction: 'sendrecv' });
+                            const parameters = videoTransceiver.sender.getParameters();
+                            const encodings = [
+                                { rid: 'r0', maxBitrate: 100000 },
+                                { rid: 'r1', maxBitrate: 500000 },
+                            ];
+                            parameters.encodings = encodings;
+                            await videoTransceiver.sender.setParameters(parameters);
+                            const offer = await pc.createOffer();
+                            try {
+                                canvas.remove();
+                            } catch (error) {}
+                            try {
+                                fakeVideoTrack.stop();
+                            } catch (error) {}
+                            try {
+                                pc.close();
+                            } catch (error) {}
+                            const sdpObject = sdpTransform.parse(offer.sdp);
+                            const nativeRtpCapabilities = sdpCommonUtils.extractRtpCapabilities({ sdpObject });
+                            return nativeRtpCapabilities;
+                        } catch (error) {
+                            try {
+                                canvas.remove();
+                            } catch (error2) {}
+                            try {
+                                fakeVideoTrack.stop();
+                            } catch (error2) {}
+                            try {
+                                pc.close();
+                            } catch (error2) {}
+                            throw error;
+                        }
+                    }
+                    async getNativeSctpCapabilities() {
+                        logger.debug('getNativeSctpCapabilities()');
+                        return {
+                            numStreams: SCTP_NUM_STREAMS,
+                        };
+                    }
+                    run({
+                        direction,
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        iceServers,
+                        iceTransportPolicy,
+                        additionalSettings,
+                        proprietaryConstraints,
+                        extendedRtpCapabilities,
+                    }) {
+                        logger.debug('run()');
+                        this._direction = direction;
+                        this._remoteSdp = new RemoteSdp_1.RemoteSdp({
+                            iceParameters,
+                            iceCandidates,
+                            dtlsParameters,
+                            sctpParameters,
+                        });
+                        this._sendingRtpParametersByKind = {
+                            audio: ortc.getSendingRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._sendingRemoteRtpParametersByKind = {
+                            audio: ortc.getSendingRemoteRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRemoteRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._pc = new RTCPeerConnection(
+                            Object.assign(
+                                {
+                                    iceServers: iceServers || [],
+                                    iceTransportPolicy: iceTransportPolicy || 'all',
+                                    bundlePolicy: 'max-bundle',
+                                    rtcpMuxPolicy: 'require',
+                                },
+                                additionalSettings,
+                            ),
+                            proprietaryConstraints,
+                        );
+                        // Handle RTCPeerConnection connection status.
+                        this._pc.addEventListener('iceconnectionstatechange', () => {
+                            switch (this._pc.iceConnectionState) {
+                                case 'checking':
+                                    this.emit('@connectionstatechange', 'connecting');
+                                    break;
+                                case 'connected':
+                                case 'completed':
+                                    this.emit('@connectionstatechange', 'connected');
+                                    break;
+                                case 'failed':
+                                    this.emit('@connectionstatechange', 'failed');
+                                    break;
+                                case 'disconnected':
+                                    this.emit('@connectionstatechange', 'disconnected');
+                                    break;
+                                case 'closed':
+                                    this.emit('@connectionstatechange', 'closed');
+                                    break;
+                            }
+                        });
+                    }
+                    // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                    async updateIceServers(iceServers) {
+                        // NOTE: Firefox does not implement pc.setConfiguration().
+                        throw new errors_1.UnsupportedError('not supported');
+                    }
+                    async restartIce(iceParameters) {
+                        logger.debug('restartIce()');
+                        // Provide the remote SDP handler with new remote ICE parameters.
+                        this._remoteSdp.updateIceParameters(iceParameters);
+                        if (!this._transportReady) return;
+                        if (this._direction === 'send') {
+                            const offer = await this._pc.createOffer({ iceRestart: true });
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                        } else {
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [answer:%o]', answer);
+                            await this._pc.setLocalDescription(answer);
+                        }
+                    }
+                    async getTransportStats() {
+                        return this._pc.getStats();
+                    }
+                    async send({ track, encodings, codecOptions, codec }) {
+                        this._assertSendDirection();
+                        logger.debug('send() [kind:%s, track.id:%s]', track.kind, track.id);
+                        if (encodings) {
+                            encodings = utils.clone(encodings, []);
+                            if (encodings.length > 1) {
+                                encodings.forEach((encoding, idx) => {
+                                    encoding.rid = `r${idx}`;
+                                });
+                                // Clone the encodings and reverse them because Firefox likes them
+                                // from high to low.
+                                encodings.reverse();
+                            }
+                        }
+                        const sendingRtpParameters = utils.clone(this._sendingRtpParametersByKind[track.kind], {});
+                        // This may throw.
+                        sendingRtpParameters.codecs = ortc.reduceCodecs(sendingRtpParameters.codecs, codec);
+                        const sendingRemoteRtpParameters = utils.clone(
+                            this._sendingRemoteRtpParametersByKind[track.kind],
+                            {},
+                        );
+                        // This may throw.
+                        sendingRemoteRtpParameters.codecs = ortc.reduceCodecs(sendingRemoteRtpParameters.codecs, codec);
+                        // NOTE: Firefox fails sometimes to properly anticipate the closed media
+                        // section that it should use, so don't reuse closed media sections.
+                        //   https://github.com/versatica/mediasoup-client/issues/104
+                        //
+                        // const mediaSectionIdx = this._remoteSdp!.getNextMediaSectionIdx();
+                        const transceiver = this._pc.addTransceiver(track, {
+                            direction: 'sendonly',
+                            streams: [this._sendStream],
+                        });
+                        // NOTE: This is not spec compliants. Encodings should be given in addTransceiver
+                        // second argument, but Firefox does not support it.
+                        if (encodings) {
+                            const parameters = transceiver.sender.getParameters();
+                            parameters.encodings = encodings;
+                            await transceiver.sender.setParameters(parameters);
+                        }
+                        const offer = await this._pc.createOffer();
+                        let localSdpObject = sdpTransform.parse(offer.sdp);
+                        // In Firefox use DTLS role client even if we are the "offerer" since
+                        // Firefox does not respect ICE-Lite.
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                        logger.debug('send() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        await this._pc.setLocalDescription(offer);
+                        // We can now get the transceiver.mid.
+                        const localId = transceiver.mid;
+                        // Set MID.
+                        sendingRtpParameters.mid = localId;
+                        localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        const offerMediaObject = localSdpObject.media[localSdpObject.media.length - 1];
+                        // Set RTCP CNAME.
+                        sendingRtpParameters.rtcp.cname = sdpCommonUtils.getCname({ offerMediaObject });
+                        // Set RTP encodings by parsing the SDP offer if no encodings are given.
+                        if (!encodings) {
+                            sendingRtpParameters.encodings = sdpUnifiedPlanUtils.getRtpEncodings({ offerMediaObject });
+                        }
+                        // Set RTP encodings by parsing the SDP offer and complete them with given
+                        // one if just a single encoding has been given.
+                        else if (encodings.length === 1) {
+                            const newEncodings = sdpUnifiedPlanUtils.getRtpEncodings({ offerMediaObject });
+                            Object.assign(newEncodings[0], encodings[0]);
+                            sendingRtpParameters.encodings = newEncodings;
+                        }
+                        // Otherwise if more than 1 encoding are given use them verbatim (but
+                        // reverse them back since we reversed them above to satisfy Firefox).
+                        else {
+                            sendingRtpParameters.encodings = encodings.reverse();
+                        }
+                        // If VP8 or H264 and there is effective simulcast, add scalabilityMode to
+                        // each encoding.
+                        if (
+                            sendingRtpParameters.encodings.length > 1 &&
+                            (sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/vp8' ||
+                                sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/h264')
+                        ) {
+                            for (const encoding of sendingRtpParameters.encodings) {
+                                encoding.scalabilityMode = 'S1T3';
+                            }
+                        }
+                        this._remoteSdp.send({
+                            offerMediaObject,
+                            offerRtpParameters: sendingRtpParameters,
+                            answerRtpParameters: sendingRemoteRtpParameters,
+                            codecOptions,
+                            extmapAllowMixed: true,
+                        });
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('send() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                        // Store in the map.
+                        this._mapMidTransceiver.set(localId, transceiver);
+                        return {
+                            localId,
+                            rtpParameters: sendingRtpParameters,
+                            rtpSender: transceiver.sender,
+                        };
+                    }
+                    async stopSending(localId) {
+                        logger.debug('stopSending() [localId:%s]', localId);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated transceiver not found');
+                        transceiver.sender.replaceTrack(null);
+                        this._pc.removeTrack(transceiver.sender);
+                        // NOTE: Cannot use closeMediaSection() due to the the note above in send()
+                        // method.
+                        // this._remoteSdp!.closeMediaSection(transceiver.mid);
+                        this._remoteSdp.disableMediaSection(transceiver.mid);
+                        const offer = await this._pc.createOffer();
+                        logger.debug('stopSending() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        await this._pc.setLocalDescription(offer);
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopSending() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                    }
+                    async replaceTrack(localId, track) {
+                        this._assertSendDirection();
+                        if (track) {
+                            logger.debug('replaceTrack() [localId:%s, track.id:%s]', localId, track.id);
+                        } else {
+                            logger.debug('replaceTrack() [localId:%s, no track]', localId);
+                        }
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        await transceiver.sender.replaceTrack(track);
+                    }
+                    async setMaxSpatialLayer(localId, spatialLayer) {
+                        this._assertSendDirection();
+                        logger.debug('setMaxSpatialLayer() [localId:%s, spatialLayer:%s]', localId, spatialLayer);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated transceiver not found');
+                        const parameters = transceiver.sender.getParameters();
+                        // NOTE: We require encodings given from low to high, however Firefox
+                        // requires them in reverse order, so do magic here.
+                        spatialLayer = parameters.encodings.length - 1 - spatialLayer;
+                        parameters.encodings.forEach((encoding, idx) => {
+                            if (idx >= spatialLayer) encoding.active = true;
+                            else encoding.active = false;
+                        });
+                        await transceiver.sender.setParameters(parameters);
+                    }
+                    async setRtpEncodingParameters(localId, params) {
+                        this._assertSendDirection();
+                        logger.debug('setRtpEncodingParameters() [localId:%s, params:%o]', localId, params);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        const parameters = transceiver.sender.getParameters();
+                        parameters.encodings.forEach((encoding, idx) => {
+                            parameters.encodings[idx] = Object.assign(Object.assign({}, encoding), params);
+                        });
+                        await transceiver.sender.setParameters(parameters);
+                    }
+                    async getSenderStats(localId) {
+                        this._assertSendDirection();
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        return transceiver.sender.getStats();
+                    }
+                    async sendDataChannel({ ordered, maxPacketLifeTime, maxRetransmits, label, protocol }) {
+                        this._assertSendDirection();
+                        const options = {
+                            negotiated: true,
+                            id: this._nextSendSctpStreamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('sendDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // Increase next id.
+                        this._nextSendSctpStreamId = ++this._nextSendSctpStreamId % SCTP_NUM_STREAMS.MIS;
+                        // If this is the first DataChannel we need to create the SDP answer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            const offer = await this._pc.createOffer();
+                            const localSdpObject = sdpTransform.parse(offer.sdp);
+                            const offerMediaObject = localSdpObject.media.find((m) => m.type === 'application');
+                            if (!this._transportReady)
+                                await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                            logger.debug('sendDataChannel() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            this._remoteSdp.sendSctpAssociation({ offerMediaObject });
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('sendDataChannel() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        const sctpStreamParameters = {
+                            streamId: options.id,
+                            ordered: options.ordered,
+                            maxPacketLifeTime: options.maxPacketLifeTime,
+                            maxRetransmits: options.maxRetransmits,
+                        };
+                        return { dataChannel, sctpStreamParameters };
+                    }
+                    async receive({ trackId, kind, rtpParameters }) {
+                        this._assertRecvDirection();
+                        logger.debug('receive() [trackId:%s, kind:%s]', trackId, kind);
+                        const localId = rtpParameters.mid || String(this._mapMidTransceiver.size);
+                        this._remoteSdp.receive({
+                            mid: localId,
+                            kind,
+                            offerRtpParameters: rtpParameters,
+                            streamId: rtpParameters.rtcp.cname,
+                            trackId,
+                        });
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('receive() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        let answer = await this._pc.createAnswer();
+                        const localSdpObject = sdpTransform.parse(answer.sdp);
+                        const answerMediaObject = localSdpObject.media.find((m) => String(m.mid) === localId);
+                        // May need to modify codec parameters in the answer based on codec
+                        // parameters in the offer.
+                        sdpCommonUtils.applyCodecParameters({
+                            offerRtpParameters: rtpParameters,
+                            answerMediaObject,
+                        });
+                        answer = { type: 'answer', sdp: sdpTransform.write(localSdpObject) };
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                        logger.debug('receive() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                        const transceiver = this._pc.getTransceivers().find((t) => t.mid === localId);
+                        if (!transceiver) throw new Error('new RTCRtpTransceiver not found');
+                        // Store in the map.
+                        this._mapMidTransceiver.set(localId, transceiver);
+                        return {
+                            localId,
+                            track: transceiver.receiver.track,
+                            rtpReceiver: transceiver.receiver,
+                        };
+                    }
+                    async stopReceiving(localId) {
+                        this._assertRecvDirection();
+                        logger.debug('stopReceiving() [localId:%s]', localId);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        this._remoteSdp.closeMediaSection(transceiver.mid);
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopReceiving() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        const answer = await this._pc.createAnswer();
+                        logger.debug('stopReceiving() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                    }
+                    async getReceiverStats(localId) {
+                        this._assertRecvDirection();
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        return transceiver.receiver.getStats();
+                    }
+                    async receiveDataChannel({ sctpStreamParameters, label, protocol }) {
+                        this._assertRecvDirection();
+                        const { streamId, ordered, maxPacketLifeTime, maxRetransmits } = sctpStreamParameters;
+                        const options = {
+                            negotiated: true,
+                            id: streamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('receiveDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // If this is the first DataChannel we need to create the SDP offer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            this._remoteSdp.receiveSctpAssociation();
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('receiveDataChannel() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            if (!this._transportReady) {
+                                const localSdpObject = sdpTransform.parse(answer.sdp);
+                                await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                            }
+                            logger.debug(
+                                'receiveDataChannel() | calling pc.setRemoteDescription() [answer:%o]',
+                                answer,
+                            );
+                            await this._pc.setLocalDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        return { dataChannel };
+                    }
+                    async _setupTransport({ localDtlsRole, localSdpObject }) {
+                        if (!localSdpObject) localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        // Get our local DTLS parameters.
+                        const dtlsParameters = sdpCommonUtils.extractDtlsParameters({ sdpObject: localSdpObject });
+                        // Set our DTLS role.
+                        dtlsParameters.role = localDtlsRole;
+                        // Update the remote DTLS role in the SDP.
+                        this._remoteSdp.updateDtlsRole(localDtlsRole === 'client' ? 'server' : 'client');
+                        // Need to tell the remote transport about our parameters.
+                        await this.safeEmitAsPromise('@connect', { dtlsParameters });
+                        this._transportReady = true;
+                    }
+                    _assertSendDirection() {
+                        if (this._direction !== 'send') {
+                            throw new Error('method can just be called for handlers with "send" direction');
+                        }
+                    }
+                    _assertRecvDirection() {
+                        if (this._direction !== 'recv') {
+                            throw new Error('method can just be called for handlers with "recv" direction');
+                        }
+                    }
+                }
+                exports.Firefox60 = Firefox60;
+            },
+            {
+                '../Logger': 13,
+                '../errors': 18,
+                '../ortc': 36,
+                '../utils': 39,
+                './HandlerInterface': 25,
+                './sdp/RemoteSdp': 31,
+                './sdp/commonUtils': 32,
+                './sdp/unifiedPlanUtils': 34,
+                'sdp-transform': 44,
+            },
+        ],
+        25: [
+            function (require, module, exports) {
+                'use strict';
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.HandlerInterface = void 0;
+                const EnhancedEventEmitter_1 = require('../EnhancedEventEmitter');
+                class HandlerInterface extends EnhancedEventEmitter_1.EnhancedEventEmitter {
+                    /**
+                     * @emits @connect - (
+                     *     { dtlsParameters: DtlsParameters },
+                     *     callback: Function,
+                     *     errback: Function
+                     *   )
+                     * @emits @connectionstatechange - (connectionState: ConnectionState)
+                     */
+                    constructor() {
+                        super();
+                    }
+                }
+                exports.HandlerInterface = HandlerInterface;
+            },
+            { '../EnhancedEventEmitter': 12 },
+        ],
+        26: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.ReactNative = void 0;
+                const sdpTransform = __importStar(require('sdp-transform'));
+                const Logger_1 = require('../Logger');
+                const errors_1 = require('../errors');
+                const utils = __importStar(require('../utils'));
+                const ortc = __importStar(require('../ortc'));
+                const sdpCommonUtils = __importStar(require('./sdp/commonUtils'));
+                const sdpPlanBUtils = __importStar(require('./sdp/planBUtils'));
+                const HandlerInterface_1 = require('./HandlerInterface');
+                const RemoteSdp_1 = require('./sdp/RemoteSdp');
+                const logger = new Logger_1.Logger('ReactNative');
+                const SCTP_NUM_STREAMS = { OS: 1024, MIS: 1024 };
+                class ReactNative extends HandlerInterface_1.HandlerInterface {
+                    constructor() {
+                        super();
+                        // Local stream for sending.
+                        this._sendStream = new MediaStream();
+                        // Map of sending MediaStreamTracks indexed by localId.
+                        this._mapSendLocalIdTrack = new Map();
+                        // Next sending localId.
+                        this._nextSendLocalId = 0;
+                        // Map of MID, RTP parameters and RTCRtpReceiver indexed by local id.
+                        // Value is an Object with mid, rtpParameters and rtpReceiver.
+                        this._mapRecvLocalIdInfo = new Map();
+                        // Whether a DataChannel m=application section has been created.
+                        this._hasDataChannelMediaSection = false;
+                        // Sending DataChannel id value counter. Incremented for each new DataChannel.
+                        this._nextSendSctpStreamId = 0;
+                        // Got transport local and remote parameters.
+                        this._transportReady = false;
+                    }
+                    /**
+                     * Creates a factory function.
+                     */
+                    static createFactory() {
+                        return () => new ReactNative();
+                    }
+                    get name() {
+                        return 'ReactNative';
+                    }
+                    close() {
+                        logger.debug('close()');
+                        // Free/dispose native stream and tracks.
+                        // @ts-ignore (proprietary API in react-native-webrtc).
+                        this._sendStream.release();
+                        // Close RTCPeerConnection.
+                        if (this._pc) {
+                            try {
+                                this._pc.close();
+                            } catch (error) {}
+                        }
+                    }
+                    async getNativeRtpCapabilities() {
+                        logger.debug('getNativeRtpCapabilities()');
+                        const pc = new RTCPeerConnection({
+                            iceServers: [],
+                            iceTransportPolicy: 'all',
+                            bundlePolicy: 'max-bundle',
+                            rtcpMuxPolicy: 'require',
+                            sdpSemantics: 'plan-b',
+                        });
+                        try {
+                            const offer = await pc.createOffer({
+                                offerToReceiveAudio: true,
+                                offerToReceiveVideo: true,
+                            });
+                            try {
+                                pc.close();
+                            } catch (error) {}
+                            const sdpObject = sdpTransform.parse(offer.sdp);
+                            const nativeRtpCapabilities = sdpCommonUtils.extractRtpCapabilities({ sdpObject });
+                            return nativeRtpCapabilities;
+                        } catch (error) {
+                            try {
+                                pc.close();
+                            } catch (error2) {}
+                            throw error;
+                        }
+                    }
+                    async getNativeSctpCapabilities() {
+                        logger.debug('getNativeSctpCapabilities()');
+                        return {
+                            numStreams: SCTP_NUM_STREAMS,
+                        };
+                    }
+                    run({
+                        direction,
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        iceServers,
+                        iceTransportPolicy,
+                        additionalSettings,
+                        proprietaryConstraints,
+                        extendedRtpCapabilities,
+                    }) {
+                        logger.debug('run()');
+                        this._direction = direction;
+                        this._remoteSdp = new RemoteSdp_1.RemoteSdp({
+                            iceParameters,
+                            iceCandidates,
+                            dtlsParameters,
+                            sctpParameters,
+                            planB: true,
+                        });
+                        this._sendingRtpParametersByKind = {
+                            audio: ortc.getSendingRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._sendingRemoteRtpParametersByKind = {
+                            audio: ortc.getSendingRemoteRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRemoteRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._pc = new RTCPeerConnection(
+                            Object.assign(
+                                {
+                                    iceServers: iceServers || [],
+                                    iceTransportPolicy: iceTransportPolicy || 'all',
+                                    bundlePolicy: 'max-bundle',
+                                    rtcpMuxPolicy: 'require',
+                                    sdpSemantics: 'plan-b',
+                                },
+                                additionalSettings,
+                            ),
+                            proprietaryConstraints,
+                        );
+                        // Handle RTCPeerConnection connection status.
+                        this._pc.addEventListener('iceconnectionstatechange', () => {
+                            switch (this._pc.iceConnectionState) {
+                                case 'checking':
+                                    this.emit('@connectionstatechange', 'connecting');
+                                    break;
+                                case 'connected':
+                                case 'completed':
+                                    this.emit('@connectionstatechange', 'connected');
+                                    break;
+                                case 'failed':
+                                    this.emit('@connectionstatechange', 'failed');
+                                    break;
+                                case 'disconnected':
+                                    this.emit('@connectionstatechange', 'disconnected');
+                                    break;
+                                case 'closed':
+                                    this.emit('@connectionstatechange', 'closed');
+                                    break;
+                            }
+                        });
+                    }
+                    async updateIceServers(iceServers) {
+                        logger.debug('updateIceServers()');
+                        const configuration = this._pc.getConfiguration();
+                        configuration.iceServers = iceServers;
+                        this._pc.setConfiguration(configuration);
+                    }
+                    async restartIce(iceParameters) {
+                        logger.debug('restartIce()');
+                        // Provide the remote SDP handler with new remote ICE parameters.
+                        this._remoteSdp.updateIceParameters(iceParameters);
+                        if (!this._transportReady) return;
+                        if (this._direction === 'send') {
+                            const offer = await this._pc.createOffer({ iceRestart: true });
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                        } else {
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [answer:%o]', answer);
+                            await this._pc.setLocalDescription(answer);
+                        }
+                    }
+                    async getTransportStats() {
+                        return this._pc.getStats();
+                    }
+                    async send({ track, encodings, codecOptions, codec }) {
+                        this._assertSendDirection();
+                        logger.debug('send() [kind:%s, track.id:%s]', track.kind, track.id);
+                        if (codec) {
+                            logger.warn('send() | codec selection is not available in %s handler', this.name);
+                        }
+                        this._sendStream.addTrack(track);
+                        this._pc.addStream(this._sendStream);
+                        let offer = await this._pc.createOffer();
+                        let localSdpObject = sdpTransform.parse(offer.sdp);
+                        let offerMediaObject;
+                        const sendingRtpParameters = utils.clone(this._sendingRtpParametersByKind[track.kind], {});
+                        sendingRtpParameters.codecs = ortc.reduceCodecs(sendingRtpParameters.codecs);
+                        const sendingRemoteRtpParameters = utils.clone(
+                            this._sendingRemoteRtpParametersByKind[track.kind],
+                            {},
+                        );
+                        sendingRemoteRtpParameters.codecs = ortc.reduceCodecs(sendingRemoteRtpParameters.codecs);
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                        if (track.kind === 'video' && encodings && encodings.length > 1) {
+                            logger.debug('send() | enabling simulcast');
+                            localSdpObject = sdpTransform.parse(offer.sdp);
+                            offerMediaObject = localSdpObject.media.find((m) => m.type === 'video');
+                            sdpPlanBUtils.addLegacySimulcast({
+                                offerMediaObject,
+                                track,
+                                numStreams: encodings.length,
+                            });
+                            offer = { type: 'offer', sdp: sdpTransform.write(localSdpObject) };
+                        }
+                        logger.debug('send() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        await this._pc.setLocalDescription(offer);
+                        localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        offerMediaObject = localSdpObject.media.find((m) => m.type === track.kind);
+                        // Set RTCP CNAME.
+                        sendingRtpParameters.rtcp.cname = sdpCommonUtils.getCname({ offerMediaObject });
+                        // Set RTP encodings.
+                        sendingRtpParameters.encodings = sdpPlanBUtils.getRtpEncodings({ offerMediaObject, track });
+                        // Complete encodings with given values.
+                        if (encodings) {
+                            for (let idx = 0; idx < sendingRtpParameters.encodings.length; ++idx) {
+                                if (encodings[idx]) Object.assign(sendingRtpParameters.encodings[idx], encodings[idx]);
+                            }
+                        }
+                        // If VP8 or H264 and there is effective simulcast, add scalabilityMode to
+                        // each encoding.
+                        if (
+                            sendingRtpParameters.encodings.length > 1 &&
+                            (sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/vp8' ||
+                                sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/h264')
+                        ) {
+                            for (const encoding of sendingRtpParameters.encodings) {
+                                encoding.scalabilityMode = 'S1T3';
+                            }
+                        }
+                        this._remoteSdp.send({
+                            offerMediaObject,
+                            offerRtpParameters: sendingRtpParameters,
+                            answerRtpParameters: sendingRemoteRtpParameters,
+                            codecOptions,
+                        });
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('send() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                        const localId = String(this._nextSendLocalId);
+                        this._nextSendLocalId++;
+                        // Insert into the map.
+                        this._mapSendLocalIdTrack.set(localId, track);
+                        return {
+                            localId: localId,
+                            rtpParameters: sendingRtpParameters,
+                        };
+                    }
+                    async stopSending(localId) {
+                        this._assertSendDirection();
+                        logger.debug('stopSending() [localId:%s]', localId);
+                        const track = this._mapSendLocalIdTrack.get(localId);
+                        if (!track) throw new Error('track not found');
+                        this._mapSendLocalIdTrack.delete(localId);
+                        this._sendStream.removeTrack(track);
+                        this._pc.addStream(this._sendStream);
+                        const offer = await this._pc.createOffer();
+                        logger.debug('stopSending() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        try {
+                            await this._pc.setLocalDescription(offer);
+                        } catch (error) {
+                            // NOTE: If there are no sending tracks, setLocalDescription() will fail with
+                            // "Failed to create channels". If so, ignore it.
+                            if (this._sendStream.getTracks().length === 0) {
+                                logger.warn(
+                                    'stopSending() | ignoring expected error due no sending tracks: %s',
+                                    error.toString(),
+                                );
+                                return;
+                            }
+                            throw error;
+                        }
+                        if (this._pc.signalingState === 'stable') return;
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopSending() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                    }
+                    async replaceTrack(
+                        // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                        localId,
+                        track,
+                    ) {
+                        throw new errors_1.UnsupportedError('not implemented');
+                    }
+                    // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                    async setMaxSpatialLayer(localId, spatialLayer) {
+                        throw new errors_1.UnsupportedError('not implemented');
+                    }
+                    // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                    async setRtpEncodingParameters(localId, params) {
+                        throw new errors_1.UnsupportedError('not implemented');
+                    }
+                    // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                    async getSenderStats(localId) {
+                        throw new errors_1.UnsupportedError('not implemented');
+                    }
+                    async sendDataChannel({ ordered, maxPacketLifeTime, maxRetransmits, label, protocol }) {
+                        this._assertSendDirection();
+                        const options = {
+                            negotiated: true,
+                            id: this._nextSendSctpStreamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmitTime: maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('sendDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // Increase next id.
+                        this._nextSendSctpStreamId = ++this._nextSendSctpStreamId % SCTP_NUM_STREAMS.MIS;
+                        // If this is the first DataChannel we need to create the SDP answer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            const offer = await this._pc.createOffer();
+                            const localSdpObject = sdpTransform.parse(offer.sdp);
+                            const offerMediaObject = localSdpObject.media.find((m) => m.type === 'application');
+                            if (!this._transportReady)
+                                await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                            logger.debug('sendDataChannel() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            this._remoteSdp.sendSctpAssociation({ offerMediaObject });
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('sendDataChannel() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        const sctpStreamParameters = {
+                            streamId: options.id,
+                            ordered: options.ordered,
+                            maxPacketLifeTime: options.maxPacketLifeTime,
+                            maxRetransmits: options.maxRetransmits,
+                        };
+                        return { dataChannel, sctpStreamParameters };
+                    }
+                    async receive({ trackId, kind, rtpParameters }) {
+                        this._assertRecvDirection();
+                        logger.debug('receive() [trackId:%s, kind:%s]', trackId, kind);
+                        const localId = trackId;
+                        const mid = kind;
+                        let streamId = rtpParameters.rtcp.cname;
+                        // NOTE: In React-Native we cannot reuse the same remote MediaStream for new
+                        // remote tracks. This is because react-native-webrtc does not react on new
+                        // tracks generated within already existing streams, so force the streamId
+                        // to be different.
+                        logger.debug(
+                            'receive() | forcing a random remote streamId to avoid well known bug in react-native-webrtc',
+                        );
+                        streamId += `-hack-${utils.generateRandomNumber()}`;
+                        this._remoteSdp.receive({
+                            mid,
+                            kind,
+                            offerRtpParameters: rtpParameters,
+                            streamId,
+                            trackId,
+                        });
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('receive() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        let answer = await this._pc.createAnswer();
+                        const localSdpObject = sdpTransform.parse(answer.sdp);
+                        const answerMediaObject = localSdpObject.media.find((m) => String(m.mid) === mid);
+                        // May need to modify codec parameters in the answer based on codec
+                        // parameters in the offer.
+                        sdpCommonUtils.applyCodecParameters({
+                            offerRtpParameters: rtpParameters,
+                            answerMediaObject,
+                        });
+                        answer = { type: 'answer', sdp: sdpTransform.write(localSdpObject) };
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                        logger.debug('receive() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                        const stream = this._pc.getRemoteStreams().find((s) => s.id === streamId);
+                        const track = stream.getTrackById(localId);
+                        if (!track) throw new Error('remote track not found');
+                        // Insert into the map.
+                        this._mapRecvLocalIdInfo.set(localId, { mid, rtpParameters });
+                        return { localId, track };
+                    }
+                    async stopReceiving(localId) {
+                        this._assertRecvDirection();
+                        logger.debug('stopReceiving() [localId:%s]', localId);
+                        const { mid, rtpParameters } = this._mapRecvLocalIdInfo.get(localId) || {};
+                        // Remove from the map.
+                        this._mapRecvLocalIdInfo.delete(localId);
+                        this._remoteSdp.planBStopReceiving({ mid: mid, offerRtpParameters: rtpParameters });
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopReceiving() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        const answer = await this._pc.createAnswer();
+                        logger.debug('stopReceiving() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                    }
+                    // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                    async getReceiverStats(localId) {
+                        throw new errors_1.UnsupportedError('not implemented');
+                    }
+                    async receiveDataChannel({ sctpStreamParameters, label, protocol }) {
+                        this._assertRecvDirection();
+                        const { streamId, ordered, maxPacketLifeTime, maxRetransmits } = sctpStreamParameters;
+                        const options = {
+                            negotiated: true,
+                            id: streamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmitTime: maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('receiveDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // If this is the first DataChannel we need to create the SDP offer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            this._remoteSdp.receiveSctpAssociation({ oldDataChannelSpec: true });
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('receiveDataChannel() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            if (!this._transportReady) {
+                                const localSdpObject = sdpTransform.parse(answer.sdp);
+                                await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                            }
+                            logger.debug(
+                                'receiveDataChannel() | calling pc.setRemoteDescription() [answer:%o]',
+                                answer,
+                            );
+                            await this._pc.setLocalDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        return { dataChannel };
+                    }
+                    async _setupTransport({ localDtlsRole, localSdpObject }) {
+                        if (!localSdpObject) localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        // Get our local DTLS parameters.
+                        const dtlsParameters = sdpCommonUtils.extractDtlsParameters({ sdpObject: localSdpObject });
+                        // Set our DTLS role.
+                        dtlsParameters.role = localDtlsRole;
+                        // Update the remote DTLS role in the SDP.
+                        this._remoteSdp.updateDtlsRole(localDtlsRole === 'client' ? 'server' : 'client');
+                        // Need to tell the remote transport about our parameters.
+                        await this.safeEmitAsPromise('@connect', { dtlsParameters });
+                        this._transportReady = true;
+                    }
+                    _assertSendDirection() {
+                        if (this._direction !== 'send') {
+                            throw new Error('method can just be called for handlers with "send" direction');
+                        }
+                    }
+                    _assertRecvDirection() {
+                        if (this._direction !== 'recv') {
+                            throw new Error('method can just be called for handlers with "recv" direction');
+                        }
+                    }
+                }
+                exports.ReactNative = ReactNative;
+            },
+            {
+                '../Logger': 13,
+                '../errors': 18,
+                '../ortc': 36,
+                '../utils': 39,
+                './HandlerInterface': 25,
+                './sdp/RemoteSdp': 31,
+                './sdp/commonUtils': 32,
+                './sdp/planBUtils': 33,
+                'sdp-transform': 44,
+            },
+        ],
+        27: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.Safari11 = void 0;
+                const sdpTransform = __importStar(require('sdp-transform'));
+                const Logger_1 = require('../Logger');
+                const utils = __importStar(require('../utils'));
+                const ortc = __importStar(require('../ortc'));
+                const sdpCommonUtils = __importStar(require('./sdp/commonUtils'));
+                const sdpPlanBUtils = __importStar(require('./sdp/planBUtils'));
+                const HandlerInterface_1 = require('./HandlerInterface');
+                const RemoteSdp_1 = require('./sdp/RemoteSdp');
+                const logger = new Logger_1.Logger('Safari11');
+                const SCTP_NUM_STREAMS = { OS: 1024, MIS: 1024 };
+                class Safari11 extends HandlerInterface_1.HandlerInterface {
+                    constructor() {
+                        super();
+                        // Local stream for sending.
+                        this._sendStream = new MediaStream();
+                        // Map of RTCRtpSender indexed by localId.
+                        this._mapSendLocalIdRtpSender = new Map();
+                        // Next sending localId.
+                        this._nextSendLocalId = 0;
+                        // Map of MID, RTP parameters and RTCRtpReceiver indexed by local id.
+                        // Value is an Object with mid, rtpParameters and rtpReceiver.
+                        this._mapRecvLocalIdInfo = new Map();
+                        // Whether a DataChannel m=application section has been created.
+                        this._hasDataChannelMediaSection = false;
+                        // Sending DataChannel id value counter. Incremented for each new DataChannel.
+                        this._nextSendSctpStreamId = 0;
+                        // Got transport local and remote parameters.
+                        this._transportReady = false;
+                    }
+                    /**
+                     * Creates a factory function.
+                     */
+                    static createFactory() {
+                        return () => new Safari11();
+                    }
+                    get name() {
+                        return 'Safari11';
+                    }
+                    close() {
+                        logger.debug('close()');
+                        // Close RTCPeerConnection.
+                        if (this._pc) {
+                            try {
+                                this._pc.close();
+                            } catch (error) {}
+                        }
+                    }
+                    async getNativeRtpCapabilities() {
+                        logger.debug('getNativeRtpCapabilities()');
+                        const pc = new RTCPeerConnection({
+                            iceServers: [],
+                            iceTransportPolicy: 'all',
+                            bundlePolicy: 'max-bundle',
+                            rtcpMuxPolicy: 'require',
+                            sdpSemantics: 'plan-b',
+                        });
+                        try {
+                            const offer = await pc.createOffer({
+                                offerToReceiveAudio: true,
+                                offerToReceiveVideo: true,
+                            });
+                            try {
+                                pc.close();
+                            } catch (error) {}
+                            const sdpObject = sdpTransform.parse(offer.sdp);
+                            const nativeRtpCapabilities = sdpCommonUtils.extractRtpCapabilities({ sdpObject });
+                            return nativeRtpCapabilities;
+                        } catch (error) {
+                            try {
+                                pc.close();
+                            } catch (error2) {}
+                            throw error;
+                        }
+                    }
+                    async getNativeSctpCapabilities() {
+                        logger.debug('getNativeSctpCapabilities()');
+                        return {
+                            numStreams: SCTP_NUM_STREAMS,
+                        };
+                    }
+                    run({
+                        direction,
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        iceServers,
+                        iceTransportPolicy,
+                        additionalSettings,
+                        proprietaryConstraints,
+                        extendedRtpCapabilities,
+                    }) {
+                        logger.debug('run()');
+                        this._direction = direction;
+                        this._remoteSdp = new RemoteSdp_1.RemoteSdp({
+                            iceParameters,
+                            iceCandidates,
+                            dtlsParameters,
+                            sctpParameters,
+                            planB: true,
+                        });
+                        this._sendingRtpParametersByKind = {
+                            audio: ortc.getSendingRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._sendingRemoteRtpParametersByKind = {
+                            audio: ortc.getSendingRemoteRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRemoteRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._pc = new RTCPeerConnection(
+                            Object.assign(
+                                {
+                                    iceServers: iceServers || [],
+                                    iceTransportPolicy: iceTransportPolicy || 'all',
+                                    bundlePolicy: 'max-bundle',
+                                    rtcpMuxPolicy: 'require',
+                                },
+                                additionalSettings,
+                            ),
+                            proprietaryConstraints,
+                        );
+                        // Handle RTCPeerConnection connection status.
+                        this._pc.addEventListener('iceconnectionstatechange', () => {
+                            switch (this._pc.iceConnectionState) {
+                                case 'checking':
+                                    this.emit('@connectionstatechange', 'connecting');
+                                    break;
+                                case 'connected':
+                                case 'completed':
+                                    this.emit('@connectionstatechange', 'connected');
+                                    break;
+                                case 'failed':
+                                    this.emit('@connectionstatechange', 'failed');
+                                    break;
+                                case 'disconnected':
+                                    this.emit('@connectionstatechange', 'disconnected');
+                                    break;
+                                case 'closed':
+                                    this.emit('@connectionstatechange', 'closed');
+                                    break;
+                            }
+                        });
+                    }
+                    async updateIceServers(iceServers) {
+                        logger.debug('updateIceServers()');
+                        const configuration = this._pc.getConfiguration();
+                        configuration.iceServers = iceServers;
+                        this._pc.setConfiguration(configuration);
+                    }
+                    async restartIce(iceParameters) {
+                        logger.debug('restartIce()');
+                        // Provide the remote SDP handler with new remote ICE parameters.
+                        this._remoteSdp.updateIceParameters(iceParameters);
+                        if (!this._transportReady) return;
+                        if (this._direction === 'send') {
+                            const offer = await this._pc.createOffer({ iceRestart: true });
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                        } else {
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [answer:%o]', answer);
+                            await this._pc.setLocalDescription(answer);
+                        }
+                    }
+                    async getTransportStats() {
+                        return this._pc.getStats();
+                    }
+                    async send({ track, encodings, codecOptions, codec }) {
+                        this._assertSendDirection();
+                        logger.debug('send() [kind:%s, track.id:%s]', track.kind, track.id);
+                        if (codec) {
+                            logger.warn('send() | codec selection is not available in %s handler', this.name);
+                        }
+                        this._sendStream.addTrack(track);
+                        this._pc.addTrack(track, this._sendStream);
+                        let offer = await this._pc.createOffer();
+                        let localSdpObject = sdpTransform.parse(offer.sdp);
+                        let offerMediaObject;
+                        const sendingRtpParameters = utils.clone(this._sendingRtpParametersByKind[track.kind], {});
+                        sendingRtpParameters.codecs = ortc.reduceCodecs(sendingRtpParameters.codecs);
+                        const sendingRemoteRtpParameters = utils.clone(
+                            this._sendingRemoteRtpParametersByKind[track.kind],
+                            {},
+                        );
+                        sendingRemoteRtpParameters.codecs = ortc.reduceCodecs(sendingRemoteRtpParameters.codecs);
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                        if (track.kind === 'video' && encodings && encodings.length > 1) {
+                            logger.debug('send() | enabling simulcast');
+                            localSdpObject = sdpTransform.parse(offer.sdp);
+                            offerMediaObject = localSdpObject.media.find((m) => m.type === 'video');
+                            sdpPlanBUtils.addLegacySimulcast({
+                                offerMediaObject,
+                                track,
+                                numStreams: encodings.length,
+                            });
+                            offer = { type: 'offer', sdp: sdpTransform.write(localSdpObject) };
+                        }
+                        logger.debug('send() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        await this._pc.setLocalDescription(offer);
+                        localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        offerMediaObject = localSdpObject.media.find((m) => m.type === track.kind);
+                        // Set RTCP CNAME.
+                        sendingRtpParameters.rtcp.cname = sdpCommonUtils.getCname({ offerMediaObject });
+                        // Set RTP encodings.
+                        sendingRtpParameters.encodings = sdpPlanBUtils.getRtpEncodings({ offerMediaObject, track });
+                        // Complete encodings with given values.
+                        if (encodings) {
+                            for (let idx = 0; idx < sendingRtpParameters.encodings.length; ++idx) {
+                                if (encodings[idx]) Object.assign(sendingRtpParameters.encodings[idx], encodings[idx]);
+                            }
+                        }
+                        // If VP8 and there is effective simulcast, add scalabilityMode to each
+                        // encoding.
+                        if (
+                            sendingRtpParameters.encodings.length > 1 &&
+                            sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/vp8'
+                        ) {
+                            for (const encoding of sendingRtpParameters.encodings) {
+                                encoding.scalabilityMode = 'S1T3';
+                            }
+                        }
+                        this._remoteSdp.send({
+                            offerMediaObject,
+                            offerRtpParameters: sendingRtpParameters,
+                            answerRtpParameters: sendingRemoteRtpParameters,
+                            codecOptions,
+                        });
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('send() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                        const localId = String(this._nextSendLocalId);
+                        this._nextSendLocalId++;
+                        const rtpSender = this._pc.getSenders().find((s) => s.track === track);
+                        // Insert into the map.
+                        this._mapSendLocalIdRtpSender.set(localId, rtpSender);
+                        return {
+                            localId: localId,
+                            rtpParameters: sendingRtpParameters,
+                            rtpSender,
+                        };
+                    }
+                    async stopSending(localId) {
+                        this._assertSendDirection();
+                        const rtpSender = this._mapSendLocalIdRtpSender.get(localId);
+                        if (!rtpSender) throw new Error('associated RTCRtpSender not found');
+                        if (rtpSender.track) this._sendStream.removeTrack(rtpSender.track);
+                        this._mapSendLocalIdRtpSender.delete(localId);
+                        const offer = await this._pc.createOffer();
+                        logger.debug('stopSending() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        try {
+                            await this._pc.setLocalDescription(offer);
+                        } catch (error) {
+                            // NOTE: If there are no sending tracks, setLocalDescription() will fail with
+                            // "Failed to create channels". If so, ignore it.
+                            if (this._sendStream.getTracks().length === 0) {
+                                logger.warn(
+                                    'stopSending() | ignoring expected error due no sending tracks: %s',
+                                    error.toString(),
+                                );
+                                return;
+                            }
+                            throw error;
+                        }
+                        if (this._pc.signalingState === 'stable') return;
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopSending() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                    }
+                    async replaceTrack(localId, track) {
+                        this._assertSendDirection();
+                        if (track) {
+                            logger.debug('replaceTrack() [localId:%s, track.id:%s]', localId, track.id);
+                        } else {
+                            logger.debug('replaceTrack() [localId:%s, no track]', localId);
+                        }
+                        const rtpSender = this._mapSendLocalIdRtpSender.get(localId);
+                        if (!rtpSender) throw new Error('associated RTCRtpSender not found');
+                        const oldTrack = rtpSender.track;
+                        await rtpSender.replaceTrack(track);
+                        // Remove the old track from the local stream.
+                        if (oldTrack) this._sendStream.removeTrack(oldTrack);
+                        // Add the new track to the local stream.
+                        if (track) this._sendStream.addTrack(track);
+                    }
+                    async setMaxSpatialLayer(localId, spatialLayer) {
+                        this._assertSendDirection();
+                        logger.debug('setMaxSpatialLayer() [localId:%s, spatialLayer:%s]', localId, spatialLayer);
+                        const rtpSender = this._mapSendLocalIdRtpSender.get(localId);
+                        if (!rtpSender) throw new Error('associated RTCRtpSender not found');
+                        const parameters = rtpSender.getParameters();
+                        parameters.encodings.forEach((encoding, idx) => {
+                            if (idx <= spatialLayer) encoding.active = true;
+                            else encoding.active = false;
+                        });
+                        await rtpSender.setParameters(parameters);
+                    }
+                    async setRtpEncodingParameters(localId, params) {
+                        this._assertSendDirection();
+                        logger.debug('setRtpEncodingParameters() [localId:%s, params:%o]', localId, params);
+                        const rtpSender = this._mapSendLocalIdRtpSender.get(localId);
+                        if (!rtpSender) throw new Error('associated RTCRtpSender not found');
+                        const parameters = rtpSender.getParameters();
+                        parameters.encodings.forEach((encoding, idx) => {
+                            parameters.encodings[idx] = Object.assign(Object.assign({}, encoding), params);
+                        });
+                        await rtpSender.setParameters(parameters);
+                    }
+                    async getSenderStats(localId) {
+                        this._assertSendDirection();
+                        const rtpSender = this._mapSendLocalIdRtpSender.get(localId);
+                        if (!rtpSender) throw new Error('associated RTCRtpSender not found');
+                        return rtpSender.getStats();
+                    }
+                    async sendDataChannel({ ordered, maxPacketLifeTime, maxRetransmits, label, protocol }) {
+                        this._assertSendDirection();
+                        const options = {
+                            negotiated: true,
+                            id: this._nextSendSctpStreamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('sendDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // Increase next id.
+                        this._nextSendSctpStreamId = ++this._nextSendSctpStreamId % SCTP_NUM_STREAMS.MIS;
+                        // If this is the first DataChannel we need to create the SDP answer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            const offer = await this._pc.createOffer();
+                            const localSdpObject = sdpTransform.parse(offer.sdp);
+                            const offerMediaObject = localSdpObject.media.find((m) => m.type === 'application');
+                            if (!this._transportReady)
+                                await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                            logger.debug('sendDataChannel() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            this._remoteSdp.sendSctpAssociation({ offerMediaObject });
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('sendDataChannel() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        const sctpStreamParameters = {
+                            streamId: options.id,
+                            ordered: options.ordered,
+                            maxPacketLifeTime: options.maxPacketLifeTime,
+                            maxRetransmits: options.maxRetransmits,
+                        };
+                        return { dataChannel, sctpStreamParameters };
+                    }
+                    async receive({ trackId, kind, rtpParameters }) {
+                        this._assertRecvDirection();
+                        logger.debug('receive() [trackId:%s, kind:%s]', trackId, kind);
+                        const localId = trackId;
+                        const mid = kind;
+                        this._remoteSdp.receive({
+                            mid,
+                            kind,
+                            offerRtpParameters: rtpParameters,
+                            streamId: rtpParameters.rtcp.cname,
+                            trackId,
+                        });
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('receive() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        let answer = await this._pc.createAnswer();
+                        const localSdpObject = sdpTransform.parse(answer.sdp);
+                        const answerMediaObject = localSdpObject.media.find((m) => String(m.mid) === mid);
+                        // May need to modify codec parameters in the answer based on codec
+                        // parameters in the offer.
+                        sdpCommonUtils.applyCodecParameters({
+                            offerRtpParameters: rtpParameters,
+                            answerMediaObject,
+                        });
+                        answer = { type: 'answer', sdp: sdpTransform.write(localSdpObject) };
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                        logger.debug('receive() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                        const rtpReceiver = this._pc.getReceivers().find((r) => r.track && r.track.id === localId);
+                        if (!rtpReceiver) throw new Error('new RTCRtpReceiver not');
+                        // Insert into the map.
+                        this._mapRecvLocalIdInfo.set(localId, { mid, rtpParameters, rtpReceiver });
+                        return {
+                            localId,
+                            track: rtpReceiver.track,
+                            rtpReceiver,
+                        };
+                    }
+                    async stopReceiving(localId) {
+                        this._assertRecvDirection();
+                        logger.debug('stopReceiving() [localId:%s]', localId);
+                        const { mid, rtpParameters } = this._mapRecvLocalIdInfo.get(localId) || {};
+                        // Remove from the map.
+                        this._mapRecvLocalIdInfo.delete(localId);
+                        this._remoteSdp.planBStopReceiving({ mid: mid, offerRtpParameters: rtpParameters });
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopReceiving() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        const answer = await this._pc.createAnswer();
+                        logger.debug('stopReceiving() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                    }
+                    async getReceiverStats(localId) {
+                        this._assertRecvDirection();
+                        const { rtpReceiver } = this._mapRecvLocalIdInfo.get(localId) || {};
+                        if (!rtpReceiver) throw new Error('associated RTCRtpReceiver not found');
+                        return rtpReceiver.getStats();
+                    }
+                    async receiveDataChannel({ sctpStreamParameters, label, protocol }) {
+                        this._assertRecvDirection();
+                        const { streamId, ordered, maxPacketLifeTime, maxRetransmits } = sctpStreamParameters;
+                        const options = {
+                            negotiated: true,
+                            id: streamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('receiveDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // If this is the first DataChannel we need to create the SDP offer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            this._remoteSdp.receiveSctpAssociation({ oldDataChannelSpec: true });
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('receiveDataChannel() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            if (!this._transportReady) {
+                                const localSdpObject = sdpTransform.parse(answer.sdp);
+                                await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                            }
+                            logger.debug(
+                                'receiveDataChannel() | calling pc.setRemoteDescription() [answer:%o]',
+                                answer,
+                            );
+                            await this._pc.setLocalDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        return { dataChannel };
+                    }
+                    async _setupTransport({ localDtlsRole, localSdpObject }) {
+                        if (!localSdpObject) localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        // Get our local DTLS parameters.
+                        const dtlsParameters = sdpCommonUtils.extractDtlsParameters({ sdpObject: localSdpObject });
+                        // Set our DTLS role.
+                        dtlsParameters.role = localDtlsRole;
+                        // Update the remote DTLS role in the SDP.
+                        this._remoteSdp.updateDtlsRole(localDtlsRole === 'client' ? 'server' : 'client');
+                        // Need to tell the remote transport about our parameters.
+                        await this.safeEmitAsPromise('@connect', { dtlsParameters });
+                        this._transportReady = true;
+                    }
+                    _assertSendDirection() {
+                        if (this._direction !== 'send') {
+                            throw new Error('method can just be called for handlers with "send" direction');
+                        }
+                    }
+                    _assertRecvDirection() {
+                        if (this._direction !== 'recv') {
+                            throw new Error('method can just be called for handlers with "recv" direction');
+                        }
+                    }
+                }
+                exports.Safari11 = Safari11;
+            },
+            {
+                '../Logger': 13,
+                '../ortc': 36,
+                '../utils': 39,
+                './HandlerInterface': 25,
+                './sdp/RemoteSdp': 31,
+                './sdp/commonUtils': 32,
+                './sdp/planBUtils': 33,
+                'sdp-transform': 44,
+            },
+        ],
+        28: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.Safari12 = void 0;
+                const sdpTransform = __importStar(require('sdp-transform'));
+                const Logger_1 = require('../Logger');
+                const utils = __importStar(require('../utils'));
+                const ortc = __importStar(require('../ortc'));
+                const sdpCommonUtils = __importStar(require('./sdp/commonUtils'));
+                const sdpUnifiedPlanUtils = __importStar(require('./sdp/unifiedPlanUtils'));
+                const HandlerInterface_1 = require('./HandlerInterface');
+                const RemoteSdp_1 = require('./sdp/RemoteSdp');
+                const logger = new Logger_1.Logger('Safari12');
+                const SCTP_NUM_STREAMS = { OS: 1024, MIS: 1024 };
+                class Safari12 extends HandlerInterface_1.HandlerInterface {
+                    constructor() {
+                        super();
+                        // Map of RTCTransceivers indexed by MID.
+                        this._mapMidTransceiver = new Map();
+                        // Local stream for sending.
+                        this._sendStream = new MediaStream();
+                        // Whether a DataChannel m=application section has been created.
+                        this._hasDataChannelMediaSection = false;
+                        // Sending DataChannel id value counter. Incremented for each new DataChannel.
+                        this._nextSendSctpStreamId = 0;
+                        // Got transport local and remote parameters.
+                        this._transportReady = false;
+                    }
+                    /**
+                     * Creates a factory function.
+                     */
+                    static createFactory() {
+                        return () => new Safari12();
+                    }
+                    get name() {
+                        return 'Safari12';
+                    }
+                    close() {
+                        logger.debug('close()');
+                        // Close RTCPeerConnection.
+                        if (this._pc) {
+                            try {
+                                this._pc.close();
+                            } catch (error) {}
+                        }
+                    }
+                    async getNativeRtpCapabilities() {
+                        logger.debug('getNativeRtpCapabilities()');
+                        const pc = new RTCPeerConnection({
+                            iceServers: [],
+                            iceTransportPolicy: 'all',
+                            bundlePolicy: 'max-bundle',
+                            rtcpMuxPolicy: 'require',
+                        });
+                        try {
+                            pc.addTransceiver('audio');
+                            pc.addTransceiver('video');
+                            const offer = await pc.createOffer();
+                            try {
+                                pc.close();
+                            } catch (error) {}
+                            const sdpObject = sdpTransform.parse(offer.sdp);
+                            const nativeRtpCapabilities = sdpCommonUtils.extractRtpCapabilities({ sdpObject });
+                            return nativeRtpCapabilities;
+                        } catch (error) {
+                            try {
+                                pc.close();
+                            } catch (error2) {}
+                            throw error;
+                        }
+                    }
+                    async getNativeSctpCapabilities() {
+                        logger.debug('getNativeSctpCapabilities()');
+                        return {
+                            numStreams: SCTP_NUM_STREAMS,
+                        };
+                    }
+                    run({
+                        direction,
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        iceServers,
+                        iceTransportPolicy,
+                        additionalSettings,
+                        proprietaryConstraints,
+                        extendedRtpCapabilities,
+                    }) {
+                        logger.debug('run()');
+                        this._direction = direction;
+                        this._remoteSdp = new RemoteSdp_1.RemoteSdp({
+                            iceParameters,
+                            iceCandidates,
+                            dtlsParameters,
+                            sctpParameters,
+                        });
+                        this._sendingRtpParametersByKind = {
+                            audio: ortc.getSendingRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._sendingRemoteRtpParametersByKind = {
+                            audio: ortc.getSendingRemoteRtpParameters('audio', extendedRtpCapabilities),
+                            video: ortc.getSendingRemoteRtpParameters('video', extendedRtpCapabilities),
+                        };
+                        this._pc = new RTCPeerConnection(
+                            Object.assign(
+                                {
+                                    iceServers: iceServers || [],
+                                    iceTransportPolicy: iceTransportPolicy || 'all',
+                                    bundlePolicy: 'max-bundle',
+                                    rtcpMuxPolicy: 'require',
+                                },
+                                additionalSettings,
+                            ),
+                            proprietaryConstraints,
+                        );
+                        // Handle RTCPeerConnection connection status.
+                        this._pc.addEventListener('iceconnectionstatechange', () => {
+                            switch (this._pc.iceConnectionState) {
+                                case 'checking':
+                                    this.emit('@connectionstatechange', 'connecting');
+                                    break;
+                                case 'connected':
+                                case 'completed':
+                                    this.emit('@connectionstatechange', 'connected');
+                                    break;
+                                case 'failed':
+                                    this.emit('@connectionstatechange', 'failed');
+                                    break;
+                                case 'disconnected':
+                                    this.emit('@connectionstatechange', 'disconnected');
+                                    break;
+                                case 'closed':
+                                    this.emit('@connectionstatechange', 'closed');
+                                    break;
+                            }
+                        });
+                    }
+                    async updateIceServers(iceServers) {
+                        logger.debug('updateIceServers()');
+                        const configuration = this._pc.getConfiguration();
+                        configuration.iceServers = iceServers;
+                        this._pc.setConfiguration(configuration);
+                    }
+                    async restartIce(iceParameters) {
+                        logger.debug('restartIce()');
+                        // Provide the remote SDP handler with new remote ICE parameters.
+                        this._remoteSdp.updateIceParameters(iceParameters);
+                        if (!this._transportReady) return;
+                        if (this._direction === 'send') {
+                            const offer = await this._pc.createOffer({ iceRestart: true });
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                        } else {
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('restartIce() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            logger.debug('restartIce() | calling pc.setLocalDescription() [answer:%o]', answer);
+                            await this._pc.setLocalDescription(answer);
+                        }
+                    }
+                    async getTransportStats() {
+                        return this._pc.getStats();
+                    }
+                    async send({ track, encodings, codecOptions, codec }) {
+                        this._assertSendDirection();
+                        logger.debug('send() [kind:%s, track.id:%s]', track.kind, track.id);
+                        const sendingRtpParameters = utils.clone(this._sendingRtpParametersByKind[track.kind], {});
+                        // This may throw.
+                        sendingRtpParameters.codecs = ortc.reduceCodecs(sendingRtpParameters.codecs, codec);
+                        const sendingRemoteRtpParameters = utils.clone(
+                            this._sendingRemoteRtpParametersByKind[track.kind],
+                            {},
+                        );
+                        // This may throw.
+                        sendingRemoteRtpParameters.codecs = ortc.reduceCodecs(sendingRemoteRtpParameters.codecs, codec);
+                        const mediaSectionIdx = this._remoteSdp.getNextMediaSectionIdx();
+                        const transceiver = this._pc.addTransceiver(track, {
+                            direction: 'sendonly',
+                            streams: [this._sendStream],
+                        });
+                        let offer = await this._pc.createOffer();
+                        let localSdpObject = sdpTransform.parse(offer.sdp);
+                        let offerMediaObject;
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                        if (encodings && encodings.length > 1) {
+                            logger.debug('send() | enabling legacy simulcast');
+                            localSdpObject = sdpTransform.parse(offer.sdp);
+                            offerMediaObject = localSdpObject.media[mediaSectionIdx.idx];
+                            sdpUnifiedPlanUtils.addLegacySimulcast({
+                                offerMediaObject,
+                                numStreams: encodings.length,
+                            });
+                            offer = { type: 'offer', sdp: sdpTransform.write(localSdpObject) };
+                        }
+                        logger.debug('send() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        await this._pc.setLocalDescription(offer);
+                        // We can now get the transceiver.mid.
+                        const localId = transceiver.mid;
+                        // Set MID.
+                        sendingRtpParameters.mid = localId;
+                        localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        offerMediaObject = localSdpObject.media[mediaSectionIdx.idx];
+                        // Set RTCP CNAME.
+                        sendingRtpParameters.rtcp.cname = sdpCommonUtils.getCname({ offerMediaObject });
+                        // Set RTP encodings.
+                        sendingRtpParameters.encodings = sdpUnifiedPlanUtils.getRtpEncodings({ offerMediaObject });
+                        // Complete encodings with given values.
+                        if (encodings) {
+                            for (let idx = 0; idx < sendingRtpParameters.encodings.length; ++idx) {
+                                if (encodings[idx]) Object.assign(sendingRtpParameters.encodings[idx], encodings[idx]);
+                            }
+                        }
+                        // If VP8 or H264 and there is effective simulcast, add scalabilityMode to
+                        // each encoding.
+                        if (
+                            sendingRtpParameters.encodings.length > 1 &&
+                            (sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/vp8' ||
+                                sendingRtpParameters.codecs[0].mimeType.toLowerCase() === 'video/h264')
+                        ) {
+                            for (const encoding of sendingRtpParameters.encodings) {
+                                encoding.scalabilityMode = 'S1T3';
+                            }
+                        }
+                        this._remoteSdp.send({
+                            offerMediaObject,
+                            reuseMid: mediaSectionIdx.reuseMid,
+                            offerRtpParameters: sendingRtpParameters,
+                            answerRtpParameters: sendingRemoteRtpParameters,
+                            codecOptions,
+                        });
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('send() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                        // Store in the map.
+                        this._mapMidTransceiver.set(localId, transceiver);
+                        return {
+                            localId,
+                            rtpParameters: sendingRtpParameters,
+                            rtpSender: transceiver.sender,
+                        };
+                    }
+                    async stopSending(localId) {
+                        this._assertSendDirection();
+                        logger.debug('stopSending() [localId:%s]', localId);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        transceiver.sender.replaceTrack(null);
+                        this._pc.removeTrack(transceiver.sender);
+                        this._remoteSdp.closeMediaSection(transceiver.mid);
+                        const offer = await this._pc.createOffer();
+                        logger.debug('stopSending() | calling pc.setLocalDescription() [offer:%o]', offer);
+                        await this._pc.setLocalDescription(offer);
+                        const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopSending() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                        await this._pc.setRemoteDescription(answer);
+                    }
+                    async replaceTrack(localId, track) {
+                        this._assertSendDirection();
+                        if (track) {
+                            logger.debug('replaceTrack() [localId:%s, track.id:%s]', localId, track.id);
+                        } else {
+                            logger.debug('replaceTrack() [localId:%s, no track]', localId);
+                        }
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        await transceiver.sender.replaceTrack(track);
+                    }
+                    async setMaxSpatialLayer(localId, spatialLayer) {
+                        this._assertSendDirection();
+                        logger.debug('setMaxSpatialLayer() [localId:%s, spatialLayer:%s]', localId, spatialLayer);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        const parameters = transceiver.sender.getParameters();
+                        parameters.encodings.forEach((encoding, idx) => {
+                            if (idx <= spatialLayer) encoding.active = true;
+                            else encoding.active = false;
+                        });
+                        await transceiver.sender.setParameters(parameters);
+                    }
+                    async setRtpEncodingParameters(localId, params) {
+                        this._assertSendDirection();
+                        logger.debug('setRtpEncodingParameters() [localId:%s, params:%o]', localId, params);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        const parameters = transceiver.sender.getParameters();
+                        parameters.encodings.forEach((encoding, idx) => {
+                            parameters.encodings[idx] = Object.assign(Object.assign({}, encoding), params);
+                        });
+                        await transceiver.sender.setParameters(parameters);
+                    }
+                    async getSenderStats(localId) {
+                        this._assertSendDirection();
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        return transceiver.sender.getStats();
+                    }
+                    async sendDataChannel({ ordered, maxPacketLifeTime, maxRetransmits, label, protocol }) {
+                        this._assertSendDirection();
+                        const options = {
+                            negotiated: true,
+                            id: this._nextSendSctpStreamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('sendDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // Increase next id.
+                        this._nextSendSctpStreamId = ++this._nextSendSctpStreamId % SCTP_NUM_STREAMS.MIS;
+                        // If this is the first DataChannel we need to create the SDP answer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            const offer = await this._pc.createOffer();
+                            const localSdpObject = sdpTransform.parse(offer.sdp);
+                            const offerMediaObject = localSdpObject.media.find((m) => m.type === 'application');
+                            if (!this._transportReady)
+                                await this._setupTransport({ localDtlsRole: 'server', localSdpObject });
+                            logger.debug('sendDataChannel() | calling pc.setLocalDescription() [offer:%o]', offer);
+                            await this._pc.setLocalDescription(offer);
+                            this._remoteSdp.sendSctpAssociation({ offerMediaObject });
+                            const answer = { type: 'answer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('sendDataChannel() | calling pc.setRemoteDescription() [answer:%o]', answer);
+                            await this._pc.setRemoteDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        const sctpStreamParameters = {
+                            streamId: options.id,
+                            ordered: options.ordered,
+                            maxPacketLifeTime: options.maxPacketLifeTime,
+                            maxRetransmits: options.maxRetransmits,
+                        };
+                        return { dataChannel, sctpStreamParameters };
+                    }
+                    async receive({ trackId, kind, rtpParameters }) {
+                        this._assertRecvDirection();
+                        logger.debug('receive() [trackId:%s, kind:%s]', trackId, kind);
+                        const localId = rtpParameters.mid || String(this._mapMidTransceiver.size);
+                        this._remoteSdp.receive({
+                            mid: localId,
+                            kind,
+                            offerRtpParameters: rtpParameters,
+                            streamId: rtpParameters.rtcp.cname,
+                            trackId,
+                        });
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('receive() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        let answer = await this._pc.createAnswer();
+                        const localSdpObject = sdpTransform.parse(answer.sdp);
+                        const answerMediaObject = localSdpObject.media.find((m) => String(m.mid) === localId);
+                        // May need to modify codec parameters in the answer based on codec
+                        // parameters in the offer.
+                        sdpCommonUtils.applyCodecParameters({
+                            offerRtpParameters: rtpParameters,
+                            answerMediaObject,
+                        });
+                        answer = { type: 'answer', sdp: sdpTransform.write(localSdpObject) };
+                        if (!this._transportReady)
+                            await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                        logger.debug('receive() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                        const transceiver = this._pc.getTransceivers().find((t) => t.mid === localId);
+                        if (!transceiver) throw new Error('new RTCRtpTransceiver not found');
+                        // Store in the map.
+                        this._mapMidTransceiver.set(localId, transceiver);
+                        return {
+                            localId,
+                            track: transceiver.receiver.track,
+                            rtpReceiver: transceiver.receiver,
+                        };
+                    }
+                    async stopReceiving(localId) {
+                        this._assertRecvDirection();
+                        logger.debug('stopReceiving() [localId:%s]', localId);
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        this._remoteSdp.closeMediaSection(transceiver.mid);
+                        const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                        logger.debug('stopReceiving() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                        await this._pc.setRemoteDescription(offer);
+                        const answer = await this._pc.createAnswer();
+                        logger.debug('stopReceiving() | calling pc.setLocalDescription() [answer:%o]', answer);
+                        await this._pc.setLocalDescription(answer);
+                    }
+                    async getReceiverStats(localId) {
+                        this._assertRecvDirection();
+                        const transceiver = this._mapMidTransceiver.get(localId);
+                        if (!transceiver) throw new Error('associated RTCRtpTransceiver not found');
+                        return transceiver.receiver.getStats();
+                    }
+                    async receiveDataChannel({ sctpStreamParameters, label, protocol }) {
+                        this._assertRecvDirection();
+                        const { streamId, ordered, maxPacketLifeTime, maxRetransmits } = sctpStreamParameters;
+                        const options = {
+                            negotiated: true,
+                            id: streamId,
+                            ordered,
+                            maxPacketLifeTime,
+                            maxRetransmits,
+                            protocol,
+                        };
+                        logger.debug('receiveDataChannel() [options:%o]', options);
+                        const dataChannel = this._pc.createDataChannel(label, options);
+                        // If this is the first DataChannel we need to create the SDP offer with
+                        // m=application section.
+                        if (!this._hasDataChannelMediaSection) {
+                            this._remoteSdp.receiveSctpAssociation();
+                            const offer = { type: 'offer', sdp: this._remoteSdp.getSdp() };
+                            logger.debug('receiveDataChannel() | calling pc.setRemoteDescription() [offer:%o]', offer);
+                            await this._pc.setRemoteDescription(offer);
+                            const answer = await this._pc.createAnswer();
+                            if (!this._transportReady) {
+                                const localSdpObject = sdpTransform.parse(answer.sdp);
+                                await this._setupTransport({ localDtlsRole: 'client', localSdpObject });
+                            }
+                            logger.debug(
+                                'receiveDataChannel() | calling pc.setRemoteDescription() [answer:%o]',
+                                answer,
+                            );
+                            await this._pc.setLocalDescription(answer);
+                            this._hasDataChannelMediaSection = true;
+                        }
+                        return { dataChannel };
+                    }
+                    async _setupTransport({ localDtlsRole, localSdpObject }) {
+                        if (!localSdpObject) localSdpObject = sdpTransform.parse(this._pc.localDescription.sdp);
+                        // Get our local DTLS parameters.
+                        const dtlsParameters = sdpCommonUtils.extractDtlsParameters({ sdpObject: localSdpObject });
+                        // Set our DTLS role.
+                        dtlsParameters.role = localDtlsRole;
+                        // Update the remote DTLS role in the SDP.
+                        this._remoteSdp.updateDtlsRole(localDtlsRole === 'client' ? 'server' : 'client');
+                        // Need to tell the remote transport about our parameters.
+                        await this.safeEmitAsPromise('@connect', { dtlsParameters });
+                        this._transportReady = true;
+                    }
+                    _assertSendDirection() {
+                        if (this._direction !== 'send') {
+                            throw new Error('method can just be called for handlers with "send" direction');
+                        }
+                    }
+                    _assertRecvDirection() {
+                        if (this._direction !== 'recv') {
+                            throw new Error('method can just be called for handlers with "recv" direction');
+                        }
+                    }
+                }
+                exports.Safari12 = Safari12;
+            },
+            {
+                '../Logger': 13,
+                '../ortc': 36,
+                '../utils': 39,
+                './HandlerInterface': 25,
+                './sdp/RemoteSdp': 31,
+                './sdp/commonUtils': 32,
+                './sdp/unifiedPlanUtils': 34,
+                'sdp-transform': 44,
+            },
+        ],
+        29: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.mangleRtpParameters = exports.getCapabilities = void 0;
+                const utils = __importStar(require('../../utils'));
+                /**
+                 * Normalize ORTC based Edge's RTCRtpReceiver.getCapabilities() to produce a full
+                 * compliant ORTC RTCRtpCapabilities.
+                 */
+                function getCapabilities() {
+                    const nativeCaps = RTCRtpReceiver.getCapabilities();
+                    const caps = utils.clone(nativeCaps, {});
+                    for (const codec of caps.codecs) {
+                        // Rename numChannels to channels.
+                        codec.channels = codec.numChannels;
+                        delete codec.numChannels;
+                        // Add mimeType.
+                        codec.mimeType = codec.mimeType || `${codec.kind}/${codec.name}`;
+                        // NOTE: Edge sets some numeric parameters as string rather than number. Fix them.
+                        if (codec.parameters) {
+                            const parameters = codec.parameters;
+                            if (parameters.apt) parameters.apt = Number(parameters.apt);
+                            if (parameters['packetization-mode'])
+                                parameters['packetization-mode'] = Number(parameters['packetization-mode']);
+                        }
+                        // Delete emty parameter String in rtcpFeedback.
+                        for (const feedback of codec.rtcpFeedback || []) {
+                            if (!feedback.parameter) feedback.parameter = '';
+                        }
+                    }
+                    return caps;
+                }
+                exports.getCapabilities = getCapabilities;
+                /**
+                 * Generate RTCRtpParameters as ORTC based Edge likes.
+                 */
+                function mangleRtpParameters(rtpParameters) {
+                    const params = utils.clone(rtpParameters, {});
+                    // Rename mid to muxId.
+                    if (params.mid) {
+                        params.muxId = params.mid;
+                        delete params.mid;
+                    }
+                    for (const codec of params.codecs) {
+                        // Rename channels to numChannels.
+                        if (codec.channels) {
+                            codec.numChannels = codec.channels;
+                            delete codec.channels;
+                        }
+                        // Add codec.name (requried by Edge).
+                        if (codec.mimeType && !codec.name) codec.name = codec.mimeType.split('/')[1];
+                        // Remove mimeType.
+                        delete codec.mimeType;
+                    }
+                    return params;
+                }
+                exports.mangleRtpParameters = mangleRtpParameters;
+            },
+            { '../../utils': 39 },
+        ],
+        30: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.OfferMediaSection = exports.AnswerMediaSection = exports.MediaSection = void 0;
+                const utils = __importStar(require('../../utils'));
+                class MediaSection {
+                    constructor({ iceParameters, iceCandidates, dtlsParameters, planB = false }) {
+                        this._mediaObject = {};
+                        this._planB = planB;
+                        if (iceParameters) {
+                            this.setIceParameters(iceParameters);
+                        }
+                        if (iceCandidates) {
+                            this._mediaObject.candidates = [];
+                            for (const candidate of iceCandidates) {
+                                const candidateObject = {};
+                                // mediasoup does mandates rtcp-mux so candidates component is always
+                                // RTP (1).
+                                candidateObject.component = 1;
+                                candidateObject.foundation = candidate.foundation;
+                                candidateObject.ip = candidate.ip;
+                                candidateObject.port = candidate.port;
+                                candidateObject.priority = candidate.priority;
+                                candidateObject.transport = candidate.protocol;
+                                candidateObject.type = candidate.type;
+                                if (candidate.tcpType) candidateObject.tcptype = candidate.tcpType;
+                                this._mediaObject.candidates.push(candidateObject);
+                            }
+                            this._mediaObject.endOfCandidates = 'end-of-candidates';
+                            this._mediaObject.iceOptions = 'renomination';
+                        }
+                        if (dtlsParameters) {
+                            this.setDtlsRole(dtlsParameters.role);
+                        }
+                    }
+                    get mid() {
+                        return String(this._mediaObject.mid);
+                    }
+                    get closed() {
+                        return this._mediaObject.port === 0;
+                    }
+                    getObject() {
+                        return this._mediaObject;
+                    }
+                    setIceParameters(iceParameters) {
+                        this._mediaObject.iceUfrag = iceParameters.usernameFragment;
+                        this._mediaObject.icePwd = iceParameters.password;
+                    }
+                    disable() {
+                        this._mediaObject.direction = 'inactive';
+                        delete this._mediaObject.ext;
+                        delete this._mediaObject.ssrcs;
+                        delete this._mediaObject.ssrcGroups;
+                        delete this._mediaObject.simulcast;
+                        delete this._mediaObject.simulcast_03;
+                        delete this._mediaObject.rids;
+                    }
+                    close() {
+                        this._mediaObject.direction = 'inactive';
+                        this._mediaObject.port = 0;
+                        delete this._mediaObject.ext;
+                        delete this._mediaObject.ssrcs;
+                        delete this._mediaObject.ssrcGroups;
+                        delete this._mediaObject.simulcast;
+                        delete this._mediaObject.simulcast_03;
+                        delete this._mediaObject.rids;
+                        delete this._mediaObject.extmapAllowMixed;
+                    }
+                }
+                exports.MediaSection = MediaSection;
+                class AnswerMediaSection extends MediaSection {
+                    constructor({
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        plainRtpParameters,
+                        planB = false,
+                        offerMediaObject,
+                        offerRtpParameters,
+                        answerRtpParameters,
+                        codecOptions,
+                        extmapAllowMixed = false,
+                    }) {
+                        super({ iceParameters, iceCandidates, dtlsParameters, planB });
+                        this._mediaObject.mid = String(offerMediaObject.mid);
+                        this._mediaObject.type = offerMediaObject.type;
+                        this._mediaObject.protocol = offerMediaObject.protocol;
+                        if (!plainRtpParameters) {
+                            this._mediaObject.connection = { ip: '127.0.0.1', version: 4 };
+                            this._mediaObject.port = 7;
+                        } else {
+                            this._mediaObject.connection = {
+                                ip: plainRtpParameters.ip,
+                                version: plainRtpParameters.ipVersion,
+                            };
+                            this._mediaObject.port = plainRtpParameters.port;
+                        }
+                        switch (offerMediaObject.type) {
+                            case 'audio':
+                            case 'video': {
+                                this._mediaObject.direction = 'recvonly';
+                                this._mediaObject.rtp = [];
+                                this._mediaObject.rtcpFb = [];
+                                this._mediaObject.fmtp = [];
+                                for (const codec of answerRtpParameters.codecs) {
+                                    const rtp = {
+                                        payload: codec.payloadType,
+                                        codec: getCodecName(codec),
+                                        rate: codec.clockRate,
+                                    };
+                                    if (codec.channels > 1) rtp.encoding = codec.channels;
+                                    this._mediaObject.rtp.push(rtp);
+                                    const codecParameters = utils.clone(codec.parameters, {});
+                                    if (codecOptions) {
+                                        const {
+                                            opusStereo,
+                                            opusFec,
+                                            opusDtx,
+                                            opusMaxPlaybackRate,
+                                            opusMaxAverageBitrate,
+                                            opusPtime,
+                                            videoGoogleStartBitrate,
+                                            videoGoogleMaxBitrate,
+                                            videoGoogleMinBitrate,
+                                        } = codecOptions;
+                                        const offerCodec = offerRtpParameters.codecs.find(
+                                            (c) => c.payloadType === codec.payloadType,
+                                        );
+                                        switch (codec.mimeType.toLowerCase()) {
+                                            case 'audio/opus': {
+                                                if (opusStereo !== undefined) {
+                                                    offerCodec.parameters['sprop-stereo'] = opusStereo ? 1 : 0;
+                                                    codecParameters.stereo = opusStereo ? 1 : 0;
+                                                }
+                                                if (opusFec !== undefined) {
+                                                    offerCodec.parameters.useinbandfec = opusFec ? 1 : 0;
+                                                    codecParameters.useinbandfec = opusFec ? 1 : 0;
+                                                }
+                                                if (opusDtx !== undefined) {
+                                                    offerCodec.parameters.usedtx = opusDtx ? 1 : 0;
+                                                    codecParameters.usedtx = opusDtx ? 1 : 0;
+                                                }
+                                                if (opusMaxPlaybackRate !== undefined) {
+                                                    codecParameters.maxplaybackrate = opusMaxPlaybackRate;
+                                                }
+                                                if (opusMaxAverageBitrate !== undefined) {
+                                                    codecParameters.maxaveragebitrate = opusMaxAverageBitrate;
+                                                }
+                                                if (opusPtime !== undefined) {
+                                                    offerCodec.parameters.ptime = opusPtime;
+                                                    codecParameters.ptime = opusPtime;
+                                                }
+                                                break;
+                                            }
+                                            case 'video/vp8':
+                                            case 'video/vp9':
+                                            case 'video/h264':
+                                            case 'video/h265': {
+                                                if (videoGoogleStartBitrate !== undefined)
+                                                    codecParameters['x-google-start-bitrate'] = videoGoogleStartBitrate;
+                                                if (videoGoogleMaxBitrate !== undefined)
+                                                    codecParameters['x-google-max-bitrate'] = videoGoogleMaxBitrate;
+                                                if (videoGoogleMinBitrate !== undefined)
+                                                    codecParameters['x-google-min-bitrate'] = videoGoogleMinBitrate;
+                                                break;
+                                            }
+                                        }
+                                    }
+                                    const fmtp = {
+                                        payload: codec.payloadType,
+                                        config: '',
+                                    };
+                                    for (const key of Object.keys(codecParameters)) {
+                                        if (fmtp.config) fmtp.config += ';';
+                                        fmtp.config += `${key}=${codecParameters[key]}`;
+                                    }
+                                    if (fmtp.config) this._mediaObject.fmtp.push(fmtp);
+                                    for (const fb of codec.rtcpFeedback) {
+                                        this._mediaObject.rtcpFb.push({
+                                            payload: codec.payloadType,
+                                            type: fb.type,
+                                            subtype: fb.parameter,
+                                        });
+                                    }
+                                }
+                                this._mediaObject.payloads = answerRtpParameters.codecs
+                                    .map((codec) => codec.payloadType)
+                                    .join(' ');
+                                this._mediaObject.ext = [];
+                                for (const ext of answerRtpParameters.headerExtensions) {
+                                    // Don't add a header extension if not present in the offer.
+                                    const found = (offerMediaObject.ext || []).some(
+                                        (localExt) => localExt.uri === ext.uri,
+                                    );
+                                    if (!found) continue;
+                                    this._mediaObject.ext.push({
+                                        uri: ext.uri,
+                                        value: ext.id,
+                                    });
+                                }
+                                // Allow both 1 byte and 2 bytes length header extensions.
+                                if (extmapAllowMixed && offerMediaObject.extmapAllowMixed === 'extmap-allow-mixed') {
+                                    this._mediaObject.extmapAllowMixed = 'extmap-allow-mixed';
+                                }
+                                // Simulcast.
+                                if (offerMediaObject.simulcast) {
+                                    this._mediaObject.simulcast = {
+                                        dir1: 'recv',
+                                        list1: offerMediaObject.simulcast.list1,
+                                    };
+                                    this._mediaObject.rids = [];
+                                    for (const rid of offerMediaObject.rids || []) {
+                                        if (rid.direction !== 'send') continue;
+                                        this._mediaObject.rids.push({
+                                            id: rid.id,
+                                            direction: 'recv',
+                                        });
+                                    }
+                                }
+                                // Simulcast (draft version 03).
+                                else if (offerMediaObject.simulcast_03) {
+                                    // eslint-disable-next-line camelcase
+                                    this._mediaObject.simulcast_03 = {
+                                        value: offerMediaObject.simulcast_03.value.replace(/send/g, 'recv'),
+                                    };
+                                    this._mediaObject.rids = [];
+                                    for (const rid of offerMediaObject.rids || []) {
+                                        if (rid.direction !== 'send') continue;
+                                        this._mediaObject.rids.push({
+                                            id: rid.id,
+                                            direction: 'recv',
+                                        });
+                                    }
+                                }
+                                this._mediaObject.rtcpMux = 'rtcp-mux';
+                                this._mediaObject.rtcpRsize = 'rtcp-rsize';
+                                if (this._planB && this._mediaObject.type === 'video')
+                                    this._mediaObject.xGoogleFlag = 'conference';
+                                break;
+                            }
+                            case 'application': {
+                                // New spec.
+                                if (typeof offerMediaObject.sctpPort === 'number') {
+                                    this._mediaObject.payloads = 'webrtc-datachannel';
+                                    this._mediaObject.sctpPort = sctpParameters.port;
+                                    this._mediaObject.maxMessageSize = sctpParameters.maxMessageSize;
+                                }
+                                // Old spec.
+                                else if (offerMediaObject.sctpmap) {
+                                    this._mediaObject.payloads = sctpParameters.port;
+                                    this._mediaObject.sctpmap = {
+                                        app: 'webrtc-datachannel',
+                                        sctpmapNumber: sctpParameters.port,
+                                        maxMessageSize: sctpParameters.maxMessageSize,
+                                    };
+                                }
+                                break;
+                            }
+                        }
+                    }
+                    setDtlsRole(role) {
+                        switch (role) {
+                            case 'client':
+                                this._mediaObject.setup = 'active';
+                                break;
+                            case 'server':
+                                this._mediaObject.setup = 'passive';
+                                break;
+                            case 'auto':
+                                this._mediaObject.setup = 'actpass';
+                                break;
+                        }
+                    }
+                }
+                exports.AnswerMediaSection = AnswerMediaSection;
+                class OfferMediaSection extends MediaSection {
+                    constructor({
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        plainRtpParameters,
+                        planB = false,
+                        mid,
+                        kind,
+                        offerRtpParameters,
+                        streamId,
+                        trackId,
+                        oldDataChannelSpec = false,
+                    }) {
+                        super({ iceParameters, iceCandidates, dtlsParameters, planB });
+                        this._mediaObject.mid = String(mid);
+                        this._mediaObject.type = kind;
+                        if (!plainRtpParameters) {
+                            this._mediaObject.connection = { ip: '127.0.0.1', version: 4 };
+                            if (!sctpParameters) this._mediaObject.protocol = 'UDP/TLS/RTP/SAVPF';
+                            else this._mediaObject.protocol = 'UDP/DTLS/SCTP';
+                            this._mediaObject.port = 7;
+                        } else {
+                            this._mediaObject.connection = {
+                                ip: plainRtpParameters.ip,
+                                version: plainRtpParameters.ipVersion,
+                            };
+                            this._mediaObject.protocol = 'RTP/AVP';
+                            this._mediaObject.port = plainRtpParameters.port;
+                        }
+                        switch (kind) {
+                            case 'audio':
+                            case 'video': {
+                                this._mediaObject.direction = 'sendonly';
+                                this._mediaObject.rtp = [];
+                                this._mediaObject.rtcpFb = [];
+                                this._mediaObject.fmtp = [];
+                                if (!this._planB) this._mediaObject.msid = `${streamId || '-'} ${trackId}`;
+                                for (const codec of offerRtpParameters.codecs) {
+                                    const rtp = {
+                                        payload: codec.payloadType,
+                                        codec: getCodecName(codec),
+                                        rate: codec.clockRate,
+                                    };
+                                    if (codec.channels > 1) rtp.encoding = codec.channels;
+                                    this._mediaObject.rtp.push(rtp);
+                                    const fmtp = {
+                                        payload: codec.payloadType,
+                                        config: '',
+                                    };
+                                    for (const key of Object.keys(codec.parameters)) {
+                                        if (fmtp.config) fmtp.config += ';';
+                                        fmtp.config += `${key}=${codec.parameters[key]}`;
+                                    }
+                                    if (fmtp.config) this._mediaObject.fmtp.push(fmtp);
+                                    for (const fb of codec.rtcpFeedback) {
+                                        this._mediaObject.rtcpFb.push({
+                                            payload: codec.payloadType,
+                                            type: fb.type,
+                                            subtype: fb.parameter,
+                                        });
+                                    }
+                                }
+                                this._mediaObject.payloads = offerRtpParameters.codecs
+                                    .map((codec) => codec.payloadType)
+                                    .join(' ');
+                                this._mediaObject.ext = [];
+                                for (const ext of offerRtpParameters.headerExtensions) {
+                                    this._mediaObject.ext.push({
+                                        uri: ext.uri,
+                                        value: ext.id,
+                                    });
+                                }
+                                this._mediaObject.rtcpMux = 'rtcp-mux';
+                                this._mediaObject.rtcpRsize = 'rtcp-rsize';
+                                const encoding = offerRtpParameters.encodings[0];
+                                const ssrc = encoding.ssrc;
+                                const rtxSsrc = encoding.rtx && encoding.rtx.ssrc ? encoding.rtx.ssrc : undefined;
+                                this._mediaObject.ssrcs = [];
+                                this._mediaObject.ssrcGroups = [];
+                                if (offerRtpParameters.rtcp.cname) {
+                                    this._mediaObject.ssrcs.push({
+                                        id: ssrc,
+                                        attribute: 'cname',
+                                        value: offerRtpParameters.rtcp.cname,
+                                    });
+                                }
+                                if (this._planB) {
+                                    this._mediaObject.ssrcs.push({
+                                        id: ssrc,
+                                        attribute: 'msid',
+                                        value: `${streamId || '-'} ${trackId}`,
+                                    });
+                                }
+                                if (rtxSsrc) {
+                                    if (offerRtpParameters.rtcp.cname) {
+                                        this._mediaObject.ssrcs.push({
+                                            id: rtxSsrc,
+                                            attribute: 'cname',
+                                            value: offerRtpParameters.rtcp.cname,
+                                        });
+                                    }
+                                    if (this._planB) {
+                                        this._mediaObject.ssrcs.push({
+                                            id: rtxSsrc,
+                                            attribute: 'msid',
+                                            value: `${streamId || '-'} ${trackId}`,
+                                        });
+                                    }
+                                    // Associate original and retransmission SSRCs.
+                                    this._mediaObject.ssrcGroups.push({
+                                        semantics: 'FID',
+                                        ssrcs: `${ssrc} ${rtxSsrc}`,
+                                    });
+                                }
+                                break;
+                            }
+                            case 'application': {
+                                // New spec.
+                                if (!oldDataChannelSpec) {
+                                    this._mediaObject.payloads = 'webrtc-datachannel';
+                                    this._mediaObject.sctpPort = sctpParameters.port;
+                                    this._mediaObject.maxMessageSize = sctpParameters.maxMessageSize;
+                                }
+                                // Old spec.
+                                else {
+                                    this._mediaObject.payloads = sctpParameters.port;
+                                    this._mediaObject.sctpmap = {
+                                        app: 'webrtc-datachannel',
+                                        sctpmapNumber: sctpParameters.port,
+                                        maxMessageSize: sctpParameters.maxMessageSize,
+                                    };
+                                }
+                                break;
+                            }
+                        }
+                    }
+                    // eslint-disable-next-line @typescript-eslint/no-unused-vars
+                    setDtlsRole(role) {
+                        // Always 'actpass'.
+                        this._mediaObject.setup = 'actpass';
+                    }
+                    planBReceive({ offerRtpParameters, streamId, trackId }) {
+                        const encoding = offerRtpParameters.encodings[0];
+                        const ssrc = encoding.ssrc;
+                        const rtxSsrc = encoding.rtx && encoding.rtx.ssrc ? encoding.rtx.ssrc : undefined;
+                        const payloads = this._mediaObject.payloads.split(' ');
+                        for (const codec of offerRtpParameters.codecs) {
+                            if (payloads.includes(String(codec.payloadType))) {
+                                continue;
+                            }
+                            const rtp = {
+                                payload: codec.payloadType,
+                                codec: getCodecName(codec),
+                                rate: codec.clockRate,
+                            };
+                            if (codec.channels > 1) rtp.encoding = codec.channels;
+                            this._mediaObject.rtp.push(rtp);
+                            const fmtp = {
+                                payload: codec.payloadType,
+                                config: '',
+                            };
+                            for (const key of Object.keys(codec.parameters)) {
+                                if (fmtp.config) fmtp.config += ';';
+                                fmtp.config += `${key}=${codec.parameters[key]}`;
+                            }
+                            if (fmtp.config) this._mediaObject.fmtp.push(fmtp);
+                            for (const fb of codec.rtcpFeedback) {
+                                this._mediaObject.rtcpFb.push({
+                                    payload: codec.payloadType,
+                                    type: fb.type,
+                                    subtype: fb.parameter,
+                                });
+                            }
+                        }
+                        this._mediaObject.payloads += ` ${offerRtpParameters.codecs
+                            .filter((codec) => !this._mediaObject.payloads.includes(codec.payloadType))
+                            .map((codec) => codec.payloadType)
+                            .join(' ')}`;
+                        this._mediaObject.payloads = this._mediaObject.payloads.trim();
+                        if (offerRtpParameters.rtcp.cname) {
+                            this._mediaObject.ssrcs.push({
+                                id: ssrc,
+                                attribute: 'cname',
+                                value: offerRtpParameters.rtcp.cname,
+                            });
+                        }
+                        this._mediaObject.ssrcs.push({
+                            id: ssrc,
+                            attribute: 'msid',
+                            value: `${streamId || '-'} ${trackId}`,
+                        });
+                        if (rtxSsrc) {
+                            if (offerRtpParameters.rtcp.cname) {
+                                this._mediaObject.ssrcs.push({
+                                    id: rtxSsrc,
+                                    attribute: 'cname',
+                                    value: offerRtpParameters.rtcp.cname,
+                                });
+                            }
+                            this._mediaObject.ssrcs.push({
+                                id: rtxSsrc,
+                                attribute: 'msid',
+                                value: `${streamId || '-'} ${trackId}`,
+                            });
+                            // Associate original and retransmission SSRCs.
+                            this._mediaObject.ssrcGroups.push({
+                                semantics: 'FID',
+                                ssrcs: `${ssrc} ${rtxSsrc}`,
+                            });
+                        }
+                    }
+                    planBStopReceiving({ offerRtpParameters }) {
+                        const encoding = offerRtpParameters.encodings[0];
+                        const ssrc = encoding.ssrc;
+                        const rtxSsrc = encoding.rtx && encoding.rtx.ssrc ? encoding.rtx.ssrc : undefined;
+                        this._mediaObject.ssrcs = this._mediaObject.ssrcs.filter(
+                            (s) => s.id !== ssrc && s.id !== rtxSsrc,
+                        );
+                        if (rtxSsrc) {
+                            this._mediaObject.ssrcGroups = this._mediaObject.ssrcGroups.filter(
+                                (group) => group.ssrcs !== `${ssrc} ${rtxSsrc}`,
+                            );
+                        }
+                    }
+                }
+                exports.OfferMediaSection = OfferMediaSection;
+                function getCodecName(codec) {
+                    const MimeTypeRegex = new RegExp('^(audio|video)/(.+)', 'i');
+                    const mimeTypeMatch = MimeTypeRegex.exec(codec.mimeType);
+                    if (!mimeTypeMatch) throw new TypeError('invalid codec.mimeType');
+                    return mimeTypeMatch[2];
+                }
+            },
+            { '../../utils': 39 },
+        ],
+        31: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.RemoteSdp = void 0;
+                const sdpTransform = __importStar(require('sdp-transform'));
+                const Logger_1 = require('../../Logger');
+                const MediaSection_1 = require('./MediaSection');
+                const logger = new Logger_1.Logger('RemoteSdp');
+                class RemoteSdp {
+                    constructor({
+                        iceParameters,
+                        iceCandidates,
+                        dtlsParameters,
+                        sctpParameters,
+                        plainRtpParameters,
+                        planB = false,
+                    }) {
+                        // MediaSection instances with same order as in the SDP.
+                        this._mediaSections = [];
+                        // MediaSection indices indexed by MID.
+                        this._midToIndex = new Map();
+                        this._iceParameters = iceParameters;
+                        this._iceCandidates = iceCandidates;
+                        this._dtlsParameters = dtlsParameters;
+                        this._sctpParameters = sctpParameters;
+                        this._plainRtpParameters = plainRtpParameters;
+                        this._planB = planB;
+                        this._sdpObject = {
+                            version: 0,
+                            origin: {
+                                address: '0.0.0.0',
+                                ipVer: 4,
+                                netType: 'IN',
+                                sessionId: 10000,
+                                sessionVersion: 0,
+                                username: 'mediasoup-client',
+                            },
+                            name: '-',
+                            timing: { start: 0, stop: 0 },
+                            media: [],
+                        };
+                        // If ICE parameters are given, add ICE-Lite indicator.
+                        if (iceParameters && iceParameters.iceLite) {
+                            this._sdpObject.icelite = 'ice-lite';
+                        }
+                        // If DTLS parameters are given, assume WebRTC and BUNDLE.
+                        if (dtlsParameters) {
+                            this._sdpObject.msidSemantic = { semantic: 'WMS', token: '*' };
+                            // NOTE: We take the latest fingerprint.
+                            const numFingerprints = this._dtlsParameters.fingerprints.length;
+                            this._sdpObject.fingerprint = {
+                                type: dtlsParameters.fingerprints[numFingerprints - 1].algorithm,
+                                hash: dtlsParameters.fingerprints[numFingerprints - 1].value,
+                            };
+                            this._sdpObject.groups = [{ type: 'BUNDLE', mids: '' }];
+                        }
+                        // If there are plain RPT parameters, override SDP origin.
+                        if (plainRtpParameters) {
+                            this._sdpObject.origin.address = plainRtpParameters.ip;
+                            this._sdpObject.origin.ipVer = plainRtpParameters.ipVersion;
+                        }
+                    }
+                    updateIceParameters(iceParameters) {
+                        logger.debug('updateIceParameters() [iceParameters:%o]', iceParameters);
+                        this._iceParameters = iceParameters;
+                        this._sdpObject.icelite = iceParameters.iceLite ? 'ice-lite' : undefined;
+                        for (const mediaSection of this._mediaSections) {
+                            mediaSection.setIceParameters(iceParameters);
+                        }
+                    }
+                    updateDtlsRole(role) {
+                        logger.debug('updateDtlsRole() [role:%s]', role);
+                        this._dtlsParameters.role = role;
+                        for (const mediaSection of this._mediaSections) {
+                            mediaSection.setDtlsRole(role);
+                        }
+                    }
+                    getNextMediaSectionIdx() {
+                        // If a closed media section is found, return its index.
+                        for (let idx = 0; idx < this._mediaSections.length; ++idx) {
+                            const mediaSection = this._mediaSections[idx];
+                            if (mediaSection.closed) return { idx, reuseMid: mediaSection.mid };
+                        }
+                        // If no closed media section is found, return next one.
+                        return { idx: this._mediaSections.length };
+                    }
+                    send({
+                        offerMediaObject,
+                        reuseMid,
+                        offerRtpParameters,
+                        answerRtpParameters,
+                        codecOptions,
+                        extmapAllowMixed = false,
+                    }) {
+                        const mediaSection = new MediaSection_1.AnswerMediaSection({
+                            iceParameters: this._iceParameters,
+                            iceCandidates: this._iceCandidates,
+                            dtlsParameters: this._dtlsParameters,
+                            plainRtpParameters: this._plainRtpParameters,
+                            planB: this._planB,
+                            offerMediaObject,
+                            offerRtpParameters,
+                            answerRtpParameters,
+                            codecOptions,
+                            extmapAllowMixed,
+                        });
+                        // Unified-Plan with closed media section replacement.
+                        if (reuseMid) {
+                            this._replaceMediaSection(mediaSection, reuseMid);
+                        }
+                        // Unified-Plan or Plan-B with different media kind.
+                        else if (!this._midToIndex.has(mediaSection.mid)) {
+                            this._addMediaSection(mediaSection);
+                        }
+                        // Plan-B with same media kind.
+                        else {
+                            this._replaceMediaSection(mediaSection);
+                        }
+                    }
+                    receive({ mid, kind, offerRtpParameters, streamId, trackId }) {
+                        const idx = this._midToIndex.get(mid);
+                        let mediaSection;
+                        if (idx !== undefined) mediaSection = this._mediaSections[idx];
+                        // Unified-Plan or different media kind.
+                        if (!mediaSection) {
+                            mediaSection = new MediaSection_1.OfferMediaSection({
+                                iceParameters: this._iceParameters,
+                                iceCandidates: this._iceCandidates,
+                                dtlsParameters: this._dtlsParameters,
+                                plainRtpParameters: this._plainRtpParameters,
+                                planB: this._planB,
+                                mid,
+                                kind,
+                                offerRtpParameters,
+                                streamId,
+                                trackId,
+                            });
+                            // Let's try to recycle a closed media section (if any).
+                            // NOTE: Yes, we can recycle a closed m=audio section with a new m=video.
+                            const oldMediaSection = this._mediaSections.find((m) => m.closed);
+                            if (oldMediaSection) {
+                                this._replaceMediaSection(mediaSection, oldMediaSection.mid);
+                            } else {
+                                this._addMediaSection(mediaSection);
+                            }
+                        }
+                        // Plan-B.
+                        else {
+                            mediaSection.planBReceive({ offerRtpParameters, streamId, trackId });
+                            this._replaceMediaSection(mediaSection);
+                        }
+                    }
+                    disableMediaSection(mid) {
+                        const idx = this._midToIndex.get(mid);
+                        if (idx === undefined) {
+                            throw new Error(`no media section found with mid '${mid}'`);
+                        }
+                        const mediaSection = this._mediaSections[idx];
+                        mediaSection.disable();
+                    }
+                    closeMediaSection(mid) {
+                        const idx = this._midToIndex.get(mid);
+                        if (idx === undefined) {
+                            throw new Error(`no media section found with mid '${mid}'`);
+                        }
+                        const mediaSection = this._mediaSections[idx];
+                        // NOTE: Closing the first m section is a pain since it invalidates the
+                        // bundled transport, so let's avoid it.
+                        if (mid === this._firstMid) {
+                            logger.debug(
+                                'closeMediaSection() | cannot close first media section, disabling it instead [mid:%s]',
+                                mid,
+                            );
+                            this.disableMediaSection(mid);
+                            return;
+                        }
+                        mediaSection.close();
+                        // Regenerate BUNDLE mids.
+                        this._regenerateBundleMids();
+                    }
+                    planBStopReceiving({ mid, offerRtpParameters }) {
+                        const idx = this._midToIndex.get(mid);
+                        if (idx === undefined) {
+                            throw new Error(`no media section found with mid '${mid}'`);
+                        }
+                        const mediaSection = this._mediaSections[idx];
+                        mediaSection.planBStopReceiving({ offerRtpParameters });
+                        this._replaceMediaSection(mediaSection);
+                    }
+                    sendSctpAssociation({ offerMediaObject }) {
+                        const mediaSection = new MediaSection_1.AnswerMediaSection({
+                            iceParameters: this._iceParameters,
+                            iceCandidates: this._iceCandidates,
+                            dtlsParameters: this._dtlsParameters,
+                            sctpParameters: this._sctpParameters,
+                            plainRtpParameters: this._plainRtpParameters,
+                            offerMediaObject,
+                        });
+                        this._addMediaSection(mediaSection);
+                    }
+                    receiveSctpAssociation({ oldDataChannelSpec = false } = {}) {
+                        const mediaSection = new MediaSection_1.OfferMediaSection({
+                            iceParameters: this._iceParameters,
+                            iceCandidates: this._iceCandidates,
+                            dtlsParameters: this._dtlsParameters,
+                            sctpParameters: this._sctpParameters,
+                            plainRtpParameters: this._plainRtpParameters,
+                            mid: 'datachannel',
+                            kind: 'application',
+                            oldDataChannelSpec,
+                        });
+                        this._addMediaSection(mediaSection);
+                    }
+                    getSdp() {
+                        // Increase SDP version.
+                        this._sdpObject.origin.sessionVersion++;
+                        return sdpTransform.write(this._sdpObject);
+                    }
+                    _addMediaSection(newMediaSection) {
+                        if (!this._firstMid) this._firstMid = newMediaSection.mid;
+                        // Add to the vector.
+                        this._mediaSections.push(newMediaSection);
+                        // Add to the map.
+                        this._midToIndex.set(newMediaSection.mid, this._mediaSections.length - 1);
+                        // Add to the SDP object.
+                        this._sdpObject.media.push(newMediaSection.getObject());
+                        // Regenerate BUNDLE mids.
+                        this._regenerateBundleMids();
+                    }
+                    _replaceMediaSection(newMediaSection, reuseMid) {
+                        // Store it in the map.
+                        if (typeof reuseMid === 'string') {
+                            const idx = this._midToIndex.get(reuseMid);
+                            if (idx === undefined) {
+                                throw new Error(`no media section found for reuseMid '${reuseMid}'`);
+                            }
+                            const oldMediaSection = this._mediaSections[idx];
+                            // Replace the index in the vector with the new media section.
+                            this._mediaSections[idx] = newMediaSection;
+                            // Update the map.
+                            this._midToIndex.delete(oldMediaSection.mid);
+                            this._midToIndex.set(newMediaSection.mid, idx);
+                            // Update the SDP object.
+                            this._sdpObject.media[idx] = newMediaSection.getObject();
+                            // Regenerate BUNDLE mids.
+                            this._regenerateBundleMids();
+                        } else {
+                            const idx = this._midToIndex.get(newMediaSection.mid);
+                            if (idx === undefined) {
+                                throw new Error(`no media section found with mid '${newMediaSection.mid}'`);
+                            }
+                            // Replace the index in the vector with the new media section.
+                            this._mediaSections[idx] = newMediaSection;
+                            // Update the SDP object.
+                            this._sdpObject.media[idx] = newMediaSection.getObject();
+                        }
+                    }
+                    _regenerateBundleMids() {
+                        if (!this._dtlsParameters) return;
+                        this._sdpObject.groups[0].mids = this._mediaSections
+                            .filter((mediaSection) => !mediaSection.closed)
+                            .map((mediaSection) => mediaSection.mid)
+                            .join(' ');
+                    }
+                }
+                exports.RemoteSdp = RemoteSdp;
+            },
+            { '../../Logger': 13, './MediaSection': 30, 'sdp-transform': 44 },
+        ],
+        32: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.applyCodecParameters =
+                    exports.getCname =
+                    exports.extractDtlsParameters =
+                    exports.extractRtpCapabilities =
+                        void 0;
+                const sdpTransform = __importStar(require('sdp-transform'));
+                function extractRtpCapabilities({ sdpObject }) {
+                    // Map of RtpCodecParameters indexed by payload type.
+                    const codecsMap = new Map();
+                    // Array of RtpHeaderExtensions.
+                    const headerExtensions = [];
+                    // Whether a m=audio/video section has been already found.
+                    let gotAudio = false;
+                    let gotVideo = false;
+                    for (const m of sdpObject.media) {
+                        const kind = m.type;
+                        switch (kind) {
+                            case 'audio': {
+                                if (gotAudio) continue;
+                                gotAudio = true;
+                                break;
+                            }
+                            case 'video': {
+                                if (gotVideo) continue;
+                                gotVideo = true;
+                                break;
+                            }
+                            default: {
+                                continue;
+                            }
+                        }
+                        // Get codecs.
+                        for (const rtp of m.rtp) {
+                            const codec = {
+                                kind: kind,
+                                mimeType: `${kind}/${rtp.codec}`,
+                                preferredPayloadType: rtp.payload,
+                                clockRate: rtp.rate,
+                                channels: rtp.encoding,
+                                parameters: {},
+                                rtcpFeedback: [],
+                            };
+                            codecsMap.set(codec.preferredPayloadType, codec);
+                        }
+                        // Get codec parameters.
+                        for (const fmtp of m.fmtp || []) {
+                            const parameters = sdpTransform.parseParams(fmtp.config);
+                            const codec = codecsMap.get(fmtp.payload);
+                            if (!codec) continue;
+                            // Specials case to convert parameter value to string.
+                            if (parameters && parameters.hasOwnProperty('profile-level-id'))
+                                parameters['profile-level-id'] = String(parameters['profile-level-id']);
+                            codec.parameters = parameters;
+                        }
+                        // Get RTCP feedback for each codec.
+                        for (const fb of m.rtcpFb || []) {
+                            const codec = codecsMap.get(fb.payload);
+                            if (!codec) continue;
+                            const feedback = {
+                                type: fb.type,
+                                parameter: fb.subtype,
+                            };
+                            if (!feedback.parameter) delete feedback.parameter;
+                            codec.rtcpFeedback.push(feedback);
+                        }
+                        // Get RTP header extensions.
+                        for (const ext of m.ext || []) {
+                            // Ignore encrypted extensions (not yet supported in mediasoup).
+                            if (ext['encrypt-uri']) continue;
+                            const headerExtension = {
+                                kind: kind,
+                                uri: ext.uri,
+                                preferredId: ext.value,
+                            };
+                            headerExtensions.push(headerExtension);
+                        }
+                    }
+                    const rtpCapabilities = {
+                        codecs: Array.from(codecsMap.values()),
+                        headerExtensions: headerExtensions,
+                    };
+                    return rtpCapabilities;
+                }
+                exports.extractRtpCapabilities = extractRtpCapabilities;
+                function extractDtlsParameters({ sdpObject }) {
+                    const mediaObject = (sdpObject.media || []).find((m) => m.iceUfrag && m.port !== 0);
+                    if (!mediaObject) throw new Error('no active media section found');
+                    const fingerprint = mediaObject.fingerprint || sdpObject.fingerprint;
+                    let role;
+                    switch (mediaObject.setup) {
+                        case 'active':
+                            role = 'client';
+                            break;
+                        case 'passive':
+                            role = 'server';
+                            break;
+                        case 'actpass':
+                            role = 'auto';
+                            break;
+                    }
+                    const dtlsParameters = {
+                        role,
+                        fingerprints: [
+                            {
+                                algorithm: fingerprint.type,
+                                value: fingerprint.hash,
+                            },
+                        ],
+                    };
+                    return dtlsParameters;
+                }
+                exports.extractDtlsParameters = extractDtlsParameters;
+                function getCname({ offerMediaObject }) {
+                    const ssrcCnameLine = (offerMediaObject.ssrcs || []).find((line) => line.attribute === 'cname');
+                    if (!ssrcCnameLine) return '';
+                    return ssrcCnameLine.value;
+                }
+                exports.getCname = getCname;
+                /**
+                 * Apply codec parameters in the given SDP m= section answer based on the
+                 * given RTP parameters of an offer.
+                 */
+                function applyCodecParameters({ offerRtpParameters, answerMediaObject }) {
+                    for (const codec of offerRtpParameters.codecs) {
+                        const mimeType = codec.mimeType.toLowerCase();
+                        // Avoid parsing codec parameters for unhandled codecs.
+                        if (mimeType !== 'audio/opus') continue;
+                        const rtp = (answerMediaObject.rtp || []).find((r) => r.payload === codec.payloadType);
+                        if (!rtp) continue;
+                        // Just in case.
+                        answerMediaObject.fmtp = answerMediaObject.fmtp || [];
+                        let fmtp = answerMediaObject.fmtp.find((f) => f.payload === codec.payloadType);
+                        if (!fmtp) {
+                            fmtp = { payload: codec.payloadType, config: '' };
+                            answerMediaObject.fmtp.push(fmtp);
+                        }
+                        const parameters = sdpTransform.parseParams(fmtp.config);
+                        switch (mimeType) {
+                            case 'audio/opus': {
+                                const spropStereo = codec.parameters['sprop-stereo'];
+                                if (spropStereo !== undefined) parameters.stereo = spropStereo ? 1 : 0;
+                                break;
+                            }
+                        }
+                        // Write the codec fmtp.config back.
+                        fmtp.config = '';
+                        for (const key of Object.keys(parameters)) {
+                            if (fmtp.config) fmtp.config += ';';
+                            fmtp.config += `${key}=${parameters[key]}`;
+                        }
+                    }
+                }
+                exports.applyCodecParameters = applyCodecParameters;
+            },
+            { 'sdp-transform': 44 },
+        ],
+        33: [
+            function (require, module, exports) {
+                'use strict';
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.addLegacySimulcast = exports.getRtpEncodings = void 0;
+                function getRtpEncodings({ offerMediaObject, track }) {
+                    // First media SSRC (or the only one).
+                    let firstSsrc;
+                    const ssrcs = new Set();
+                    for (const line of offerMediaObject.ssrcs || []) {
+                        if (line.attribute !== 'msid') continue;
+                        const trackId = line.value.split(' ')[1];
+                        if (trackId === track.id) {
+                            const ssrc = line.id;
+                            ssrcs.add(ssrc);
+                            if (!firstSsrc) firstSsrc = ssrc;
+                        }
+                    }
+                    if (ssrcs.size === 0)
+                        throw new Error(`a=ssrc line with msid information not found [track.id:${track.id}]`);
+                    const ssrcToRtxSsrc = new Map();
+                    // First assume RTX is used.
+                    for (const line of offerMediaObject.ssrcGroups || []) {
+                        if (line.semantics !== 'FID') continue;
+                        let [ssrc, rtxSsrc] = line.ssrcs.split(/\s+/);
+                        ssrc = Number(ssrc);
+                        rtxSsrc = Number(rtxSsrc);
+                        if (ssrcs.has(ssrc)) {
+                            // Remove both the SSRC and RTX SSRC from the set so later we know that they
+                            // are already handled.
+                            ssrcs.delete(ssrc);
+                            ssrcs.delete(rtxSsrc);
+                            // Add to the map.
+                            ssrcToRtxSsrc.set(ssrc, rtxSsrc);
+                        }
+                    }
+                    // If the set of SSRCs is not empty it means that RTX is not being used, so take
+                    // media SSRCs from there.
+                    for (const ssrc of ssrcs) {
+                        // Add to the map.
+                        ssrcToRtxSsrc.set(ssrc, null);
+                    }
+                    const encodings = [];
+                    for (const [ssrc, rtxSsrc] of ssrcToRtxSsrc) {
+                        const encoding = { ssrc };
+                        if (rtxSsrc) encoding.rtx = { ssrc: rtxSsrc };
+                        encodings.push(encoding);
+                    }
+                    return encodings;
+                }
+                exports.getRtpEncodings = getRtpEncodings;
+                /**
+                 * Adds multi-ssrc based simulcast into the given SDP media section offer.
+                 */
+                function addLegacySimulcast({ offerMediaObject, track, numStreams }) {
+                    if (numStreams <= 1) throw new TypeError('numStreams must be greater than 1');
+                    let firstSsrc;
+                    let firstRtxSsrc;
+                    let streamId;
+                    // Get the SSRC.
+                    const ssrcMsidLine = (offerMediaObject.ssrcs || []).find((line) => {
+                        if (line.attribute !== 'msid') return false;
+                        const trackId = line.value.split(' ')[1];
+                        if (trackId === track.id) {
+                            firstSsrc = line.id;
+                            streamId = line.value.split(' ')[0];
+                            return true;
+                        } else {
+                            return false;
+                        }
+                    });
+                    if (!ssrcMsidLine)
+                        throw new Error(`a=ssrc line with msid information not found [track.id:${track.id}]`);
+                    // Get the SSRC for RTX.
+                    (offerMediaObject.ssrcGroups || []).some((line) => {
+                        if (line.semantics !== 'FID') return false;
+                        const ssrcs = line.ssrcs.split(/\s+/);
+                        if (Number(ssrcs[0]) === firstSsrc) {
+                            firstRtxSsrc = Number(ssrcs[1]);
+                            return true;
+                        } else {
+                            return false;
+                        }
+                    });
+                    const ssrcCnameLine = offerMediaObject.ssrcs.find(
+                        (line) => line.attribute === 'cname' && line.id === firstSsrc,
+                    );
+                    if (!ssrcCnameLine)
+                        throw new Error(`a=ssrc line with cname information not found [track.id:${track.id}]`);
+                    const cname = ssrcCnameLine.value;
+                    const ssrcs = [];
+                    const rtxSsrcs = [];
+                    for (let i = 0; i < numStreams; ++i) {
+                        ssrcs.push(firstSsrc + i);
+                        if (firstRtxSsrc) rtxSsrcs.push(firstRtxSsrc + i);
+                    }
+                    offerMediaObject.ssrcGroups = offerMediaObject.ssrcGroups || [];
+                    offerMediaObject.ssrcs = offerMediaObject.ssrcs || [];
+                    offerMediaObject.ssrcGroups.push({
+                        semantics: 'SIM',
+                        ssrcs: ssrcs.join(' '),
+                    });
+                    for (let i = 0; i < ssrcs.length; ++i) {
+                        const ssrc = ssrcs[i];
+                        offerMediaObject.ssrcs.push({
+                            id: ssrc,
+                            attribute: 'cname',
+                            value: cname,
+                        });
+                        offerMediaObject.ssrcs.push({
+                            id: ssrc,
+                            attribute: 'msid',
+                            value: `${streamId} ${track.id}`,
+                        });
+                    }
+                    for (let i = 0; i < rtxSsrcs.length; ++i) {
+                        const ssrc = ssrcs[i];
+                        const rtxSsrc = rtxSsrcs[i];
+                        offerMediaObject.ssrcs.push({
+                            id: rtxSsrc,
+                            attribute: 'cname',
+                            value: cname,
+                        });
+                        offerMediaObject.ssrcs.push({
+                            id: rtxSsrc,
+                            attribute: 'msid',
+                            value: `${streamId} ${track.id}`,
+                        });
+                        offerMediaObject.ssrcGroups.push({
+                            semantics: 'FID',
+                            ssrcs: `${ssrc} ${rtxSsrc}`,
+                        });
+                    }
+                }
+                exports.addLegacySimulcast = addLegacySimulcast;
+            },
+            {},
+        ],
+        34: [
+            function (require, module, exports) {
+                'use strict';
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.addLegacySimulcast = exports.getRtpEncodings = void 0;
+                function getRtpEncodings({ offerMediaObject }) {
+                    const ssrcs = new Set();
+                    for (const line of offerMediaObject.ssrcs || []) {
+                        const ssrc = line.id;
+                        ssrcs.add(ssrc);
+                    }
+                    if (ssrcs.size === 0) throw new Error('no a=ssrc lines found');
+                    const ssrcToRtxSsrc = new Map();
+                    // First assume RTX is used.
+                    for (const line of offerMediaObject.ssrcGroups || []) {
+                        if (line.semantics !== 'FID') continue;
+                        let [ssrc, rtxSsrc] = line.ssrcs.split(/\s+/);
+                        ssrc = Number(ssrc);
+                        rtxSsrc = Number(rtxSsrc);
+                        if (ssrcs.has(ssrc)) {
+                            // Remove both the SSRC and RTX SSRC from the set so later we know that they
+                            // are already handled.
+                            ssrcs.delete(ssrc);
+                            ssrcs.delete(rtxSsrc);
+                            // Add to the map.
+                            ssrcToRtxSsrc.set(ssrc, rtxSsrc);
+                        }
+                    }
+                    // If the set of SSRCs is not empty it means that RTX is not being used, so take
+                    // media SSRCs from there.
+                    for (const ssrc of ssrcs) {
+                        // Add to the map.
+                        ssrcToRtxSsrc.set(ssrc, null);
+                    }
+                    const encodings = [];
+                    for (const [ssrc, rtxSsrc] of ssrcToRtxSsrc) {
+                        const encoding = { ssrc };
+                        if (rtxSsrc) encoding.rtx = { ssrc: rtxSsrc };
+                        encodings.push(encoding);
+                    }
+                    return encodings;
+                }
+                exports.getRtpEncodings = getRtpEncodings;
+                /**
+                 * Adds multi-ssrc based simulcast into the given SDP media section offer.
+                 */
+                function addLegacySimulcast({ offerMediaObject, numStreams }) {
+                    if (numStreams <= 1) throw new TypeError('numStreams must be greater than 1');
+                    // Get the SSRC.
+                    const ssrcMsidLine = (offerMediaObject.ssrcs || []).find((line) => line.attribute === 'msid');
+                    if (!ssrcMsidLine) throw new Error('a=ssrc line with msid information not found');
+                    const [streamId, trackId] = ssrcMsidLine.value.split(' ');
+                    const firstSsrc = ssrcMsidLine.id;
+                    let firstRtxSsrc;
+                    // Get the SSRC for RTX.
+                    (offerMediaObject.ssrcGroups || []).some((line) => {
+                        if (line.semantics !== 'FID') return false;
+                        const ssrcs = line.ssrcs.split(/\s+/);
+                        if (Number(ssrcs[0]) === firstSsrc) {
+                            firstRtxSsrc = Number(ssrcs[1]);
+                            return true;
+                        } else {
+                            return false;
+                        }
+                    });
+                    const ssrcCnameLine = offerMediaObject.ssrcs.find((line) => line.attribute === 'cname');
+                    if (!ssrcCnameLine) throw new Error('a=ssrc line with cname information not found');
+                    const cname = ssrcCnameLine.value;
+                    const ssrcs = [];
+                    const rtxSsrcs = [];
+                    for (let i = 0; i < numStreams; ++i) {
+                        ssrcs.push(firstSsrc + i);
+                        if (firstRtxSsrc) rtxSsrcs.push(firstRtxSsrc + i);
+                    }
+                    offerMediaObject.ssrcGroups = [];
+                    offerMediaObject.ssrcs = [];
+                    offerMediaObject.ssrcGroups.push({
+                        semantics: 'SIM',
+                        ssrcs: ssrcs.join(' '),
+                    });
+                    for (let i = 0; i < ssrcs.length; ++i) {
+                        const ssrc = ssrcs[i];
+                        offerMediaObject.ssrcs.push({
+                            id: ssrc,
+                            attribute: 'cname',
+                            value: cname,
+                        });
+                        offerMediaObject.ssrcs.push({
+                            id: ssrc,
+                            attribute: 'msid',
+                            value: `${streamId} ${trackId}`,
+                        });
+                    }
+                    for (let i = 0; i < rtxSsrcs.length; ++i) {
+                        const ssrc = ssrcs[i];
+                        const rtxSsrc = rtxSsrcs[i];
+                        offerMediaObject.ssrcs.push({
+                            id: rtxSsrc,
+                            attribute: 'cname',
+                            value: cname,
+                        });
+                        offerMediaObject.ssrcs.push({
+                            id: rtxSsrc,
+                            attribute: 'msid',
+                            value: `${streamId} ${trackId}`,
+                        });
+                        offerMediaObject.ssrcGroups.push({
+                            semantics: 'FID',
+                            ssrcs: `${ssrc} ${rtxSsrc}`,
+                        });
+                    }
+                }
+                exports.addLegacySimulcast = addLegacySimulcast;
+            },
+            {},
+        ],
+        35: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                var __importDefault =
+                    (this && this.__importDefault) ||
+                    function (mod) {
+                        return mod && mod.__esModule ? mod : { default: mod };
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.debug = exports.detectDevice = exports.Device = exports.version = exports.types = void 0;
+                const debug_1 = __importDefault(require('debug'));
+                exports.debug = debug_1.default;
+                const Device_1 = require('./Device');
+                Object.defineProperty(exports, 'Device', {
+                    enumerable: true,
+                    get: function () {
+                        return Device_1.Device;
+                    },
+                });
+                Object.defineProperty(exports, 'detectDevice', {
+                    enumerable: true,
+                    get: function () {
+                        return Device_1.detectDevice;
+                    },
+                });
+                const types = __importStar(require('./types'));
+                exports.types = types;
+                /**
+                 * Expose mediasoup-client version.
+                 */
+                exports.version = '3.6.37';
+                /**
+                 * Expose parseScalabilityMode() function.
+                 */
+                var scalabilityModes_1 = require('./scalabilityModes');
+                Object.defineProperty(exports, 'parseScalabilityMode', {
+                    enumerable: true,
+                    get: function () {
+                        return scalabilityModes_1.parse;
+                    },
+                });
+            },
+            { './Device': 11, './scalabilityModes': 37, './types': 38, debug: 40 },
+        ],
+        36: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __setModuleDefault =
+                    (this && this.__setModuleDefault) ||
+                    (Object.create
+                        ? function (o, v) {
+                              Object.defineProperty(o, 'default', { enumerable: true, value: v });
+                          }
+                        : function (o, v) {
+                              o['default'] = v;
+                          });
+                var __importStar =
+                    (this && this.__importStar) ||
+                    function (mod) {
+                        if (mod && mod.__esModule) return mod;
+                        var result = {};
+                        if (mod != null)
+                            for (var k in mod)
+                                if (k !== 'default' && Object.hasOwnProperty.call(mod, k))
+                                    __createBinding(result, mod, k);
+                        __setModuleDefault(result, mod);
+                        return result;
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.canReceive =
+                    exports.canSend =
+                    exports.generateProbatorRtpParameters =
+                    exports.reduceCodecs =
+                    exports.getSendingRemoteRtpParameters =
+                    exports.getSendingRtpParameters =
+                    exports.getRecvRtpCapabilities =
+                    exports.getExtendedRtpCapabilities =
+                    exports.validateSctpStreamParameters =
+                    exports.validateSctpParameters =
+                    exports.validateNumSctpStreams =
+                    exports.validateSctpCapabilities =
+                    exports.validateRtcpParameters =
+                    exports.validateRtpEncodingParameters =
+                    exports.validateRtpHeaderExtensionParameters =
+                    exports.validateRtpCodecParameters =
+                    exports.validateRtpParameters =
+                    exports.validateRtpHeaderExtension =
+                    exports.validateRtcpFeedback =
+                    exports.validateRtpCodecCapability =
+                    exports.validateRtpCapabilities =
+                        void 0;
+                const h264 = __importStar(require('h264-profile-level-id'));
+                const utils = __importStar(require('./utils'));
+                const RTP_PROBATOR_MID = 'probator';
+                const RTP_PROBATOR_SSRC = 1234;
+                const RTP_PROBATOR_CODEC_PAYLOAD_TYPE = 127;
+                /**
+                 * Validates RtpCapabilities. It may modify given data by adding missing
+                 * fields with default values.
+                 * It throws if invalid.
+                 */
+                function validateRtpCapabilities(caps) {
+                    if (typeof caps !== 'object') throw new TypeError('caps is not an object');
+                    // codecs is optional. If unset, fill with an empty array.
+                    if (caps.codecs && !Array.isArray(caps.codecs)) throw new TypeError('caps.codecs is not an array');
+                    else if (!caps.codecs) caps.codecs = [];
+                    for (const codec of caps.codecs) {
+                        validateRtpCodecCapability(codec);
+                    }
+                    // headerExtensions is optional. If unset, fill with an empty array.
+                    if (caps.headerExtensions && !Array.isArray(caps.headerExtensions))
+                        throw new TypeError('caps.headerExtensions is not an array');
+                    else if (!caps.headerExtensions) caps.headerExtensions = [];
+                    for (const ext of caps.headerExtensions) {
+                        validateRtpHeaderExtension(ext);
+                    }
+                }
+                exports.validateRtpCapabilities = validateRtpCapabilities;
+                /**
+                 * Validates RtpCodecCapability. It may modify given data by adding missing
+                 * fields with default values.
+                 * It throws if invalid.
+                 */
+                function validateRtpCodecCapability(codec) {
+                    const MimeTypeRegex = new RegExp('^(audio|video)/(.+)', 'i');
+                    if (typeof codec !== 'object') throw new TypeError('codec is not an object');
+                    // mimeType is mandatory.
+                    if (!codec.mimeType || typeof codec.mimeType !== 'string')
+                        throw new TypeError('missing codec.mimeType');
+                    const mimeTypeMatch = MimeTypeRegex.exec(codec.mimeType);
+                    if (!mimeTypeMatch) throw new TypeError('invalid codec.mimeType');
+                    // Just override kind with media component of mimeType.
+                    codec.kind = mimeTypeMatch[1].toLowerCase();
+                    // preferredPayloadType is optional.
+                    if (codec.preferredPayloadType && typeof codec.preferredPayloadType !== 'number')
+                        throw new TypeError('invalid codec.preferredPayloadType');
+                    // clockRate is mandatory.
+                    if (typeof codec.clockRate !== 'number') throw new TypeError('missing codec.clockRate');
+                    // channels is optional. If unset, set it to 1 (just if audio).
+                    if (codec.kind === 'audio') {
+                        if (typeof codec.channels !== 'number') codec.channels = 1;
+                    } else {
+                        delete codec.channels;
+                    }
+                    // parameters is optional. If unset, set it to an empty object.
+                    if (!codec.parameters || typeof codec.parameters !== 'object') codec.parameters = {};
+                    for (const key of Object.keys(codec.parameters)) {
+                        let value = codec.parameters[key];
+                        if (value === undefined) {
+                            codec.parameters[key] = '';
+                            value = '';
+                        }
+                        if (typeof value !== 'string' && typeof value !== 'number') {
+                            throw new TypeError(`invalid codec parameter [key:${key}s, value:${value}]`);
+                        }
+                        // Specific parameters validation.
+                        if (key === 'apt') {
+                            if (typeof value !== 'number') throw new TypeError('invalid codec apt parameter');
+                        }
+                    }
+                    // rtcpFeedback is optional. If unset, set it to an empty array.
+                    if (!codec.rtcpFeedback || !Array.isArray(codec.rtcpFeedback)) codec.rtcpFeedback = [];
+                    for (const fb of codec.rtcpFeedback) {
+                        validateRtcpFeedback(fb);
+                    }
+                }
+                exports.validateRtpCodecCapability = validateRtpCodecCapability;
+                /**
+                 * Validates RtcpFeedback. It may modify given data by adding missing
+                 * fields with default values.
+                 * It throws if invalid.
+                 */
+                function validateRtcpFeedback(fb) {
+                    if (typeof fb !== 'object') throw new TypeError('fb is not an object');
+                    // type is mandatory.
+                    if (!fb.type || typeof fb.type !== 'string') throw new TypeError('missing fb.type');
+                    // parameter is optional. If unset set it to an empty string.
+                    if (!fb.parameter || typeof fb.parameter !== 'string') fb.parameter = '';
+                }
+                exports.validateRtcpFeedback = validateRtcpFeedback;
+                /**
+                 * Validates RtpHeaderExtension. It may modify given data by adding missing
+                 * fields with default values.
+                 * It throws if invalid.
+                 */
+                function validateRtpHeaderExtension(ext) {
+                    if (typeof ext !== 'object') throw new TypeError('ext is not an object');
+                    // kind is mandatory.
+                    if (ext.kind !== 'audio' && ext.kind !== 'video') throw new TypeError('invalid ext.kind');
+                    // uri is mandatory.
+                    if (!ext.uri || typeof ext.uri !== 'string') throw new TypeError('missing ext.uri');
+                    // preferredId is mandatory.
+                    if (typeof ext.preferredId !== 'number') throw new TypeError('missing ext.preferredId');
+                    // preferredEncrypt is optional. If unset set it to false.
+                    if (ext.preferredEncrypt && typeof ext.preferredEncrypt !== 'boolean')
+                        throw new TypeError('invalid ext.preferredEncrypt');
+                    else if (!ext.preferredEncrypt) ext.preferredEncrypt = false;
+                    // direction is optional. If unset set it to sendrecv.
+                    if (ext.direction && typeof ext.direction !== 'string')
+                        throw new TypeError('invalid ext.direction');
+                    else if (!ext.direction) ext.direction = 'sendrecv';
+                }
+                exports.validateRtpHeaderExtension = validateRtpHeaderExtension;
+                /**
+                 * Validates RtpParameters. It may modify given data by adding missing
+                 * fields with default values.
+                 * It throws if invalid.
+                 */
+                function validateRtpParameters(params) {
+                    if (typeof params !== 'object') throw new TypeError('params is not an object');
+                    // mid is optional.
+                    if (params.mid && typeof params.mid !== 'string') throw new TypeError('params.mid is not a string');
+                    // codecs is mandatory.
+                    if (!Array.isArray(params.codecs)) throw new TypeError('missing params.codecs');
+                    for (const codec of params.codecs) {
+                        validateRtpCodecParameters(codec);
+                    }
+                    // headerExtensions is optional. If unset, fill with an empty array.
+                    if (params.headerExtensions && !Array.isArray(params.headerExtensions))
+                        throw new TypeError('params.headerExtensions is not an array');
+                    else if (!params.headerExtensions) params.headerExtensions = [];
+                    for (const ext of params.headerExtensions) {
+                        validateRtpHeaderExtensionParameters(ext);
+                    }
+                    // encodings is optional. If unset, fill with an empty array.
+                    if (params.encodings && !Array.isArray(params.encodings))
+                        throw new TypeError('params.encodings is not an array');
+                    else if (!params.encodings) params.encodings = [];
+                    for (const encoding of params.encodings) {
+                        validateRtpEncodingParameters(encoding);
+                    }
+                    // rtcp is optional. If unset, fill with an empty object.
+                    if (params.rtcp && typeof params.rtcp !== 'object')
+                        throw new TypeError('params.rtcp is not an object');
+                    else if (!params.rtcp) params.rtcp = {};
+                    validateRtcpParameters(params.rtcp);
+                }
+                exports.validateRtpParameters = validateRtpParameters;
+                /**
+                 * Validates RtpCodecParameters. It may modify given data by adding missing
+                 * fields with default values.
+                 * It throws if invalid.
+                 */
+                function validateRtpCodecParameters(codec) {
+                    const MimeTypeRegex = new RegExp('^(audio|video)/(.+)', 'i');
+                    if (typeof codec !== 'object') throw new TypeError('codec is not an object');
+                    // mimeType is mandatory.
+                    if (!codec.mimeType || typeof codec.mimeType !== 'string')
+                        throw new TypeError('missing codec.mimeType');
+                    const mimeTypeMatch = MimeTypeRegex.exec(codec.mimeType);
+                    if (!mimeTypeMatch) throw new TypeError('invalid codec.mimeType');
+                    // payloadType is mandatory.
+                    if (typeof codec.payloadType !== 'number') throw new TypeError('missing codec.payloadType');
+                    // clockRate is mandatory.
+                    if (typeof codec.clockRate !== 'number') throw new TypeError('missing codec.clockRate');
+                    const kind = mimeTypeMatch[1].toLowerCase();
+                    // channels is optional. If unset, set it to 1 (just if audio).
+                    if (kind === 'audio') {
+                        if (typeof codec.channels !== 'number') codec.channels = 1;
+                    } else {
+                        delete codec.channels;
+                    }
+                    // parameters is optional. If unset, set it to an empty object.
+                    if (!codec.parameters || typeof codec.parameters !== 'object') codec.parameters = {};
+                    for (const key of Object.keys(codec.parameters)) {
+                        let value = codec.parameters[key];
+                        if (value === undefined) {
+                            codec.parameters[key] = '';
+                            value = '';
+                        }
+                        if (typeof value !== 'string' && typeof value !== 'number') {
+                            throw new TypeError(`invalid codec parameter [key:${key}s, value:${value}]`);
+                        }
+                        // Specific parameters validation.
+                        if (key === 'apt') {
+                            if (typeof value !== 'number') throw new TypeError('invalid codec apt parameter');
+                        }
+                    }
+                    // rtcpFeedback is optional. If unset, set it to an empty array.
+                    if (!codec.rtcpFeedback || !Array.isArray(codec.rtcpFeedback)) codec.rtcpFeedback = [];
+                    for (const fb of codec.rtcpFeedback) {
+                        validateRtcpFeedback(fb);
+                    }
+                }
+                exports.validateRtpCodecParameters = validateRtpCodecParameters;
+                /**
+                 * Validates RtpHeaderExtensionParameteters. It may modify given data by adding missing
+                 * fields with default values.
+                 * It throws if invalid.
+                 */
+                function validateRtpHeaderExtensionParameters(ext) {
+                    if (typeof ext !== 'object') throw new TypeError('ext is not an object');
+                    // uri is mandatory.
+                    if (!ext.uri || typeof ext.uri !== 'string') throw new TypeError('missing ext.uri');
+                    // id is mandatory.
+                    if (typeof ext.id !== 'number') throw new TypeError('missing ext.id');
+                    // encrypt is optional. If unset set it to false.
+                    if (ext.encrypt && typeof ext.encrypt !== 'boolean') throw new TypeError('invalid ext.encrypt');
+                    else if (!ext.encrypt) ext.encrypt = false;
+                    // parameters is optional. If unset, set it to an empty object.
+                    if (!ext.parameters || typeof ext.parameters !== 'object') ext.parameters = {};
+                    for (const key of Object.keys(ext.parameters)) {
+                        let value = ext.parameters[key];
+                        if (value === undefined) {
+                            ext.parameters[key] = '';
+                            value = '';
+                        }
+                        if (typeof value !== 'string' && typeof value !== 'number')
+                            throw new TypeError('invalid header extension parameter');
+                    }
+                }
+                exports.validateRtpHeaderExtensionParameters = validateRtpHeaderExtensionParameters;
+                /**
+                 * Validates RtpEncodingParameters. It may modify given data by adding missing
+                 * fields with default values.
+                 * It throws if invalid.
+                 */
+                function validateRtpEncodingParameters(encoding) {
+                    if (typeof encoding !== 'object') throw new TypeError('encoding is not an object');
+                    // ssrc is optional.
+                    if (encoding.ssrc && typeof encoding.ssrc !== 'number')
+                        throw new TypeError('invalid encoding.ssrc');
+                    // rid is optional.
+                    if (encoding.rid && typeof encoding.rid !== 'string') throw new TypeError('invalid encoding.rid');
+                    // rtx is optional.
+                    if (encoding.rtx && typeof encoding.rtx !== 'object') {
+                        throw new TypeError('invalid encoding.rtx');
+                    } else if (encoding.rtx) {
+                        // RTX ssrc is mandatory if rtx is present.
+                        if (typeof encoding.rtx.ssrc !== 'number') throw new TypeError('missing encoding.rtx.ssrc');
+                    }
+                    // dtx is optional. If unset set it to false.
+                    if (!encoding.dtx || typeof encoding.dtx !== 'boolean') encoding.dtx = false;
+                    // scalabilityMode is optional.
+                    if (encoding.scalabilityMode && typeof encoding.scalabilityMode !== 'string')
+                        throw new TypeError('invalid encoding.scalabilityMode');
+                }
+                exports.validateRtpEncodingParameters = validateRtpEncodingParameters;
+                /**
+                 * Validates RtcpParameters. It may modify given data by adding missing
+                 * fields with default values.
+                 * It throws if invalid.
+                 */
+                function validateRtcpParameters(rtcp) {
+                    if (typeof rtcp !== 'object') throw new TypeError('rtcp is not an object');
+                    // cname is optional.
+                    if (rtcp.cname && typeof rtcp.cname !== 'string') throw new TypeError('invalid rtcp.cname');
+                    // reducedSize is optional. If unset set it to true.
+                    if (!rtcp.reducedSize || typeof rtcp.reducedSize !== 'boolean') rtcp.reducedSize = true;
+                }
+                exports.validateRtcpParameters = validateRtcpParameters;
+                /**
+                 * Validates SctpCapabilities. It may modify given data by adding missing
+                 * fields with default values.
+                 * It throws if invalid.
+                 */
+                function validateSctpCapabilities(caps) {
+                    if (typeof caps !== 'object') throw new TypeError('caps is not an object');
+                    // numStreams is mandatory.
+                    if (!caps.numStreams || typeof caps.numStreams !== 'object')
+                        throw new TypeError('missing caps.numStreams');
+                    validateNumSctpStreams(caps.numStreams);
+                }
+                exports.validateSctpCapabilities = validateSctpCapabilities;
+                /**
+                 * Validates NumSctpStreams. It may modify given data by adding missing
+                 * fields with default values.
+                 * It throws if invalid.
+                 */
+                function validateNumSctpStreams(numStreams) {
+                    if (typeof numStreams !== 'object') throw new TypeError('numStreams is not an object');
+                    // OS is mandatory.
+                    if (typeof numStreams.OS !== 'number') throw new TypeError('missing numStreams.OS');
+                    // MIS is mandatory.
+                    if (typeof numStreams.MIS !== 'number') throw new TypeError('missing numStreams.MIS');
+                }
+                exports.validateNumSctpStreams = validateNumSctpStreams;
+                /**
+                 * Validates SctpParameters. It may modify given data by adding missing
+                 * fields with default values.
+                 * It throws if invalid.
+                 */
+                function validateSctpParameters(params) {
+                    if (typeof params !== 'object') throw new TypeError('params is not an object');
+                    // port is mandatory.
+                    if (typeof params.port !== 'number') throw new TypeError('missing params.port');
+                    // OS is mandatory.
+                    if (typeof params.OS !== 'number') throw new TypeError('missing params.OS');
+                    // MIS is mandatory.
+                    if (typeof params.MIS !== 'number') throw new TypeError('missing params.MIS');
+                    // maxMessageSize is mandatory.
+                    if (typeof params.maxMessageSize !== 'number') throw new TypeError('missing params.maxMessageSize');
+                }
+                exports.validateSctpParameters = validateSctpParameters;
+                /**
+                 * Validates SctpStreamParameters. It may modify given data by adding missing
+                 * fields with default values.
+                 * It throws if invalid.
+                 */
+                function validateSctpStreamParameters(params) {
+                    if (typeof params !== 'object') throw new TypeError('params is not an object');
+                    // streamId is mandatory.
+                    if (typeof params.streamId !== 'number') throw new TypeError('missing params.streamId');
+                    // ordered is optional.
+                    let orderedGiven = false;
+                    if (typeof params.ordered === 'boolean') orderedGiven = true;
+                    else params.ordered = true;
+                    // maxPacketLifeTime is optional.
+                    if (params.maxPacketLifeTime && typeof params.maxPacketLifeTime !== 'number')
+                        throw new TypeError('invalid params.maxPacketLifeTime');
+                    // maxRetransmits is optional.
+                    if (params.maxRetransmits && typeof params.maxRetransmits !== 'number')
+                        throw new TypeError('invalid params.maxRetransmits');
+                    if (params.maxPacketLifeTime && params.maxRetransmits)
+                        throw new TypeError('cannot provide both maxPacketLifeTime and maxRetransmits');
+                    if (orderedGiven && params.ordered && (params.maxPacketLifeTime || params.maxRetransmits)) {
+                        throw new TypeError('cannot be ordered with maxPacketLifeTime or maxRetransmits');
+                    } else if (!orderedGiven && (params.maxPacketLifeTime || params.maxRetransmits)) {
+                        params.ordered = false;
+                    }
+                    // label is optional.
+                    if (params.label && typeof params.label !== 'string') throw new TypeError('invalid params.label');
+                    // protocol is optional.
+                    if (params.protocol && typeof params.protocol !== 'string')
+                        throw new TypeError('invalid params.protocol');
+                }
+                exports.validateSctpStreamParameters = validateSctpStreamParameters;
+                /**
+                 * Generate extended RTP capabilities for sending and receiving.
+                 */
+                function getExtendedRtpCapabilities(localCaps, remoteCaps) {
+                    const extendedRtpCapabilities = {
+                        codecs: [],
+                        headerExtensions: [],
+                    };
+                    // Match media codecs and keep the order preferred by remoteCaps.
+                    for (const remoteCodec of remoteCaps.codecs || []) {
+                        if (isRtxCodec(remoteCodec)) continue;
+                        const matchingLocalCodec = (localCaps.codecs || []).find((localCodec) =>
+                            matchCodecs(localCodec, remoteCodec, { strict: true, modify: true }),
+                        );
+                        if (!matchingLocalCodec) continue;
+                        const extendedCodec = {
+                            mimeType: matchingLocalCodec.mimeType,
+                            kind: matchingLocalCodec.kind,
+                            clockRate: matchingLocalCodec.clockRate,
+                            channels: matchingLocalCodec.channels,
+                            localPayloadType: matchingLocalCodec.preferredPayloadType,
+                            localRtxPayloadType: undefined,
+                            remotePayloadType: remoteCodec.preferredPayloadType,
+                            remoteRtxPayloadType: undefined,
+                            localParameters: matchingLocalCodec.parameters,
+                            remoteParameters: remoteCodec.parameters,
+                            rtcpFeedback: reduceRtcpFeedback(matchingLocalCodec, remoteCodec),
+                        };
+                        extendedRtpCapabilities.codecs.push(extendedCodec);
+                    }
+                    // Match RTX codecs.
+                    for (const extendedCodec of extendedRtpCapabilities.codecs) {
+                        const matchingLocalRtxCodec = localCaps.codecs.find(
+                            (localCodec) =>
+                                isRtxCodec(localCodec) && localCodec.parameters.apt === extendedCodec.localPayloadType,
+                        );
+                        const matchingRemoteRtxCodec = remoteCaps.codecs.find(
+                            (remoteCodec) =>
+                                isRtxCodec(remoteCodec) &&
+                                remoteCodec.parameters.apt === extendedCodec.remotePayloadType,
+                        );
+                        if (matchingLocalRtxCodec && matchingRemoteRtxCodec) {
+                            extendedCodec.localRtxPayloadType = matchingLocalRtxCodec.preferredPayloadType;
+                            extendedCodec.remoteRtxPayloadType = matchingRemoteRtxCodec.preferredPayloadType;
+                        }
+                    }
+                    // Match header extensions.
+                    for (const remoteExt of remoteCaps.headerExtensions) {
+                        const matchingLocalExt = localCaps.headerExtensions.find((localExt) =>
+                            matchHeaderExtensions(localExt, remoteExt),
+                        );
+                        if (!matchingLocalExt) continue;
+                        const extendedExt = {
+                            kind: remoteExt.kind,
+                            uri: remoteExt.uri,
+                            sendId: matchingLocalExt.preferredId,
+                            recvId: remoteExt.preferredId,
+                            encrypt: matchingLocalExt.preferredEncrypt,
+                            direction: 'sendrecv',
+                        };
+                        switch (remoteExt.direction) {
+                            case 'sendrecv':
+                                extendedExt.direction = 'sendrecv';
+                                break;
+                            case 'recvonly':
+                                extendedExt.direction = 'sendonly';
+                                break;
+                            case 'sendonly':
+                                extendedExt.direction = 'recvonly';
+                                break;
+                            case 'inactive':
+                                extendedExt.direction = 'inactive';
+                                break;
+                        }
+                        extendedRtpCapabilities.headerExtensions.push(extendedExt);
+                    }
+                    return extendedRtpCapabilities;
+                }
+                exports.getExtendedRtpCapabilities = getExtendedRtpCapabilities;
+                /**
+                 * Generate RTP capabilities for receiving media based on the given extended
+                 * RTP capabilities.
+                 */
+                function getRecvRtpCapabilities(extendedRtpCapabilities) {
+                    const rtpCapabilities = {
+                        codecs: [],
+                        headerExtensions: [],
+                    };
+                    for (const extendedCodec of extendedRtpCapabilities.codecs) {
+                        const codec = {
+                            mimeType: extendedCodec.mimeType,
+                            kind: extendedCodec.kind,
+                            preferredPayloadType: extendedCodec.remotePayloadType,
+                            clockRate: extendedCodec.clockRate,
+                            channels: extendedCodec.channels,
+                            parameters: extendedCodec.localParameters,
+                            rtcpFeedback: extendedCodec.rtcpFeedback,
+                        };
+                        rtpCapabilities.codecs.push(codec);
+                        // Add RTX codec.
+                        if (!extendedCodec.remoteRtxPayloadType) continue;
+                        const rtxCodec = {
+                            mimeType: `${extendedCodec.kind}/rtx`,
+                            kind: extendedCodec.kind,
+                            preferredPayloadType: extendedCodec.remoteRtxPayloadType,
+                            clockRate: extendedCodec.clockRate,
+                            parameters: {
+                                apt: extendedCodec.remotePayloadType,
+                            },
+                            rtcpFeedback: [],
+                        };
+                        rtpCapabilities.codecs.push(rtxCodec);
+                        // TODO: In the future, we need to add FEC, CN, etc, codecs.
+                    }
+                    for (const extendedExtension of extendedRtpCapabilities.headerExtensions) {
+                        // Ignore RTP extensions not valid for receiving.
+                        if (extendedExtension.direction !== 'sendrecv' && extendedExtension.direction !== 'recvonly') {
+                            continue;
+                        }
+                        const ext = {
+                            kind: extendedExtension.kind,
+                            uri: extendedExtension.uri,
+                            preferredId: extendedExtension.recvId,
+                            preferredEncrypt: extendedExtension.encrypt,
+                            direction: extendedExtension.direction,
+                        };
+                        rtpCapabilities.headerExtensions.push(ext);
+                    }
+                    return rtpCapabilities;
+                }
+                exports.getRecvRtpCapabilities = getRecvRtpCapabilities;
+                /**
+                 * Generate RTP parameters of the given kind for sending media.
+                 * NOTE: mid, encodings and rtcp fields are left empty.
+                 */
+                function getSendingRtpParameters(kind, extendedRtpCapabilities) {
+                    const rtpParameters = {
+                        mid: undefined,
+                        codecs: [],
+                        headerExtensions: [],
+                        encodings: [],
+                        rtcp: {},
+                    };
+                    for (const extendedCodec of extendedRtpCapabilities.codecs) {
+                        if (extendedCodec.kind !== kind) continue;
+                        const codec = {
+                            mimeType: extendedCodec.mimeType,
+                            payloadType: extendedCodec.localPayloadType,
+                            clockRate: extendedCodec.clockRate,
+                            channels: extendedCodec.channels,
+                            parameters: extendedCodec.localParameters,
+                            rtcpFeedback: extendedCodec.rtcpFeedback,
+                        };
+                        rtpParameters.codecs.push(codec);
+                        // Add RTX codec.
+                        if (extendedCodec.localRtxPayloadType) {
+                            const rtxCodec = {
+                                mimeType: `${extendedCodec.kind}/rtx`,
+                                payloadType: extendedCodec.localRtxPayloadType,
+                                clockRate: extendedCodec.clockRate,
+                                parameters: {
+                                    apt: extendedCodec.localPayloadType,
+                                },
+                                rtcpFeedback: [],
+                            };
+                            rtpParameters.codecs.push(rtxCodec);
+                        }
+                    }
+                    for (const extendedExtension of extendedRtpCapabilities.headerExtensions) {
+                        // Ignore RTP extensions of a different kind and those not valid for sending.
+                        if (
+                            (extendedExtension.kind && extendedExtension.kind !== kind) ||
+                            (extendedExtension.direction !== 'sendrecv' && extendedExtension.direction !== 'sendonly')
+                        ) {
+                            continue;
+                        }
+                        const ext = {
+                            uri: extendedExtension.uri,
+                            id: extendedExtension.sendId,
+                            encrypt: extendedExtension.encrypt,
+                            parameters: {},
+                        };
+                        rtpParameters.headerExtensions.push(ext);
+                    }
+                    return rtpParameters;
+                }
+                exports.getSendingRtpParameters = getSendingRtpParameters;
+                /**
+                 * Generate RTP parameters of the given kind suitable for the remote SDP answer.
+                 */
+                function getSendingRemoteRtpParameters(kind, extendedRtpCapabilities) {
+                    const rtpParameters = {
+                        mid: undefined,
+                        codecs: [],
+                        headerExtensions: [],
+                        encodings: [],
+                        rtcp: {},
+                    };
+                    for (const extendedCodec of extendedRtpCapabilities.codecs) {
+                        if (extendedCodec.kind !== kind) continue;
+                        const codec = {
+                            mimeType: extendedCodec.mimeType,
+                            payloadType: extendedCodec.localPayloadType,
+                            clockRate: extendedCodec.clockRate,
+                            channels: extendedCodec.channels,
+                            parameters: extendedCodec.remoteParameters,
+                            rtcpFeedback: extendedCodec.rtcpFeedback,
+                        };
+                        rtpParameters.codecs.push(codec);
+                        // Add RTX codec.
+                        if (extendedCodec.localRtxPayloadType) {
+                            const rtxCodec = {
+                                mimeType: `${extendedCodec.kind}/rtx`,
+                                payloadType: extendedCodec.localRtxPayloadType,
+                                clockRate: extendedCodec.clockRate,
+                                parameters: {
+                                    apt: extendedCodec.localPayloadType,
+                                },
+                                rtcpFeedback: [],
+                            };
+                            rtpParameters.codecs.push(rtxCodec);
+                        }
+                    }
+                    for (const extendedExtension of extendedRtpCapabilities.headerExtensions) {
+                        // Ignore RTP extensions of a different kind and those not valid for sending.
+                        if (
+                            (extendedExtension.kind && extendedExtension.kind !== kind) ||
+                            (extendedExtension.direction !== 'sendrecv' && extendedExtension.direction !== 'sendonly')
+                        ) {
+                            continue;
+                        }
+                        const ext = {
+                            uri: extendedExtension.uri,
+                            id: extendedExtension.sendId,
+                            encrypt: extendedExtension.encrypt,
+                            parameters: {},
+                        };
+                        rtpParameters.headerExtensions.push(ext);
+                    }
+                    // Reduce codecs' RTCP feedback. Use Transport-CC if available, REMB otherwise.
+                    if (
+                        rtpParameters.headerExtensions.some(
+                            (ext) =>
+                                ext.uri === 'http://www.ietf.org/id/draft-holmer-rmcat-transport-wide-cc-extensions-01',
+                        )
+                    ) {
+                        for (const codec of rtpParameters.codecs) {
+                            codec.rtcpFeedback = (codec.rtcpFeedback || []).filter((fb) => fb.type !== 'goog-remb');
+                        }
+                    } else if (
+                        rtpParameters.headerExtensions.some(
+                            (ext) => ext.uri === 'http://www.webrtc.org/experiments/rtp-hdrext/abs-send-time',
+                        )
+                    ) {
+                        for (const codec of rtpParameters.codecs) {
+                            codec.rtcpFeedback = (codec.rtcpFeedback || []).filter((fb) => fb.type !== 'transport-cc');
+                        }
+                    } else {
+                        for (const codec of rtpParameters.codecs) {
+                            codec.rtcpFeedback = (codec.rtcpFeedback || []).filter(
+                                (fb) => fb.type !== 'transport-cc' && fb.type !== 'goog-remb',
+                            );
+                        }
+                    }
+                    return rtpParameters;
+                }
+                exports.getSendingRemoteRtpParameters = getSendingRemoteRtpParameters;
+                /**
+                 * Reduce given codecs by returning an array of codecs "compatible" with the
+                 * given capability codec. If no capability codec is given, take the first
+                 * one(s).
+                 *
+                 * Given codecs must be generated by ortc.getSendingRtpParameters() or
+                 * ortc.getSendingRemoteRtpParameters().
+                 *
+                 * The returned array of codecs also include a RTX codec if available.
+                 */
+                function reduceCodecs(codecs, capCodec) {
+                    const filteredCodecs = [];
+                    // If no capability codec is given, take the first one (and RTX).
+                    if (!capCodec) {
+                        filteredCodecs.push(codecs[0]);
+                        if (isRtxCodec(codecs[1])) filteredCodecs.push(codecs[1]);
+                    }
+                    // Otherwise look for a compatible set of codecs.
+                    else {
+                        for (let idx = 0; idx < codecs.length; ++idx) {
+                            if (matchCodecs(codecs[idx], capCodec)) {
+                                filteredCodecs.push(codecs[idx]);
+                                if (isRtxCodec(codecs[idx + 1])) filteredCodecs.push(codecs[idx + 1]);
+                                break;
+                            }
+                        }
+                        if (filteredCodecs.length === 0) throw new TypeError('no matching codec found');
+                    }
+                    return filteredCodecs;
+                }
+                exports.reduceCodecs = reduceCodecs;
+                /**
+                 * Create RTP parameters for a Consumer for the RTP probator.
+                 */
+                function generateProbatorRtpParameters(videoRtpParameters) {
+                    // Clone given reference video RTP parameters.
+                    videoRtpParameters = utils.clone(videoRtpParameters, {});
+                    // This may throw.
+                    validateRtpParameters(videoRtpParameters);
+                    const rtpParameters = {
+                        mid: RTP_PROBATOR_MID,
+                        codecs: [],
+                        headerExtensions: [],
+                        encodings: [{ ssrc: RTP_PROBATOR_SSRC }],
+                        rtcp: { cname: 'probator' },
+                    };
+                    rtpParameters.codecs.push(videoRtpParameters.codecs[0]);
+                    rtpParameters.codecs[0].payloadType = RTP_PROBATOR_CODEC_PAYLOAD_TYPE;
+                    rtpParameters.headerExtensions = videoRtpParameters.headerExtensions;
+                    return rtpParameters;
+                }
+                exports.generateProbatorRtpParameters = generateProbatorRtpParameters;
+                /**
+                 * Whether media can be sent based on the given RTP capabilities.
+                 */
+                function canSend(kind, extendedRtpCapabilities) {
+                    return extendedRtpCapabilities.codecs.some((codec) => codec.kind === kind);
+                }
+                exports.canSend = canSend;
+                /**
+                 * Whether the given RTP parameters can be received with the given RTP
+                 * capabilities.
+                 */
+                function canReceive(rtpParameters, extendedRtpCapabilities) {
+                    // This may throw.
+                    validateRtpParameters(rtpParameters);
+                    if (rtpParameters.codecs.length === 0) return false;
+                    const firstMediaCodec = rtpParameters.codecs[0];
+                    return extendedRtpCapabilities.codecs.some(
+                        (codec) => codec.remotePayloadType === firstMediaCodec.payloadType,
+                    );
+                }
+                exports.canReceive = canReceive;
+                function isRtxCodec(codec) {
+                    if (!codec) return false;
+                    return /.+\/rtx$/i.test(codec.mimeType);
+                }
+                function matchCodecs(aCodec, bCodec, { strict = false, modify = false } = {}) {
+                    const aMimeType = aCodec.mimeType.toLowerCase();
+                    const bMimeType = bCodec.mimeType.toLowerCase();
+                    if (aMimeType !== bMimeType) return false;
+                    if (aCodec.clockRate !== bCodec.clockRate) return false;
+                    if (aCodec.channels !== bCodec.channels) return false;
+                    // Per codec special checks.
+                    switch (aMimeType) {
+                        case 'video/h264': {
+                            const aPacketizationMode = aCodec.parameters['packetization-mode'] || 0;
+                            const bPacketizationMode = bCodec.parameters['packetization-mode'] || 0;
+                            if (aPacketizationMode !== bPacketizationMode) return false;
+                            // If strict matching check profile-level-id.
+                            if (strict) {
+                                if (!h264.isSameProfile(aCodec.parameters, bCodec.parameters)) return false;
+                                let selectedProfileLevelId;
+                                try {
+                                    selectedProfileLevelId = h264.generateProfileLevelIdForAnswer(
+                                        aCodec.parameters,
+                                        bCodec.parameters,
+                                    );
+                                } catch (error) {
+                                    return false;
+                                }
+                                if (modify) {
+                                    if (selectedProfileLevelId) {
+                                        aCodec.parameters['profile-level-id'] = selectedProfileLevelId;
+                                        bCodec.parameters['profile-level-id'] = selectedProfileLevelId;
+                                    } else {
+                                        delete aCodec.parameters['profile-level-id'];
+                                        delete bCodec.parameters['profile-level-id'];
+                                    }
+                                }
+                            }
+                            break;
+                        }
+                        case 'video/vp9': {
+                            // If strict matching check profile-id.
+                            if (strict) {
+                                const aProfileId = aCodec.parameters['profile-id'] || 0;
+                                const bProfileId = bCodec.parameters['profile-id'] || 0;
+                                if (aProfileId !== bProfileId) return false;
+                            }
+                            break;
+                        }
+                    }
+                    return true;
+                }
+                function matchHeaderExtensions(aExt, bExt) {
+                    if (aExt.kind && bExt.kind && aExt.kind !== bExt.kind) return false;
+                    if (aExt.uri !== bExt.uri) return false;
+                    return true;
+                }
+                function reduceRtcpFeedback(codecA, codecB) {
+                    const reducedRtcpFeedback = [];
+                    for (const aFb of codecA.rtcpFeedback || []) {
+                        const matchingBFb = (codecB.rtcpFeedback || []).find(
+                            (bFb) =>
+                                bFb.type === aFb.type &&
+                                (bFb.parameter === aFb.parameter || (!bFb.parameter && !aFb.parameter)),
+                        );
+                        if (matchingBFb) reducedRtcpFeedback.push(matchingBFb);
+                    }
+                    return reducedRtcpFeedback;
+                }
+            },
+            { './utils': 39, 'h264-profile-level-id': 4 },
+        ],
+        37: [
+            function (require, module, exports) {
+                'use strict';
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.parse = void 0;
+                const ScalabilityModeRegex = new RegExp('^[LS]([1-9]\\d{0,1})T([1-9]\\d{0,1})');
+                function parse(scalabilityMode) {
+                    const match = ScalabilityModeRegex.exec(scalabilityMode || '');
+                    if (match) {
+                        return {
+                            spatialLayers: Number(match[1]),
+                            temporalLayers: Number(match[2]),
+                        };
+                    } else {
+                        return {
+                            spatialLayers: 1,
+                            temporalLayers: 1,
+                        };
+                    }
+                }
+                exports.parse = parse;
+            },
+            {},
+        ],
+        38: [
+            function (require, module, exports) {
+                'use strict';
+                var __createBinding =
+                    (this && this.__createBinding) ||
+                    (Object.create
+                        ? function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              Object.defineProperty(o, k2, {
+                                  enumerable: true,
+                                  get: function () {
+                                      return m[k];
+                                  },
+                              });
+                          }
+                        : function (o, m, k, k2) {
+                              if (k2 === undefined) k2 = k;
+                              o[k2] = m[k];
+                          });
+                var __exportStar =
+                    (this && this.__exportStar) ||
+                    function (m, exports) {
+                        for (var p in m)
+                            if (p !== 'default' && !exports.hasOwnProperty(p)) __createBinding(exports, m, p);
+                    };
+                Object.defineProperty(exports, '__esModule', { value: true });
+                __exportStar(require('./Device'), exports);
+                __exportStar(require('./Transport'), exports);
+                __exportStar(require('./Producer'), exports);
+                __exportStar(require('./Consumer'), exports);
+                __exportStar(require('./DataProducer'), exports);
+                __exportStar(require('./DataConsumer'), exports);
+                __exportStar(require('./RtpParameters'), exports);
+                __exportStar(require('./SctpParameters'), exports);
+                __exportStar(require('./handlers/HandlerInterface'), exports);
+                __exportStar(require('./errors'), exports);
+            },
+            {
+                './Consumer': 8,
+                './DataConsumer': 9,
+                './DataProducer': 10,
+                './Device': 11,
+                './Producer': 14,
+                './RtpParameters': 15,
+                './SctpParameters': 16,
+                './Transport': 17,
+                './errors': 18,
+                './handlers/HandlerInterface': 25,
+            },
+        ],
+        39: [
+            function (require, module, exports) {
+                'use strict';
+                Object.defineProperty(exports, '__esModule', { value: true });
+                exports.generateRandomNumber = exports.clone = void 0;
+                /**
+                 * Clones the given data.
+                 */
+                function clone(data, defaultValue) {
+                    if (typeof data === 'undefined') return defaultValue;
+                    return JSON.parse(JSON.stringify(data));
+                }
+                exports.clone = clone;
+                /**
+                 * Generates a random positive integer.
+                 */
+                function generateRandomNumber() {
+                    return Math.round(Math.random() * 10000000);
+                }
+                exports.generateRandomNumber = generateRandomNumber;
+            },
+            {},
+        ],
+        40: [
+            function (require, module, exports) {
+                arguments[4][5][0].apply(exports, arguments);
+            },
+            { './common': 41, _process: 48, dup: 5 },
+        ],
+        41: [
+            function (require, module, exports) {
+                arguments[4][6][0].apply(exports, arguments);
+            },
+            { dup: 6, ms: 42 },
+        ],
+        42: [
+            function (require, module, exports) {
+                arguments[4][7][0].apply(exports, arguments);
+            },
+            { dup: 7 },
+        ],
+        43: [
+            function (require, module, exports) {
+                var grammar = (module.exports = {
+                    v: [
+                        {
+                            name: 'version',
+                            reg: /^(\d*)$/,
+                        },
+                    ],
+                    o: [
+                        {
+                            // o=- 20518 0 IN IP4 203.0.113.1
+                            // NB: sessionId will be a String in most cases because it is huge
+                            name: 'origin',
+                            reg: /^(\S*) (\d*) (\d*) (\S*) IP(\d) (\S*)/,
+                            names: ['username', 'sessionId', 'sessionVersion', 'netType', 'ipVer', 'address'],
+                            format: '%s %s %d %s IP%d %s',
+                        },
+                    ],
+                    // default parsing of these only (though some of these feel outdated)
+                    s: [{ name: 'name' }],
+                    i: [{ name: 'description' }],
+                    u: [{ name: 'uri' }],
+                    e: [{ name: 'email' }],
+                    p: [{ name: 'phone' }],
+                    z: [{ name: 'timezones' }], // TODO: this one can actually be parsed properly...
+                    r: [{ name: 'repeats' }], // TODO: this one can also be parsed properly
+                    // k: [{}], // outdated thing ignored
+                    t: [
+                        {
+                            // t=0 0
+                            name: 'timing',
+                            reg: /^(\d*) (\d*)/,
+                            names: ['start', 'stop'],
+                            format: '%d %d',
+                        },
+                    ],
+                    c: [
+                        {
+                            // c=IN IP4 10.47.197.26
+                            name: 'connection',
+                            reg: /^IN IP(\d) (\S*)/,
+                            names: ['version', 'ip'],
+                            format: 'IN IP%d %s',
+                        },
+                    ],
+                    b: [
+                        {
+                            // b=AS:4000
+                            push: 'bandwidth',
+                            reg: /^(TIAS|AS|CT|RR|RS):(\d*)/,
+                            names: ['type', 'limit'],
+                            format: '%s:%s',
+                        },
+                    ],
+                    m: [
+                        {
+                            // m=video 51744 RTP/AVP 126 97 98 34 31
+                            // NB: special - pushes to session
+                            // TODO: rtp/fmtp should be filtered by the payloads found here?
+                            reg: /^(\w*) (\d*) ([\w/]*)(?: (.*))?/,
+                            names: ['type', 'port', 'protocol', 'payloads'],
+                            format: '%s %d %s %s',
+                        },
+                    ],
+                    a: [
+                        {
+                            // a=rtpmap:110 opus/48000/2
+                            push: 'rtp',
+                            reg: /^rtpmap:(\d*) ([\w\-.]*)(?:\s*\/(\d*)(?:\s*\/(\S*))?)?/,
+                            names: ['payload', 'codec', 'rate', 'encoding'],
+                            format: function (o) {
+                                return o.encoding ? 'rtpmap:%d %s/%s/%s' : o.rate ? 'rtpmap:%d %s/%s' : 'rtpmap:%d %s';
+                            },
+                        },
+                        {
+                            // a=fmtp:108 profile-level-id=24;object=23;bitrate=64000
+                            // a=fmtp:111 minptime=10; useinbandfec=1
+                            push: 'fmtp',
+                            reg: /^fmtp:(\d*) ([\S| ]*)/,
+                            names: ['payload', 'config'],
+                            format: 'fmtp:%d %s',
+                        },
+                        {
+                            // a=control:streamid=0
+                            name: 'control',
+                            reg: /^control:(.*)/,
+                            format: 'control:%s',
+                        },
+                        {
+                            // a=rtcp:65179 IN IP4 193.84.77.194
+                            name: 'rtcp',
+                            reg: /^rtcp:(\d*)(?: (\S*) IP(\d) (\S*))?/,
+                            names: ['port', 'netType', 'ipVer', 'address'],
+                            format: function (o) {
+                                return o.address != null ? 'rtcp:%d %s IP%d %s' : 'rtcp:%d';
+                            },
+                        },
+                        {
+                            // a=rtcp-fb:98 trr-int 100
+                            push: 'rtcpFbTrrInt',
+                            reg: /^rtcp-fb:(\*|\d*) trr-int (\d*)/,
+                            names: ['payload', 'value'],
+                            format: 'rtcp-fb:%s trr-int %d',
+                        },
+                        {
+                            // a=rtcp-fb:98 nack rpsi
+                            push: 'rtcpFb',
+                            reg: /^rtcp-fb:(\*|\d*) ([\w-_]*)(?: ([\w-_]*))?/,
+                            names: ['payload', 'type', 'subtype'],
+                            format: function (o) {
+                                return o.subtype != null ? 'rtcp-fb:%s %s %s' : 'rtcp-fb:%s %s';
+                            },
+                        },
+                        {
+                            // a=extmap:2 urn:ietf:params:rtp-hdrext:toffset
+                            // a=extmap:1/recvonly URI-gps-string
+                            // a=extmap:3 urn:ietf:params:rtp-hdrext:encrypt urn:ietf:params:rtp-hdrext:smpte-tc 25@600/24
+                            push: 'ext',
+                            reg: /^extmap:(\d+)(?:\/(\w+))?(?: (urn:ietf:params:rtp-hdrext:encrypt))? (\S*)(?: (\S*))?/,
+                            names: ['value', 'direction', 'encrypt-uri', 'uri', 'config'],
+                            format: function (o) {
+                                return (
+                                    'extmap:%d' +
+                                    (o.direction ? '/%s' : '%v') +
+                                    (o['encrypt-uri'] ? ' %s' : '%v') +
+                                    ' %s' +
+                                    (o.config ? ' %s' : '')
+                                );
+                            },
+                        },
+                        {
+                            // a=extmap-allow-mixed
+                            name: 'extmapAllowMixed',
+                            reg: /^(extmap-allow-mixed)/,
+                        },
+                        {
+                            // a=crypto:1 AES_CM_128_HMAC_SHA1_80 inline:PS1uQCVeeCFCanVmcjkpPywjNWhcYD0mXXtxaVBR|2^20|1:32
+                            push: 'crypto',
+                            reg: /^crypto:(\d*) ([\w_]*) (\S*)(?: (\S*))?/,
+                            names: ['id', 'suite', 'config', 'sessionConfig'],
+                            format: function (o) {
+                                return o.sessionConfig != null ? 'crypto:%d %s %s %s' : 'crypto:%d %s %s';
+                            },
+                        },
+                        {
+                            // a=setup:actpass
+                            name: 'setup',
+                            reg: /^setup:(\w*)/,
+                            format: 'setup:%s',
+                        },
+                        {
+                            // a=connection:new
+                            name: 'connectionType',
+                            reg: /^connection:(new|existing)/,
+                            format: 'connection:%s',
+                        },
+                        {
+                            // a=mid:1
+                            name: 'mid',
+                            reg: /^mid:([^\s]*)/,
+                            format: 'mid:%s',
+                        },
+                        {
+                            // a=msid:0c8b064d-d807-43b4-b434-f92a889d8587 98178685-d409-46e0-8e16-7ef0db0db64a
+                            name: 'msid',
+                            reg: /^msid:(.*)/,
+                            format: 'msid:%s',
+                        },
+                        {
+                            // a=ptime:20
+                            name: 'ptime',
+                            reg: /^ptime:(\d*(?:\.\d*)*)/,
+                            format: 'ptime:%d',
+                        },
+                        {
+                            // a=maxptime:60
+                            name: 'maxptime',
+                            reg: /^maxptime:(\d*(?:\.\d*)*)/,
+                            format: 'maxptime:%d',
+                        },
+                        {
+                            // a=sendrecv
+                            name: 'direction',
+                            reg: /^(sendrecv|recvonly|sendonly|inactive)/,
+                        },
+                        {
+                            // a=ice-lite
+                            name: 'icelite',
+                            reg: /^(ice-lite)/,
+                        },
+                        {
+                            // a=ice-ufrag:F7gI
+                            name: 'iceUfrag',
+                            reg: /^ice-ufrag:(\S*)/,
+                            format: 'ice-ufrag:%s',
+                        },
+                        {
+                            // a=ice-pwd:x9cml/YzichV2+XlhiMu8g
+                            name: 'icePwd',
+                            reg: /^ice-pwd:(\S*)/,
+                            format: 'ice-pwd:%s',
+                        },
+                        {
+                            // a=fingerprint:SHA-1 00:11:22:33:44:55:66:77:88:99:AA:BB:CC:DD:EE:FF:00:11:22:33
+                            name: 'fingerprint',
+                            reg: /^fingerprint:(\S*) (\S*)/,
+                            names: ['type', 'hash'],
+                            format: 'fingerprint:%s %s',
+                        },
+                        {
+                            // a=candidate:0 1 UDP 2113667327 203.0.113.1 54400 typ host
+                            // a=candidate:1162875081 1 udp 2113937151 192.168.34.75 60017 typ host generation 0 network-id 3 network-cost 10
+                            // a=candidate:3289912957 2 udp 1845501695 193.84.77.194 60017 typ srflx raddr 192.168.34.75 rport 60017 generation 0 network-id 3 network-cost 10
+                            // a=candidate:229815620 1 tcp 1518280447 192.168.150.19 60017 typ host tcptype active generation 0 network-id 3 network-cost 10
+                            // a=candidate:3289912957 2 tcp 1845501695 193.84.77.194 60017 typ srflx raddr 192.168.34.75 rport 60017 tcptype passive generation 0 network-id 3 network-cost 10
+                            push: 'candidates',
+                            reg: /^candidate:(\S*) (\d*) (\S*) (\d*) (\S*) (\d*) typ (\S*)(?: raddr (\S*) rport (\d*))?(?: tcptype (\S*))?(?: generation (\d*))?(?: network-id (\d*))?(?: network-cost (\d*))?/,
+                            names: [
+                                'foundation',
+                                'component',
+                                'transport',
+                                'priority',
+                                'ip',
+                                'port',
+                                'type',
+                                'raddr',
+                                'rport',
+                                'tcptype',
+                                'generation',
+                                'network-id',
+                                'network-cost',
+                            ],
+                            format: function (o) {
+                                var str = 'candidate:%s %d %s %d %s %d typ %s';
+
+                                str += o.raddr != null ? ' raddr %s rport %d' : '%v%v';
+
+                                // NB: candidate has three optional chunks, so %void middles one if it's missing
+                                str += o.tcptype != null ? ' tcptype %s' : '%v';
+
+                                if (o.generation != null) {
+                                    str += ' generation %d';
+                                }
+
+                                str += o['network-id'] != null ? ' network-id %d' : '%v';
+                                str += o['network-cost'] != null ? ' network-cost %d' : '%v';
+                                return str;
+                            },
+                        },
+                        {
+                            // a=end-of-candidates (keep after the candidates line for readability)
+                            name: 'endOfCandidates',
+                            reg: /^(end-of-candidates)/,
+                        },
+                        {
+                            // a=remote-candidates:1 203.0.113.1 54400 2 203.0.113.1 54401 ...
+                            name: 'remoteCandidates',
+                            reg: /^remote-candidates:(.*)/,
+                            format: 'remote-candidates:%s',
+                        },
+                        {
+                            // a=ice-options:google-ice
+                            name: 'iceOptions',
+                            reg: /^ice-options:(\S*)/,
+                            format: 'ice-options:%s',
+                        },
+                        {
+                            // a=ssrc:2566107569 cname:t9YU8M1UxTF8Y1A1
+                            push: 'ssrcs',
+                            reg: /^ssrc:(\d*) ([\w_-]*)(?::(.*))?/,
+                            names: ['id', 'attribute', 'value'],
+                            format: function (o) {
+                                var str = 'ssrc:%d';
+                                if (o.attribute != null) {
+                                    str += ' %s';
+                                    if (o.value != null) {
+                                        str += ':%s';
+                                    }
+                                }
+                                return str;
+                            },
+                        },
+                        {
+                            // a=ssrc-group:FEC 1 2
+                            // a=ssrc-group:FEC-FR 3004364195 1080772241
+                            push: 'ssrcGroups',
+                            // token-char = %x21 / %x23-27 / %x2A-2B / %x2D-2E / %x30-39 / %x41-5A / %x5E-7E
+                            reg: /^ssrc-group:([\x21\x23\x24\x25\x26\x27\x2A\x2B\x2D\x2E\w]*) (.*)/,
+                            names: ['semantics', 'ssrcs'],
+                            format: 'ssrc-group:%s %s',
+                        },
+                        {
+                            // a=msid-semantic: WMS Jvlam5X3SX1OP6pn20zWogvaKJz5Hjf9OnlV
+                            name: 'msidSemantic',
+                            reg: /^msid-semantic:\s?(\w*) (\S*)/,
+                            names: ['semantic', 'token'],
+                            format: 'msid-semantic: %s %s', // space after ':' is not accidental
+                        },
+                        {
+                            // a=group:BUNDLE audio video
+                            push: 'groups',
+                            reg: /^group:(\w*) (.*)/,
+                            names: ['type', 'mids'],
+                            format: 'group:%s %s',
+                        },
+                        {
+                            // a=rtcp-mux
+                            name: 'rtcpMux',
+                            reg: /^(rtcp-mux)/,
+                        },
+                        {
+                            // a=rtcp-rsize
+                            name: 'rtcpRsize',
+                            reg: /^(rtcp-rsize)/,
+                        },
+                        {
+                            // a=sctpmap:5000 webrtc-datachannel 1024
+                            name: 'sctpmap',
+                            reg: /^sctpmap:([\w_/]*) (\S*)(?: (\S*))?/,
+                            names: ['sctpmapNumber', 'app', 'maxMessageSize'],
+                            format: function (o) {
+                                return o.maxMessageSize != null ? 'sctpmap:%s %s %s' : 'sctpmap:%s %s';
+                            },
+                        },
+                        {
+                            // a=x-google-flag:conference
+                            name: 'xGoogleFlag',
+                            reg: /^x-google-flag:([^\s]*)/,
+                            format: 'x-google-flag:%s',
+                        },
+                        {
+                            // a=rid:1 send max-width=1280;max-height=720;max-fps=30;depend=0
+                            push: 'rids',
+                            reg: /^rid:([\d\w]+) (\w+)(?: ([\S| ]*))?/,
+                            names: ['id', 'direction', 'params'],
+                            format: function (o) {
+                                return o.params ? 'rid:%s %s %s' : 'rid:%s %s';
+                            },
+                        },
+                        {
+                            // a=imageattr:97 send [x=800,y=640,sar=1.1,q=0.6] [x=480,y=320] recv [x=330,y=250]
+                            // a=imageattr:* send [x=800,y=640] recv *
+                            // a=imageattr:100 recv [x=320,y=240]
+                            push: 'imageattrs',
+                            reg: new RegExp(
+                                // a=imageattr:97
+                                '^imageattr:(\\d+|\\*)' +
+                                    // send [x=800,y=640,sar=1.1,q=0.6] [x=480,y=320]
+                                    '[\\s\\t]+(send|recv)[\\s\\t]+(\\*|\\[\\S+\\](?:[\\s\\t]+\\[\\S+\\])*)' +
+                                    // recv [x=330,y=250]
+                                    '(?:[\\s\\t]+(recv|send)[\\s\\t]+(\\*|\\[\\S+\\](?:[\\s\\t]+\\[\\S+\\])*))?',
+                            ),
+                            names: ['pt', 'dir1', 'attrs1', 'dir2', 'attrs2'],
+                            format: function (o) {
+                                return 'imageattr:%s %s %s' + (o.dir2 ? ' %s %s' : '');
+                            },
+                        },
+                        {
+                            // a=simulcast:send 1,2,3;~4,~5 recv 6;~7,~8
+                            // a=simulcast:recv 1;4,5 send 6;7
+                            name: 'simulcast',
+                            reg: new RegExp(
+                                // a=simulcast:
+                                '^simulcast:' +
+                                    // send 1,2,3;~4,~5
+                                    '(send|recv) ([a-zA-Z0-9\\-_~;,]+)' +
+                                    // space + recv 6;~7,~8
+                                    '(?:\\s?(send|recv) ([a-zA-Z0-9\\-_~;,]+))?' +
+                                    // end
+                                    '$',
+                            ),
+                            names: ['dir1', 'list1', 'dir2', 'list2'],
+                            format: function (o) {
+                                return 'simulcast:%s %s' + (o.dir2 ? ' %s %s' : '');
+                            },
+                        },
+                        {
+                            // old simulcast draft 03 (implemented by Firefox)
+                            //   https://tools.ietf.org/html/draft-ietf-mmusic-sdp-simulcast-03
+                            // a=simulcast: recv pt=97;98 send pt=97
+                            // a=simulcast: send rid=5;6;7 paused=6,7
+                            name: 'simulcast_03',
+                            reg: /^simulcast:[\s\t]+([\S+\s\t]+)$/,
+                            names: ['value'],
+                            format: 'simulcast: %s',
+                        },
+                        {
+                            // a=framerate:25
+                            // a=framerate:29.97
+                            name: 'framerate',
+                            reg: /^framerate:(\d+(?:$|\.\d+))/,
+                            format: 'framerate:%s',
+                        },
+                        {
+                            // RFC4570
+                            // a=source-filter: incl IN IP4 239.5.2.31 10.1.15.5
+                            name: 'sourceFilter',
+                            reg: /^source-filter: *(excl|incl) (\S*) (IP4|IP6|\*) (\S*) (.*)/,
+                            names: ['filterMode', 'netType', 'addressTypes', 'destAddress', 'srcList'],
+                            format: 'source-filter: %s %s %s %s %s',
+                        },
+                        {
+                            // a=bundle-only
+                            name: 'bundleOnly',
+                            reg: /^(bundle-only)/,
+                        },
+                        {
+                            // a=label:1
+                            name: 'label',
+                            reg: /^label:(.+)/,
+                            format: 'label:%s',
+                        },
+                        {
+                            // RFC version 26 for SCTP over DTLS
+                            // https://tools.ietf.org/html/draft-ietf-mmusic-sctp-sdp-26#section-5
+                            name: 'sctpPort',
+                            reg: /^sctp-port:(\d+)$/,
+                            format: 'sctp-port:%s',
+                        },
+                        {
+                            // RFC version 26 for SCTP over DTLS
+                            // https://tools.ietf.org/html/draft-ietf-mmusic-sctp-sdp-26#section-6
+                            name: 'maxMessageSize',
+                            reg: /^max-message-size:(\d+)$/,
+                            format: 'max-message-size:%s',
+                        },
+                        {
+                            // RFC7273
+                            // a=ts-refclk:ptp=IEEE1588-2008:39-A7-94-FF-FE-07-CB-D0:37
+                            push: 'tsRefClocks',
+                            reg: /^ts-refclk:([^\s=]*)(?:=(\S*))?/,
+                            names: ['clksrc', 'clksrcExt'],
+                            format: function (o) {
+                                return 'ts-refclk:%s' + (o.clksrcExt != null ? '=%s' : '');
+                            },
+                        },
+                        {
+                            // RFC7273
+                            // a=mediaclk:direct=963214424
+                            name: 'mediaClk',
+                            reg: /^mediaclk:(?:id=(\S*))? *([^\s=]*)(?:=(\S*))?(?: *rate=(\d+)\/(\d+))?/,
+                            names: ['id', 'mediaClockName', 'mediaClockValue', 'rateNumerator', 'rateDenominator'],
+                            format: function (o) {
+                                var str = 'mediaclk:';
+                                str += o.id != null ? 'id=%s %s' : '%v%s';
+                                str += o.mediaClockValue != null ? '=%s' : '';
+                                str += o.rateNumerator != null ? ' rate=%s' : '';
+                                str += o.rateDenominator != null ? '/%s' : '';
+                                return str;
+                            },
+                        },
+                        {
+                            // a=keywds:keywords
+                            name: 'keywords',
+                            reg: /^keywds:(.+)$/,
+                            format: 'keywds:%s',
+                        },
+                        {
+                            // a=content:main
+                            name: 'content',
+                            reg: /^content:(.+)/,
+                            format: 'content:%s',
+                        },
+                        // BFCP https://tools.ietf.org/html/rfc4583
+                        {
+                            // a=floorctrl:c-s
+                            name: 'bfcpFloorCtrl',
+                            reg: /^floorctrl:(c-only|s-only|c-s)/,
+                            format: 'floorctrl:%s',
+                        },
+                        {
+                            // a=confid:1
+                            name: 'bfcpConfId',
+                            reg: /^confid:(\d+)/,
+                            format: 'confid:%s',
+                        },
+                        {
+                            // a=userid:1
+                            name: 'bfcpUserId',
+                            reg: /^userid:(\d+)/,
+                            format: 'userid:%s',
+                        },
+                        {
+                            // a=floorid:1
+                            name: 'bfcpFloorId',
+                            reg: /^floorid:(.+) (?:m-stream|mstrm):(.+)/,
+                            names: ['id', 'mStream'],
+                            format: 'floorid:%s mstrm:%s',
+                        },
+                        {
+                            // any a= that we don't understand is kept verbatim on media.invalid
+                            push: 'invalid',
+                            names: ['value'],
+                        },
+                    ],
+                });
+
+                // set sensible defaults to avoid polluting the grammar with boring details
+                Object.keys(grammar).forEach(function (key) {
+                    var objs = grammar[key];
+                    objs.forEach(function (obj) {
+                        if (!obj.reg) {
+                            obj.reg = /(.*)/;
+                        }
+                        if (!obj.format) {
+                            obj.format = '%s';
+                        }
+                    });
+                });
+            },
+            {},
+        ],
+        44: [
+            function (require, module, exports) {
+                var parser = require('./parser');
+                var writer = require('./writer');
+
+                exports.write = writer;
+                exports.parse = parser.parse;
+                exports.parseParams = parser.parseParams;
+                exports.parseFmtpConfig = parser.parseFmtpConfig; // Alias of parseParams().
+                exports.parsePayloads = parser.parsePayloads;
+                exports.parseRemoteCandidates = parser.parseRemoteCandidates;
+                exports.parseImageAttributes = parser.parseImageAttributes;
+                exports.parseSimulcastStreamList = parser.parseSimulcastStreamList;
+            },
+            { './parser': 45, './writer': 46 },
+        ],
+        45: [
+            function (require, module, exports) {
+                var toIntIfInt = function (v) {
+                    return String(Number(v)) === v ? Number(v) : v;
+                };
+
+                var attachProperties = function (match, location, names, rawName) {
+                    if (rawName && !names) {
+                        location[rawName] = toIntIfInt(match[1]);
+                    } else {
+                        for (var i = 0; i < names.length; i += 1) {
+                            if (match[i + 1] != null) {
+                                location[names[i]] = toIntIfInt(match[i + 1]);
+                            }
+                        }
+                    }
+                };
+
+                var parseReg = function (obj, location, content) {
+                    var needsBlank = obj.name && obj.names;
+                    if (obj.push && !location[obj.push]) {
+                        location[obj.push] = [];
+                    } else if (needsBlank && !location[obj.name]) {
+                        location[obj.name] = {};
+                    }
+                    var keyLocation = obj.push
+                        ? {} // blank object that will be pushed
+                        : needsBlank
+                        ? location[obj.name]
+                        : location; // otherwise, named location or root
+
+                    attachProperties(content.match(obj.reg), keyLocation, obj.names, obj.name);
+
+                    if (obj.push) {
+                        location[obj.push].push(keyLocation);
+                    }
+                };
+
+                var grammar = require('./grammar');
+                var validLine = RegExp.prototype.test.bind(/^([a-z])=(.*)/);
+
+                exports.parse = function (sdp) {
+                    var session = {},
+                        media = [],
+                        location = session; // points at where properties go under (one of the above)
+
+                    // parse lines we understand
+                    sdp.split(/(\r\n|\r|\n)/)
+                        .filter(validLine)
+                        .forEach(function (l) {
+                            var type = l[0];
+                            var content = l.slice(2);
+                            if (type === 'm') {
+                                media.push({ rtp: [], fmtp: [] });
+                                location = media[media.length - 1]; // point at latest media line
+                            }
+
+                            for (var j = 0; j < (grammar[type] || []).length; j += 1) {
+                                var obj = grammar[type][j];
+                                if (obj.reg.test(content)) {
+                                    return parseReg(obj, location, content);
+                                }
+                            }
+                        });
+
+                    session.media = media; // link it up
+                    return session;
+                };
+
+                var paramReducer = function (acc, expr) {
+                    var s = expr.split(/=(.+)/, 2);
+                    if (s.length === 2) {
+                        acc[s[0]] = toIntIfInt(s[1]);
+                    } else if (s.length === 1 && expr.length > 1) {
+                        acc[s[0]] = undefined;
+                    }
+                    return acc;
+                };
+
+                exports.parseParams = function (str) {
+                    return str.split(/;\s?/).reduce(paramReducer, {});
+                };
+
+                // For backward compatibility - alias will be removed in 3.0.0
+                exports.parseFmtpConfig = exports.parseParams;
+
+                exports.parsePayloads = function (str) {
+                    return str.toString().split(' ').map(Number);
+                };
+
+                exports.parseRemoteCandidates = function (str) {
+                    var candidates = [];
+                    var parts = str.split(' ').map(toIntIfInt);
+                    for (var i = 0; i < parts.length; i += 3) {
+                        candidates.push({
+                            component: parts[i],
+                            ip: parts[i + 1],
+                            port: parts[i + 2],
+                        });
+                    }
+                    return candidates;
+                };
+
+                exports.parseImageAttributes = function (str) {
+                    return str.split(' ').map(function (item) {
+                        return item
+                            .substring(1, item.length - 1)
+                            .split(',')
+                            .reduce(paramReducer, {});
+                    });
+                };
+
+                exports.parseSimulcastStreamList = function (str) {
+                    return str.split(';').map(function (stream) {
+                        return stream.split(',').map(function (format) {
+                            var scid,
+                                paused = false;
+
+                            if (format[0] !== '~') {
+                                scid = toIntIfInt(format);
+                            } else {
+                                scid = toIntIfInt(format.substring(1, format.length));
+                                paused = true;
+                            }
+
+                            return {
+                                scid: scid,
+                                paused: paused,
+                            };
+                        });
+                    });
+                };
+            },
+            { './grammar': 43 },
+        ],
+        46: [
+            function (require, module, exports) {
+                var grammar = require('./grammar');
+
+                // customized util.format - discards excess arguments and can void middle ones
+                var formatRegExp = /%[sdv%]/g;
+                var format = function (formatStr) {
+                    var i = 1;
+                    var args = arguments;
+                    var len = args.length;
+                    return formatStr.replace(formatRegExp, function (x) {
+                        if (i >= len) {
+                            return x; // missing argument
+                        }
+                        var arg = args[i];
+                        i += 1;
+                        switch (x) {
+                            case '%%':
+                                return '%';
+                            case '%s':
+                                return String(arg);
+                            case '%d':
+                                return Number(arg);
+                            case '%v':
+                                return '';
+                        }
+                    });
+                    // NB: we discard excess arguments - they are typically undefined from makeLine
+                };
+
+                var makeLine = function (type, obj, location) {
+                    var str =
+                        obj.format instanceof Function
+                            ? obj.format(obj.push ? location : location[obj.name])
+                            : obj.format;
+
+                    var args = [type + '=' + str];
+                    if (obj.names) {
+                        for (var i = 0; i < obj.names.length; i += 1) {
+                            var n = obj.names[i];
+                            if (obj.name) {
+                                args.push(location[obj.name][n]);
+                            } else {
+                                // for mLine and push attributes
+                                args.push(location[obj.names[i]]);
+                            }
+                        }
+                    } else {
+                        args.push(location[obj.name]);
+                    }
+                    return format.apply(null, args);
+                };
+
+                // RFC specified order
+                // TODO: extend this with all the rest
+                var defaultOuterOrder = ['v', 'o', 's', 'i', 'u', 'e', 'p', 'c', 'b', 't', 'r', 'z', 'a'];
+                var defaultInnerOrder = ['i', 'c', 'b', 'a'];
+
+                module.exports = function (session, opts) {
+                    opts = opts || {};
+                    // ensure certain properties exist
+                    if (session.version == null) {
+                        session.version = 0; // 'v=0' must be there (only defined version atm)
+                    }
+                    if (session.name == null) {
+                        session.name = ' '; // 's= ' must be there if no meaningful name set
+                    }
+                    session.media.forEach(function (mLine) {
+                        if (mLine.payloads == null) {
+                            mLine.payloads = '';
+                        }
+                    });
+
+                    var outerOrder = opts.outerOrder || defaultOuterOrder;
+                    var innerOrder = opts.innerOrder || defaultInnerOrder;
+                    var sdp = [];
+
+                    // loop through outerOrder for matching properties on session
+                    outerOrder.forEach(function (type) {
+                        grammar[type].forEach(function (obj) {
+                            if (obj.name in session && session[obj.name] != null) {
+                                sdp.push(makeLine(type, obj, session));
+                            } else if (obj.push in session && session[obj.push] != null) {
+                                session[obj.push].forEach(function (el) {
+                                    sdp.push(makeLine(type, obj, el));
+                                });
+                            }
+                        });
+                    });
+
+                    // then for each media line, follow the innerOrder
+                    session.media.forEach(function (mLine) {
+                        sdp.push(makeLine('m', grammar.m[0], mLine));
+
+                        innerOrder.forEach(function (type) {
+                            grammar[type].forEach(function (obj) {
+                                if (obj.name in mLine && mLine[obj.name] != null) {
+                                    sdp.push(makeLine(type, obj, mLine));
+                                } else if (obj.push in mLine && mLine[obj.push] != null) {
+                                    mLine[obj.push].forEach(function (el) {
+                                        sdp.push(makeLine(type, obj, el));
+                                    });
+                                }
+                            });
+                        });
+                    });
+
+                    return sdp.join('\r\n') + '\r\n';
+                };
+            },
+            { './grammar': 43 },
+        ],
+        47: [
+            function (require, module, exports) {
+                // Copyright Joyent, Inc. and other Node contributors.
+                //
+                // Permission is hereby granted, free of charge, to any person obtaining a
+                // copy of this software and associated documentation files (the
+                // "Software"), to deal in the Software without restriction, including
+                // without limitation the rights to use, copy, modify, merge, publish,
+                // distribute, sublicense, and/or sell copies of the Software, and to permit
+                // persons to whom the Software is furnished to do so, subject to the
+                // following conditions:
+                //
+                // The above copyright notice and this permission notice shall be included
+                // in all copies or substantial portions of the Software.
+                //
+                // THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+                // OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+                // MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+                // NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+                // DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+                // OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+                // USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+                'use strict';
+
+                var R = typeof Reflect === 'object' ? Reflect : null;
+                var ReflectApply =
+                    R && typeof R.apply === 'function'
+                        ? R.apply
+                        : function ReflectApply(target, receiver, args) {
+                              return Function.prototype.apply.call(target, receiver, args);
+                          };
+
+                var ReflectOwnKeys;
+                if (R && typeof R.ownKeys === 'function') {
+                    ReflectOwnKeys = R.ownKeys;
+                } else if (Object.getOwnPropertySymbols) {
+                    ReflectOwnKeys = function ReflectOwnKeys(target) {
+                        return Object.getOwnPropertyNames(target).concat(Object.getOwnPropertySymbols(target));
+                    };
+                } else {
+                    ReflectOwnKeys = function ReflectOwnKeys(target) {
+                        return Object.getOwnPropertyNames(target);
+                    };
+                }
+
+                function ProcessEmitWarning(warning) {
+                    if (console && console.warn) console.warn(warning);
+                }
+
+                var NumberIsNaN =
+                    Number.isNaN ||
+                    function NumberIsNaN(value) {
+                        return value !== value;
+                    };
+
+                function EventEmitter() {
+                    EventEmitter.init.call(this);
+                }
+                module.exports = EventEmitter;
+                module.exports.once = once;
+
+                // Backwards-compat with node 0.10.x
+                EventEmitter.EventEmitter = EventEmitter;
+
+                EventEmitter.prototype._events = undefined;
+                EventEmitter.prototype._eventsCount = 0;
+                EventEmitter.prototype._maxListeners = undefined;
+
+                // By default EventEmitters will print a warning if more than 10 listeners are
+                // added to it. This is a useful default which helps finding memory leaks.
+                var defaultMaxListeners = 10;
+
+                function checkListener(listener) {
+                    if (typeof listener !== 'function') {
+                        throw new TypeError(
+                            'The "listener" argument must be of type Function. Received type ' + typeof listener,
+                        );
+                    }
+                }
+
+                Object.defineProperty(EventEmitter, 'defaultMaxListeners', {
+                    enumerable: true,
+                    get: function () {
+                        return defaultMaxListeners;
+                    },
+                    set: function (arg) {
+                        if (typeof arg !== 'number' || arg < 0 || NumberIsNaN(arg)) {
+                            throw new RangeError(
+                                'The value of "defaultMaxListeners" is out of range. It must be a non-negative number. Received ' +
+                                    arg +
+                                    '.',
+                            );
+                        }
+                        defaultMaxListeners = arg;
+                    },
+                });
+
+                EventEmitter.init = function () {
+                    if (this._events === undefined || this._events === Object.getPrototypeOf(this)._events) {
+                        this._events = Object.create(null);
+                        this._eventsCount = 0;
+                    }
+
+                    this._maxListeners = this._maxListeners || undefined;
+                };
+
+                // Obviously not all Emitters should be limited to 10. This function allows
+                // that to be increased. Set to zero for unlimited.
+                EventEmitter.prototype.setMaxListeners = function setMaxListeners(n) {
+                    if (typeof n !== 'number' || n < 0 || NumberIsNaN(n)) {
+                        throw new RangeError(
+                            'The value of "n" is out of range. It must be a non-negative number. Received ' + n + '.',
+                        );
+                    }
+                    this._maxListeners = n;
+                    return this;
+                };
+
+                function _getMaxListeners(that) {
+                    if (that._maxListeners === undefined) return EventEmitter.defaultMaxListeners;
+                    return that._maxListeners;
+                }
+
+                EventEmitter.prototype.getMaxListeners = function getMaxListeners() {
+                    return _getMaxListeners(this);
+                };
+
+                EventEmitter.prototype.emit = function emit(type) {
+                    var args = [];
+                    for (var i = 1; i < arguments.length; i++) args.push(arguments[i]);
+                    var doError = type === 'error';
+
+                    var events = this._events;
+                    if (events !== undefined) doError = doError && events.error === undefined;
+                    else if (!doError) return false;
+
+                    // If there is no 'error' event listener then throw.
+                    if (doError) {
+                        var er;
+                        if (args.length > 0) er = args[0];
+                        if (er instanceof Error) {
+                            // Note: The comments on the `throw` lines are intentional, they show
+                            // up in Node's output if this results in an unhandled exception.
+                            throw er; // Unhandled 'error' event
+                        }
+                        // At least give some kind of context to the user
+                        var err = new Error('Unhandled error.' + (er ? ' (' + er.message + ')' : ''));
+                        err.context = er;
+                        throw err; // Unhandled 'error' event
+                    }
+
+                    var handler = events[type];
+
+                    if (handler === undefined) return false;
+
+                    if (typeof handler === 'function') {
+                        ReflectApply(handler, this, args);
+                    } else {
+                        var len = handler.length;
+                        var listeners = arrayClone(handler, len);
+                        for (var i = 0; i < len; ++i) ReflectApply(listeners[i], this, args);
+                    }
+
+                    return true;
+                };
+
+                function _addListener(target, type, listener, prepend) {
+                    var m;
+                    var events;
+                    var existing;
+
+                    checkListener(listener);
+
+                    events = target._events;
+                    if (events === undefined) {
+                        events = target._events = Object.create(null);
+                        target._eventsCount = 0;
+                    } else {
+                        // To avoid recursion in the case that type === "newListener"! Before
+                        // adding it to the listeners, first emit "newListener".
+                        if (events.newListener !== undefined) {
+                            target.emit('newListener', type, listener.listener ? listener.listener : listener);
+
+                            // Re-assign `events` because a newListener handler could have caused the
+                            // this._events to be assigned to a new object
+                            events = target._events;
+                        }
+                        existing = events[type];
+                    }
+
+                    if (existing === undefined) {
+                        // Optimize the case of one listener. Don't need the extra array object.
+                        existing = events[type] = listener;
+                        ++target._eventsCount;
+                    } else {
+                        if (typeof existing === 'function') {
+                            // Adding the second element, need to change to array.
+                            existing = events[type] = prepend ? [listener, existing] : [existing, listener];
+                            // If we've already got an array, just append.
+                        } else if (prepend) {
+                            existing.unshift(listener);
+                        } else {
+                            existing.push(listener);
+                        }
+
+                        // Check for listener leak
+                        m = _getMaxListeners(target);
+                        if (m > 0 && existing.length > m && !existing.warned) {
+                            existing.warned = true;
+                            // No error code for this since it is a Warning
+                            // eslint-disable-next-line no-restricted-syntax
+                            var w = new Error(
+                                'Possible EventEmitter memory leak detected. ' +
+                                    existing.length +
+                                    ' ' +
+                                    String(type) +
+                                    ' listeners ' +
+                                    'added. Use emitter.setMaxListeners() to ' +
+                                    'increase limit',
+                            );
+                            w.name = 'MaxListenersExceededWarning';
+                            w.emitter = target;
+                            w.type = type;
+                            w.count = existing.length;
+                            ProcessEmitWarning(w);
+                        }
+                    }
+
+                    return target;
+                }
+
+                EventEmitter.prototype.addListener = function addListener(type, listener) {
+                    return _addListener(this, type, listener, false);
+                };
+
+                EventEmitter.prototype.on = EventEmitter.prototype.addListener;
+
+                EventEmitter.prototype.prependListener = function prependListener(type, listener) {
+                    return _addListener(this, type, listener, true);
+                };
+
+                function onceWrapper() {
+                    if (!this.fired) {
+                        this.target.removeListener(this.type, this.wrapFn);
+                        this.fired = true;
+                        if (arguments.length === 0) return this.listener.call(this.target);
+                        return this.listener.apply(this.target, arguments);
+                    }
+                }
+
+                function _onceWrap(target, type, listener) {
+                    var state = { fired: false, wrapFn: undefined, target: target, type: type, listener: listener };
+                    var wrapped = onceWrapper.bind(state);
+                    wrapped.listener = listener;
+                    state.wrapFn = wrapped;
+                    return wrapped;
+                }
+
+                EventEmitter.prototype.once = function once(type, listener) {
+                    checkListener(listener);
+                    this.on(type, _onceWrap(this, type, listener));
+                    return this;
+                };
+
+                EventEmitter.prototype.prependOnceListener = function prependOnceListener(type, listener) {
+                    checkListener(listener);
+                    this.prependListener(type, _onceWrap(this, type, listener));
+                    return this;
+                };
+
+                // Emits a 'removeListener' event if and only if the listener was removed.
+                EventEmitter.prototype.removeListener = function removeListener(type, listener) {
+                    var list, events, position, i, originalListener;
+
+                    checkListener(listener);
+
+                    events = this._events;
+                    if (events === undefined) return this;
+
+                    list = events[type];
+                    if (list === undefined) return this;
+
+                    if (list === listener || list.listener === listener) {
+                        if (--this._eventsCount === 0) this._events = Object.create(null);
+                        else {
+                            delete events[type];
+                            if (events.removeListener) this.emit('removeListener', type, list.listener || listener);
+                        }
+                    } else if (typeof list !== 'function') {
+                        position = -1;
+
+                        for (i = list.length - 1; i >= 0; i--) {
+                            if (list[i] === listener || list[i].listener === listener) {
+                                originalListener = list[i].listener;
+                                position = i;
+                                break;
+                            }
+                        }
+
+                        if (position < 0) return this;
+
+                        if (position === 0) list.shift();
+                        else {
+                            spliceOne(list, position);
+                        }
+
+                        if (list.length === 1) events[type] = list[0];
+
+                        if (events.removeListener !== undefined)
+                            this.emit('removeListener', type, originalListener || listener);
+                    }
+
+                    return this;
+                };
+
+                EventEmitter.prototype.off = EventEmitter.prototype.removeListener;
+
+                EventEmitter.prototype.removeAllListeners = function removeAllListeners(type) {
+                    var listeners, events, i;
+
+                    events = this._events;
+                    if (events === undefined) return this;
+
+                    // not listening for removeListener, no need to emit
+                    if (events.removeListener === undefined) {
+                        if (arguments.length === 0) {
+                            this._events = Object.create(null);
+                            this._eventsCount = 0;
+                        } else if (events[type] !== undefined) {
+                            if (--this._eventsCount === 0) this._events = Object.create(null);
+                            else delete events[type];
+                        }
+                        return this;
+                    }
+
+                    // emit removeListener for all listeners on all events
+                    if (arguments.length === 0) {
+                        var keys = Object.keys(events);
+                        var key;
+                        for (i = 0; i < keys.length; ++i) {
+                            key = keys[i];
+                            if (key === 'removeListener') continue;
+                            this.removeAllListeners(key);
+                        }
+                        this.removeAllListeners('removeListener');
+                        this._events = Object.create(null);
+                        this._eventsCount = 0;
+                        return this;
+                    }
+
+                    listeners = events[type];
+
+                    if (typeof listeners === 'function') {
+                        this.removeListener(type, listeners);
+                    } else if (listeners !== undefined) {
+                        // LIFO order
+                        for (i = listeners.length - 1; i >= 0; i--) {
+                            this.removeListener(type, listeners[i]);
+                        }
+                    }
+
+                    return this;
+                };
+
+                function _listeners(target, type, unwrap) {
+                    var events = target._events;
+
+                    if (events === undefined) return [];
+
+                    var evlistener = events[type];
+                    if (evlistener === undefined) return [];
+
+                    if (typeof evlistener === 'function')
+                        return unwrap ? [evlistener.listener || evlistener] : [evlistener];
+
+                    return unwrap ? unwrapListeners(evlistener) : arrayClone(evlistener, evlistener.length);
+                }
+
+                EventEmitter.prototype.listeners = function listeners(type) {
+                    return _listeners(this, type, true);
+                };
+
+                EventEmitter.prototype.rawListeners = function rawListeners(type) {
+                    return _listeners(this, type, false);
+                };
+
+                EventEmitter.listenerCount = function (emitter, type) {
+                    if (typeof emitter.listenerCount === 'function') {
+                        return emitter.listenerCount(type);
+                    } else {
+                        return listenerCount.call(emitter, type);
+                    }
+                };
+
+                EventEmitter.prototype.listenerCount = listenerCount;
+                function listenerCount(type) {
+                    var events = this._events;
+
+                    if (events !== undefined) {
+                        var evlistener = events[type];
+
+                        if (typeof evlistener === 'function') {
+                            return 1;
+                        } else if (evlistener !== undefined) {
+                            return evlistener.length;
+                        }
+                    }
+
+                    return 0;
+                }
+
+                EventEmitter.prototype.eventNames = function eventNames() {
+                    return this._eventsCount > 0 ? ReflectOwnKeys(this._events) : [];
+                };
+
+                function arrayClone(arr, n) {
+                    var copy = new Array(n);
+                    for (var i = 0; i < n; ++i) copy[i] = arr[i];
+                    return copy;
+                }
+
+                function spliceOne(list, index) {
+                    for (; index + 1 < list.length; index++) list[index] = list[index + 1];
+                    list.pop();
+                }
+
+                function unwrapListeners(arr) {
+                    var ret = new Array(arr.length);
+                    for (var i = 0; i < ret.length; ++i) {
+                        ret[i] = arr[i].listener || arr[i];
+                    }
+                    return ret;
+                }
+
+                function once(emitter, name) {
+                    return new Promise(function (resolve, reject) {
+                        function errorListener(err) {
+                            emitter.removeListener(name, resolver);
+                            reject(err);
+                        }
+
+                        function resolver() {
+                            if (typeof emitter.removeListener === 'function') {
+                                emitter.removeListener('error', errorListener);
+                            }
+                            resolve([].slice.call(arguments));
+                        }
+
+                        eventTargetAgnosticAddListener(emitter, name, resolver, { once: true });
+                        if (name !== 'error') {
+                            addErrorHandlerIfEventEmitter(emitter, errorListener, { once: true });
+                        }
+                    });
+                }
+
+                function addErrorHandlerIfEventEmitter(emitter, handler, flags) {
+                    if (typeof emitter.on === 'function') {
+                        eventTargetAgnosticAddListener(emitter, 'error', handler, flags);
+                    }
+                }
+
+                function eventTargetAgnosticAddListener(emitter, name, listener, flags) {
+                    if (typeof emitter.on === 'function') {
+                        if (flags.once) {
+                            emitter.once(name, listener);
+                        } else {
+                            emitter.on(name, listener);
+                        }
+                    } else if (typeof emitter.addEventListener === 'function') {
+                        // EventTarget does not have `error` event semantics like Node
+                        // EventEmitters, we do not listen for `error` events here.
+                        emitter.addEventListener(name, function wrapListener(arg) {
+                            // IE does not have builtin `{ once: true }` support so we
+                            // have to do it manually.
+                            if (flags.once) {
+                                emitter.removeEventListener(name, wrapListener);
+                            }
+                            listener(arg);
+                        });
+                    } else {
+                        throw new TypeError(
+                            'The "emitter" argument must be of type EventEmitter. Received type ' + typeof emitter,
+                        );
+                    }
+                }
+            },
+            {},
+        ],
+        48: [
+            function (require, module, exports) {
+                // shim for using process in browser
+                var process = (module.exports = {});
+
+                // cached from whatever global is present so that test runners that stub it
+                // don't break things.  But we need to wrap it in a try catch in case it is
+                // wrapped in strict mode code which doesn't define any globals.  It's inside a
+                // function because try/catches deoptimize in certain engines.
+
+                var cachedSetTimeout;
+                var cachedClearTimeout;
+
+                function defaultSetTimout() {
+                    throw new Error('setTimeout has not been defined');
+                }
+                function defaultClearTimeout() {
+                    throw new Error('clearTimeout has not been defined');
+                }
+                (function () {
+                    try {
+                        if (typeof setTimeout === 'function') {
+                            cachedSetTimeout = setTimeout;
+                        } else {
+                            cachedSetTimeout = defaultSetTimout;
+                        }
+                    } catch (e) {
+                        cachedSetTimeout = defaultSetTimout;
+                    }
+                    try {
+                        if (typeof clearTimeout === 'function') {
+                            cachedClearTimeout = clearTimeout;
+                        } else {
+                            cachedClearTimeout = defaultClearTimeout;
+                        }
+                    } catch (e) {
+                        cachedClearTimeout = defaultClearTimeout;
+                    }
+                })();
+                function runTimeout(fun) {
+                    if (cachedSetTimeout === setTimeout) {
+                        //normal enviroments in sane situations
+                        return setTimeout(fun, 0);
+                    }
+                    // if setTimeout wasn't available but was latter defined
+                    if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) {
+                        cachedSetTimeout = setTimeout;
+                        return setTimeout(fun, 0);
+                    }
+                    try {
+                        // when when somebody has screwed with setTimeout but no I.E. maddness
+                        return cachedSetTimeout(fun, 0);
+                    } catch (e) {
+                        try {
+                            // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally
+                            return cachedSetTimeout.call(null, fun, 0);
+                        } catch (e) {
+                            // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error
+                            return cachedSetTimeout.call(this, fun, 0);
+                        }
+                    }
+                }
+                function runClearTimeout(marker) {
+                    if (cachedClearTimeout === clearTimeout) {
+                        //normal enviroments in sane situations
+                        return clearTimeout(marker);
+                    }
+                    // if clearTimeout wasn't available but was latter defined
+                    if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) {
+                        cachedClearTimeout = clearTimeout;
+                        return clearTimeout(marker);
+                    }
+                    try {
+                        // when when somebody has screwed with setTimeout but no I.E. maddness
+                        return cachedClearTimeout(marker);
+                    } catch (e) {
+                        try {
+                            // When we are in I.E. but the script has been evaled so I.E. doesn't  trust the global object when called normally
+                            return cachedClearTimeout.call(null, marker);
+                        } catch (e) {
+                            // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error.
+                            // Some versions of I.E. have different rules for clearTimeout vs setTimeout
+                            return cachedClearTimeout.call(this, marker);
+                        }
+                    }
+                }
+                var queue = [];
+                var draining = false;
+                var currentQueue;
+                var queueIndex = -1;
+
+                function cleanUpNextTick() {
+                    if (!draining || !currentQueue) {
+                        return;
+                    }
+                    draining = false;
+                    if (currentQueue.length) {
+                        queue = currentQueue.concat(queue);
+                    } else {
+                        queueIndex = -1;
+                    }
+                    if (queue.length) {
+                        drainQueue();
+                    }
+                }
+
+                function drainQueue() {
+                    if (draining) {
+                        return;
+                    }
+                    var timeout = runTimeout(cleanUpNextTick);
+                    draining = true;
+
+                    var len = queue.length;
+                    while (len) {
+                        currentQueue = queue;
+                        queue = [];
+                        while (++queueIndex < len) {
+                            if (currentQueue) {
+                                currentQueue[queueIndex].run();
+                            }
+                        }
+                        queueIndex = -1;
+                        len = queue.length;
+                    }
+                    currentQueue = null;
+                    draining = false;
+                    runClearTimeout(timeout);
+                }
+
+                process.nextTick = function (fun) {
+                    var args = new Array(arguments.length - 1);
+                    if (arguments.length > 1) {
+                        for (var i = 1; i < arguments.length; i++) {
+                            args[i - 1] = arguments[i];
+                        }
+                    }
+                    queue.push(new Item(fun, args));
+                    if (queue.length === 1 && !draining) {
+                        runTimeout(drainQueue);
+                    }
+                };
+
+                // v8 likes predictible objects
+                function Item(fun, array) {
+                    this.fun = fun;
+                    this.array = array;
+                }
+                Item.prototype.run = function () {
+                    this.fun.apply(null, this.array);
+                };
+                process.title = 'browser';
+                process.browser = true;
+                process.env = {};
+                process.argv = [];
+                process.version = ''; // empty string to avoid regexp issues
+                process.versions = {};
+
+                function noop() {}
+
+                process.on = noop;
+                process.addListener = noop;
+                process.once = noop;
+                process.off = noop;
+                process.removeListener = noop;
+                process.removeAllListeners = noop;
+                process.emit = noop;
+                process.prependListener = noop;
+                process.prependOnceListener = noop;
+
+                process.listeners = function (name) {
+                    return [];
+                };
+
+                process.binding = function (name) {
+                    throw new Error('process.binding is not supported');
+                };
+
+                process.cwd = function () {
+                    return '/';
+                };
+                process.chdir = function (dir) {
+                    throw new Error('process.chdir is not supported');
+                };
+                process.umask = function () {
+                    return 0;
+                };
+            },
+            {},
+        ],
+    },
+    {},
+    [1],
+);
diff --git a/public/modules/MediasoupClientCompile.js b/public/modules/MediasoupClientCompile.js
new file mode 100644
index 00000000..d55a4a0b
--- /dev/null
+++ b/public/modules/MediasoupClientCompile.js
@@ -0,0 +1,2 @@
+const client = require('mediasoup-client');
+window.mediasoupClient = client;
diff --git a/public/newroom.html b/public/newroom.html
new file mode 100755
index 00000000..53ca0ac8
--- /dev/null
+++ b/public/newroom.html
@@ -0,0 +1,159 @@
+<!DOCTYPE html>
+<html lang="en" class="no-js">
+    <head>
+        <!-- Title and Icon -->
+
+        <title>MiroTalk SFU - Create your Room name and start the new call.</title>
+        <link rel="shortcut icon" href="images/logo.svg" />
+        <link rel="apple-touch-icon" href="images/logo.svg" />
+
+        <!-- Meta Information -->
+
+        <meta charset="utf-8" />
+        <meta http-equiv="X-UA-Compatible" content="IE=edge" />
+        <meta name="viewport" content="width=device-width, initial-scale=1.0" />
+
+        <meta
+            name="description"
+            content="MiroTalk SFU powered by WebRTC and mediasoup, Real-time secure video calls, messaging and screen sharing capabilities in the browser."
+        />
+        <meta
+            name="keywords"
+            content="webrtc, mediasoup, mediasoup-client, self hosted, voip, sip, real-time communications, chat, messaging, meet, webrtc stun, webrtc turn, video meeting, video chat, video conference, multi video chat, multi video conference, peer to peer, p2p, rtc, alternative to, zoom, microsoft teams, google meet, jitsi, meeting"
+        />
+
+        <!-- https://ogp.me -->
+
+        <meta property="og:type" content="app-webrtc" />
+        <meta property="og:site_name" content="MiroTalk SFU" />
+        <meta property="og:title" content="Click the link to make a call." />
+        <meta
+            property="og:description"
+            content="MiroTalk SFU calling provides real-time video calls, messaging and screen sharing."
+        />
+        <meta property="og:image" content="images/mirotalksfu.png" />
+
+        <!-- StyleSheet -->
+        <link rel="stylesheet" href="https://fonts.googleapis.com/css?family=IBM+Plex+Sans:400,600" />
+        <link rel="stylesheet" href="css/landing.css" />
+
+        <!-- Js scripts -->
+
+        <script src="https://unpkg.com/animejs@3.0.1/lib/anime.min.js"></script>
+        <script src="https://unpkg.com/scrollreveal@4.0.0/dist/scrollreveal.min.js"></script>
+    </head>
+    <body class="is-boxed has-animations">
+        <div class="body-wrap">
+            <header class="site-header">
+                <div class="container">
+                    <div class="site-header-inner">
+                        <div class="brand header-brand">
+                            <h1 class="m-0">
+                                <a href="/">
+                                    <img class="header-logo-image" src="images/logo.svg" alt="Logo" />
+                                </a>
+                            </h1>
+                        </div>
+                    </div>
+                </div>
+            </header>
+
+            <main>
+                <section class="hero">
+                    <div class="container">
+                        <div class="hero-inner">
+                            <div class="hero-copy">
+                                <h1 class="hero-title mt-0">
+                                    Pick name. <br />
+                                    Share URL. <br />
+                                    Start conference.
+                                </h1>
+                                <p class="hero-paragraph">
+                                    Each room has its own disposable URL. Just pick a room name and share your custom
+                                    URL. It's really that easy.
+                                </p>
+                            </div>
+                            <div class="hero-figure anime-element">
+                                <svg class="placeholder" width="528" height="396" viewBox="0 0 528 396">
+                                    <rect width="528" height="396" style="fill: transparent" />
+                                </svg>
+                                <div class="hero-figure-box hero-figure-box-01" data-rotation="45deg"></div>
+                                <div class="hero-figure-box hero-figure-box-02" data-rotation="-45deg"></div>
+                                <div class="hero-figure-box hero-figure-box-03" data-rotation="0deg"></div>
+                                <div class="hero-figure-box hero-figure-box-04" data-rotation="-135deg"></div>
+                                <div class="hero-figure-box hero-figure-box-05"></div>
+                                <div class="hero-figure-box hero-figure-box-06"></div>
+                                <div class="hero-figure-box hero-figure-box-07"></div>
+                                <div class="hero-figure-box hero-figure-box-08" data-rotation="-22deg"></div>
+                                <div class="hero-figure-box hero-figure-box-09" data-rotation="-52deg"></div>
+                                <div class="hero-figure-box hero-figure-box-10" data-rotation="-50deg"></div>
+                            </div>
+                        </div>
+                    </div>
+                </section>
+
+                <hr />
+
+                <section class="cta section">
+                    <div class="container">
+                        <div class="cta-inner section-inner">
+                            <h3 class="section-title mt-0">
+                                Pick a room name.<br />
+                                How about this one?
+                            </h3>
+                            <div>
+                                <div class="mb-24">
+                                    <label for="roomName"></label>
+                                    <input class="button" type="text" id="roomName" value="" />
+                                    <button
+                                        class="button button-primary button-wide-mobile pulse"
+                                        onclick="{window.location.href = '/join/' + document.getElementById('roomName').value}"
+                                    >
+                                        Join to room
+                                    </button>
+                                </div>
+                            </div>
+                        </div>
+                    </div>
+                </section>
+            </main>
+
+            <footer class="site-footer">
+                <div class="container">
+                    <div class="site-footer-inner">
+                        <div class="brand footer-brand">
+                            <a href="/">
+                                <img class="header-logo-image" src="images/logo.svg" alt="Logo" />
+                            </a>
+                        </div>
+                        <ul class="footer-links list-reset">
+                            <li>
+                                Contact:
+                                <a target="_blank" href="https://www.linkedin.com/in/miroslav-pejic-976a07101/"
+                                    >Miroslav Pejic</a
+                                >
+                            </li>
+                        </ul>
+                        <ul class="footer-social-links list-reset">
+                            <li>
+                                <a target="_blank" href="https://github.com/miroslavpejic85/mirotalksfu">
+                                    <svg width="16" height="16" viewBox="0 0 16 16" xmlns="http://www.w3.org/2000/svg">
+                                        <title>GitHub</title>
+                                        <path
+                                            d="M7.95 0C3.578 0 0 3.578 0 7.95c0 3.479 2.286 6.46 5.466 7.553.397.1.497-.199.497-.397v-1.392c-2.187.497-2.683-.994-2.683-.994-.398-.894-.895-1.192-.895-1.192-.696-.497.1-.497.1-.497.795.1 1.192.795 1.192.795.696 1.292 1.888.894 2.286.696.1-.497.298-.895.497-1.093-1.79-.2-3.578-.895-3.578-3.976 0-.894.298-1.59.795-2.087-.1-.198-.397-.993.1-2.086 0 0 .695-.2 2.186.795a6.408 6.408 0 0 1 1.987-.299c.696 0 1.392.1 1.988.299 1.49-.994 2.186-.795 2.186-.795.398 1.093.199 1.888.1 2.086.496.597.795 1.292.795 2.087 0 3.081-1.889 3.677-3.677 3.876.298.398.596.895.596 1.59v2.187c0 .198.1.496.596.397C13.714 14.41 16 11.43 16 7.95 15.9 3.578 12.323 0 7.95 0z"
+                                            fill="#0270D7"
+                                        />
+                                    </svg>
+                                </a>
+                            </li>
+                        </ul>
+                        <div class="footer-copyright">&copy; 2021 MiroTalk SFU, all rights reserved</div>
+                    </div>
+                </div>
+            </footer>
+        </div>
+
+        <script src="js/landing.js"></script>
+        <script src="js/newroom.js"></script>
+    </body>
+</html>
diff --git a/public/permission.html b/public/permission.html
new file mode 100755
index 00000000..8e225e6c
--- /dev/null
+++ b/public/permission.html
@@ -0,0 +1,139 @@
+<!DOCTYPE html>
+<html lang="en" class="no-js">
+    <head>
+        <!-- Title and Icon -->
+
+        <title>MiroTalk SFU - Allow Video or Audio access to join in the Room.</title>
+        <link rel="shortcut icon" href="images/logo.svg" />
+        <link rel="apple-touch-icon" href="images/logo.svg" />
+
+        <!-- Meta Information -->
+
+        <meta charset="utf-8" />
+        <meta http-equiv="X-UA-Compatible" content="IE=edge" />
+        <meta name="viewport" content="width=device-width, initial-scale=1.0" />
+
+        <!-- https://ogp.me -->
+
+        <meta property="og:type" content="app-webrtc" />
+        <meta property="og:site_name" content="MiroTalk SFU" />
+        <meta property="og:title" content="Click the link to make a call." />
+        <meta
+            property="og:description"
+            content="MiroTalk SFU calling provides real-time HD quality and latency simply not available with traditional technology."
+        />
+        <meta property="og:image" content="/images/mirotalksfu.png" />
+
+        <!-- StyleSheet -->
+
+        <link rel="stylesheet" href="https://fonts.googleapis.com/css?family=IBM+Plex+Sans:400,600" />
+        <link rel="stylesheet" href="css/landing.css" />
+
+        <!-- Js scripts -->
+
+        <script src="https://unpkg.com/animejs@3.0.1/lib/anime.min.js"></script>
+        <script src="https://unpkg.com/scrollreveal@4.0.0/dist/scrollreveal.min.js"></script>
+    </head>
+    <body class="is-boxed has-animations">
+        <div class="body-wrap">
+            <header class="site-header">
+                <div class="container">
+                    <div class="site-header-inner">
+                        <div class="brand header-brand">
+                            <h1 class="m-0">
+                                <a href="/">
+                                    <img class="header-logo-image" src="images/logo.svg" alt="Logo" />
+                                </a>
+                            </h1>
+                        </div>
+                    </div>
+                </div>
+            </header>
+
+            <main>
+                <section class="hero">
+                    <div class="container">
+                        <div class="hero-inner">
+                            <div class="hero-copy">
+                                <h1 class="hero-title mt-0">Access denied.</h1>
+                                <p class="hero-paragraph" id="message"></p>
+                                <p class="hero-paragraph">
+                                    This app will not work without camera or microphone access. Please Try again and
+                                    allow it.
+                                </p>
+                                <script>
+                                    let qs = new URLSearchParams(window.location.search);
+                                    let room_id = qs.get('room_id');
+                                    let message = qs.get('message');
+                                    console.log('Allow Camera or Audio', {
+                                        room_id: room_id,
+                                        message: message,
+                                    });
+                                    document.getElementById('message').innerHTML = message;
+                                </script>
+                                <div class="hero-cta">
+                                    <a
+                                        class="button button-primary pulse"
+                                        onclick="room_id ? window.location.href = '/join/' + room_id : window.location.href = '/newroom';"
+                                        >TRY AGAIN</a
+                                    >
+                                </div>
+                            </div>
+                            <div class="hero-figure anime-element">
+                                <svg class="placeholder" width="528" height="396" viewBox="0 0 528 396">
+                                    <rect width="528" height="396" style="fill: transparent" />
+                                </svg>
+                                <div class="hero-figure-box hero-figure-box-01" data-rotation="45deg"></div>
+                                <div class="hero-figure-box hero-figure-box-02" data-rotation="-45deg"></div>
+                                <div class="hero-figure-box hero-figure-box-03" data-rotation="0deg"></div>
+                                <div class="hero-figure-box hero-figure-box-04" data-rotation="-135deg"></div>
+                                <div class="hero-figure-box hero-figure-box-05"></div>
+                                <div class="hero-figure-box hero-figure-box-06"></div>
+                                <div class="hero-figure-box hero-figure-box-07"></div>
+                                <div class="hero-figure-box hero-figure-box-08" data-rotation="-22deg"></div>
+                                <div class="hero-figure-box hero-figure-box-09" data-rotation="-52deg"></div>
+                                <div class="hero-figure-box hero-figure-box-10" data-rotation="-50deg"></div>
+                            </div>
+                        </div>
+                    </div>
+                </section>
+            </main>
+
+            <footer class="site-footer">
+                <div class="container">
+                    <div class="site-footer-inner">
+                        <div class="brand footer-brand">
+                            <a href="/">
+                                <img class="header-logo-image" src="images/logo.svg" alt="Logo" />
+                            </a>
+                        </div>
+                        <ul class="footer-links list-reset">
+                            <li>
+                                Contact:
+                                <a target="_blank" href="https://www.linkedin.com/in/miroslav-pejic-976a07101/"
+                                    >Miroslav Pejic</a
+                                >
+                            </li>
+                        </ul>
+                        <ul class="footer-social-links list-reset">
+                            <li>
+                                <a target="_blank" href="https://github.com/miroslavpejic85/mirotalksfu">
+                                    <svg width="16" height="16" viewBox="0 0 16 16" xmlns="http://www.w3.org/2000/svg">
+                                        <title>GitHub</title>
+                                        <path
+                                            d="M7.95 0C3.578 0 0 3.578 0 7.95c0 3.479 2.286 6.46 5.466 7.553.397.1.497-.199.497-.397v-1.392c-2.187.497-2.683-.994-2.683-.994-.398-.894-.895-1.192-.895-1.192-.696-.497.1-.497.1-.497.795.1 1.192.795 1.192.795.696 1.292 1.888.894 2.286.696.1-.497.298-.895.497-1.093-1.79-.2-3.578-.895-3.578-3.976 0-.894.298-1.59.795-2.087-.1-.198-.397-.993.1-2.086 0 0 .695-.2 2.186.795a6.408 6.408 0 0 1 1.987-.299c.696 0 1.392.1 1.988.299 1.49-.994 2.186-.795 2.186-.795.398 1.093.199 1.888.1 2.086.496.597.795 1.292.795 2.087 0 3.081-1.889 3.677-3.677 3.876.298.398.596.895.596 1.59v2.187c0 .198.1.496.596.397C13.714 14.41 16 11.43 16 7.95 15.9 3.578 12.323 0 7.95 0z"
+                                            fill="#0270D7"
+                                        />
+                                    </svg>
+                                </a>
+                            </li>
+                        </ul>
+                        <div class="footer-copyright">&copy; 2021 MiroTalk SFU, all rights reserved</div>
+                    </div>
+                </div>
+            </footer>
+        </div>
+
+        <script src="js/landing.js"></script>
+    </body>
+</html>
diff --git a/public/robots.txt b/public/robots.txt
new file mode 100644
index 00000000..21fed79c
--- /dev/null
+++ b/public/robots.txt
@@ -0,0 +1,3 @@
+# Allow crawling of all content
+User-agent: *
+Disallow:
\ No newline at end of file
diff --git a/public/sounds/joined.wav b/public/sounds/joined.wav
new file mode 100644
index 00000000..16ceb80a
Binary files /dev/null and b/public/sounds/joined.wav differ
diff --git a/public/sounds/left.wav b/public/sounds/left.wav
new file mode 100644
index 00000000..0c9cee0a
Binary files /dev/null and b/public/sounds/left.wav differ
diff --git a/public/sounds/message.wav b/public/sounds/message.wav
new file mode 100644
index 00000000..445f9270
Binary files /dev/null and b/public/sounds/message.wav differ
diff --git a/public/sounds/open.wav b/public/sounds/open.wav
new file mode 100644
index 00000000..e20340e0
Binary files /dev/null and b/public/sounds/open.wav differ
diff --git a/public/sounds/recStart.wav b/public/sounds/recStart.wav
new file mode 100644
index 00000000..166d3b8f
Binary files /dev/null and b/public/sounds/recStart.wav differ
diff --git a/public/sounds/recStop.wav b/public/sounds/recStop.wav
new file mode 100644
index 00000000..3d97f5d9
Binary files /dev/null and b/public/sounds/recStop.wav differ
diff --git a/src/Logger.js b/src/Logger.js
new file mode 100644
index 00000000..0f5cf8e9
--- /dev/null
+++ b/src/Logger.js
@@ -0,0 +1,25 @@
+'use strict';
+
+module.exports = class Logger {
+    constructor(appName, debugOn = true) {
+        if (appName) this.appName = appName;
+        else this.appName = 'mirotalk';
+        this.debugOn = debugOn;
+    }
+
+    debug(msg, op = '') {
+        if (this.debugOn === false) return;
+        let dataTime = new Date().toISOString().replace(/T/, ' ').replace(/Z/, '');
+        console.log('[' + dataTime + '] [' + this.appName + '] ' + msg, op);
+    }
+
+    warn(msg, op = '') {
+        let dataTime = new Date().toISOString().replace(/T/, ' ').replace(/Z/, '');
+        console.warn('[' + dataTime + '] [' + this.appName + '] ' + msg, op);
+    }
+
+    error(msg, op = '') {
+        let dataTime = new Date().toISOString().replace(/T/, ' ').replace(/Z/, '');
+        console.error('[' + dataTime + '] [' + this.appName + '] ' + msg, op);
+    }
+};
diff --git a/src/Peer.js b/src/Peer.js
new file mode 100644
index 00000000..40cdf1e3
--- /dev/null
+++ b/src/Peer.js
@@ -0,0 +1,133 @@
+'use strict';
+
+const Logger = require('./Logger');
+const log = new Logger('Peer');
+
+module.exports = class Peer {
+    constructor(socket_id, data) {
+        this.id = socket_id;
+        this.peer_name = data.peer_name;
+        this.peer_audio = data.peer_audio;
+        this.peer_video = data.peer_video;
+        this.peer_info = data.peer_info;
+        this.transports = new Map();
+        this.consumers = new Map();
+        this.producers = new Map();
+    }
+
+    // ####################################################
+    // TRANSPORT
+    // ####################################################
+
+    addTransport(transport) {
+        this.transports.set(transport.id, transport);
+    }
+
+    async connectTransport(transport_id, dtlsParameters) {
+        if (!this.transports.has(transport_id)) return;
+
+        await this.transports.get(transport_id).connect({
+            dtlsParameters: dtlsParameters,
+        });
+    }
+
+    close() {
+        this.transports.forEach((transport) => transport.close());
+    }
+
+    // ####################################################
+    // PRODUCER
+    // ####################################################
+
+    getProducer(producer_id) {
+        return this.producers.get(producer_id);
+    }
+
+    async createProducer(producerTransportId, rtpParameters, kind) {
+        let producer = await this.transports.get(producerTransportId).produce({
+            kind,
+            rtpParameters,
+        });
+
+        this.producers.set(producer.id, producer);
+
+        producer.on(
+            'transportclose',
+            function () {
+                log.debug('Producer transport close', {
+                    peer_name: this.peer_name,
+                    consumer_id: producer.id,
+                });
+                producer.close();
+                this.producers.delete(producer.id);
+            }.bind(this),
+        );
+
+        return producer;
+    }
+
+    closeProducer(producer_id) {
+        try {
+            this.producers.get(producer_id).close();
+        } catch (ex) {
+            log.warn('Close Producer', ex);
+        }
+        this.producers.delete(producer_id);
+    }
+
+    // ####################################################
+    // CONSUMER
+    // ####################################################
+
+    async createConsumer(consumer_transport_id, producer_id, rtpCapabilities) {
+        let consumerTransport = this.transports.get(consumer_transport_id);
+        let consumer = null;
+
+        try {
+            consumer = await consumerTransport.consume({
+                producerId: producer_id,
+                rtpCapabilities,
+                paused: false,
+            });
+        } catch (error) {
+            console.error('Consume failed', error);
+            return;
+        }
+
+        if (consumer.type === 'simulcast') {
+            await consumer.setPreferredLayers({
+                spatialLayer: 2,
+                temporalLayer: 2,
+            });
+        }
+
+        this.consumers.set(consumer.id, consumer);
+
+        consumer.on(
+            'transportclose',
+            function () {
+                log.debug('Consumer transport close', {
+                    peer_name: this.peer_name,
+                    consumer_id: consumer.id,
+                });
+                this.consumers.delete(consumer.id);
+            }.bind(this),
+        );
+
+        return {
+            consumer,
+            params: {
+                producerId: producer_id,
+                id: consumer.id,
+                kind: consumer.kind,
+                rtpParameters: consumer.rtpParameters,
+                type: consumer.type,
+                producerPaused: consumer.producerPaused,
+            },
+        };
+    }
+
+    removeConsumer(consumer_id) {
+        this.consumers.delete(consumer_id);
+    }
+};
diff --git a/src/Room.js b/src/Room.js
new file mode 100644
index 00000000..52fd3f07
--- /dev/null
+++ b/src/Room.js
@@ -0,0 +1,203 @@
+'use strict';
+
+const config = require('./config');
+const Logger = require('./Logger');
+const log = new Logger('Room');
+
+module.exports = class Room {
+    constructor(room_id, worker, io) {
+        this.id = room_id;
+        this.worker = worker;
+        this.router = null;
+        this.io = io;
+        this.peers = new Map();
+        this.createTheRouter();
+    }
+
+    // ####################################################
+    // ROUTER
+    // ####################################################
+
+    createTheRouter() {
+        const mediaCodecs = config.mediasoup.router.mediaCodecs;
+        this.worker
+            .createRouter({
+                mediaCodecs,
+            })
+            .then(
+                function (router) {
+                    this.router = router;
+                }.bind(this),
+            );
+    }
+
+    getRtpCapabilities() {
+        return this.router.rtpCapabilities;
+    }
+
+    // ####################################################
+    // PEERS
+    // ####################################################
+
+    addPeer(peer) {
+        this.peers.set(peer.id, peer);
+    }
+
+    getPeers() {
+        return this.peers;
+    }
+
+    toJson() {
+        return {
+            id: this.id,
+            peers: JSON.stringify([...this.peers]),
+        };
+    }
+
+    getProducerListForPeer() {
+        let producerList = [];
+        this.peers.forEach((peer) => {
+            peer.producers.forEach((producer) => {
+                producerList.push({
+                    producer_id: producer.id,
+                    peer_name: peer.peer_name,
+                    peer_info: peer.peer_info,
+                });
+            });
+        });
+        return producerList;
+    }
+
+    async connectPeerTransport(socket_id, transport_id, dtlsParameters) {
+        if (!this.peers.has(socket_id)) return;
+        await this.peers.get(socket_id).connectTransport(transport_id, dtlsParameters);
+    }
+
+    async removePeer(socket_id) {
+        this.peers.get(socket_id).close();
+        this.peers.delete(socket_id);
+    }
+
+    // ####################################################
+    // WEBRTC TRANSPORT
+    // ####################################################
+
+    async createWebRtcTransport(socket_id) {
+        const { maxIncomingBitrate, initialAvailableOutgoingBitrate } = config.mediasoup.webRtcTransport;
+
+        const transport = await this.router.createWebRtcTransport({
+            listenIps: config.mediasoup.webRtcTransport.listenIps,
+            enableUdp: true,
+            enableTcp: true,
+            preferUdp: true,
+            initialAvailableOutgoingBitrate,
+        });
+
+        if (maxIncomingBitrate) {
+            try {
+                await transport.setMaxIncomingBitrate(maxIncomingBitrate);
+            } catch (error) {}
+        }
+
+        transport.on(
+            'dtlsstatechange',
+            function (dtlsState) {
+                if (dtlsState === 'closed') {
+                    log.debug('Transport close', { peer_name: this.peers.get(socket_id).peer_name });
+                    transport.close();
+                }
+            }.bind(this),
+        );
+
+        transport.on('close', () => {
+            log.debug('Transport close', { peer_name: this.peers.get(socket_id).peer_name });
+        });
+
+        log.debug('Adding transport', { transportId: transport.id });
+        this.peers.get(socket_id).addTransport(transport);
+        return {
+            params: {
+                id: transport.id,
+                iceParameters: transport.iceParameters,
+                iceCandidates: transport.iceCandidates,
+                dtlsParameters: transport.dtlsParameters,
+            },
+        };
+    }
+
+    // ####################################################
+    // PRODUCE
+    // ####################################################
+
+    async produce(socket_id, producerTransportId, rtpParameters, kind) {
+        return new Promise(
+            async function (resolve, reject) {
+                let producer = await this.peers.get(socket_id).createProducer(producerTransportId, rtpParameters, kind);
+                resolve(producer.id);
+                this.broadCast(socket_id, 'newProducers', [
+                    {
+                        producer_id: producer.id,
+                        producer_socket_id: socket_id,
+                        peer_name: this.peers.get(socket_id).peer_name,
+                    },
+                ]);
+            }.bind(this),
+        );
+    }
+
+    // ####################################################
+    // CONSUME
+    // ####################################################
+
+    async consume(socket_id, consumer_transport_id, producer_id, rtpCapabilities) {
+        if (
+            !this.router.canConsume({
+                producerId: producer_id,
+                rtpCapabilities,
+            })
+        ) {
+            log.error('can not consume');
+            return;
+        }
+
+        let { consumer, params } = await this.peers
+            .get(socket_id)
+            .createConsumer(consumer_transport_id, producer_id, rtpCapabilities);
+
+        consumer.on(
+            'producerclose',
+            function () {
+                log.debug('Consumer closed due to producerclose event', {
+                    peer_name: this.peers.get(socket_id).peer_name,
+                    consumer_id: consumer.id,
+                });
+                this.peers.get(socket_id).removeConsumer(consumer.id);
+
+                // tell client consumer is dead
+                this.io.to(socket_id).emit('consumerClosed', {
+                    consumer_id: consumer.id,
+                });
+            }.bind(this),
+        );
+
+        return params;
+    }
+
+    closeProducer(socket_id, producer_id) {
+        this.peers.get(socket_id).closeProducer(producer_id);
+    }
+
+    // ####################################################
+    // SENDER
+    // ####################################################
+
+    broadCast(socket_id, peer_name, data) {
+        for (let otherID of Array.from(this.peers.keys()).filter((id) => id !== socket_id)) {
+            this.send(otherID, peer_name, data);
+        }
+    }
+
+    send(socket_id, peer_name, data) {
+        this.io.to(socket_id).emit(peer_name, data);
+    }
+};
diff --git a/src/Server.js b/src/Server.js
new file mode 100644
index 00000000..27a21be5
--- /dev/null
+++ b/src/Server.js
@@ -0,0 +1,362 @@
+'use strict';
+
+const express = require('express');
+const cors = require('cors');
+const app = express();
+const compression = require('compression');
+const https = require('httpolyglot');
+const fs = require('fs');
+const mediasoup = require('mediasoup');
+const config = require('./config');
+const path = require('path');
+const ngrok = require('ngrok');
+const Room = require('./Room');
+const Peer = require('./Peer');
+const ServerApi = require('./ServerApi');
+const Logger = require('./Logger');
+const log = new Logger('Server');
+
+const options = {
+    key: fs.readFileSync(path.join(__dirname, config.sslKey), 'utf-8'),
+    cert: fs.readFileSync(path.join(__dirname, config.sslCrt), 'utf-8'),
+};
+
+const httpsServer = https.createServer(options, app);
+const io = require('socket.io')(httpsServer);
+const localHost = 'https://' + 'localhost' + ':' + config.listenPort; // config.listenIp
+
+// all mediasoup workers
+let workers = [];
+let nextMediasoupWorkerIdx = 0;
+
+// all Room lists
+let roomList = new Map();
+
+app.use(cors());
+app.use(compression());
+app.use(express.static(path.join(__dirname, '..', 'public')));
+
+// Remove trailing slashes in url handle bad requests
+app.use((err, req, res, next) => {
+    if (err instanceof SyntaxError && err.status === 400 && 'body' in err) {
+        log.debug('Request Error', {
+            header: req.headers,
+            body: req.body,
+            error: err.message,
+        });
+        return res.status(400).send({ status: 404, message: err.message }); // Bad request
+    }
+    if (req.path.substr(-1) === '/' && req.path.length > 1) {
+        let query = req.url.slice(req.path.length);
+        res.redirect(301, req.path.slice(0, -1) + query);
+    } else {
+        next();
+    }
+});
+
+// all start from here
+app.get(['/'], (req, res) => {
+    res.sendFile(path.join(__dirname, '..', 'public/landing.html'));
+});
+
+// set new room name and join
+app.get(['/newroom'], (req, res) => {
+    res.sendFile(path.join(__dirname, '..', 'public/newroom.html'));
+});
+
+// if not allow video/audio
+app.get(['/permission'], (req, res) => {
+    res.sendFile(path.join(__dirname, '..', 'public/permission.html'));
+});
+
+// no room name specified to join
+app.get('/join/', (req, res) => {
+    res.redirect('/');
+});
+
+// join to room
+app.get('/join/*', (req, res) => {
+    if (Object.keys(req.query).length > 0) {
+        log.debug('redirect:' + req.url + ' to ' + url.parse(req.url).pathname);
+        res.redirect(url.parse(req.url).pathname);
+    } else {
+        res.sendFile(path.join(__dirname, '..', 'public/Room.html'));
+    }
+});
+
+// ####################################################
+// API
+// ####################################################
+
+// Api parse body data as json
+app.use(express.json());
+
+// request meeting room endpoint
+app.post(['/api/v1/meeting'], (req, res) => {
+    // check if user was authorized for the api call
+    let host = req.headers.host;
+    let authorization = req.headers.authorization;
+    let api = new ServerApi(host, authorization);
+    if (!api.isAuthorized()) {
+        log.debug('MiroTalk get meeting - Unauthorized', {
+            header: req.headers,
+            body: req.body,
+        });
+        return res.status(403).json({ error: 'Unauthorized!' });
+    }
+    // setup meeting URL
+    let meetingURL = api.getMeetingURL();
+    res.setHeader('Content-Type', 'application/json');
+    res.end(JSON.stringify({ meeting: meetingURL }));
+    // log.debug the output if all done
+    log.debug('MiroTalk get meeting - Authorized', {
+        header: req.headers,
+        body: req.body,
+        meeting: meetingURL,
+    });
+});
+
+// ####################################################
+// NGROK
+// ####################################################
+
+async function ngrokStart() {
+    try {
+        await ngrok.authtoken(config.ngrokAuthToken);
+        await ngrok.connect(config.listenPort);
+        let api = ngrok.getApi();
+        let data = await api.listTunnels();
+        let pu0 = data.tunnels[0].public_url;
+        let pu1 = data.tunnels[1].public_url;
+        let tunnel = pu0.startsWith('https') ? pu0 : pu1;
+        log.debug('Listening on', {
+            https: localHost,
+            ngrok: tunnel,
+        });
+    } catch (err) {
+        console.error('Ngrok Start error: ', err);
+        process.exit(1);
+    }
+}
+
+// ####################################################
+// START SERVER
+// ####################################################
+
+httpsServer.listen(config.listenPort, () => {
+    if (config.ngrokAuthToken !== '') {
+        ngrokStart();
+        return;
+    }
+    log.debug('Listening on', {
+        https: localHost,
+    });
+});
+
+// ####################################################
+// WORKERS
+// ####################################################
+
+(async () => {
+    await createWorkers();
+})();
+
+async function createWorkers() {
+    let { numWorkers } = config.mediasoup;
+
+    for (let i = 0; i < numWorkers; i++) {
+        let worker = await mediasoup.createWorker({
+            logLevel: config.mediasoup.worker.logLevel,
+            logTags: config.mediasoup.worker.logTags,
+            rtcMinPort: config.mediasoup.worker.rtcMinPort,
+            rtcMaxPort: config.mediasoup.worker.rtcMaxPort,
+        });
+        worker.on('died', () => {
+            console.error('Mediasoup worker died, exiting in 2 seconds... [pid:%d]', worker.pid);
+            setTimeout(() => process.exit(1), 2000);
+        });
+        workers.push(worker);
+    }
+}
+
+async function getMediasoupWorker() {
+    const worker = workers[nextMediasoupWorkerIdx];
+    if (++nextMediasoupWorkerIdx === workers.length) nextMediasoupWorkerIdx = 0;
+    return worker;
+}
+
+// ####################################################
+// SOCKET IO
+// ####################################################
+
+io.on('connection', (socket) => {
+    socket.on('createRoom', async ({ room_id }, callback) => {
+        socket.room_id = room_id;
+
+        if (roomList.has(socket.room_id)) {
+            callback('already exists');
+        } else {
+            log.debug('Created room', { room_id: socket.room_id });
+            let worker = await getMediasoupWorker();
+            roomList.set(socket.room_id, new Room(socket.room_id, worker, io));
+            callback(socket.room_id);
+        }
+    });
+
+    socket.on('join', (data, cb) => {
+        log.debug('User joined', data);
+
+        if (!roomList.has(socket.room_id)) {
+            return cb({
+                error: 'Room does not exist',
+            });
+        }
+
+        roomList.get(socket.room_id).addPeer(new Peer(socket.id, data));
+        cb(roomList.get(socket.room_id).toJson());
+    });
+
+    socket.on('getRouterRtpCapabilities', (_, callback) => {
+        log.debug('Get RouterRtpCapabilities', getPeerName());
+        try {
+            callback(roomList.get(socket.room_id).getRtpCapabilities());
+        } catch (err) {
+            callback({
+                error: err.message,
+            });
+        }
+    });
+
+    socket.on('getProducers', () => {
+        if (!roomList.has(socket.room_id)) return;
+
+        log.debug('Get producers', getPeerName());
+
+        // send all the current producer to newly joined member
+        let producerList = roomList.get(socket.room_id).getProducerListForPeer();
+
+        socket.emit('newProducers', producerList);
+    });
+
+    socket.on('createWebRtcTransport', async (_, callback) => {
+        log.debug('Create webrtc transport', getPeerName());
+        try {
+            const { params } = await roomList.get(socket.room_id).createWebRtcTransport(socket.id);
+            callback(params);
+        } catch (err) {
+            console.error('Create WebRtc Transport error: ', err);
+            callback({
+                error: err.message,
+            });
+        }
+    });
+
+    socket.on('connectTransport', async ({ transport_id, dtlsParameters }, callback) => {
+        log.debug('Connect transport', getPeerName());
+
+        if (!roomList.has(socket.room_id)) return;
+        await roomList.get(socket.room_id).connectPeerTransport(socket.id, transport_id, dtlsParameters);
+
+        callback('success');
+    });
+
+    socket.on('produce', async ({ kind, rtpParameters, producerTransportId }, callback) => {
+        if (!roomList.has(socket.room_id)) {
+            return callback({ error: 'Room not found' });
+        }
+
+        let producer_id = await roomList
+            .get(socket.room_id)
+            .produce(socket.id, producerTransportId, rtpParameters, kind);
+
+        log.debug('Produce', {
+            kind: kind,
+            peer_name: getPeerName(false),
+            producer_id: producer_id,
+        });
+
+        callback({
+            producer_id,
+        });
+    });
+
+    socket.on('consume', async ({ consumerTransportId, producerId, rtpCapabilities }, callback) => {
+        if (!roomList.has(socket.room_id)) {
+            return callback({ error: 'Room not found' });
+        }
+
+        let params = await roomList
+            .get(socket.room_id)
+            .consume(socket.id, consumerTransportId, producerId, rtpCapabilities);
+
+        log.debug('Consuming', {
+            peer_name: getPeerName(false),
+            producer_id: producerId,
+            consumer_id: params.id,
+        });
+
+        callback(params);
+    });
+
+    socket.on('producerClosed', ({ producer_id }) => {
+        log.debug('Producer close', getPeerName());
+
+        roomList.get(socket.room_id).closeProducer(socket.id, producer_id);
+    });
+
+    socket.on('resume', async (_, callback) => {
+        await consumer.resume();
+        callback();
+    });
+
+    socket.on('getMyRoomInfo', (_, cb) => {
+        cb(roomList.get(socket.room_id).toJson());
+    });
+
+    socket.on('message', (data) => {
+        log.debug('message', data);
+        roomList.get(socket.room_id).broadCast(socket.id, 'message', {
+            peer_name: data.peer_name,
+            peer_msg: data.peer_msg,
+        });
+    });
+
+    socket.on('disconnect', () => {
+        if (!socket.room_id) return;
+
+        log.debug('Disconnect', getPeerName());
+
+        roomList.get(socket.room_id).removePeer(socket.id);
+    });
+
+    socket.on('exitRoom', async (_, callback) => {
+        if (!roomList.has(socket.room_id)) {
+            callback({
+                error: 'Not currently in a room',
+            });
+            return;
+        }
+        log.debug('Exit room', getPeerName());
+
+        // close transports
+        await roomList.get(socket.room_id).removePeer(socket.id);
+        if (roomList.get(socket.room_id).getPeers().size === 0) {
+            roomList.delete(socket.room_id);
+        }
+
+        socket.room_id = null;
+
+        callback('Successfully exited room');
+    });
+
+    // common
+    function getPeerName(json = true) {
+        if (json) {
+            return {
+                peer_name:
+                    roomList.get(socket.room_id) && roomList.get(socket.room_id).getPeers().get(socket.id).peer_name,
+            };
+        }
+        return roomList.get(socket.room_id) && roomList.get(socket.room_id).getPeers().get(socket.id).peer_name;
+    }
+});
diff --git a/src/ServerApi.js b/src/ServerApi.js
new file mode 100644
index 00000000..ac424e37
--- /dev/null
+++ b/src/ServerApi.js
@@ -0,0 +1,21 @@
+'use strict';
+
+const config = require('./config');
+const { v4: uuidV4 } = require('uuid');
+
+module.exports = class ServerApi {
+    constructor(host, authorization) {
+        this._host = host;
+        this._authorization = authorization;
+        this._api_key_secret = config.apiKeySecret;
+    }
+
+    isAuthorized() {
+        if (this._authorization != this._api_key_secret) return false;
+        return true;
+    }
+
+    getMeetingURL() {
+        return 'https://' + this._host + '/join/' + uuidV4();
+    }
+};
diff --git a/src/config.template.js b/src/config.template.js
new file mode 100644
index 00000000..05cfa795
--- /dev/null
+++ b/src/config.template.js
@@ -0,0 +1,78 @@
+'use strict';
+
+const os = require('os');
+const ifaces = os.networkInterfaces();
+
+const getLocalIp = () => {
+    let localIp = '127.0.0.1';
+    Object.keys(ifaces).forEach((ifname) => {
+        for (const iface of ifaces[ifname]) {
+            // Ignore IPv6 and 127.0.0.1
+            if (iface.family !== 'IPv4' || iface.internal !== false) {
+                continue;
+            }
+            // Set the local ip to the first IPv4 address found and exit the loop
+            localIp = iface.address;
+            return;
+        }
+    });
+    return localIp;
+};
+
+// https://api.ipify.org
+
+module.exports = {
+    listenIp: '0.0.0.0',
+    listenPort: 3010,
+    // ssl/README.md
+    sslCrt: '../ssl/cert.pem',
+    sslKey: '../ssl/key.pem',
+    /* 
+    Ngrok
+        1. Goto https://ngrok.com
+        2. Get started for free 
+        3. Copy YourNgrokAuthToken: https://dashboard.ngrok.com/get-started/your-authtoken
+    */
+    ngrokAuthToken: '',
+    apiKeySecret: 'mirotalksfu_default_secret',
+    mediasoup: {
+        // Worker settings
+        numWorkers: Object.keys(os.cpus()).length,
+        worker: {
+            rtcMinPort: 40000,
+            rtcMaxPort: 41000,
+            logLevel: 'warn',
+            logTags: ['info', 'ice', 'dtls', 'rtp', 'srtp', 'rtcp'],
+        },
+        // Router settings
+        router: {
+            mediaCodecs: [
+                {
+                    kind: 'audio',
+                    mimeType: 'audio/opus',
+                    clockRate: 48000,
+                    channels: 2,
+                },
+                {
+                    kind: 'video',
+                    mimeType: 'video/VP8',
+                    clockRate: 90000,
+                    parameters: {
+                        'x-google-start-bitrate': 1000,
+                    },
+                },
+            ],
+        },
+        // WebRtcTransport settings
+        webRtcTransport: {
+            listenIps: [
+                {
+                    ip: '0.0.0.0',
+                    announcedIp: getLocalIp(), // replace by public static IP address https://api.ipify.org
+                },
+            ],
+            maxIncomingBitrate: 1500000,
+            initialAvailableOutgoingBitrate: 1000000,
+        },
+    },
+};
diff --git a/ssl/README.md b/ssl/README.md
new file mode 100644
index 00000000..16af4376
--- /dev/null
+++ b/ssl/README.md
@@ -0,0 +1,18 @@
+## Self-signed certificate
+
+![mirotalksfu-https](https.png)
+
+```bash
+# install openssl 4 ubuntu
+apt install openssl
+# install openssl 4 mac
+brew install openssl
+
+# self-signed certificate
+openssl genrsa -out key.pem
+openssl req -new -key key.pem -out csr.pem
+openssl x509 -req -days 9999 -in csr.pem -signkey key.pem -out cert.pem
+rm csr.pem
+
+# https://www.sslchecker.com/certdecoder
+```
diff --git a/ssl/cert.pem b/ssl/cert.pem
new file mode 100644
index 00000000..893c641f
--- /dev/null
+++ b/ssl/cert.pem
@@ -0,0 +1,22 @@
+-----BEGIN CERTIFICATE-----
+MIIDlTCCAn0CFBM91H+g2aRKsaRrCmo3NdYjwfWUMA0GCSqGSIb3DQEBCwUAMIGG
+MQswCQYDVQQGEwJJVDEOMAwGA1UECAwFSXRhbHkxETAPBgNVBAoMCE1pcm9UYWxr
+MQ8wDQYDVQQLDAZXZWJSVEMxFzAVBgNVBAMMDk1pcm9zbGF2IFBlamljMSowKAYJ
+KoZIhvcNAQkBFhttaXJvc2xhdi5wZWppYy44NUBnbWFpbC5jb20wHhcNMjEwODEx
+MTUwOTUzWhcNNDgxMjI2MTUwOTUzWjCBhjELMAkGA1UEBhMCSVQxDjAMBgNVBAgM
+BUl0YWx5MREwDwYDVQQKDAhNaXJvVGFsazEPMA0GA1UECwwGV2ViUlRDMRcwFQYD
+VQQDDA5NaXJvc2xhdiBQZWppYzEqMCgGCSqGSIb3DQEJARYbbWlyb3NsYXYucGVq
+aWMuODVAZ21haWwuY29tMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA
+rn2tC9W6wqjDI7B/4LfEnE4ILBOdwa9889QjmWUToKua7iXTpaSNP3SefKY50Q8T
+BFfkZXEGyqAESBUn2rYeHtebgLQTKHsixhSCdHqpBDOyYFeTywGiRP4gQHFKbExd
+X2AAD1ptTjHVuSlg/ojWstESBh/4TktifKzy3PKVKX6p889eDfyJtlv0PADAkon/
+rZp3hHq0FORhvQEER1sm6g58WyIfqGWjW7bb7/bkyS1baQI16fPeexfu1Rs7y4kx
+gX7+9/oA40D3rz0Wf378PTwVzbYCF+hZo/H9yJGTUAZSz84zNbSLvKBZFPfabA2A
+l92uPgNWoct06uf7ubEJhwIDAQABMA0GCSqGSIb3DQEBCwUAA4IBAQAyH68yi+mf
+2HNwEscSLN1oU9uXNC4hwHi2xoPrpxoLsbhoc/aVhgd5peOEmIlOQPQofCO/JSKt
+HqidURSt8U+WrcsXz3HTdq+m/Qw3E/BA5CDXL/LUmIh43cZzkWSawx2EocJr7g1W
+JeAtUt8xpDtuLlTMjoGGmTsKQG7ub8NcYN7EEqWa2v+2qSTqvhASMs+cf7DT2HZI
+I3q2v6l1N+DcpO8ey8dbLhbhd4d+bGjyjEcT+clDHFrKsqiYDCS99sOmedmHoyZk
++h+CzXICtqFSrAAGE/PoetQtJlojwnu9mJN/xj3i/zJTZTRh3jOGF8Hfg2bvwgdg
+vMYRLwtknqya
+-----END CERTIFICATE-----
diff --git a/ssl/https.png b/ssl/https.png
new file mode 100644
index 00000000..467dbdee
Binary files /dev/null and b/ssl/https.png differ
diff --git a/ssl/key.pem b/ssl/key.pem
new file mode 100644
index 00000000..54fb0c20
--- /dev/null
+++ b/ssl/key.pem
@@ -0,0 +1,27 @@
+-----BEGIN RSA PRIVATE KEY-----
+MIIEpAIBAAKCAQEArn2tC9W6wqjDI7B/4LfEnE4ILBOdwa9889QjmWUToKua7iXT
+paSNP3SefKY50Q8TBFfkZXEGyqAESBUn2rYeHtebgLQTKHsixhSCdHqpBDOyYFeT
+ywGiRP4gQHFKbExdX2AAD1ptTjHVuSlg/ojWstESBh/4TktifKzy3PKVKX6p889e
+DfyJtlv0PADAkon/rZp3hHq0FORhvQEER1sm6g58WyIfqGWjW7bb7/bkyS1baQI1
+6fPeexfu1Rs7y4kxgX7+9/oA40D3rz0Wf378PTwVzbYCF+hZo/H9yJGTUAZSz84z
+NbSLvKBZFPfabA2Al92uPgNWoct06uf7ubEJhwIDAQABAoIBAAhskNota2LSevlS
+IBpdROS277YRDGC5dDLhXwac1qG/Jy+wK9OnahpSKwShkdECBU0EYUZ0ent11j8U
+pmPsvu+GQT+pcfNWXotpmhK9iUNmq4nzMHNwlMD3896omYs49JkSLW6QUw6fYU4b
+LU+ck6D2bwRUrsw433xdbSw1mfXyzyCIWfPNzRmkEcUkCe1RHkGqFv8FrePhezOB
+tByAwQQLtBt7FMioTSCedOe7B+tuxwqj5Px7Vr8K3x/PKccSId6hS2ihnptYB+n7
+3eAxoa049wazsW3SXJQrTxUB1z2bh2p2lA0AedgVNme1FCq4zzA7qa2WppcV2ava
+Gu+dCgECgYEA1xjLFQmiUqCJVqA99DZNvgiPecuHSe2+2QRIk10uUQcxQAF8K9XT
+ORpO05lc0ccPZt7tIbQytsnt/NxL2mnvXQ+dzzrQCsPu/HH8fLEaJ4xBdxuIFeDU
+qCBKYlckCQkDwnNYUqCZCNfxb0Csx98RBDYlwDwZa0hFsLPbGen538cCgYEAz6wh
+iRXZVTqfhy3meWYFmHqeMb0agFugl4d0Lwl/kI/0M62Jc1u1OU+uI6u5fuevEeBB
+xYjnaDpBuCWccLw6R5luc98QIbxldbx2A07rUGo2JlQafmDX8wI1GVBXgzOw7HAK
+jHhCw+ZgtvF2c1XjaTPaunKDomPX6Pjt6R23CEECgYEArRRvPbNt4Wz6djElCSC1
+N+ftg4TJjSx4eGog+CtvvJW8BJPtVdyORZGswknSzZ6O/yj8yTUV5c3g6apegxbh
+HBIX2wupIjB9WrdiAvgDYrVSbEREIc6zb8Hj+PPDtF2Dn/FurbY6zkntJad2ILKX
+H7tubxwtHA2gvkpLULPcdDsCgYAxm3WbUHvM7ycCXIWMhEFb7hZx3TFCbiDLcZDg
+V42AU9LKsW5+/u4oVY9MeA3kcaWRSJeNfyl/7UKboWhgSaZGSjFnPmaVGHLIEA/E
+tIpjeCudNkPp4mpTYziZ5mYxMhzWLeFnMqcIMrTxnnZkEKU1ESzzkr09AkqmHSh/
+ohiBwQKBgQCvaDQS7aBS/1+iBrOyMwxARwFirReJHdgEtkBVrB+sasbj1B4Jd3zO
+gL6FzxKCKBMIF+sSAjKs0XoRG1K6OPGFg1b5naEq023gObO6aBZqSXhHCajGK790
+Xhrvj6BojWkJUnc8T0cocrwhMJrTFC0u00KgAnRNyNYw1vccd5q2uQ==
+-----END RSA PRIVATE KEY-----